Migrate spelling-0.0.21 changes from main

There is no guarantee that the HWND's backing color matches our expected
backing color.

This repairs the gutter in the WPF terminal.

(cherry picked from commit 177fd74584)

.github/actions/spell-check/dictionary/math.txt

@@ -1,3 +0,0 @@
-powf
-sqrtf
-isnan

.github/actions/spell-check/dictionary/microsoft.txt

@@ -1,7 +0,0 @@
-mfcribbon
-microsoft
-microsoftonline
-osgvsowi
-powershell
-tdbuildteamid
-visualstudio

.github/actions/spell-check/excludes.txt

@@ -1,61 +0,0 @@
-(?:^|/)dirs$
-(?:^|/)go\.mod$
-(?:^|/)go\.sum$
-(?:^|/)package-lock\.json$
-(?:^|/)sources(?:|\.dep)$
-SUMS$
-\.ai$
-\.bmp$
-\.cer$
-\.class$
-\.crl$
-\.crt$
-\.csr$
-\.dll$
-\.DS_Store$
-\.eot$
-\.eps$
-\.exe$
-\.gif$
-\.graffle$
-\.gz$
-\.icns$
-\.ico$
-\.jar$
-\.jpeg$
-\.jpg$
-\.key$
-\.lib$
-\.lock$
-\.map$
-\.min\..
-\.mp3$
-\.mp4$
-\.otf$
-\.pbxproj$
-\.pdf$
-\.pem$
-\.png$
-\.psd$
-\.runsettings$
-\.sig$
-\.so$
-\.svg$
-\.svgz$
-\.tar$
-\.tgz$
-\.ttf$
-\.woff
-\.xcf$
-\.xls
-\.xpm$
-\.yml$
-\.zip$
-^dep/
-^doc/reference/UTF8-torture-test\.txt$
-^src/interactivity/onecore/BgfxEngine\.
-^src/renderer/wddmcon/WddmConRenderer\.
-^src/terminal/parser/ft_fuzzer/VTCommandFuzzer\.cpp$
-^src/tools/U8U16Test/(?:fr|ru|zh)\.txt$
-^\.github/actions/spell-check/
-^\.gitignore$

.github/actions/spell-check/patterns/patterns.txt

@@ -1,7 +0,0 @@
-https://(?:(?:www\.|)youtube\.com|youtu.be)/[-a-zA-Z0-9?&=]*
-(?:0[Xx]|U\+|#)[a-f0-9A-FGgRr]{2,}[Uu]?[Ll]?\b
-\{[0-9A-FA-F]{8}-(?:[0-9A-FA-F]{4}-){3}[0-9A-FA-F]{12}\}
-\d+x\d+Logo
-Scro\&ll
-# selectionInput.cpp
- :\\windows\\syste\b

.github/actions/spell-check/whitelist/README.md

@@ -1,7 +0,0 @@
-The contents of each `.txt` file in this directory are merged together.
-
-* [alphabet](alphabet.txt) is a sample for alphabet related items
-* [web](web.txt) is a sample for web/html related items
-* [whitelist](whitelist.txt) is the main whitelist -- there is nothing
-particularly special about the file name (beyond the extension which is
-important).

.github/actions/spell-check/whitelist/web.txt

@@ -1,3 +0,0 @@
-http
-td
-www

.github/actions/spelling/README.md

@@ -0,0 +1,15 @@
+# check-spelling/check-spelling configuration
+
+File | Purpose | Format | Info
+-|-|-|-
+[allow/*.txt](allow/) | Add words to the dictionary | one word per line (only letters and `'`s allowed) | [allow](https://github.com/check-spelling/check-spelling/wiki/Configuration#allow)
+[reject.txt](reject.txt) | Remove words from the dictionary (after allow) | grep pattern matching whole dictionary words | [reject](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-reject)
+[excludes.txt](excludes.txt) | Files to ignore entirely | perl regular expression | [excludes](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-excludes)
+[patterns/*.txt](patterns/) | Patterns to ignore from checked lines | perl regular expression (order matters, first match wins) | [patterns](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-patterns)
+[candidate.patterns](candidate.patterns) | Patterns that might be worth adding to [patterns.txt](patterns.txt) | perl regular expression with optional comment block introductions (all matches will be suggested) | [candidates](https://github.com/check-spelling/check-spelling/wiki/Feature:-Suggest-patterns)
+[line_forbidden.patterns](line_forbidden.patterns) | Patterns to flag in checked lines | perl regular expression (order matters, first match wins) | [patterns](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-patterns)
+[expect/*.txt](expect.txt) | Expected words that aren't in the dictionary | one word per line (sorted, alphabetically) | [expect](https://github.com/check-spelling/check-spelling/wiki/Configuration#expect)
+[advice.md](advice.md) | Supplement for GitHub comment when unrecognized words are found | GitHub Markdown | [advice](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-advice)
+
+Note: you can replace any of these files with a directory by the same name (minus the suffix)
+and then include multiple files inside that directory (with that suffix) to merge multiple files together.

.github/actions/spelling/advice.md

@@ -0,0 +1,48 @@
+<!-- See https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-advice --> <!-- markdownlint-disable MD033 MD041 -->
+<details>
+<summary>
+:pencil2: Contributor please read this
+</summary>
+
+By default the command suggestion will generate a file named based on your commit. That's generally ok as long as you add the file to your commit. Someone can reorganize it later.
+
+:warning: The command is written for posix shells. If it doesn't work for you, you can manually _add_ (one word per line) / _remove_ items to `expect.txt` and the `excludes.txt` files.
+
+If the listed items are:
+
+* ... **misspelled**, then please *correct* them instead of using the command.
+* ... *names*, please add them to `.github/actions/spelling/allow/names.txt`.
+* ... APIs, you can add them to a file in `.github/actions/spelling/allow/`.
+* ... just things you're using, please add them to an appropriate file in `.github/actions/spelling/expect/`.
+* ... tokens you only need in one place and shouldn't *generally be used*, you can add an item in an appropriate file in `.github/actions/spelling/patterns/`.
+
+See the `README.md` in each directory for more information.
+
+:microscope: You can test your commits **without** *appending* to a PR by creating a new branch with that extra change and pushing it to your fork. The [check-spelling](https://github.com/marketplace/actions/check-spelling) action will run in response to your **push** -- it doesn't require an open pull request. By using such a branch, you can limit the number of typos your peers see you make. :wink:
+
+
+<details><summary>If the flagged items are :exploding_head: false positives</summary>
+
+If items relate to a ...
+* binary file (or some other file you wouldn't want to check at all).
+
+  Please add a file path to the `excludes.txt` file matching the containing file.
+
+  File paths are Perl 5 Regular Expressions - you can [test](
+https://www.regexplanet.com/advanced/perl/) yours before committing to verify it will match your files.
+
+  `^` refers to the file's path from the root of the repository, so `^README\.md$` would exclude [README.md](
+../tree/HEAD/README.md) (on whichever branch you're using).
+
+* well-formed pattern.
+
+  If you can write a [pattern](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples:-patterns) that would match it,
+  try adding it to the `patterns.txt` file.
+
+  Patterns are Perl 5 Regular Expressions - you can [test](
+https://www.regexplanet.com/advanced/perl/) yours before committing to verify it will match your lines.
+
+  Note that patterns can't match multiline strings.
+</details>
+
+</details>

.github/actions/spelling/allow/README.md

@@ -1,6 +1,6 @@
-# Dictionaries are lists of words to accept unconditionally
+# Allow files are lists of words to accept unconditionally
 
-While check spelling will complain about a whitelisted word
+While check spelling will complain about an expected word
 which is no longer present, you can include things here even if
 they are not otherwise present in the repository.
 
@@ -8,13 +8,14 @@ E.g., you could include a list of system APIs here, or potential
 contributors (so that if a future commit includes their name,
 it'll be accepted).
 
-### Files
+## Files
 
 | File | Description |
 | ---- | ----------- |
-| [Dictionary](dictionary.txt) | Primary US English dictionary |
+| [Allow](allow.txt) | Supplements to the dictionary |
 | [Chinese](chinese.txt) | Chinese words |
 | [Japanese](japanese.txt) | Japanese words |
 | [Microsoft](microsoft.txt) | Microsoft brand items |
 | [Fonts](fonts.txt) | Font names |
 | [Names](names.txt) | Names of people |
+| [Colors](colors.txt) | Names of color |

.github/actions/spelling/allow/allow.txt

@@ -0,0 +1,108 @@
+admins
+allcolors
+Apc
+apc
+breadcrumb
+breadcrumbs
+bsd
+calt
+ccmp
+changelog
+clickable
+clig
+CMMI
+copyable
+cybersecurity
+dalet
+Dcs
+dcs
+dialytika
+dje
+downside
+downsides
+dze
+dzhe
+EDDB
+EDDC
+Enum'd
+Fitt
+formattings
+FTCS
+ftp
+fvar
+gantt
+gcc
+geeksforgeeks
+ghe
+github
+gje
+godbolt
+hostname
+hostnames
+https
+hyperlink
+hyperlinking
+hyperlinks
+iconify
+img
+inlined
+It'd
+kje
+libfuzzer
+libuv
+liga
+lje
+Llast
+llvm
+Lmid
+locl
+lol
+lorem
+Lorigin
+maxed
+minimalistic
+mkmk
+mnt
+mru
+nje
+noreply
+ogonek
+ok'd
+overlined
+pipeline
+postmodern
+ptys
+qof
+qps
+rclt
+reimplementation
+reserialization
+reserialize
+reserializes
+rlig
+runtimes
+shcha
+slnt
+Sos
+ssh
+timeline
+timelines
+timestamped
+TLDR
+tokenizes
+tonos
+toolset
+tshe
+ubuntu
+uiatextrange
+UIs
+und
+unregister
+versioned
+vsdevcmd
+We'd
+wildcards
+XBox
+YBox
+yeru
+zhe

.github/actions/spelling/allow/apis.txt

@@ -0,0 +1,248 @@
+ACCEPTFILES
+ACCESSDENIED
+acl
+aclapi
+alignas
+alignof
+APPLYTOSUBMENUS
+appxrecipe
+bitfield
+bitfields
+BUILDBRANCH
+BUILDMSG
+BUILDNUMBER
+BYCOMMAND
+BYPOSITION
+charconv
+CLASSNOTAVAILABLE
+CLOSEAPP
+cmdletbinding
+COLORPROPERTY
+colspan
+COMDLG
+commandlinetoargv
+comparand
+cstdint
+CXICON
+CYICON
+Dacl
+dataobject
+dcomp
+DERR
+dlldata
+DNE
+DONTADDTORECENT
+DWMSBT
+DWMWA
+DWMWA
+DWORDLONG
+endfor
+ENDSESSION
+enumset
+environstrings
+EXPCMDFLAGS
+EXPCMDSTATE
+filetime
+FILTERSPEC
+FORCEFILESYSTEM
+FORCEMINIMIZE
+frac
+fullkbd
+futex
+GETDESKWALLPAPER
+GETHIGHCONTRAST
+GETMOUSEHOVERTIME
+Hashtable
+HIGHCONTRASTON
+HIGHCONTRASTW
+hotkeys
+href
+hrgn
+HTCLOSE
+hwinsta
+HWINSTA
+IActivation
+IApp
+IAppearance
+IAsync
+IBind
+IBox
+IClass
+IComparable
+IComparer
+IConnection
+ICustom
+IDialog
+IDirect
+IExplorer
+IFACEMETHOD
+IFile
+IGraphics
+IInheritable
+IMap
+IMonarch
+IObject
+iosfwd
+IPackage
+IPeasant
+ISetup
+isspace
+IStorage
+istream
+IStringable
+ITab
+ITaskbar
+itow
+IUri
+IVirtual
+KEYSELECT
+LCID
+llabs
+llu
+localtime
+lround
+Lsa
+lsass
+LSHIFT
+LTGRAY
+MAINWINDOW
+memchr
+memicmp
+MENUCOMMAND
+MENUDATA
+MENUINFO
+MENUITEMINFOW
+mmeapi
+MOUSELEAVE
+mov
+mptt
+msappx
+MULTIPLEUSE
+NCHITTEST
+NCLBUTTONDBLCLK
+NCMOUSELEAVE
+NCMOUSEMOVE
+NCRBUTTONDBLCLK
+NIF
+NIN
+NOAGGREGATION
+NOASYNC
+NOCHANGEDIR
+NOPROGRESS
+NOREDIRECTIONBITMAP
+NOREPEAT
+NOTIFYBYPOS
+NOTIFYICON
+NOTIFYICONDATA
+ntprivapi
+oaidl
+ocidl
+ODR
+offsetof
+ofstream
+onefuzz
+osver
+OSVERSIONINFOEXW
+otms
+OUTLINETEXTMETRICW
+overridable
+PACL
+PAGESCROLL
+PATINVERT
+PEXPLICIT
+PICKFOLDERS
+pmr
+ptstr
+QUERYENDSESSION
+rcx
+REGCLS
+RETURNCMD
+rfind
+ROOTOWNER
+roundf
+RSHIFT
+SACL
+schandle
+semver
+serializer
+SETVERSION
+SHELLEXECUTEINFOW
+shobjidl
+SHOWHIDE
+SHOWMINIMIZED
+SHOWTIP
+SINGLEUSE
+SIZENS
+smoothstep
+snprintf
+spsc
+sregex
+SRWLOC
+SRWLOCK
+STDCPP
+STDMETHOD
+strchr
+strcpy
+streambuf
+strtoul
+Stubless
+Subheader
+Subpage
+syscall
+SYSTEMBACKDROP
+TABROW
+TASKBARCREATED
+TBPF
+THEMECHANGED
+tlg
+TME
+tmp
+tmpdir
+tolower
+toupper
+TRACKMOUSEEVENT
+TTask
+TVal
+UChar
+UFIELD
+ULARGE
+UOI
+UPDATEINIFILE
+userenv
+USEROBJECTFLAGS
+Viewbox
+virtualalloc
+wcsstr
+wcstoui
+winmain
+winsta
+winstamin
+wmemcmp
+wpc
+WSF
+wsregex
+wwinmain
+xchg
+XDocument
+XElement
+xfacet
+xhash
+XIcon
+xiosbase
+xlocale
+xlocbuf
+xlocinfo
+xlocmes
+xlocmon
+xlocnum
+xloctime
+XMax
+xmemory
+XParse
+xpath
+xstddef
+xstring
+xtree
+xutility
+YIcon
+YMax

.github/actions/spelling/allow/colors.txt

@@ -0,0 +1,117 @@
+alice
+aliceblue
+antiquewhite
+blanchedalmond
+blueviolet
+burlywood
+cadetblue
+cornflowerblue
+cornsilk
+cyan
+darkblue
+darkcyan
+darkgoldenrod
+darkgray
+darkgreen
+darkgrey
+darkkhaki
+darkmagenta
+darkolivegreen
+darkorange
+darkorchid
+darkred
+darksalmon
+darkseagreen
+darkslateblue
+darkslategray
+darkslategrey
+darkturquoise
+darkviolet
+deeppink
+deepskyblue
+dimgray
+dimgrey
+dodgerblue
+firebrick
+floralwhite
+forestgreen
+gainsboro
+ghostwhite
+greenyellow
+hotpink
+indian
+indianred
+lavenderblush
+lawngreen
+lemonchiffon
+lightblue
+lightcoral
+lightcyan
+lightgoldenrod
+lightgoldenrodyellow
+lightgray
+lightgreen
+lightgrey
+lightpink
+lightsalmon
+lightseagreen
+lightskyblue
+lightslateblue
+lightslategray
+lightslategrey
+lightsteelblue
+lightyellow
+limegreen
+mediumaquamarine
+mediumblue
+mediumorchid
+mediumpurple
+mediumseagreen
+mediumslateblue
+mediumspringgreen
+mediumturquoise
+mediumvioletred
+midnightblue
+mintcream
+mistyrose
+navajo
+navajowhite
+navyblue
+oldlace
+olivedrab
+orangered
+palegoldenrod
+palegreen
+paleturquoise
+palevioletred
+papayawhip
+peachpuff
+peru
+powderblue
+rebecca
+rebeccapurple
+rosybrown
+royalblue
+saddlebrown
+sandybrown
+seagreen
+sienna
+skyblue
+slateblue
+slategray
+slategrey
+springgreen
+steelblue
+violetred
+webgray
+webgreen
+webgrey
+webmaroon
+webpurple
+whitesmoke
+xaroon
+xray
+xreen
+xrey
+xurple
+yellowgreen

.github/actions/spelling/allow/fonts.txt

@@ -1,8 +1,10 @@
 Consolas
 emoji
+emojis
 Extralight
 Gabriola
 Iosevka
 MDL
 Monofur
 Segoe
+wght

.github/actions/spelling/allow/math.txt

@@ -0,0 +1,11 @@
+atan
+CPrime
+HBar
+HPrime
+isnan
+LPrime
+LStep
+powf
+RSub
+sqrtf
+ULP

.github/actions/spelling/allow/microsoft.txt

@@ -0,0 +1,85 @@
+ACLs
+ADMINS
+advapi
+altform
+altforms
+appendwttlogging
+appx
+appxbundle
+appxerror
+appxmanifest
+ATL
+backplating
+bitmaps
+BOMs
+CPLs
+cpptools
+cppvsdbg
+CPRs
+cryptbase
+DACL
+DACLs
+defaultlib
+diffs
+disposables
+dotnetfeed
+DTDs
+DWINRT
+enablewttlogging
+Intelli
+IVisual
+libucrt
+libucrtd
+LKG
+LOCKFILE
+Lxss
+mfcribbon
+microsoft
+microsoftonline
+MSAA
+msixbundle
+MSVC
+MSVCP
+muxc
+netcore
+Onefuzz
+osgvsowi
+PFILETIME
+pgc
+pgo
+pgosweep
+powerrename
+powershell
+propkey
+pscustomobject
+QWORD
+regedit
+robocopy
+SACLs
+sdkddkver
+Shobjidl
+Skype
+SRW
+sxs
+Sysinternals
+sysnative
+systemroot
+taskkill
+tasklist
+tdbuildteamid
+ucrt
+ucrtd
+unvirtualized
+VCRT
+vcruntime
+Virtualization
+visualstudio
+vscode
+VSTHRD
+winsdkver
+wlk
+wslpath
+wtl
+wtt
+wttlog
+Xamarin

.github/actions/spelling/allow/names.txt

@@ -1,55 +1,91 @@
 Anup
 austdi
+arkthur
 Ballmer
 bhoj
 Bhojwani
+Bluloco
+carlos
 dhowett
 Diviness
+dsafa
 duhowett
+DXP
+ekg
+eryksun
 ethanschoonover
 Firefox
 Gatta
+glsl
+Gravell
 Grie
 Griese
 Hernan
 Howett
 Illhardt
+iquilezles
+italo
 jantari
 jerrysh
 Kaiyu
 kimwalisch
 KMehrain
+KODELIFE
+Kodelife
 Kourosh
 kowalczyk
 leonmsft
 Lepilleur
+lhecker
+lukesampson
+Macbook
 Manandhar
+masserano
 mbadolato
 Mehrain
+menger
 mgravell
 michaelniksa
+michkap
 migrie
 mikegr
 mikemaccana
+miloush
 miniksa
 niksa
+nvaccess
+nvda
 oising
 oldnewthing
+opengl
 osgwiki
+pabhojwa
+panos
 paulcam
 pauldotknopf
+PGP
 Pham
 Rincewind
 rprichard
 Schoonover
+shadertoy
+Shomnipotence
+simioni
 Somuah
 sonph
 sonpham
 stakx
+talo
+thereses
 Walisch
+WDX
+Wellons
 Wirt
 Wojciech
 zadjii
 Zamor
+Zamora
+zamora
 Zoey
 zorio
+Zverovich

.github/actions/spelling/candidate.patterns

@@ -0,0 +1,523 @@
+# marker to ignore all code on line
+^.*/\* #no-spell-check-line \*/.*$
+# marker for ignoring a comment to the end of the line
+// #no-spell-check.*$
+
+# patch hunk comments
+^\@\@ -\d+(?:,\d+|) \+\d+(?:,\d+|) \@\@ .*
+# git index header
+index [0-9a-z]{7,40}\.\.[0-9a-z]{7,40}
+
+# cid urls
+(['"])cid:.*?\g{-1}
+
+# data url in parens
+\(data:[^)]*?(?:[A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,})[^)]*\)
+# data url in quotes
+([`'"])data:.*?(?:[A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,}).*\g{-1}
+# data url
+data:[-a-zA-Z=;:/0-9+]*,\S*
+
+# mailto urls
+mailto:[-a-zA-Z=;:/?%&0-9+@.]{3,}
+
+# magnet urls
+magnet:[?=:\w]+
+
+# magnet urls
+"magnet:[^"]+"
+
+# obs:
+"obs:[^"]*"
+
+# The `\b` here means a break, it's the fancy way to handle urls, but it makes things harder to read
+# In this examples content, I'm using a number of different ways to match things to show various approaches
+# asciinema
+\basciinema\.org/a/[0-9a-zA-Z]+
+
+# apple
+\bdeveloper\.apple\.com/[-\w?=/]+
+# Apple music
+\bembed\.music\.apple\.com/fr/playlist/usr-share/[-\w.]+
+
+# appveyor api
+\bci\.appveyor\.com/api/projects/status/[0-9a-z]+
+# appveyor project
+\bci\.appveyor\.com/project/(?:[^/\s"]*/){2}builds?/\d+/job/[0-9a-z]+
+
+# Amazon
+
+# Amazon
+\bamazon\.com/[-\w]+/(?:dp/[0-9A-Z]+|)
+# AWS S3
+\b\w*\.s3[^.]*\.amazonaws\.com/[-\w/&#%_?:=]*
+# AWS execute-api
+\b[0-9a-z]{10}\.execute-api\.[-0-9a-z]+\.amazonaws\.com\b
+# AWS ELB
+\b\w+\.[-0-9a-z]+\.elb\.amazonaws\.com\b
+# AWS SNS
+\bsns\.[-0-9a-z]+.amazonaws\.com/[-\w/&#%_?:=]*
+# AWS VPC
+vpc-\w+
+
+# While you could try to match `http://` and `https://` by using `s?` in `https?://`, sometimes there
+# YouTube url
+\b(?:(?:www\.|)youtube\.com|youtu.be)/(?:channel/|embed/|user/|playlist\?list=|watch\?v=|v/|)[-a-zA-Z0-9?&=_%]*
+# YouTube music
+\bmusic\.youtube\.com/youtubei/v1/browse(?:[?&]\w+=[-a-zA-Z0-9?&=_]*)
+# YouTube tag
+<\s*youtube\s+id=['"][-a-zA-Z0-9?_]*['"]
+# YouTube image
+\bimg\.youtube\.com/vi/[-a-zA-Z0-9?&=_]*
+# Google Accounts
+\baccounts.google.com/[-_/?=.:;+%&0-9a-zA-Z]*
+# Google Analytics
+\bgoogle-analytics\.com/collect.[-0-9a-zA-Z?%=&_.~]*
+# Google APIs
+\bgoogleapis\.(?:com|dev)/[a-z]+/(?:v\d+/|)[a-z]+/[-@:./?=\w+|&]+
+# Google Storage
+\b[-a-zA-Z0-9.]*\bstorage\d*\.googleapis\.com(?:/\S*|)
+# Google Calendar
+\bcalendar\.google\.com/calendar(?:/u/\d+|)/embed\?src=[@./?=\w&%]+
+\w+\@group\.calendar\.google\.com\b
+# Google DataStudio
+\bdatastudio\.google\.com/(?:(?:c/|)u/\d+/|)(?:embed/|)(?:open|reporting|datasources|s)/[-0-9a-zA-Z]+(?:/page/[-0-9a-zA-Z]+|)
+# The leading `/` here is as opposed to the `\b` above
+# ... a short way to match `https://` or `http://` since most urls have one of those prefixes
+# Google Docs
+/docs\.google\.com/[a-z]+/(?:ccc\?key=\w+|(?:u/\d+|d/(?:e/|)[0-9a-zA-Z_-]+/)?(?:edit\?[-\w=#.]*|/\?[\w=&]*|))
+# Google Drive
+\bdrive\.google\.com/(?:file/d/|open)[-0-9a-zA-Z_?=]*
+# Google Groups
+\bgroups\.google\.com/(?:(?:forum/#!|d/)(?:msg|topics?|searchin)|a)/[^/\s"]+/[-a-zA-Z0-9$]+(?:/[-a-zA-Z0-9]+)*
+# Google Maps
+\bmaps\.google\.com/maps\?[\w&;=]*
+# Google themes
+themes\.googleusercontent\.com/static/fonts/[^/\s"]+/v\d+/[^.]+.
+# Google CDN
+\bclients2\.google(?:usercontent|)\.com[-0-9a-zA-Z/.]*
+# Goo.gl
+/goo\.gl/[a-zA-Z0-9]+
+# Google Chrome Store
+\bchrome\.google\.com/webstore/detail/[-\w]*(?:/\w*|)
+# Google Books
+\bgoogle\.(?:\w{2,4})/books(?:/\w+)*\?[-\w\d=&#.]*
+# Google Fonts
+\bfonts\.(?:googleapis|gstatic)\.com/[-/?=:;+&0-9a-zA-Z]*
+# Google Forms
+\bforms\.gle/\w+
+# Google Scholar
+\bscholar\.google\.com/citations\?user=[A-Za-z0-9_]+
+# Google Colab Research Drive
+\bcolab\.research\.google\.com/drive/[-0-9a-zA-Z_?=]*
+
+# GitHub SHAs (api)
+\bapi.github\.com/repos(?:/[^/\s"]+){3}/[0-9a-f]+\b
+# GitHub SHAs (markdown)
+(?:\[`?[0-9a-f]+`?\]\(https:/|)/(?:www\.|)github\.com(?:/[^/\s"]+){2,}(?:/[^/\s")]+)(?:[0-9a-f]+(?:[-0-9a-zA-Z/#.]*|)\b|)
+# GitHub SHAs
+\bgithub\.com(?:/[^/\s"]+){2}[@#][0-9a-f]+\b
+# GitHub wiki
+\bgithub\.com/(?:[^/]+/){2}wiki/(?:(?:[^/]+/|)_history|[^/]+(?:/_compare|)/[0-9a-f.]{40,})\b
+# githubusercontent
+/[-a-z0-9]+\.githubusercontent\.com/[-a-zA-Z0-9?&=_\/.]*
+# githubassets
+\bgithubassets.com/[0-9a-f]+(?:[-/\w.]+)
+# gist github
+\bgist\.github\.com/[^/\s"]+/[0-9a-f]+
+# git.io
+\bgit\.io/[0-9a-zA-Z]+
+# GitHub JSON
+"node_id": "[-a-zA-Z=;:/0-9+]*"
+# Contributor
+\[[^\]]+\]\(https://github\.com/[^/\s"]+\)
+# GHSA
+GHSA(?:-[0-9a-z]{4}){3}
+
+# GitLab commit
+\bgitlab\.[^/\s"]*/\S+/\S+/commit/[0-9a-f]{7,16}#[0-9a-f]{40}\b
+# GitLab merge requests
+\bgitlab\.[^/\s"]*/\S+/\S+/-/merge_requests/\d+/diffs#[0-9a-f]{40}\b
+# GitLab uploads
+\bgitlab\.[^/\s"]*/uploads/[-a-zA-Z=;:/0-9+]*
+# GitLab commits
+\bgitlab\.[^/\s"]*/(?:[^/\s"]+/){2}commits?/[0-9a-f]+\b
+
+# binanace
+accounts.binance.com/[a-z/]*oauth/authorize\?[-0-9a-zA-Z&%]*
+
+# bitbucket diff
+\bapi\.bitbucket\.org/\d+\.\d+/repositories/(?:[^/\s"]+/){2}diff(?:stat|)(?:/[^/\s"]+){2}:[0-9a-f]+
+# bitbucket repositories commits
+\bapi\.bitbucket\.org/\d+\.\d+/repositories/(?:[^/\s"]+/){2}commits?/[0-9a-f]+
+# bitbucket commits
+\bbitbucket\.org/(?:[^/\s"]+/){2}commits?/[0-9a-f]+
+
+# bit.ly
+\bbit\.ly/\w+
+
+# bitrise
+\bapp\.bitrise\.io/app/[0-9a-f]*/[\w.?=&]*
+
+# bootstrapcdn.com
+\bbootstrapcdn\.com/[-./\w]+
+
+# cdn.cloudflare.com
+\bcdnjs\.cloudflare\.com/[./\w]+
+
+# circleci
+\bcircleci\.com/gh(?:/[^/\s"]+){1,5}.[a-z]+\?[-0-9a-zA-Z=&]+
+
+# gitter
+\bgitter\.im(?:/[^/\s"]+){2}\?at=[0-9a-f]+
+
+# gravatar
+\bgravatar\.com/avatar/[0-9a-f]+
+
+# ibm
+[a-z.]*ibm\.com/[-_#=:%!?~.\\/\d\w]*
+
+# imgur
+\bimgur\.com/[^.]+
+
+# Internet Archive
+\barchive\.org/web/\d+/(?:[-\w.?,'/\\+&%$#_:]*)
+
+# discord
+/discord(?:app\.com|\.gg)/(?:invite/)?[a-zA-Z0-9]{7,}
+
+# Disqus
+\bdisqus\.com/[-\w/%.()!?&=_]*
+
+# medium link
+\blink\.medium\.com/[a-zA-Z0-9]+
+# medium
+\bmedium\.com/\@?[^/\s"]+/[-\w]+
+
+# microsoft
+\b(?:https?://|)(?:(?:download\.visualstudio|docs|msdn2?|research)\.microsoft|blogs\.msdn)\.com/[-_a-zA-Z0-9()=./%]*
+# powerbi
+\bapp\.powerbi\.com/reportEmbed/[^"' ]*
+# vs devops
+\bvisualstudio.com(?::443|)/[-\w/?=%&.]*
+# microsoft store
+\bmicrosoft\.com/store/apps/\w+
+
+# mvnrepository.com
+\bmvnrepository\.com/[-0-9a-z./]+
+
+# now.sh
+/[0-9a-z-.]+\.now\.sh\b
+
+# oracle
+\bdocs\.oracle\.com/[-0-9a-zA-Z./_?#&=]*
+
+# chromatic.com
+/\S+.chromatic.com\S*[")]
+
+# codacy
+\bapi\.codacy\.com/project/badge/Grade/[0-9a-f]+
+
+# compai
+\bcompai\.pub/v1/png/[0-9a-f]+
+
+# mailgun api
+\.api\.mailgun\.net/v3/domains/[0-9a-z]+\.mailgun.org/messages/[0-9a-zA-Z=@]*
+# mailgun
+\b[0-9a-z]+.mailgun.org
+
+# /message-id/
+/message-id/[-\w@./%]+
+
+# Reddit
+\breddit\.com/r/[/\w_]*
+
+# requestb.in
+\brequestb\.in/[0-9a-z]+
+
+# sched
+\b[a-z0-9]+\.sched\.com\b
+
+# Slack url
+slack://[a-zA-Z0-9?&=]+
+# Slack
+\bslack\.com/[-0-9a-zA-Z/_~?&=.]*
+# Slack edge
+\bslack-edge\.com/[-a-zA-Z0-9?&=%./]+
+# Slack images
+\bslack-imgs\.com/[-a-zA-Z0-9?&=%.]+
+
+# shields.io
+\bshields\.io/[-\w/%?=&.:+;,]*
+
+# stackexchange -- https://stackexchange.com/feeds/sites
+\b(?:askubuntu|serverfault|stack(?:exchange|overflow)|superuser).com/(?:questions/\w+/[-\w]+|a/)
+
+# Sentry
+[0-9a-f]{32}\@o\d+\.ingest\.sentry\.io\b
+
+# Twitter markdown
+\[\@[^[/\]:]*?\]\(https://twitter.com/[^/\s"')]*(?:/status/\d+(?:\?[-_0-9a-zA-Z&=]*|)|)\)
+# Twitter hashtag
+\btwitter\.com/hashtag/[\w?_=&]*
+# Twitter status
+\btwitter\.com/[^/\s"')]*(?:/status/\d+(?:\?[-_0-9a-zA-Z&=]*|)|)
+# Twitter profile images
+\btwimg\.com/profile_images/[_\w./]*
+# Twitter media
+\btwimg\.com/media/[-_\w./?=]*
+# Twitter link shortened
+\bt\.co/\w+
+
+# facebook
+\bfburl\.com/[0-9a-z_]+
+# facebook CDN
+\bfbcdn\.net/[\w/.,]*
+# facebook watch
+\bfb\.watch/[0-9A-Za-z]+
+
+# dropbox
+\bdropbox\.com/sh?/[^/\s"]+/[-0-9A-Za-z_.%?=&;]+
+
+# ipfs protocol
+ipfs://[0-9a-z]*
+# ipfs url
+/ipfs/[0-9a-z]*
+
+# w3
+\bw3\.org/[-0-9a-zA-Z/#.]+
+
+# loom
+\bloom\.com/embed/[0-9a-f]+
+
+# regex101
+\bregex101\.com/r/[^/\s"]+/\d+
+
+# figma
+\bfigma\.com/file(?:/[0-9a-zA-Z]+/)+
+
+# freecodecamp.org
+\bfreecodecamp\.org/[-\w/.]+
+
+# image.tmdb.org
+\bimage\.tmdb\.org/[/\w.]+
+
+# mermaid
+\bmermaid\.ink/img/[-\w]+|\bmermaid-js\.github\.io/mermaid-live-editor/#/edit/[-\w]+
+
+# Wikipedia
+\ben\.wikipedia\.org/wiki/[-\w%.#]+
+
+# gitweb
+[^"\s]+/gitweb/\S+;h=[0-9a-f]+
+
+# HyperKitty lists
+/archives/list/[^@/]+\@[^/\s"]*/message/[^/\s"]*/
+
+# lists
+/thread\.html/[^"\s]+
+
+# list-management
+\blist-manage\.com/subscribe(?:[?&](?:u|id)=[0-9a-f]+)+
+
+# kubectl.kubernetes.io/last-applied-configuration
+"kubectl.kubernetes.io/last-applied-configuration": ".*"
+
+# pgp
+\bgnupg\.net/pks/lookup[?&=0-9a-zA-Z]*
+
+# Spotify
+\bopen\.spotify\.com/embed/playlist/\w+
+
+# Mastodon
+\bmastodon\.[-a-z.]*/(?:media/|\@)[?&=0-9a-zA-Z_]*
+
+# scastie
+\bscastie\.scala-lang\.org/[^/]+/\w+
+
+# images.unsplash.com
+\bimages\.unsplash\.com/(?:(?:flagged|reserve)/|)[-\w./%?=%&.;]+
+
+# pastebin
+\bpastebin\.com/[\w/]+
+
+# heroku
+\b\w+\.heroku\.com/source/archive/\w+
+
+# quip
+\b\w+\.quip\.com/\w+(?:(?:#|/issues/)\w+)?
+
+# badgen.net
+\bbadgen\.net/badge/[^")\]'\s]+
+
+# statuspage.io
+\w+\.statuspage\.io\b
+
+# media.giphy.com
+\bmedia\.giphy\.com/media/[^/]+/[\w.?&=]+
+
+# tinyurl
+\btinyurl\.com/\w+
+
+# getopts
+\bgetopts\s+(?:"[^"]+"|'[^']+')
+
+# ANSI color codes
+(?:\\(?:u00|x)1b|\x1b)\[\d+(?:;\d+|)m
+
+# URL escaped characters
+\%[0-9A-F][A-F]
+# IPv6
+\b(?:[0-9a-fA-F]{0,4}:){3,7}[0-9a-fA-F]{0,4}\b
+# c99 hex digits (not the full format, just one I've seen)
+0x[0-9a-fA-F](?:\.[0-9a-fA-F]*|)[pP]
+# Punycode
+\bxn--[-0-9a-z]+
+# sha
+sha\d+:[0-9]*[a-f]{3,}[0-9a-f]*
+# sha-... -- uses a fancy capture
+(['"]|&quot;)[0-9a-f]{40,}\g{-1}
+# hex runs
+\b[0-9a-fA-F]{16,}\b
+# hex in url queries
+=[0-9a-fA-F]*?(?:[A-F]{3,}|[a-f]{3,})[0-9a-fA-F]*?&
+# ssh
+(?:ssh-\S+|-nistp256) [-a-zA-Z=;:/0-9+]{12,}
+
+# PGP
+\b(?:[0-9A-F]{4} ){9}[0-9A-F]{4}\b
+# GPG keys
+\b(?:[0-9A-F]{4} ){5}(?: [0-9A-F]{4}){5}\b
+# Well known gpg keys
+.well-known/openpgpkey/[\w./]+
+
+# uuid:
+\b[0-9a-fA-F]{8}-(?:[0-9a-fA-F]{4}-){3}[0-9a-fA-F]{12}\b
+# hex digits including css/html color classes:
+(?:[\\0][xX]|\\u|[uU]\+|#x?|\%23)[0-9_a-fA-FgGrR]*?[a-fA-FgGrR]{2,}[0-9_a-fA-FgGrR]*(?:[uUlL]{0,3}|u\d+)\b
+# integrity
+integrity="sha\d+-[-a-zA-Z=;:/0-9+]{40,}"
+
+# https://www.gnu.org/software/groff/manual/groff.html
+# man troff content
+\\f[BCIPR]
+# '
+\\\(aq
+
+# .desktop mime types
+^MimeTypes?=.*$
+# .desktop localized entries
+^[A-Z][a-z]+\[[a-z]+\]=.*$
+# Localized .desktop content
+Name\[[^\]]+\]=.*
+
+# IServiceProvider
+\bI(?=(?:[A-Z][a-z]{2,})+\b)
+
+# crypt
+"\$2[ayb]\$.{56}"
+
+# scrypt / argon
+\$(?:scrypt|argon\d+[di]*)\$\S+
+
+# Input to GitHub JSON
+content: "[-a-zA-Z=;:/0-9+]*="
+
+# Python stringprefix / binaryprefix
+# Note that there's a high false positive rate, remove the `?=` and search for the regex to see if the matches seem like reasonable strings
+(?<!')\b(?:B|BR|Br|F|FR|Fr|R|RB|RF|Rb|Rf|U|UR|Ur|b|bR|br|f|fR|fr|r|rB|rF|rb|rf|u|uR|ur)'(?:[A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,})
+
+# Regular expressions for (P|p)assword
+\([A-Z]\|[a-z]\)[a-z]+
+
+# JavaScript regular expressions
+# javascript test regex
+/.*/[gim]*\.test\(
+# javascript match regex
+\.match\(/[^/\s"]*/[gim]*\s*
+# javascript match regex
+\.match\(/\\[b].*?/[gim]*\s*\)(?:;|$)
+# javascript regex
+^\s*/\\[b].*/[gim]*\s*(?:\)(?:;|$)|,$)
+# javascript replace regex
+\.replace\(/[^/\s"]*/[gim]*\s*,
+
+# Go regular expressions
+regexp?\.MustCompile\(`[^`]*`\)
+
+# sed regular expressions
+sed 's/(?:[^/]*?[a-zA-Z]{3,}[^/]*?/){2}
+
+# go install
+go install(?:\s+[a-z]+\.[-@\w/.]+)+
+
+# kubernetes pod status lists
+# https://kubernetes.io/docs/concepts/workloads/pods/pod-lifecycle/#pod-phase
+\w+(?:-\w+)+\s+\d+/\d+\s+(?:Running|Pending|Succeeded|Failed|Unknown)\s+
+
+# kubectl - pods in CrashLoopBackOff
+\w+-[0-9a-f]+-\w+\s+\d+/\d+\s+CrashLoopBackOff\s+
+
+# kubernetes object suffix
+-[0-9a-f]{10}-\w{5}\s
+
+# posthog secrets
+posthog\.init\((['"])phc_[^"',]+\g{-1},
+
+# xcode
+
+# xcodeproject scenes
+(?:Controller|ID|id)="\w{3}-\w{2}-\w{3}"
+
+# xcode api botches
+customObjectInstantitationMethod
+
+# font awesome classes
+\.fa-[-a-z0-9]+
+
+# Update Lorem based on your content (requires `ge` and `w` from https://github.com/jsoref/spelling; and `review` from https://github.com/check-spelling/check-spelling/wiki/Looking-for-items-locally )
+# grep '^[^#].*lorem' .github/actions/spelling/patterns.txt|perl -pne 's/.*i..\?://;s/\).*//' |tr '|' "\n"|sort -f |xargs -n1 ge|perl -pne 's/^[^:]*://'|sort -u|w|sed -e 's/ .*//'|w|review -
+# Warning, while `(?i)` is very neat and fancy, if you have some binary files that aren't proper unicode, you might run into:
+## Operation "substitution (s///)" returns its argument for non-Unicode code point 0x1C19AE (the code point will vary).
+## You could manually change `(?i)X...` to use `[Xx]...`
+## or you could add the files to your `excludes` file (a version after 0.0.19 should identify the file path)
+# Lorem
+(?:\w|\s|[,.])*\b(?i)(?:amet|consectetur|cursus|dolor|eros|ipsum|lacus|libero|ligula|lorem|magna|neque|nulla|suscipit|tempus)\b(?:\w|\s|[,.])*
+
+# Non-English
+[a-zA-Z]*[ÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź][a-zA-Z]{3}[a-zA-ZÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź]*
+
+# French
+# This corpus only had capital letters, but you probably want lowercase ones as well.
+\b[LN]'+[a-z]{2,}\b
+
+# latex
+\\(?:n(?:ew|ormal|osub)|r(?:enew)|t(?:able(?:of|)|he|itle))(?=[a-z]+)
+
+# the negative lookahead here is to allow catching 'templatesz' as a misspelling
+# but to otherwise recognize a Windows path with \templates\foo.template or similar:
+\\(?:necessary|r(?:eport|esolve[dr]?|esult)|t(?:arget|emplates?))(?![a-z])
+# ignore long runs of a single character:
+\b([A-Za-z])\g{-1}{3,}\b
+# Note that the next example is no longer necessary if you are using
+# to match a string starting with a `#`, use a character-class:
+[#]backwards
+# version suffix <word>v#
+(?:(?<=[A-Z]{2})V|(?<=[a-z]{2}|[A-Z]{2})v)\d+(?:\b|(?=[a-zA-Z_]))
+# Compiler flags (Scala)
+(?:^|[\t ,>"'`=(])-J-[DPWXY](?=[A-Z]{2,}|[A-Z][a-z]|[a-z]{2,})
+# Compiler flags
+#(?:^|[\t ,"'`=(])-[DPWXYLlf](?=[A-Z]{2,}|[A-Z][a-z]|[a-z]{2,})
+
+# Compiler flags (linker)
+,-B
+# curl arguments
+\b(?:\\n|)curl(?:\s+-[a-zA-Z]{1,2}\b)*(?:\s+-[a-zA-Z]{3,})(?:\s+-[a-zA-Z]+)*
+# set arguments
+\bset(?:\s+-[abefimouxE]{1,2})*\s+-[abefimouxE]{3,}(?:\s+-[abefimouxE]+)*
+# tar arguments
+\b(?:\\n|)g?tar(?:\.exe|)(?:(?:\s+--[-a-zA-Z]+|\s+-[a-zA-Z]+|\s[ABGJMOPRSUWZacdfh-pr-xz]+\b)(?:=[^ ]*|))+
+# tput arguments -- https://man7.org/linux/man-pages/man5/terminfo.5.html -- technically they can be more than 5 chars long...
+\btput\s+(?:(?:-[SV]|-T\s*\w+)\s+)*\w{3,5}\b
+# macOS temp folders
+/var/folders/\w\w/[+\w]+/(?:T|-Caches-)/

.github/actions/spelling/excludes.txt

@@ -0,0 +1,117 @@
+# See https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples:-excludes
+(?:(?i)\.png$)
+(?:^|/)(?i)COPYRIGHT
+(?:^|/)(?i)LICEN[CS]E
+(?:^|/)3rdparty/
+(?:^|/)dirs$
+(?:^|/)go\.mod$
+(?:^|/)go\.sum$
+(?:^|/)package(?:-lock|)\.json$
+(?:^|/)sources(?:|\.dep)$
+(?:^|/)vendor/
+\.a$
+\.ai$
+\.avi$
+\.bmp$
+\.bz2$
+\.cer$
+\.class$
+\.crl$
+\.crt$
+\.csr$
+\.dll$
+\.docx?$
+\.drawio$
+\.DS_Store$
+\.eot$
+\.eps$
+\.exe$
+\.gif$
+\.gitattributes$
+\.graffle$
+\.gz$
+\.icns$
+\.ico$
+\.jar$
+\.jks$
+\.jpeg$
+\.jpg$
+\.key$
+\.lib$
+\.lock$
+\.map$
+\.min\..
+\.mod$
+\.mp3$
+\.mp4$
+\.o$
+\.ocf$
+\.otf$
+\.pbxproj$
+\.pdf$
+\.pem$
+\.png$
+\.psd$
+\.pyc$
+\.runsettings$
+\.s$
+\.sig$
+\.so$
+\.svg$
+\.svgz$
+\.svgz?$
+\.tar$
+\.tgz$
+\.tiff?$
+\.ttf$
+\.vsdx$
+\.wav$
+\.webm$
+\.webp$
+\.woff
+\.woff2?$
+\.xcf$
+\.xls
+\.xlsx?$
+\.xpm$
+\.yml$
+\.zip$
+^\.github/actions/spelling/
+^\.github/fabricbot.json$
+^\.gitignore$
+^\Q.git-blame-ignore-revs\E$
+^\Q.github/workflows/spelling.yml\E$
+^\Qdoc/reference/windows-terminal-logo.ans\E$
+^\Qsamples/ConPTY/EchoCon/EchoCon/EchoCon.vcxproj.filters\E$
+^\Qsrc/host/exe/Host.EXE.vcxproj.filters\E$
+^\Qsrc/host/ft_host/chafa.txt\E$
+^\Qsrc/tools/closetest/CloseTest.vcxproj.filters\E$
+^\XamlStyler.json$
+^build/config/
+^consolegit2gitfilters\.json$
+^dep/
+^doc/reference/master-sequence-list.csv$
+^doc/reference/UTF8-torture-test\.txt$
+^oss/
+^src/host/ft_uia/run\.bat$
+^src/host/runft\.bat$
+^src/host/runut\.bat$
+^src/interactivity/onecore/BgfxEngine\.
+^src/renderer/atlas/
+^src/renderer/wddmcon/WddmConRenderer\.
+^src/terminal/adapter/ut_adapter/run\.bat$
+^src/terminal/parser/delfuzzpayload\.bat$
+^src/terminal/parser/ft_fuzzer/run\.bat$
+^src/terminal/parser/ft_fuzzer/VTCommandFuzzer\.cpp$
+^src/terminal/parser/ft_fuzzwrapper/run\.bat$
+^src/terminal/parser/ut_parser/Base64Test.cpp$
+^src/terminal/parser/ut_parser/run\.bat$
+^src/tools/integrity/packageuwp/ConsoleUWP\.appxSources$
+^src/tools/lnkd/lnkd\.bat$
+^src/tools/pixels/pixels\.bat$
+^src/tools/texttests/fira\.txt$
+^src/tools/U8U16Test/(?:fr|ru|zh)\.txt$
+^src/types/ut_types/UtilsTests.cpp$
+^tools/ReleaseEngineering/ServicingPipeline.ps1$
+ignore$
+SUMS$

.github/actions/spelling/expect/README.md

@@ -0,0 +1,13 @@
+The contents of each `.txt` file in this directory are merged together.
+
+* [alphabet](alphabet.txt) is a sample for alphabet related items
+* [web](web.txt) is a sample for web/html related items
+* [expect](expect.txt) is the main list of expected items -- there is nothing
+particularly special about the file name (beyond the extension which is
+important).
+
+These terms are things which temporarily exist in the project, but which
+aren't necessarily words.
+
+If something is a word that could come and go, it probably belongs in a
+[dictionary](../dictionary/README.md).

.github/actions/spelling/expect/alphabet.txt

@@ -1,27 +1,33 @@
+AAAa
+AAAAA
+AAAAAAAAAAAAA
+AAAAAABBBBBBCCC
+AAAAABBBBBBCCC
+abcd
 abcd
-abcde
-abcdef
-ABCDEFG
-ABCDEFGH
 ABCDEFGHIJ
 abcdefghijk
+ABCDEFGHIJKLMNO
 abcdefghijklmnop
 ABCDEFGHIJKLMNOPQRST
-abcdefghijklmnopqrstuvwxyz
-QQQQQ
-QQQQQQQQQ
-QQQQQQQQQQ
+ABCG
+ABE
+abf
+BBBBB
+BBBBBBBB
+BBBBBCCC
+BBBBCCCCC
+BBGGRR
+EFG
+EFGh
 QQQQQQQQQQABCDEFGHIJ
 QQQQQQQQQQABCDEFGHIJKLMNOPQRSTQQQQQQQQQ
 QQQQQQQQQQABCDEFGHIJKLMNOPQRSTQQQQQQQQQQ
 QQQQQQQQQQABCDEFGHIJPQRSTQQQQQQQQQQ
 qrstuvwxyz
 qwerty
-QWERTYUIOP
 qwertyuiopasdfg
-TTTTTTTTTTTTTTTTTTTTTTTTTT
-VVVVVVVVVVVVVVVV
-yyyy
+YYYYYYYDDDDDDDDDDD
 ZAAZZ
 ZABBZ
 ZBAZZ

.github/actions/spelling/expect/web.txt

@@ -0,0 +1,6 @@
+WCAG
+winui
+appshellintegration
+mdtauk
+gfycat
+Guake

.github/actions/spelling/line_forbidden.patterns

@@ -0,0 +1,62 @@
+# reject `m_data` as there's a certain OS which has evil defines that break things if it's used elsewhere
+# \bm_data\b
+
+# If you have a framework that uses `it()` for testing and `fit()` for debugging a specific test,
+# you might not want to check in code where you were debugging w/ `fit()`, in which case, you might want
+# to use this:
+#\bfit\(
+
+# s.b. GitHub
+\bGithub\b
+
+# s.b. GitLab
+\bGitlab\b
+
+# s.b. JavaScript
+\bJavascript\b
+
+# s.b. Microsoft
+\bMicroSoft\b
+
+# s.b. another
+\ban[- ]other\b
+
+# s.b. greater than
+\bgreater then\b
+
+# s.b. into
+#\sin to\s
+
+# s.b. opt-in
+\sopt in\s
+
+# s.b. less than
+\bless then\b
+
+# s.b. otherwise
+\bother[- ]wise\b
+
+# s.b. nonexistent
+\bnon existing\b
+\b[Nn]o[nt][- ]existent\b
+
+# s.b. preexisting
+[Pp]re[- ]existing
+
+# s.b. preempt
+[Pp]re[- ]empt\b
+
+# s.b. preemptively
+[Pp]re[- ]emptively
+
+# s.b. reentrancy
+[Rr]e[- ]entrancy
+
+# s.b. reentrant
+[Rr]e[- ]entrant
+
+# s.b. workaround(s)
+#\bwork[- ]arounds?\b
+
+# Reject duplicate words
+\s([A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,})\s\g{-1}\s

.github/actions/spelling/patterns/patterns.txt

@@ -0,0 +1,96 @@
+# See https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples:-patterns
+
+https?://\S+
+[Pp]ublicKeyToken="?[0-9a-fA-F]{16}"?
+(?:[{"]|UniqueIdentifier>)[0-9a-fA-F]{8}-(?:[0-9a-fA-F]{4}-){3}[0-9a-fA-F]{12}(?:[}"]|</UniqueIdentifier)
+(?:0[Xx]|\\x|U\+|#)[a-f0-9A-FGgRr]{2,}[Uu]?[Ll]{0,2}\b
+microsoft/cascadia-code\@[0-9a-fA-F]{40}
+\d+x\d+Logo
+Scro\&ll
+# selectionInput.cpp
+ :\\windows\\syste\b
+TestUtils::VerifyExpectedString\(tb, L"[^"]+"
+(?:hostSm|mach)\.ProcessString\(L"[^"]+"
+\b([A-Za-z])\g{-1}{3,}\b
+0x[0-9A-Za-z]+
+Base64::s_(?:En|De)code\(L"[^"]+"
+VERIFY_ARE_EQUAL\(L"[^"]+"
+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789\+/"
+std::memory_order_[\w]+
+D2DERR_SHADER_COMPILE_FAILED
+TIL_FEATURE_[0-9A-Z_]+
+vcvars\w*
+ROY\sG\.\sBIV
+!(?:(?i)ESC)!\[
+!(?:(?i)CSI)!(?:\d+(?:;\d+|)m|[ABCDF])
+
+# Python stringprefix / binaryprefix
+\b(?:B|BR|Br|F|FR|Fr|R|RB|RF|Rb|Rf|U|UR|Ur|b|bR|br|f|fR|fr|r|rB|rF|rb|rf|u|uR|ur)'
+
+# Automatically suggested patterns
+# hit-count: 3831 file-count: 582
+# IServiceProvider
+\bI(?=(?:[A-Z][a-z]{2,})+\b)
+
+# hit-count: 71 file-count: 35
+# Compiler flags
+(?:^|[\t ,"'`=(])-[D](?=[A-Z]{2,}|[A-Z][a-z])
+(?:^|[\t ,"'`=(])-[X](?=[A-Z]{2,}|[A-Z][a-z]|[a-z]{2,})
+
+# hit-count: 41 file-count: 28
+# version suffix <word>v#
+(?:(?<=[A-Z]{2})V|(?<=[a-z]{2}|[A-Z]{2})v)\d+(?:\b|(?=[a-zA-Z_]))
+
+# hit-count: 20 file-count: 9
+# hex runs
+\b[0-9a-fA-F]{16,}\b
+
+# hit-count: 10 file-count: 7
+# uuid:
+\b[0-9a-fA-F]{8}-(?:[0-9a-fA-F]{4}-){3}[0-9a-fA-F]{12}\b
+
+# hit-count: 4 file-count: 4
+# mailto urls
+mailto:[-a-zA-Z=;:/?%&0-9+@.]{3,}
+
+# hit-count: 4 file-count: 1
+# ANSI color codes
+(?:\\(?:u00|x)1b|\x1b)\[\d+(?:;\d+|)m
+
+# hit-count: 2 file-count: 1
+# latex
+\\(?:n(?:ew|ormal|osub)|r(?:enew)|t(?:able(?:of|)|he|itle))(?=[a-z]+)
+
+# hit-count: 1 file-count: 1
+# hex digits including css/html color classes:
+(?:[\\0][xX]|\\u|[uU]\+|#x?|\%23)[0-9_a-fA-FgGrR]*?[a-fA-FgGrR]{2,}[0-9_a-fA-FgGrR]*(?:[uUlL]{0,3}|u\d+)\b
+
+# hit-count: 1 file-count: 1
+# Non-English
+[a-zA-Z]*[ÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź][a-zA-Z]{3}[a-zA-ZÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź]*
+
+# hit-count: 1 file-count: 1
+# French
+# This corpus only had capital letters, but you probably want lowercase ones as well.
+\b[LN]'+[a-z]{2,}\b
+
+# acceptable duplicates
+# ls directory listings
+[-bcdlpsw](?:[-r][-w][-sx]){3}\s+\d+\s+(\S+)\s+\g{-1}\s+\d+\s+
+# C/idl types + English ...
+\s(Guid|long|LONG|that) \g{-1}\s
+
+# javadoc / .net
+(?:[\\@](?:groupname|param)|(?:public|private)(?:\s+static|\s+readonly)*)\s+(\w+)\s+\g{-1}\s
+
+# Commit message -- Signed-off-by and friends
+^\s*(?:(?:Based-on-patch|Co-authored|Helped|Mentored|Reported|Reviewed|Signed-off)-by|Thanks-to): (?:[^<]*<[^>]*>|[^<]*)\s*$
+
+# Autogenerated revert commit message
+^This reverts commit [0-9a-f]{40}\.$
+
+# vtmode
+--vtmode\s+(\w+)\s+\g{-1}\s
+
+# ignore long runs of a single character:
+\b([A-Za-z])\g{-1}{3,}\b

.github/actions/spelling/reject.txt

@@ -0,0 +1,12 @@
+^attache$
+^attacher$
+^attachers$
+benefitting
+occurences?
+^dependan.*
+^oer$
+Sorce
+^[Ss]pae.*
+^untill$
+^untilling$
+^wether.*

.github/workflows/spelling.yml

@@ -1,20 +0,0 @@
-name: Spell checking
-on:
-  push:
-  schedule:
-    # * is a special character in YAML so you have to quote this string
-    - cron: '15 * * * *'
-
-jobs:
-  build:
-    name: Spell checking
-    runs-on: ubuntu-latest
-    steps:
-    - uses: actions/checkout@v2.0.0
-      with:
-        fetch-depth: 5
-    - uses: check-spelling/check-spelling@0.0.12-alpha
-      env:
-        GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
-        bucket: .github/actions
-        project: spell-check

.github/workflows/spelling2.yml

@@ -0,0 +1,134 @@
+# spelling.yml is blocked per https://github.com/check-spelling/check-spelling/security/advisories/GHSA-g86g-chm8-7r2p
+name: Spell checking
+
+# Comment management is handled through a secondary job, for details see:
+# https://github.com/check-spelling/check-spelling/wiki/Feature%3A-Restricted-Permissions
+#
+# `jobs.comment-push` runs when a push is made to a repository and the `jobs.spelling` job needs to make a comment
+#   (in odd cases, it might actually run just to collapse a commment, but that's fairly rare)
+#   it needs `contents: write` in order to add a comment.
+#
+# `jobs.comment-pr` runs when a pull_request is made to a repository and the `jobs.spelling` job needs to make a comment
+#   or collapse a comment (in the case where it had previously made a comment and now no longer needs to show a comment)
+#   it needs `pull-requests: write` in order to manipulate those comments.
+
+# Updating pull request branches is managed via comment handling.
+# For details, see: https://github.com/check-spelling/check-spelling/wiki/Feature:-Update-expect-list
+#
+# These elements work together to make it happen:
+#
+# `on.issue_comment`
+#   This event listens to comments by users asking to update the metadata.
+#
+# `jobs.update`
+#   This job runs in response to an issue_comment and will push a new commit
+#   to update the spelling metadata.
+#
+# `with.experimental_apply_changes_via_bot`
+#   Tells the action to support and generate messages that enable it
+#   to make a commit to update the spelling metadata.
+#
+# `with.ssh_key`
+#   In order to trigger workflows when the commit is made, you can provide a
+#   secret (typically, a write-enabled github deploy key).
+#
+#   For background, see: https://github.com/check-spelling/check-spelling/wiki/Feature:-Update-with-deploy-key
+
+on:
+  push:
+    branches:
+    - "**"
+    tags-ignore:
+    - "**"
+  pull_request_target:
+    branches:
+    - "**"
+    tags-ignore:
+    - "**"
+    types:
+    - 'opened'
+    - 'reopened'
+    - 'synchronize'
+  issue_comment:
+    types:
+    - 'created'
+
+jobs:
+  spelling:
+    name: Spell checking
+    permissions:
+      contents: read
+      pull-requests: read
+      actions: read
+    outputs:
+      followup: ${{ steps.spelling.outputs.followup }}
+    runs-on: ubuntu-latest
+    if: "contains(github.event_name, 'pull_request') || github.event_name == 'push'"
+    concurrency:
+      group: spelling-${{ github.event.pull_request.number || github.ref }}
+      # note: If you use only_check_changed_files, you do not want cancel-in-progress
+      cancel-in-progress: true
+    steps:
+    - name: check-spelling
+      id: spelling
+      uses: check-spelling/check-spelling@v0.0.21
+      with:
+        suppress_push_for_open_pull_request: 1
+        checkout: true
+        check_file_names: 1
+        spell_check_this: check-spelling/spell-check-this@prerelease
+        post_comment: 0
+        use_magic_file: 1
+        extra_dictionary_limit: 10
+        extra_dictionaries:
+          cspell:software-terms/src/software-terms.txt
+          cspell:python/src/python/python-lib.txt
+          cspell:node/node.txt
+          cspell:cpp/src/stdlib-c.txt
+          cspell:cpp/src/stdlib-cpp.txt
+          cspell:fullstack/fullstack.txt
+          cspell:filetypes/filetypes.txt
+          cspell:html/html.txt
+          cspell:cpp/src/compiler-msvc.txt
+          cspell:python/src/common/extra.txt
+          cspell:powershell/powershell.txt
+          cspell:aws/aws.txt
+          cspell:cpp/src/lang-keywords.txt
+          cspell:npm/npm.txt
+          cspell:dotnet/dotnet.txt
+          cspell:python/src/python/python.txt
+          cspell:css/css.txt
+          cspell:cpp/src/stdlib-cmath.txt
+        check_extra_dictionaries: ''
+
+  comment-push:
+    name: Report (Push)
+    # If your workflow isn't running on push, you can remove this job
+    runs-on: ubuntu-latest
+    needs: spelling
+    permissions:
+      contents: write
+    if: (success() || failure()) && needs.spelling.outputs.followup && github.event_name == 'push'
+    steps:
+    - name: comment
+      uses: check-spelling/check-spelling@v0.0.21
+      with:
+        checkout: true
+        spell_check_this: check-spelling/spell-check-this@prerelease
+        task: ${{ needs.spelling.outputs.followup }}
+
+  comment-pr:
+    name: Report (PR)
+    # If you workflow isn't running on pull_request*, you can remove this job
+    runs-on: ubuntu-latest
+    needs: spelling
+    permissions:
+      pull-requests: write
+    if: (success() || failure()) && needs.spelling.outputs.followup && contains(github.event_name, 'pull_request')
+    steps:
+    - name: comment
+      uses: check-spelling/check-spelling@v0.0.21
+      with:
+        checkout: true
+        spell_check_this: check-spelling/spell-check-this@prerelease
+        task: ${{ needs.spelling.outputs.followup }}

NOTICE.md

@@ -179,4 +179,42 @@ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
 OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
 SOFTWARE.
 
-```
+```
+
+## {fmt}
+
+**Source**: https://github.com/fmtlib/fmt
+
+### License
+
+```
+MIT License
+
+Copyright (c) 2012 - present, Victor Zverovich
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+--- Optional exception to the license ---
+
+As an exception, if, as a result of your compiling your source code, portions
+of this Software are embedded into a machine-executable object form of such
+source code, you may redistribute such embedded portions in such object form
+without including the above copyright and permission notices.
+```

OpenConsole.sln

@@ -300,6 +300,8 @@ Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "winconpty.Tests.Feature", "
 EndProject
 Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "TerminalAzBridge", "src\cascadia\TerminalAzBridge\TerminalAzBridge.vcxproj", "{067F0A06-FCB7-472C-96E9-B03B54E8E18D}"
 EndProject
+Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "fmt", "src\dep\fmt\fmt.vcxproj", "{6BAE5851-50D5-4934-8D5E-30361A8A40F3}"
+EndProject
 Global
 	GlobalSection(SolutionConfigurationPlatforms) = preSolution
 		AuditMode|Any CPU = AuditMode|Any CPU
@@ -1485,6 +1487,27 @@ Global
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D}.Release|x64.Build.0 = Release|x64
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D}.Release|x86.ActiveCfg = Release|Win32
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D}.Release|x86.Build.0 = Release|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|Any CPU.ActiveCfg = AuditMode|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|ARM64.ActiveCfg = AuditMode|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|ARM64.Build.0 = AuditMode|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x64.ActiveCfg = AuditMode|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x64.Build.0 = AuditMode|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x86.ActiveCfg = AuditMode|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x86.Build.0 = AuditMode|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|Any CPU.ActiveCfg = Debug|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|ARM64.ActiveCfg = Debug|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|ARM64.Build.0 = Debug|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x64.ActiveCfg = Debug|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x64.Build.0 = Debug|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x86.ActiveCfg = Debug|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x86.Build.0 = Debug|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|Any CPU.ActiveCfg = Release|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|ARM64.ActiveCfg = Release|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|ARM64.Build.0 = Release|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x64.ActiveCfg = Release|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x64.Build.0 = Release|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x86.ActiveCfg = Release|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x86.Build.0 = Release|Win32
 	EndGlobalSection
 	GlobalSection(SolutionProperties) = preSolution
 		HideSolutionNode = FALSE
@@ -1562,6 +1585,7 @@ Global
 		{95B136F9-B238-490C-A7C5-5843C1FECAC4} = {05500DEF-2294-41E3-AF9A-24E580B82836}
 		{024052DE-83FB-4653-AEA4-90790D29D5BD} = {E8F24881-5E37-4362-B191-A3BA0ED7F4EB}
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D} = {59840756-302F-44DF-AA47-441A9D673202}
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3} = {81C352DB-1818-45B7-A284-18E259F1CC87}
 	EndGlobalSection
 	GlobalSection(ExtensibilityGlobals) = postSolution
 		SolutionGuid = {3140B1B7-C8EE-43D1-A772-D82A7061A271}

README.md

@@ -150,7 +150,6 @@ Please file new issues, feature requests and suggestions, but **DO search for si
 If you would like to ask a question that you feel doesn't warrant an issue (yet), please reach out to us via Twitter:
 
 * Kayla Cinnamon, Program Manager: [@cinnamon\_msft](https://twitter.com/cinnamon_msft)
-* Rich Turner, Program Manager: [@richturn\_ms](https://twitter.com/richturn_ms)
 * Dustin Howett, Engineering Lead: [@dhowett](https://twitter.com/DHowett)
 * Michael Niksa, Senior Developer: [@michaelniksa](https://twitter.com/MichaelNiksa)
 * Mike Griese, Developer: [@zadjii](https://twitter.com/zadjii)

build/pipelines/ci.yml

@@ -27,21 +27,43 @@ variables:
 #     0.0.1904.0900
 name: 0.0.$(Date:yyMM).$(Date:dd)$(Rev:rr)
 
-jobs:
-  - template: ./templates/build-console-audit-job.yml
-    parameters:
-      platform: x64
+stages:
+  - stage: Audit_x64
+    displayName: Audit Mode
+    dependsOn: []
+    condition: succeeded()
+    jobs:
+      - template: ./templates/build-console-audit-job.yml
+        parameters:
+          platform: x64
+  - stage: Build_x64
+    displayName: Build x64
+    dependsOn: []
+    condition: succeeded()
+    jobs:
+      - template: ./templates/build-console-ci.yml
+        parameters:
+          platform: x64
+  - stage: Build_x86
+    displayName: Build x86
+    dependsOn: []
+    condition: not(eq(variables['Build.Reason'], 'PullRequest'))
+    jobs:
+      - template: ./templates/build-console-ci.yml
+        parameters:
+          platform: x86
+  - stage: Build_ARM64
+    displayName: Build ARM64
+    dependsOn: []
+    condition: not(eq(variables['Build.Reason'], 'PullRequest'))
+    jobs:
+      - template: ./templates/build-console-ci.yml
+        parameters:
+          platform: ARM64
+  - stage: Scripts
+    displayName: Code Health Scripts
+    dependsOn: []
+    condition: succeeded()
+    jobs:
+      - template: ./templates/check-formatting.yml
 
-  - template: ./templates/build-console-ci.yml
-    parameters:
-      platform: x64
-
-  - template: ./templates/build-console-ci.yml
-    parameters:
-      platform: x86
-
-  - template: ./templates/build-console-ci.yml
-    parameters:
-      platform: ARM64
-
-  - template: ./templates/check-formatting.yml

dep/fmt/LICENSE.rst

@@ -0,0 +1,27 @@
+Copyright (c) 2012 - present, Victor Zverovich
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+--- Optional exception to the license ---
+
+As an exception, if, as a result of your compiling your source code, portions
+of this Software are embedded into a machine-executable object form of such
+source code, you may redistribute such embedded portions in such object form
+without including the above copyright and permission notices.

dep/fmt/MAINTAINER_README.md

@@ -0,0 +1,17 @@
+### Notes for Future Maintainers
+
+This was originally imported by @DHowett-MSFT in April 2020.
+
+The provenance information (where it came from and which commit) is stored in the file `cgmanifest.json` in the same directory as this readme.
+Please update the provenance information in that file when ingesting an updated version of the dependent library.
+That provenance file is automatically read and inventoried by Microsoft systems to ensure compliance with appropiate governance standards.
+
+## What should be done to update this in the future?
+
+1. Go to fmtlib/fmt repository on GitHub.
+2. Take the entire contents of the include/ and src/ directories and drop them in this directory.
+3. Don't change anything about it.
+4. Validate that the license in the root of the repository didn't change and update it if so. It is sitting in the same directory as this readme. 
+   If it changed dramatically, ensure that it is still compatible with our license scheme. Also update the NOTICE file in the root of our repository to declare the third-party usage.
+5. Submit the pull.
+

dep/fmt/cgmanifest.json

@@ -0,0 +1,13 @@
+{"Registrations":[ 
+    {
+      "component": { 
+       "type": "git", 
+       "git": { 
+         "repositoryUrl": "https://github.com/fmtlib/fmt", 
+         "commitHash": "9bdd1596cef1b57b9556f8bef32dc4a32322ef3e" 
+         }
+       }
+    }
+ ],
+ "Version": 1
+}

dep/fmt/include/fmt/color.h

@@ -0,0 +1,568 @@
+// Formatting library for C++ - color support
+//
+// Copyright (c) 2018 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COLOR_H_
+#define FMT_COLOR_H_
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+enum class color : uint32_t {
+  alice_blue = 0xF0F8FF,               // rgb(240,248,255)
+  antique_white = 0xFAEBD7,            // rgb(250,235,215)
+  aqua = 0x00FFFF,                     // rgb(0,255,255)
+  aquamarine = 0x7FFFD4,               // rgb(127,255,212)
+  azure = 0xF0FFFF,                    // rgb(240,255,255)
+  beige = 0xF5F5DC,                    // rgb(245,245,220)
+  bisque = 0xFFE4C4,                   // rgb(255,228,196)
+  black = 0x000000,                    // rgb(0,0,0)
+  blanched_almond = 0xFFEBCD,          // rgb(255,235,205)
+  blue = 0x0000FF,                     // rgb(0,0,255)
+  blue_violet = 0x8A2BE2,              // rgb(138,43,226)
+  brown = 0xA52A2A,                    // rgb(165,42,42)
+  burly_wood = 0xDEB887,               // rgb(222,184,135)
+  cadet_blue = 0x5F9EA0,               // rgb(95,158,160)
+  chartreuse = 0x7FFF00,               // rgb(127,255,0)
+  chocolate = 0xD2691E,                // rgb(210,105,30)
+  coral = 0xFF7F50,                    // rgb(255,127,80)
+  cornflower_blue = 0x6495ED,          // rgb(100,149,237)
+  cornsilk = 0xFFF8DC,                 // rgb(255,248,220)
+  crimson = 0xDC143C,                  // rgb(220,20,60)
+  cyan = 0x00FFFF,                     // rgb(0,255,255)
+  dark_blue = 0x00008B,                // rgb(0,0,139)
+  dark_cyan = 0x008B8B,                // rgb(0,139,139)
+  dark_golden_rod = 0xB8860B,          // rgb(184,134,11)
+  dark_gray = 0xA9A9A9,                // rgb(169,169,169)
+  dark_green = 0x006400,               // rgb(0,100,0)
+  dark_khaki = 0xBDB76B,               // rgb(189,183,107)
+  dark_magenta = 0x8B008B,             // rgb(139,0,139)
+  dark_olive_green = 0x556B2F,         // rgb(85,107,47)
+  dark_orange = 0xFF8C00,              // rgb(255,140,0)
+  dark_orchid = 0x9932CC,              // rgb(153,50,204)
+  dark_red = 0x8B0000,                 // rgb(139,0,0)
+  dark_salmon = 0xE9967A,              // rgb(233,150,122)
+  dark_sea_green = 0x8FBC8F,           // rgb(143,188,143)
+  dark_slate_blue = 0x483D8B,          // rgb(72,61,139)
+  dark_slate_gray = 0x2F4F4F,          // rgb(47,79,79)
+  dark_turquoise = 0x00CED1,           // rgb(0,206,209)
+  dark_violet = 0x9400D3,              // rgb(148,0,211)
+  deep_pink = 0xFF1493,                // rgb(255,20,147)
+  deep_sky_blue = 0x00BFFF,            // rgb(0,191,255)
+  dim_gray = 0x696969,                 // rgb(105,105,105)
+  dodger_blue = 0x1E90FF,              // rgb(30,144,255)
+  fire_brick = 0xB22222,               // rgb(178,34,34)
+  floral_white = 0xFFFAF0,             // rgb(255,250,240)
+  forest_green = 0x228B22,             // rgb(34,139,34)
+  fuchsia = 0xFF00FF,                  // rgb(255,0,255)
+  gainsboro = 0xDCDCDC,                // rgb(220,220,220)
+  ghost_white = 0xF8F8FF,              // rgb(248,248,255)
+  gold = 0xFFD700,                     // rgb(255,215,0)
+  golden_rod = 0xDAA520,               // rgb(218,165,32)
+  gray = 0x808080,                     // rgb(128,128,128)
+  green = 0x008000,                    // rgb(0,128,0)
+  green_yellow = 0xADFF2F,             // rgb(173,255,47)
+  honey_dew = 0xF0FFF0,                // rgb(240,255,240)
+  hot_pink = 0xFF69B4,                 // rgb(255,105,180)
+  indian_red = 0xCD5C5C,               // rgb(205,92,92)
+  indigo = 0x4B0082,                   // rgb(75,0,130)
+  ivory = 0xFFFFF0,                    // rgb(255,255,240)
+  khaki = 0xF0E68C,                    // rgb(240,230,140)
+  lavender = 0xE6E6FA,                 // rgb(230,230,250)
+  lavender_blush = 0xFFF0F5,           // rgb(255,240,245)
+  lawn_green = 0x7CFC00,               // rgb(124,252,0)
+  lemon_chiffon = 0xFFFACD,            // rgb(255,250,205)
+  light_blue = 0xADD8E6,               // rgb(173,216,230)
+  light_coral = 0xF08080,              // rgb(240,128,128)
+  light_cyan = 0xE0FFFF,               // rgb(224,255,255)
+  light_golden_rod_yellow = 0xFAFAD2,  // rgb(250,250,210)
+  light_gray = 0xD3D3D3,               // rgb(211,211,211)
+  light_green = 0x90EE90,              // rgb(144,238,144)
+  light_pink = 0xFFB6C1,               // rgb(255,182,193)
+  light_salmon = 0xFFA07A,             // rgb(255,160,122)
+  light_sea_green = 0x20B2AA,          // rgb(32,178,170)
+  light_sky_blue = 0x87CEFA,           // rgb(135,206,250)
+  light_slate_gray = 0x778899,         // rgb(119,136,153)
+  light_steel_blue = 0xB0C4DE,         // rgb(176,196,222)
+  light_yellow = 0xFFFFE0,             // rgb(255,255,224)
+  lime = 0x00FF00,                     // rgb(0,255,0)
+  lime_green = 0x32CD32,               // rgb(50,205,50)
+  linen = 0xFAF0E6,                    // rgb(250,240,230)
+  magenta = 0xFF00FF,                  // rgb(255,0,255)
+  maroon = 0x800000,                   // rgb(128,0,0)
+  medium_aquamarine = 0x66CDAA,        // rgb(102,205,170)
+  medium_blue = 0x0000CD,              // rgb(0,0,205)
+  medium_orchid = 0xBA55D3,            // rgb(186,85,211)
+  medium_purple = 0x9370DB,            // rgb(147,112,219)
+  medium_sea_green = 0x3CB371,         // rgb(60,179,113)
+  medium_slate_blue = 0x7B68EE,        // rgb(123,104,238)
+  medium_spring_green = 0x00FA9A,      // rgb(0,250,154)
+  medium_turquoise = 0x48D1CC,         // rgb(72,209,204)
+  medium_violet_red = 0xC71585,        // rgb(199,21,133)
+  midnight_blue = 0x191970,            // rgb(25,25,112)
+  mint_cream = 0xF5FFFA,               // rgb(245,255,250)
+  misty_rose = 0xFFE4E1,               // rgb(255,228,225)
+  moccasin = 0xFFE4B5,                 // rgb(255,228,181)
+  navajo_white = 0xFFDEAD,             // rgb(255,222,173)
+  navy = 0x000080,                     // rgb(0,0,128)
+  old_lace = 0xFDF5E6,                 // rgb(253,245,230)
+  olive = 0x808000,                    // rgb(128,128,0)
+  olive_drab = 0x6B8E23,               // rgb(107,142,35)
+  orange = 0xFFA500,                   // rgb(255,165,0)
+  orange_red = 0xFF4500,               // rgb(255,69,0)
+  orchid = 0xDA70D6,                   // rgb(218,112,214)
+  pale_golden_rod = 0xEEE8AA,          // rgb(238,232,170)
+  pale_green = 0x98FB98,               // rgb(152,251,152)
+  pale_turquoise = 0xAFEEEE,           // rgb(175,238,238)
+  pale_violet_red = 0xDB7093,          // rgb(219,112,147)
+  papaya_whip = 0xFFEFD5,              // rgb(255,239,213)
+  peach_puff = 0xFFDAB9,               // rgb(255,218,185)
+  peru = 0xCD853F,                     // rgb(205,133,63)
+  pink = 0xFFC0CB,                     // rgb(255,192,203)
+  plum = 0xDDA0DD,                     // rgb(221,160,221)
+  powder_blue = 0xB0E0E6,              // rgb(176,224,230)
+  purple = 0x800080,                   // rgb(128,0,128)
+  rebecca_purple = 0x663399,           // rgb(102,51,153)
+  red = 0xFF0000,                      // rgb(255,0,0)
+  rosy_brown = 0xBC8F8F,               // rgb(188,143,143)
+  royal_blue = 0x4169E1,               // rgb(65,105,225)
+  saddle_brown = 0x8B4513,             // rgb(139,69,19)
+  salmon = 0xFA8072,                   // rgb(250,128,114)
+  sandy_brown = 0xF4A460,              // rgb(244,164,96)
+  sea_green = 0x2E8B57,                // rgb(46,139,87)
+  sea_shell = 0xFFF5EE,                // rgb(255,245,238)
+  sienna = 0xA0522D,                   // rgb(160,82,45)
+  silver = 0xC0C0C0,                   // rgb(192,192,192)
+  sky_blue = 0x87CEEB,                 // rgb(135,206,235)
+  slate_blue = 0x6A5ACD,               // rgb(106,90,205)
+  slate_gray = 0x708090,               // rgb(112,128,144)
+  snow = 0xFFFAFA,                     // rgb(255,250,250)
+  spring_green = 0x00FF7F,             // rgb(0,255,127)
+  steel_blue = 0x4682B4,               // rgb(70,130,180)
+  tan = 0xD2B48C,                      // rgb(210,180,140)
+  teal = 0x008080,                     // rgb(0,128,128)
+  thistle = 0xD8BFD8,                  // rgb(216,191,216)
+  tomato = 0xFF6347,                   // rgb(255,99,71)
+  turquoise = 0x40E0D0,                // rgb(64,224,208)
+  violet = 0xEE82EE,                   // rgb(238,130,238)
+  wheat = 0xF5DEB3,                    // rgb(245,222,179)
+  white = 0xFFFFFF,                    // rgb(255,255,255)
+  white_smoke = 0xF5F5F5,              // rgb(245,245,245)
+  yellow = 0xFFFF00,                   // rgb(255,255,0)
+  yellow_green = 0x9ACD32              // rgb(154,205,50)
+};                                     // enum class color
+
+enum class terminal_color : uint8_t {
+  black = 30,
+  red,
+  green,
+  yellow,
+  blue,
+  magenta,
+  cyan,
+  white,
+  bright_black = 90,
+  bright_red,
+  bright_green,
+  bright_yellow,
+  bright_blue,
+  bright_magenta,
+  bright_cyan,
+  bright_white
+};
+
+enum class emphasis : uint8_t {
+  bold = 1,
+  italic = 1 << 1,
+  underline = 1 << 2,
+  strikethrough = 1 << 3
+};
+
+// rgb is a struct for red, green and blue colors.
+// Using the name "rgb" makes some editors show the color in a tooltip.
+struct rgb {
+  FMT_CONSTEXPR rgb() : r(0), g(0), b(0) {}
+  FMT_CONSTEXPR rgb(uint8_t r_, uint8_t g_, uint8_t b_) : r(r_), g(g_), b(b_) {}
+  FMT_CONSTEXPR rgb(uint32_t hex)
+      : r((hex >> 16) & 0xFF), g((hex >> 8) & 0xFF), b(hex & 0xFF) {}
+  FMT_CONSTEXPR rgb(color hex)
+      : r((uint32_t(hex) >> 16) & 0xFF),
+        g((uint32_t(hex) >> 8) & 0xFF),
+        b(uint32_t(hex) & 0xFF) {}
+  uint8_t r;
+  uint8_t g;
+  uint8_t b;
+};
+
+namespace internal {
+
+// color is a struct of either a rgb color or a terminal color.
+struct color_type {
+  FMT_CONSTEXPR color_type() FMT_NOEXCEPT : is_rgb(), value{} {}
+  FMT_CONSTEXPR color_type(color rgb_color) FMT_NOEXCEPT : is_rgb(true),
+                                                           value{} {
+    value.rgb_color = static_cast<uint32_t>(rgb_color);
+  }
+  FMT_CONSTEXPR color_type(rgb rgb_color) FMT_NOEXCEPT : is_rgb(true), value{} {
+    value.rgb_color = (static_cast<uint32_t>(rgb_color.r) << 16) |
+                      (static_cast<uint32_t>(rgb_color.g) << 8) | rgb_color.b;
+  }
+  FMT_CONSTEXPR color_type(terminal_color term_color) FMT_NOEXCEPT : is_rgb(),
+                                                                     value{} {
+    value.term_color = static_cast<uint8_t>(term_color);
+  }
+  bool is_rgb;
+  union color_union {
+    uint8_t term_color;
+    uint32_t rgb_color;
+  } value;
+};
+}  // namespace internal
+
+// Experimental text formatting support.
+class text_style {
+ public:
+  FMT_CONSTEXPR text_style(emphasis em = emphasis()) FMT_NOEXCEPT
+      : set_foreground_color(),
+        set_background_color(),
+        ems(em) {}
+
+  FMT_CONSTEXPR text_style& operator|=(const text_style& rhs) {
+    if (!set_foreground_color) {
+      set_foreground_color = rhs.set_foreground_color;
+      foreground_color = rhs.foreground_color;
+    } else if (rhs.set_foreground_color) {
+      if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
+        FMT_THROW(format_error("can't OR a terminal color"));
+      foreground_color.value.rgb_color |= rhs.foreground_color.value.rgb_color;
+    }
+
+    if (!set_background_color) {
+      set_background_color = rhs.set_background_color;
+      background_color = rhs.background_color;
+    } else if (rhs.set_background_color) {
+      if (!background_color.is_rgb || !rhs.background_color.is_rgb)
+        FMT_THROW(format_error("can't OR a terminal color"));
+      background_color.value.rgb_color |= rhs.background_color.value.rgb_color;
+    }
+
+    ems = static_cast<emphasis>(static_cast<uint8_t>(ems) |
+                                static_cast<uint8_t>(rhs.ems));
+    return *this;
+  }
+
+  friend FMT_CONSTEXPR text_style operator|(text_style lhs,
+                                            const text_style& rhs) {
+    return lhs |= rhs;
+  }
+
+  FMT_CONSTEXPR text_style& operator&=(const text_style& rhs) {
+    if (!set_foreground_color) {
+      set_foreground_color = rhs.set_foreground_color;
+      foreground_color = rhs.foreground_color;
+    } else if (rhs.set_foreground_color) {
+      if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
+        FMT_THROW(format_error("can't AND a terminal color"));
+      foreground_color.value.rgb_color &= rhs.foreground_color.value.rgb_color;
+    }
+
+    if (!set_background_color) {
+      set_background_color = rhs.set_background_color;
+      background_color = rhs.background_color;
+    } else if (rhs.set_background_color) {
+      if (!background_color.is_rgb || !rhs.background_color.is_rgb)
+        FMT_THROW(format_error("can't AND a terminal color"));
+      background_color.value.rgb_color &= rhs.background_color.value.rgb_color;
+    }
+
+    ems = static_cast<emphasis>(static_cast<uint8_t>(ems) &
+                                static_cast<uint8_t>(rhs.ems));
+    return *this;
+  }
+
+  friend FMT_CONSTEXPR text_style operator&(text_style lhs,
+                                            const text_style& rhs) {
+    return lhs &= rhs;
+  }
+
+  FMT_CONSTEXPR bool has_foreground() const FMT_NOEXCEPT {
+    return set_foreground_color;
+  }
+  FMT_CONSTEXPR bool has_background() const FMT_NOEXCEPT {
+    return set_background_color;
+  }
+  FMT_CONSTEXPR bool has_emphasis() const FMT_NOEXCEPT {
+    return static_cast<uint8_t>(ems) != 0;
+  }
+  FMT_CONSTEXPR internal::color_type get_foreground() const FMT_NOEXCEPT {
+    FMT_ASSERT(has_foreground(), "no foreground specified for this style");
+    return foreground_color;
+  }
+  FMT_CONSTEXPR internal::color_type get_background() const FMT_NOEXCEPT {
+    FMT_ASSERT(has_background(), "no background specified for this style");
+    return background_color;
+  }
+  FMT_CONSTEXPR emphasis get_emphasis() const FMT_NOEXCEPT {
+    FMT_ASSERT(has_emphasis(), "no emphasis specified for this style");
+    return ems;
+  }
+
+ private:
+  FMT_CONSTEXPR text_style(bool is_foreground,
+                           internal::color_type text_color) FMT_NOEXCEPT
+      : set_foreground_color(),
+        set_background_color(),
+        ems() {
+    if (is_foreground) {
+      foreground_color = text_color;
+      set_foreground_color = true;
+    } else {
+      background_color = text_color;
+      set_background_color = true;
+    }
+  }
+
+  friend FMT_CONSTEXPR_DECL text_style fg(internal::color_type foreground)
+      FMT_NOEXCEPT;
+  friend FMT_CONSTEXPR_DECL text_style bg(internal::color_type background)
+      FMT_NOEXCEPT;
+
+  internal::color_type foreground_color;
+  internal::color_type background_color;
+  bool set_foreground_color;
+  bool set_background_color;
+  emphasis ems;
+};
+
+FMT_CONSTEXPR text_style fg(internal::color_type foreground) FMT_NOEXCEPT {
+  return text_style(/*is_foreground=*/true, foreground);
+}
+
+FMT_CONSTEXPR text_style bg(internal::color_type background) FMT_NOEXCEPT {
+  return text_style(/*is_foreground=*/false, background);
+}
+
+FMT_CONSTEXPR text_style operator|(emphasis lhs, emphasis rhs) FMT_NOEXCEPT {
+  return text_style(lhs) | rhs;
+}
+
+namespace internal {
+
+template <typename Char> struct ansi_color_escape {
+  FMT_CONSTEXPR ansi_color_escape(internal::color_type text_color,
+                                  const char* esc) FMT_NOEXCEPT {
+    // If we have a terminal color, we need to output another escape code
+    // sequence.
+    if (!text_color.is_rgb) {
+      bool is_background = esc == internal::data::background_color;
+      uint32_t value = text_color.value.term_color;
+      // Background ASCII codes are the same as the foreground ones but with
+      // 10 more.
+      if (is_background) value += 10u;
+
+      std::size_t index = 0;
+      buffer[index++] = static_cast<Char>('\x1b');
+      buffer[index++] = static_cast<Char>('[');
+
+      if (value >= 100u) {
+        buffer[index++] = static_cast<Char>('1');
+        value %= 100u;
+      }
+      buffer[index++] = static_cast<Char>('0' + value / 10u);
+      buffer[index++] = static_cast<Char>('0' + value % 10u);
+
+      buffer[index++] = static_cast<Char>('m');
+      buffer[index++] = static_cast<Char>('\0');
+      return;
+    }
+
+    for (int i = 0; i < 7; i++) {
+      buffer[i] = static_cast<Char>(esc[i]);
+    }
+    rgb color(text_color.value.rgb_color);
+    to_esc(color.r, buffer + 7, ';');
+    to_esc(color.g, buffer + 11, ';');
+    to_esc(color.b, buffer + 15, 'm');
+    buffer[19] = static_cast<Char>(0);
+  }
+  FMT_CONSTEXPR ansi_color_escape(emphasis em) FMT_NOEXCEPT {
+    uint8_t em_codes[4] = {};
+    uint8_t em_bits = static_cast<uint8_t>(em);
+    if (em_bits & static_cast<uint8_t>(emphasis::bold)) em_codes[0] = 1;
+    if (em_bits & static_cast<uint8_t>(emphasis::italic)) em_codes[1] = 3;
+    if (em_bits & static_cast<uint8_t>(emphasis::underline)) em_codes[2] = 4;
+    if (em_bits & static_cast<uint8_t>(emphasis::strikethrough))
+      em_codes[3] = 9;
+
+    std::size_t index = 0;
+    for (int i = 0; i < 4; ++i) {
+      if (!em_codes[i]) continue;
+      buffer[index++] = static_cast<Char>('\x1b');
+      buffer[index++] = static_cast<Char>('[');
+      buffer[index++] = static_cast<Char>('0' + em_codes[i]);
+      buffer[index++] = static_cast<Char>('m');
+    }
+    buffer[index++] = static_cast<Char>(0);
+  }
+  FMT_CONSTEXPR operator const Char*() const FMT_NOEXCEPT { return buffer; }
+
+  FMT_CONSTEXPR const Char* begin() const FMT_NOEXCEPT { return buffer; }
+  FMT_CONSTEXPR const Char* end() const FMT_NOEXCEPT {
+    return buffer + std::char_traits<Char>::length(buffer);
+  }
+
+ private:
+  Char buffer[7u + 3u * 4u + 1u];
+
+  static FMT_CONSTEXPR void to_esc(uint8_t c, Char* out,
+                                   char delimiter) FMT_NOEXCEPT {
+    out[0] = static_cast<Char>('0' + c / 100);
+    out[1] = static_cast<Char>('0' + c / 10 % 10);
+    out[2] = static_cast<Char>('0' + c % 10);
+    out[3] = static_cast<Char>(delimiter);
+  }
+};
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_foreground_color(
+    internal::color_type foreground) FMT_NOEXCEPT {
+  return ansi_color_escape<Char>(foreground, internal::data::foreground_color);
+}
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_background_color(
+    internal::color_type background) FMT_NOEXCEPT {
+  return ansi_color_escape<Char>(background, internal::data::background_color);
+}
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_emphasis(emphasis em) FMT_NOEXCEPT {
+  return ansi_color_escape<Char>(em);
+}
+
+template <typename Char>
+inline void fputs(const Char* chars, FILE* stream) FMT_NOEXCEPT {
+  std::fputs(chars, stream);
+}
+
+template <>
+inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) FMT_NOEXCEPT {
+  std::fputws(chars, stream);
+}
+
+template <typename Char> inline void reset_color(FILE* stream) FMT_NOEXCEPT {
+  fputs(internal::data::reset_color, stream);
+}
+
+template <> inline void reset_color<wchar_t>(FILE* stream) FMT_NOEXCEPT {
+  fputs(internal::data::wreset_color, stream);
+}
+
+template <typename Char>
+inline void reset_color(basic_memory_buffer<Char>& buffer) FMT_NOEXCEPT {
+  const char* begin = data::reset_color;
+  const char* end = begin + sizeof(data::reset_color) - 1;
+  buffer.append(begin, end);
+}
+
+template <typename Char>
+void vformat_to(basic_memory_buffer<Char>& buf, const text_style& ts,
+                basic_string_view<Char> format_str,
+                basic_format_args<buffer_context<Char>> args) {
+  bool has_style = false;
+  if (ts.has_emphasis()) {
+    has_style = true;
+    auto emphasis = internal::make_emphasis<Char>(ts.get_emphasis());
+    buf.append(emphasis.begin(), emphasis.end());
+  }
+  if (ts.has_foreground()) {
+    has_style = true;
+    auto foreground =
+        internal::make_foreground_color<Char>(ts.get_foreground());
+    buf.append(foreground.begin(), foreground.end());
+  }
+  if (ts.has_background()) {
+    has_style = true;
+    auto background =
+        internal::make_background_color<Char>(ts.get_background());
+    buf.append(background.begin(), background.end());
+  }
+  internal::vformat_to(buf, format_str, args);
+  if (has_style) internal::reset_color<Char>(buf);
+}
+}  // namespace internal
+
+template <typename S, typename Char = char_t<S>>
+void vprint(std::FILE* f, const text_style& ts, const S& format,
+            basic_format_args<buffer_context<Char>> args) {
+  basic_memory_buffer<Char> buf;
+  internal::vformat_to(buf, ts, to_string_view(format), args);
+  buf.push_back(Char(0));
+  internal::fputs(buf.data(), f);
+}
+
+/**
+  Formats a string and prints it to the specified file stream using ANSI
+  escape sequences to specify text formatting.
+  Example:
+    fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+               "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_string<S>::value)>
+void print(std::FILE* f, const text_style& ts, const S& format_str,
+           const Args&... args) {
+  internal::check_format_string<Args...>(format_str);
+  using context = buffer_context<char_t<S>>;
+  format_arg_store<context, Args...> as{args...};
+  vprint(f, ts, format_str, basic_format_args<context>(as));
+}
+
+/**
+  Formats a string and prints it to stdout using ANSI escape sequences to
+  specify text formatting.
+  Example:
+    fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+               "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_string<S>::value)>
+void print(const text_style& ts, const S& format_str, const Args&... args) {
+  return print(stdout, ts, format_str, args...);
+}
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vformat(
+    const text_style& ts, const S& format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buf;
+  internal::vformat_to(buf, ts, to_string_view(format_str), args);
+  return fmt::to_string(buf);
+}
+
+/**
+  \rst
+  Formats arguments and returns the result as a string using ANSI
+  escape sequences to specify text formatting.
+
+  **Example**::
+
+    #include <fmt/color.h>
+    std::string message = fmt::format(fmt::emphasis::bold | fg(fmt::color::red),
+                                      "The answer is {}", 42);
+  \endrst
+*/
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline std::basic_string<Char> format(const text_style& ts, const S& format_str,
+                                      const Args&... args) {
+  return vformat(ts, to_string_view(format_str),
+                 internal::make_args_checked<Args...>(format_str, args...));
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_COLOR_H_

dep/fmt/include/fmt/compile.h

@@ -0,0 +1,595 @@
+// Formatting library for C++ - experimental format string compilation
+//
+// Copyright (c) 2012 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COMPILE_H_
+#define FMT_COMPILE_H_
+
+#include <vector>
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+// Part of a compiled format string. It can be either literal text or a
+// replacement field.
+template <typename Char> struct format_part {
+  enum class kind { arg_index, arg_name, text, replacement };
+
+  struct replacement {
+    arg_ref<Char> arg_id;
+    dynamic_format_specs<Char> specs;
+  };
+
+  kind part_kind;
+  union value {
+    int arg_index;
+    basic_string_view<Char> str;
+    replacement repl;
+
+    FMT_CONSTEXPR value(int index = 0) : arg_index(index) {}
+    FMT_CONSTEXPR value(basic_string_view<Char> s) : str(s) {}
+    FMT_CONSTEXPR value(replacement r) : repl(r) {}
+  } val;
+  // Position past the end of the argument id.
+  const Char* arg_id_end = nullptr;
+
+  FMT_CONSTEXPR format_part(kind k = kind::arg_index, value v = {})
+      : part_kind(k), val(v) {}
+
+  static FMT_CONSTEXPR format_part make_arg_index(int index) {
+    return format_part(kind::arg_index, index);
+  }
+  static FMT_CONSTEXPR format_part make_arg_name(basic_string_view<Char> name) {
+    return format_part(kind::arg_name, name);
+  }
+  static FMT_CONSTEXPR format_part make_text(basic_string_view<Char> text) {
+    return format_part(kind::text, text);
+  }
+  static FMT_CONSTEXPR format_part make_replacement(replacement repl) {
+    return format_part(kind::replacement, repl);
+  }
+};
+
+template <typename Char> struct part_counter {
+  unsigned num_parts = 0;
+
+  FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
+    if (begin != end) ++num_parts;
+  }
+
+  FMT_CONSTEXPR void on_arg_id() { ++num_parts; }
+  FMT_CONSTEXPR void on_arg_id(int) { ++num_parts; }
+  FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) { ++num_parts; }
+
+  FMT_CONSTEXPR void on_replacement_field(const Char*) {}
+
+  FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
+                                            const Char* end) {
+    // Find the matching brace.
+    unsigned brace_counter = 0;
+    for (; begin != end; ++begin) {
+      if (*begin == '{') {
+        ++brace_counter;
+      } else if (*begin == '}') {
+        if (brace_counter == 0u) break;
+        --brace_counter;
+      }
+    }
+    return begin;
+  }
+
+  FMT_CONSTEXPR void on_error(const char*) {}
+};
+
+// Counts the number of parts in a format string.
+template <typename Char>
+FMT_CONSTEXPR unsigned count_parts(basic_string_view<Char> format_str) {
+  part_counter<Char> counter;
+  parse_format_string<true>(format_str, counter);
+  return counter.num_parts;
+}
+
+template <typename Char, typename PartHandler>
+class format_string_compiler : public error_handler {
+ private:
+  using part = format_part<Char>;
+
+  PartHandler handler_;
+  part part_;
+  basic_string_view<Char> format_str_;
+  basic_format_parse_context<Char> parse_context_;
+
+ public:
+  FMT_CONSTEXPR format_string_compiler(basic_string_view<Char> format_str,
+                                       PartHandler handler)
+      : handler_(handler),
+        format_str_(format_str),
+        parse_context_(format_str) {}
+
+  FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
+    if (begin != end)
+      handler_(part::make_text({begin, to_unsigned(end - begin)}));
+  }
+
+  FMT_CONSTEXPR void on_arg_id() {
+    part_ = part::make_arg_index(parse_context_.next_arg_id());
+  }
+
+  FMT_CONSTEXPR void on_arg_id(int id) {
+    parse_context_.check_arg_id(id);
+    part_ = part::make_arg_index(id);
+  }
+
+  FMT_CONSTEXPR void on_arg_id(basic_string_view<Char> id) {
+    part_ = part::make_arg_name(id);
+  }
+
+  FMT_CONSTEXPR void on_replacement_field(const Char* ptr) {
+    part_.arg_id_end = ptr;
+    handler_(part_);
+  }
+
+  FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
+                                            const Char* end) {
+    auto repl = typename part::replacement();
+    dynamic_specs_handler<basic_format_parse_context<Char>> handler(
+        repl.specs, parse_context_);
+    auto it = parse_format_specs(begin, end, handler);
+    if (*it != '}') on_error("missing '}' in format string");
+    repl.arg_id = part_.part_kind == part::kind::arg_index
+                      ? arg_ref<Char>(part_.val.arg_index)
+                      : arg_ref<Char>(part_.val.str);
+    auto part = part::make_replacement(repl);
+    part.arg_id_end = begin;
+    handler_(part);
+    return it;
+  }
+};
+
+// Compiles a format string and invokes handler(part) for each parsed part.
+template <bool IS_CONSTEXPR, typename Char, typename PartHandler>
+FMT_CONSTEXPR void compile_format_string(basic_string_view<Char> format_str,
+                                         PartHandler handler) {
+  parse_format_string<IS_CONSTEXPR>(
+      format_str,
+      format_string_compiler<Char, PartHandler>(format_str, handler));
+}
+
+template <typename Range, typename Context, typename Id>
+void format_arg(
+    basic_format_parse_context<typename Range::value_type>& parse_ctx,
+    Context& ctx, Id arg_id) {
+  ctx.advance_to(
+      visit_format_arg(arg_formatter<Range>(ctx, &parse_ctx), ctx.arg(arg_id)));
+}
+
+// vformat_to is defined in a subnamespace to prevent ADL.
+namespace cf {
+template <typename Context, typename Range, typename CompiledFormat>
+auto vformat_to(Range out, CompiledFormat& cf, basic_format_args<Context> args)
+    -> typename Context::iterator {
+  using char_type = typename Context::char_type;
+  basic_format_parse_context<char_type> parse_ctx(
+      to_string_view(cf.format_str_));
+  Context ctx(out.begin(), args);
+
+  const auto& parts = cf.parts();
+  for (auto part_it = std::begin(parts); part_it != std::end(parts);
+       ++part_it) {
+    const auto& part = *part_it;
+    const auto& value = part.val;
+
+    using format_part_t = format_part<char_type>;
+    switch (part.part_kind) {
+    case format_part_t::kind::text: {
+      const auto text = value.str;
+      auto output = ctx.out();
+      auto&& it = reserve(output, text.size());
+      it = std::copy_n(text.begin(), text.size(), it);
+      ctx.advance_to(output);
+      break;
+    }
+
+    case format_part_t::kind::arg_index:
+      advance_to(parse_ctx, part.arg_id_end);
+      internal::format_arg<Range>(parse_ctx, ctx, value.arg_index);
+      break;
+
+    case format_part_t::kind::arg_name:
+      advance_to(parse_ctx, part.arg_id_end);
+      internal::format_arg<Range>(parse_ctx, ctx, value.str);
+      break;
+
+    case format_part_t::kind::replacement: {
+      const auto& arg_id_value = value.repl.arg_id.val;
+      const auto arg = value.repl.arg_id.kind == arg_id_kind::index
+                           ? ctx.arg(arg_id_value.index)
+                           : ctx.arg(arg_id_value.name);
+
+      auto specs = value.repl.specs;
+
+      handle_dynamic_spec<width_checker>(specs.width, specs.width_ref, ctx);
+      handle_dynamic_spec<precision_checker>(specs.precision,
+                                             specs.precision_ref, ctx);
+
+      error_handler h;
+      numeric_specs_checker<error_handler> checker(h, arg.type());
+      if (specs.align == align::numeric) checker.require_numeric_argument();
+      if (specs.sign != sign::none) checker.check_sign();
+      if (specs.alt) checker.require_numeric_argument();
+      if (specs.precision >= 0) checker.check_precision();
+
+      advance_to(parse_ctx, part.arg_id_end);
+      ctx.advance_to(
+          visit_format_arg(arg_formatter<Range>(ctx, nullptr, &specs), arg));
+      break;
+    }
+    }
+  }
+  return ctx.out();
+}
+}  // namespace cf
+
+struct basic_compiled_format {};
+
+template <typename S, typename = void>
+struct compiled_format_base : basic_compiled_format {
+  using char_type = char_t<S>;
+  using parts_container = std::vector<internal::format_part<char_type>>;
+
+  parts_container compiled_parts;
+
+  explicit compiled_format_base(basic_string_view<char_type> format_str) {
+    compile_format_string<false>(format_str,
+                                 [this](const format_part<char_type>& part) {
+                                   compiled_parts.push_back(part);
+                                 });
+  }
+
+  const parts_container& parts() const { return compiled_parts; }
+};
+
+template <typename Char, unsigned N> struct format_part_array {
+  format_part<Char> data[N] = {};
+  FMT_CONSTEXPR format_part_array() = default;
+};
+
+template <typename Char, unsigned N>
+FMT_CONSTEXPR format_part_array<Char, N> compile_to_parts(
+    basic_string_view<Char> format_str) {
+  format_part_array<Char, N> parts;
+  unsigned counter = 0;
+  // This is not a lambda for compatibility with older compilers.
+  struct {
+    format_part<Char>* parts;
+    unsigned* counter;
+    FMT_CONSTEXPR void operator()(const format_part<Char>& part) {
+      parts[(*counter)++] = part;
+    }
+  } collector{parts.data, &counter};
+  compile_format_string<true>(format_str, collector);
+  if (counter < N) {
+    parts.data[counter] =
+        format_part<Char>::make_text(basic_string_view<Char>());
+  }
+  return parts;
+}
+
+template <typename T> constexpr const T& constexpr_max(const T& a, const T& b) {
+  return (a < b) ? b : a;
+}
+
+template <typename S>
+struct compiled_format_base<S, enable_if_t<is_compile_string<S>::value>>
+    : basic_compiled_format {
+  using char_type = char_t<S>;
+
+  FMT_CONSTEXPR explicit compiled_format_base(basic_string_view<char_type>) {}
+
+// Workaround for old compilers. Format string compilation will not be
+// performed there anyway.
+#if FMT_USE_CONSTEXPR
+  static FMT_CONSTEXPR_DECL const unsigned num_format_parts =
+      constexpr_max(count_parts(to_string_view(S())), 1u);
+#else
+  static const unsigned num_format_parts = 1;
+#endif
+
+  using parts_container = format_part<char_type>[num_format_parts];
+
+  const parts_container& parts() const {
+    static FMT_CONSTEXPR_DECL const auto compiled_parts =
+        compile_to_parts<char_type, num_format_parts>(
+            internal::to_string_view(S()));
+    return compiled_parts.data;
+  }
+};
+
+template <typename S, typename... Args>
+class compiled_format : private compiled_format_base<S> {
+ public:
+  using typename compiled_format_base<S>::char_type;
+
+ private:
+  basic_string_view<char_type> format_str_;
+
+  template <typename Context, typename Range, typename CompiledFormat>
+  friend auto cf::vformat_to(Range out, CompiledFormat& cf,
+                             basic_format_args<Context> args) ->
+      typename Context::iterator;
+
+ public:
+  compiled_format() = delete;
+  explicit constexpr compiled_format(basic_string_view<char_type> format_str)
+      : compiled_format_base<S>(format_str), format_str_(format_str) {}
+};
+
+#ifdef __cpp_if_constexpr
+template <typename... Args> struct type_list {};
+
+// Returns a reference to the argument at index N from [first, rest...].
+template <int N, typename T, typename... Args>
+constexpr const auto& get(const T& first, const Args&... rest) {
+  static_assert(N < 1 + sizeof...(Args), "index is out of bounds");
+  if constexpr (N == 0)
+    return first;
+  else
+    return get<N - 1>(rest...);
+}
+
+template <int N, typename> struct get_type_impl;
+
+template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> {
+  using type = remove_cvref_t<decltype(get<N>(std::declval<Args>()...))>;
+};
+
+template <int N, typename T>
+using get_type = typename get_type_impl<N, T>::type;
+
+template <typename T> struct is_compiled_format : std::false_type {};
+
+template <typename Char> struct text {
+  basic_string_view<Char> data;
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  OutputIt format(OutputIt out, const Args&...) const {
+    // TODO: reserve
+    return copy_str<Char>(data.begin(), data.end(), out);
+  }
+};
+
+template <typename Char>
+struct is_compiled_format<text<Char>> : std::true_type {};
+
+template <typename Char>
+constexpr text<Char> make_text(basic_string_view<Char> s, size_t pos,
+                               size_t size) {
+  return {{&s[pos], size}};
+}
+
+template <typename Char, typename OutputIt, typename T,
+          std::enable_if_t<std::is_integral_v<T>, int> = 0>
+OutputIt format_default(OutputIt out, T value) {
+  // TODO: reserve
+  format_int fi(value);
+  return std::copy(fi.data(), fi.data() + fi.size(), out);
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, double value) {
+  writer w(out);
+  w.write(value);
+  return w.out();
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, Char value) {
+  *out++ = value;
+  return out;
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, const Char* value) {
+  auto length = std::char_traits<Char>::length(value);
+  return copy_str<Char>(value, value + length, out);
+}
+
+// A replacement field that refers to argument N.
+template <typename Char, typename T, int N> struct field {
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  OutputIt format(OutputIt out, const Args&... args) const {
+    // This ensures that the argument type is convertile to `const T&`.
+    const T& arg = get<N>(args...);
+    return format_default<Char>(out, arg);
+  }
+};
+
+template <typename Char, typename T, int N>
+struct is_compiled_format<field<Char, T, N>> : std::true_type {};
+
+template <typename L, typename R> struct concat {
+  L lhs;
+  R rhs;
+  using char_type = typename L::char_type;
+
+  template <typename OutputIt, typename... Args>
+  OutputIt format(OutputIt out, const Args&... args) const {
+    out = lhs.format(out, args...);
+    return rhs.format(out, args...);
+  }
+};
+
+template <typename L, typename R>
+struct is_compiled_format<concat<L, R>> : std::true_type {};
+
+template <typename L, typename R>
+constexpr concat<L, R> make_concat(L lhs, R rhs) {
+  return {lhs, rhs};
+}
+
+struct unknown_format {};
+
+template <typename Char>
+constexpr size_t parse_text(basic_string_view<Char> str, size_t pos) {
+  for (size_t size = str.size(); pos != size; ++pos) {
+    if (str[pos] == '{' || str[pos] == '}') break;
+  }
+  return pos;
+}
+
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S format_str);
+
+template <typename Args, size_t POS, int ID, typename T, typename S>
+constexpr auto parse_tail(T head, S format_str) {
+  if constexpr (POS != to_string_view(format_str).size()) {
+    constexpr auto tail = compile_format_string<Args, POS, ID>(format_str);
+    if constexpr (std::is_same<remove_cvref_t<decltype(tail)>,
+                               unknown_format>())
+      return tail;
+    else
+      return make_concat(head, tail);
+  } else {
+    return head;
+  }
+}
+
+// Compiles a non-empty format string and returns the compiled representation
+// or unknown_format() on unrecognized input.
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S format_str) {
+  using char_type = typename S::char_type;
+  constexpr basic_string_view<char_type> str = format_str;
+  if constexpr (str[POS] == '{') {
+    if (POS + 1 == str.size())
+      throw format_error("unmatched '{' in format string");
+    if constexpr (str[POS + 1] == '{') {
+      return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
+    } else if constexpr (str[POS + 1] == '}') {
+      using type = get_type<ID, Args>;
+      if constexpr (std::is_same<type, int>::value) {
+        return parse_tail<Args, POS + 2, ID + 1>(field<char_type, type, ID>(),
+                                                 format_str);
+      } else {
+        return unknown_format();
+      }
+    } else {
+      return unknown_format();
+    }
+  } else if constexpr (str[POS] == '}') {
+    if (POS + 1 == str.size())
+      throw format_error("unmatched '}' in format string");
+    return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
+  } else {
+    constexpr auto end = parse_text(str, POS + 1);
+    return parse_tail<Args, end, ID>(make_text(str, POS, end - POS),
+                                     format_str);
+  }
+}
+#endif  // __cpp_if_constexpr
+}  // namespace internal
+
+#if FMT_USE_CONSTEXPR
+#  ifdef __cpp_if_constexpr
+template <typename... Args, typename S,
+          FMT_ENABLE_IF(is_compile_string<S>::value)>
+constexpr auto compile(S format_str) {
+  constexpr basic_string_view<typename S::char_type> str = format_str;
+  if constexpr (str.size() == 0) {
+    return internal::make_text(str, 0, 0);
+  } else {
+    constexpr auto result =
+        internal::compile_format_string<internal::type_list<Args...>, 0, 0>(
+            format_str);
+    if constexpr (std::is_same<remove_cvref_t<decltype(result)>,
+                               internal::unknown_format>()) {
+      return internal::compiled_format<S, Args...>(to_string_view(format_str));
+    } else {
+      return result;
+    }
+  }
+}
+
+template <typename CompiledFormat, typename... Args,
+          typename Char = typename CompiledFormat::char_type,
+          FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
+std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
+  basic_memory_buffer<Char> buffer;
+  cf.format(std::back_inserter(buffer), args...);
+  return to_string(buffer);
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+          FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
+OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+                   const Args&... args) {
+  return cf.format(out, args...);
+}
+#  else
+template <typename... Args, typename S,
+          FMT_ENABLE_IF(is_compile_string<S>::value)>
+constexpr auto compile(S format_str) -> internal::compiled_format<S, Args...> {
+  return internal::compiled_format<S, Args...>(to_string_view(format_str));
+}
+#  endif  // __cpp_if_constexpr
+#endif    // FMT_USE_CONSTEXPR
+
+// Compiles the format string which must be a string literal.
+template <typename... Args, typename Char, size_t N>
+auto compile(const Char (&format_str)[N])
+    -> internal::compiled_format<const Char*, Args...> {
+  return internal::compiled_format<const Char*, Args...>(
+      basic_string_view<Char>(format_str, N - 1));
+}
+
+template <typename CompiledFormat, typename... Args,
+          typename Char = typename CompiledFormat::char_type,
+          FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
+                                        CompiledFormat>::value)>
+std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
+  basic_memory_buffer<Char> buffer;
+  using range = buffer_range<Char>;
+  using context = buffer_context<Char>;
+  internal::cf::vformat_to<context>(range(buffer), cf,
+                                    make_format_args<context>(args...));
+  return to_string(buffer);
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+          FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
+                                        CompiledFormat>::value)>
+OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+                   const Args&... args) {
+  using char_type = typename CompiledFormat::char_type;
+  using range = internal::output_range<OutputIt, char_type>;
+  using context = format_context_t<OutputIt, char_type>;
+  return internal::cf::vformat_to<context>(range(out), cf,
+                                           make_format_args<context>(args...));
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)>
+format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n,
+                                         const CompiledFormat& cf,
+                                         const Args&... args) {
+  auto it =
+      format_to(internal::truncating_iterator<OutputIt>(out, n), cf, args...);
+  return {it.base(), it.count()};
+}
+
+template <typename CompiledFormat, typename... Args>
+std::size_t formatted_size(const CompiledFormat& cf, const Args&... args) {
+  return format_to(internal::counting_iterator(), cf, args...).count();
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_COMPILE_H_

dep/fmt/include/fmt/locale.h

@@ -0,0 +1,78 @@
+// Formatting library for C++ - std::locale support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_LOCALE_H_
+#define FMT_LOCALE_H_
+
+#include <locale>
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+namespace internal {
+template <typename Char>
+typename buffer_context<Char>::iterator vformat_to(
+    const std::locale& loc, buffer<Char>& buf,
+    basic_string_view<Char> format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  using range = buffer_range<Char>;
+  return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), args,
+                                          internal::locale_ref(loc));
+}
+
+template <typename Char>
+std::basic_string<Char> vformat(
+    const std::locale& loc, basic_string_view<Char> format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  internal::vformat_to(loc, buffer, format_str, args);
+  return fmt::to_string(buffer);
+}
+}  // namespace internal
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vformat(
+    const std::locale& loc, const S& format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  return internal::vformat(loc, to_string_view(format_str), args);
+}
+
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline std::basic_string<Char> format(const std::locale& loc,
+                                      const S& format_str, Args&&... args) {
+  return internal::vformat(
+      loc, to_string_view(format_str),
+      internal::make_args_checked<Args...>(format_str, args...));
+}
+
+template <typename S, typename OutputIt, typename... Args,
+          typename Char = enable_if_t<
+              internal::is_output_iterator<OutputIt>::value, char_t<S>>>
+inline OutputIt vformat_to(
+    OutputIt out, const std::locale& loc, const S& format_str,
+    format_args_t<type_identity_t<OutputIt>, Char> args) {
+  using range = internal::output_range<OutputIt, Char>;
+  return vformat_to<arg_formatter<range>>(
+      range(out), to_string_view(format_str), args, internal::locale_ref(loc));
+}
+
+template <typename OutputIt, typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value&&
+                            internal::is_string<S>::value)>
+inline OutputIt format_to(OutputIt out, const std::locale& loc,
+                          const S& format_str, Args&&... args) {
+  internal::check_format_string<Args...>(format_str);
+  using context = format_context_t<OutputIt, char_t<S>>;
+  format_arg_store<context, Args...> as{args...};
+  return vformat_to(out, loc, to_string_view(format_str),
+                    basic_format_args<context>(as));
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_LOCALE_H_

dep/fmt/include/fmt/os.h

@@ -0,0 +1,392 @@
+// Formatting library for C++ - optional OS-specific functionality
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_OS_H_
+#define FMT_OS_H_
+
+#if defined(__MINGW32__) || defined(__CYGWIN__)
+// Workaround MinGW bug https://sourceforge.net/p/mingw/bugs/2024/.
+#  undef __STRICT_ANSI__
+#endif
+
+#include <cerrno>
+#include <clocale>  // for locale_t
+#include <cstddef>
+#include <cstdio>
+#include <cstdlib>  // for strtod_l
+
+#if defined __APPLE__ || defined(__FreeBSD__)
+#  include <xlocale.h>  // for LC_NUMERIC_MASK on OS X
+#endif
+
+#include "format.h"
+
+// UWP doesn't provide _pipe.
+#if FMT_HAS_INCLUDE("winapifamily.h")
+#  include <winapifamily.h>
+#endif
+#if FMT_HAS_INCLUDE("fcntl.h") && \
+    (!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+#  include <fcntl.h>  // for O_RDONLY
+#  define FMT_USE_FCNTL 1
+#else
+#  define FMT_USE_FCNTL 0
+#endif
+
+#ifndef FMT_POSIX
+#  if defined(_WIN32) && !defined(__MINGW32__)
+// Fix warnings about deprecated symbols.
+#    define FMT_POSIX(call) _##call
+#  else
+#    define FMT_POSIX(call) call
+#  endif
+#endif
+
+// Calls to system functions are wrapped in FMT_SYSTEM for testability.
+#ifdef FMT_SYSTEM
+#  define FMT_POSIX_CALL(call) FMT_SYSTEM(call)
+#else
+#  define FMT_SYSTEM(call) call
+#  ifdef _WIN32
+// Fix warnings about deprecated symbols.
+#    define FMT_POSIX_CALL(call) ::_##call
+#  else
+#    define FMT_POSIX_CALL(call) ::call
+#  endif
+#endif
+
+// Retries the expression while it evaluates to error_result and errno
+// equals to EINTR.
+#ifndef _WIN32
+#  define FMT_RETRY_VAL(result, expression, error_result) \
+    do {                                                  \
+      (result) = (expression);                            \
+    } while ((result) == (error_result) && errno == EINTR)
+#else
+#  define FMT_RETRY_VAL(result, expression, error_result) result = (expression)
+#endif
+
+#define FMT_RETRY(result, expression) FMT_RETRY_VAL(result, expression, -1)
+
+FMT_BEGIN_NAMESPACE
+
+/**
+  \rst
+  A reference to a null-terminated string. It can be constructed from a C
+  string or ``std::string``.
+
+  You can use one of the following type aliases for common character types:
+
+  +---------------+-----------------------------+
+  | Type          | Definition                  |
+  +===============+=============================+
+  | cstring_view  | basic_cstring_view<char>    |
+  +---------------+-----------------------------+
+  | wcstring_view | basic_cstring_view<wchar_t> |
+  +---------------+-----------------------------+
+
+  This class is most useful as a parameter type to allow passing
+  different types of strings to a function, for example::
+
+    template <typename... Args>
+    std::string format(cstring_view format_str, const Args & ... args);
+
+    format("{}", 42);
+    format(std::string("{}"), 42);
+  \endrst
+ */
+template <typename Char> class basic_cstring_view {
+ private:
+  const Char* data_;
+
+ public:
+  /** Constructs a string reference object from a C string. */
+  basic_cstring_view(const Char* s) : data_(s) {}
+
+  /**
+    \rst
+    Constructs a string reference from an ``std::string`` object.
+    \endrst
+   */
+  basic_cstring_view(const std::basic_string<Char>& s) : data_(s.c_str()) {}
+
+  /** Returns the pointer to a C string. */
+  const Char* c_str() const { return data_; }
+};
+
+using cstring_view = basic_cstring_view<char>;
+using wcstring_view = basic_cstring_view<wchar_t>;
+
+// An error code.
+class error_code {
+ private:
+  int value_;
+
+ public:
+  explicit error_code(int value = 0) FMT_NOEXCEPT : value_(value) {}
+
+  int get() const FMT_NOEXCEPT { return value_; }
+};
+
+#ifdef _WIN32
+namespace internal {
+// A converter from UTF-16 to UTF-8.
+// It is only provided for Windows since other systems support UTF-8 natively.
+class utf16_to_utf8 {
+ private:
+  memory_buffer buffer_;
+
+ public:
+  utf16_to_utf8() {}
+  FMT_API explicit utf16_to_utf8(wstring_view s);
+  operator string_view() const { return string_view(&buffer_[0], size()); }
+  size_t size() const { return buffer_.size() - 1; }
+  const char* c_str() const { return &buffer_[0]; }
+  std::string str() const { return std::string(&buffer_[0], size()); }
+
+  // Performs conversion returning a system error code instead of
+  // throwing exception on conversion error. This method may still throw
+  // in case of memory allocation error.
+  FMT_API int convert(wstring_view s);
+};
+
+FMT_API void format_windows_error(buffer<char>& out, int error_code,
+                                  string_view message) FMT_NOEXCEPT;
+}  // namespace internal
+
+/** A Windows error. */
+class windows_error : public system_error {
+ private:
+  FMT_API void init(int error_code, string_view format_str, format_args args);
+
+ public:
+  /**
+   \rst
+   Constructs a :class:`fmt::windows_error` object with the description
+   of the form
+
+   .. parsed-literal::
+     *<message>*: *<system-message>*
+
+   where *<message>* is the formatted message and *<system-message>* is the
+   system message corresponding to the error code.
+   *error_code* is a Windows error code as given by ``GetLastError``.
+   If *error_code* is not a valid error code such as -1, the system message
+   will look like "error -1".
+
+   **Example**::
+
+     // This throws a windows_error with the description
+     //   cannot open file 'madeup': The system cannot find the file specified.
+     // or similar (system message may vary).
+     const char *filename = "madeup";
+     LPOFSTRUCT of = LPOFSTRUCT();
+     HFILE file = OpenFile(filename, &of, OF_READ);
+     if (file == HFILE_ERROR) {
+       throw fmt::windows_error(GetLastError(),
+                                "cannot open file '{}'", filename);
+     }
+   \endrst
+  */
+  template <typename... Args>
+  windows_error(int error_code, string_view message, const Args&... args) {
+    init(error_code, message, make_format_args(args...));
+  }
+};
+
+// Reports a Windows error without throwing an exception.
+// Can be used to report errors from destructors.
+FMT_API void report_windows_error(int error_code,
+                                  string_view message) FMT_NOEXCEPT;
+#endif  // _WIN32
+
+// A buffered file.
+class buffered_file {
+ private:
+  FILE* file_;
+
+  friend class file;
+
+  explicit buffered_file(FILE* f) : file_(f) {}
+
+ public:
+  buffered_file(const buffered_file&) = delete;
+  void operator=(const buffered_file&) = delete;
+
+  // Constructs a buffered_file object which doesn't represent any file.
+  buffered_file() FMT_NOEXCEPT : file_(nullptr) {}
+
+  // Destroys the object closing the file it represents if any.
+  FMT_API ~buffered_file() FMT_NOEXCEPT;
+
+ public:
+  buffered_file(buffered_file&& other) FMT_NOEXCEPT : file_(other.file_) {
+    other.file_ = nullptr;
+  }
+
+  buffered_file& operator=(buffered_file&& other) {
+    close();
+    file_ = other.file_;
+    other.file_ = nullptr;
+    return *this;
+  }
+
+  // Opens a file.
+  FMT_API buffered_file(cstring_view filename, cstring_view mode);
+
+  // Closes the file.
+  FMT_API void close();
+
+  // Returns the pointer to a FILE object representing this file.
+  FILE* get() const FMT_NOEXCEPT { return file_; }
+
+  // We place parentheses around fileno to workaround a bug in some versions
+  // of MinGW that define fileno as a macro.
+  FMT_API int(fileno)() const;
+
+  void vprint(string_view format_str, format_args args) {
+    fmt::vprint(file_, format_str, args);
+  }
+
+  template <typename... Args>
+  inline void print(string_view format_str, const Args&... args) {
+    vprint(format_str, make_format_args(args...));
+  }
+};
+
+#if FMT_USE_FCNTL
+// A file. Closed file is represented by a file object with descriptor -1.
+// Methods that are not declared with FMT_NOEXCEPT may throw
+// fmt::system_error in case of failure. Note that some errors such as
+// closing the file multiple times will cause a crash on Windows rather
+// than an exception. You can get standard behavior by overriding the
+// invalid parameter handler with _set_invalid_parameter_handler.
+class file {
+ private:
+  int fd_;  // File descriptor.
+
+  // Constructs a file object with a given descriptor.
+  explicit file(int fd) : fd_(fd) {}
+
+ public:
+  // Possible values for the oflag argument to the constructor.
+  enum {
+    RDONLY = FMT_POSIX(O_RDONLY),  // Open for reading only.
+    WRONLY = FMT_POSIX(O_WRONLY),  // Open for writing only.
+    RDWR = FMT_POSIX(O_RDWR)       // Open for reading and writing.
+  };
+
+  // Constructs a file object which doesn't represent any file.
+  file() FMT_NOEXCEPT : fd_(-1) {}
+
+  // Opens a file and constructs a file object representing this file.
+  FMT_API file(cstring_view path, int oflag);
+
+ public:
+  file(const file&) = delete;
+  void operator=(const file&) = delete;
+
+  file(file&& other) FMT_NOEXCEPT : fd_(other.fd_) { other.fd_ = -1; }
+
+  file& operator=(file&& other) FMT_NOEXCEPT {
+    close();
+    fd_ = other.fd_;
+    other.fd_ = -1;
+    return *this;
+  }
+
+  // Destroys the object closing the file it represents if any.
+  FMT_API ~file() FMT_NOEXCEPT;
+
+  // Returns the file descriptor.
+  int descriptor() const FMT_NOEXCEPT { return fd_; }
+
+  // Closes the file.
+  FMT_API void close();
+
+  // Returns the file size. The size has signed type for consistency with
+  // stat::st_size.
+  FMT_API long long size() const;
+
+  // Attempts to read count bytes from the file into the specified buffer.
+  FMT_API std::size_t read(void* buffer, std::size_t count);
+
+  // Attempts to write count bytes from the specified buffer to the file.
+  FMT_API std::size_t write(const void* buffer, std::size_t count);
+
+  // Duplicates a file descriptor with the dup function and returns
+  // the duplicate as a file object.
+  FMT_API static file dup(int fd);
+
+  // Makes fd be the copy of this file descriptor, closing fd first if
+  // necessary.
+  FMT_API void dup2(int fd);
+
+  // Makes fd be the copy of this file descriptor, closing fd first if
+  // necessary.
+  FMT_API void dup2(int fd, error_code& ec) FMT_NOEXCEPT;
+
+  // Creates a pipe setting up read_end and write_end file objects for reading
+  // and writing respectively.
+  FMT_API static void pipe(file& read_end, file& write_end);
+
+  // Creates a buffered_file object associated with this file and detaches
+  // this file object from the file.
+  FMT_API buffered_file fdopen(const char* mode);
+};
+
+// Returns the memory page size.
+long getpagesize();
+#endif  // FMT_USE_FCNTL
+
+#ifdef FMT_LOCALE
+// A "C" numeric locale.
+class locale {
+ private:
+#  ifdef _WIN32
+  using locale_t = _locale_t;
+
+  static void freelocale(locale_t loc) { _free_locale(loc); }
+
+  static double strtod_l(const char* nptr, char** endptr, _locale_t loc) {
+    return _strtod_l(nptr, endptr, loc);
+  }
+#  endif
+
+  locale_t locale_;
+
+ public:
+  using type = locale_t;
+  locale(const locale&) = delete;
+  void operator=(const locale&) = delete;
+
+  locale() {
+#  ifndef _WIN32
+    locale_ = FMT_SYSTEM(newlocale(LC_NUMERIC_MASK, "C", nullptr));
+#  else
+    locale_ = _create_locale(LC_NUMERIC, "C");
+#  endif
+    if (!locale_) FMT_THROW(system_error(errno, "cannot create locale"));
+  }
+  ~locale() { freelocale(locale_); }
+
+  type get() const { return locale_; }
+
+  // Converts string to floating-point number and advances str past the end
+  // of the parsed input.
+  double strtod(const char*& str) const {
+    char* end = nullptr;
+    double result = strtod_l(str, &end, locale_);
+    str = end;
+    return result;
+  }
+};
+using Locale FMT_DEPRECATED_ALIAS = locale;
+#endif  // FMT_LOCALE
+FMT_END_NAMESPACE
+
+#endif  // FMT_OS_H_

dep/fmt/include/fmt/ostream.h

@@ -0,0 +1,143 @@
+// Formatting library for C++ - std::ostream support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_OSTREAM_H_
+#define FMT_OSTREAM_H_
+
+#include <ostream>
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+template <class Char> class formatbuf : public std::basic_streambuf<Char> {
+ private:
+  using int_type = typename std::basic_streambuf<Char>::int_type;
+  using traits_type = typename std::basic_streambuf<Char>::traits_type;
+
+  buffer<Char>& buffer_;
+
+ public:
+  formatbuf(buffer<Char>& buf) : buffer_(buf) {}
+
+ protected:
+  // The put-area is actually always empty. This makes the implementation
+  // simpler and has the advantage that the streambuf and the buffer are always
+  // in sync and sputc never writes into uninitialized memory. The obvious
+  // disadvantage is that each call to sputc always results in a (virtual) call
+  // to overflow. There is no disadvantage here for sputn since this always
+  // results in a call to xsputn.
+
+  int_type overflow(int_type ch = traits_type::eof()) FMT_OVERRIDE {
+    if (!traits_type::eq_int_type(ch, traits_type::eof()))
+      buffer_.push_back(static_cast<Char>(ch));
+    return ch;
+  }
+
+  std::streamsize xsputn(const Char* s, std::streamsize count) FMT_OVERRIDE {
+    buffer_.append(s, s + count);
+    return count;
+  }
+};
+
+template <typename Char> struct test_stream : std::basic_ostream<Char> {
+ private:
+  // Hide all operator<< from std::basic_ostream<Char>.
+  void_t<> operator<<(null<>);
+  void_t<> operator<<(const Char*);
+
+  template <typename T, FMT_ENABLE_IF(std::is_convertible<T, int>::value &&
+                                      !std::is_enum<T>::value)>
+  void_t<> operator<<(T);
+};
+
+// Checks if T has a user-defined operator<< (e.g. not a member of
+// std::ostream).
+template <typename T, typename Char> class is_streamable {
+ private:
+  template <typename U>
+  static bool_constant<!std::is_same<decltype(std::declval<test_stream<Char>&>()
+                                              << std::declval<U>()),
+                                     void_t<>>::value>
+  test(int);
+
+  template <typename> static std::false_type test(...);
+
+  using result = decltype(test<T>(0));
+
+ public:
+  static const bool value = result::value;
+};
+
+// Write the content of buf to os.
+template <typename Char>
+void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
+  const Char* buf_data = buf.data();
+  using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
+  unsigned_streamsize size = buf.size();
+  unsigned_streamsize max_size = to_unsigned(max_value<std::streamsize>());
+  do {
+    unsigned_streamsize n = size <= max_size ? size : max_size;
+    os.write(buf_data, static_cast<std::streamsize>(n));
+    buf_data += n;
+    size -= n;
+  } while (size != 0);
+}
+
+template <typename Char, typename T>
+void format_value(buffer<Char>& buf, const T& value,
+                  locale_ref loc = locale_ref()) {
+  formatbuf<Char> format_buf(buf);
+  std::basic_ostream<Char> output(&format_buf);
+  #if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+  if (loc) output.imbue(loc.get<std::locale>());
+  #endif
+  output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
+  output << value;
+  buf.resize(buf.size());
+}
+
+// Formats an object of type T that has an overloaded ostream operator<<.
+template <typename T, typename Char>
+struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>>
+    : formatter<basic_string_view<Char>, Char> {
+  template <typename Context>
+  auto format(const T& value, Context& ctx) -> decltype(ctx.out()) {
+    basic_memory_buffer<Char> buffer;
+    format_value(buffer, value, ctx.locale());
+    basic_string_view<Char> str(buffer.data(), buffer.size());
+    return formatter<basic_string_view<Char>, Char>::format(str, ctx);
+  }
+};
+}  // namespace internal
+
+template <typename Char>
+void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
+            basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  internal::vformat_to(buffer, format_str, args);
+  internal::write(os, buffer);
+}
+
+/**
+  \rst
+  Prints formatted data to the stream *os*.
+
+  **Example**::
+
+    fmt::print(cerr, "Don't {}!", "panic");
+  \endrst
+ */
+template <typename S, typename... Args,
+          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+void print(std::basic_ostream<Char>& os, const S& format_str, Args&&... args) {
+  vprint(os, to_string_view(format_str),
+         internal::make_args_checked<Args...>(format_str, args...));
+}
+FMT_END_NAMESPACE
+
+#endif  // FMT_OSTREAM_H_

dep/fmt/include/fmt/posix.h

@@ -0,0 +1,2 @@
+#include "os.h"
+#warning "fmt/posix.h is deprecated; use fmt/os.h instead"

dep/fmt/include/fmt/printf.h

@@ -0,0 +1,721 @@
+// Formatting library for C++ - legacy printf implementation
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_PRINTF_H_
+#define FMT_PRINTF_H_
+
+#include <algorithm>  // std::max
+#include <limits>     // std::numeric_limits
+
+#include "ostream.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+// Checks if a value fits in int - used to avoid warnings about comparing
+// signed and unsigned integers.
+template <bool IsSigned> struct int_checker {
+  template <typename T> static bool fits_in_int(T value) {
+    unsigned max = max_value<int>();
+    return value <= max;
+  }
+  static bool fits_in_int(bool) { return true; }
+};
+
+template <> struct int_checker<true> {
+  template <typename T> static bool fits_in_int(T value) {
+    return value >= (std::numeric_limits<int>::min)() &&
+           value <= max_value<int>();
+  }
+  static bool fits_in_int(int) { return true; }
+};
+
+class printf_precision_handler {
+ public:
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  int operator()(T value) {
+    if (!int_checker<std::numeric_limits<T>::is_signed>::fits_in_int(value))
+      FMT_THROW(format_error("number is too big"));
+    return (std::max)(static_cast<int>(value), 0);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  int operator()(T) {
+    FMT_THROW(format_error("precision is not integer"));
+    return 0;
+  }
+};
+
+// An argument visitor that returns true iff arg is a zero integer.
+class is_zero_int {
+ public:
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  bool operator()(T value) {
+    return value == 0;
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  bool operator()(T) {
+    return false;
+  }
+};
+
+template <typename T> struct make_unsigned_or_bool : std::make_unsigned<T> {};
+
+template <> struct make_unsigned_or_bool<bool> { using type = bool; };
+
+template <typename T, typename Context> class arg_converter {
+ private:
+  using char_type = typename Context::char_type;
+
+  basic_format_arg<Context>& arg_;
+  char_type type_;
+
+ public:
+  arg_converter(basic_format_arg<Context>& arg, char_type type)
+      : arg_(arg), type_(type) {}
+
+  void operator()(bool value) {
+    if (type_ != 's') operator()<bool>(value);
+  }
+
+  template <typename U, FMT_ENABLE_IF(std::is_integral<U>::value)>
+  void operator()(U value) {
+    bool is_signed = type_ == 'd' || type_ == 'i';
+    using target_type = conditional_t<std::is_same<T, void>::value, U, T>;
+    if (const_check(sizeof(target_type) <= sizeof(int))) {
+      // Extra casts are used to silence warnings.
+      if (is_signed) {
+        arg_ = internal::make_arg<Context>(
+            static_cast<int>(static_cast<target_type>(value)));
+      } else {
+        using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
+        arg_ = internal::make_arg<Context>(
+            static_cast<unsigned>(static_cast<unsigned_type>(value)));
+      }
+    } else {
+      if (is_signed) {
+        // glibc's printf doesn't sign extend arguments of smaller types:
+        //   std::printf("%lld", -42);  // prints "4294967254"
+        // but we don't have to do the same because it's a UB.
+        arg_ = internal::make_arg<Context>(static_cast<long long>(value));
+      } else {
+        arg_ = internal::make_arg<Context>(
+            static_cast<typename make_unsigned_or_bool<U>::type>(value));
+      }
+    }
+  }
+
+  template <typename U, FMT_ENABLE_IF(!std::is_integral<U>::value)>
+  void operator()(U) {}  // No conversion needed for non-integral types.
+};
+
+// Converts an integer argument to T for printf, if T is an integral type.
+// If T is void, the argument is converted to corresponding signed or unsigned
+// type depending on the type specifier: 'd' and 'i' - signed, other -
+// unsigned).
+template <typename T, typename Context, typename Char>
+void convert_arg(basic_format_arg<Context>& arg, Char type) {
+  visit_format_arg(arg_converter<T, Context>(arg, type), arg);
+}
+
+// Converts an integer argument to char for printf.
+template <typename Context> class char_converter {
+ private:
+  basic_format_arg<Context>& arg_;
+
+ public:
+  explicit char_converter(basic_format_arg<Context>& arg) : arg_(arg) {}
+
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  void operator()(T value) {
+    arg_ = internal::make_arg<Context>(
+        static_cast<typename Context::char_type>(value));
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  void operator()(T) {}  // No conversion needed for non-integral types.
+};
+
+// Checks if an argument is a valid printf width specifier and sets
+// left alignment if it is negative.
+template <typename Char> class printf_width_handler {
+ private:
+  using format_specs = basic_format_specs<Char>;
+
+  format_specs& specs_;
+
+ public:
+  explicit printf_width_handler(format_specs& specs) : specs_(specs) {}
+
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  unsigned operator()(T value) {
+    auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
+    if (internal::is_negative(value)) {
+      specs_.align = align::left;
+      width = 0 - width;
+    }
+    unsigned int_max = max_value<int>();
+    if (width > int_max) FMT_THROW(format_error("number is too big"));
+    return static_cast<unsigned>(width);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  unsigned operator()(T) {
+    FMT_THROW(format_error("width is not integer"));
+    return 0;
+  }
+};
+
+template <typename Char, typename Context>
+void printf(buffer<Char>& buf, basic_string_view<Char> format,
+            basic_format_args<Context> args) {
+  Context(std::back_inserter(buf), format, args).format();
+}
+
+template <typename OutputIt, typename Char, typename Context>
+internal::truncating_iterator<OutputIt> printf(
+    internal::truncating_iterator<OutputIt> it, basic_string_view<Char> format,
+    basic_format_args<Context> args) {
+  return Context(it, format, args).format();
+}
+}  // namespace internal
+
+using internal::printf;  // For printing into memory_buffer.
+
+template <typename Range> class printf_arg_formatter;
+
+template <typename OutputIt, typename Char> class basic_printf_context;
+
+/**
+  \rst
+  The ``printf`` argument formatter.
+  \endrst
+ */
+template <typename Range>
+class printf_arg_formatter : public internal::arg_formatter_base<Range> {
+ public:
+  using iterator = typename Range::iterator;
+
+ private:
+  using char_type = typename Range::value_type;
+  using base = internal::arg_formatter_base<Range>;
+  using context_type = basic_printf_context<iterator, char_type>;
+
+  context_type& context_;
+
+  void write_null_pointer(char) {
+    this->specs()->type = 0;
+    this->write("(nil)");
+  }
+
+  void write_null_pointer(wchar_t) {
+    this->specs()->type = 0;
+    this->write(L"(nil)");
+  }
+
+ public:
+  using format_specs = typename base::format_specs;
+
+  /**
+    \rst
+    Constructs an argument formatter object.
+    *buffer* is a reference to the output buffer and *specs* contains format
+    specifier information for standard argument types.
+    \endrst
+   */
+  printf_arg_formatter(iterator iter, format_specs& specs, context_type& ctx)
+      : base(Range(iter), &specs, internal::locale_ref()), context_(ctx) {}
+
+  template <typename T, FMT_ENABLE_IF(fmt::internal::is_integral<T>::value)>
+  iterator operator()(T value) {
+    // MSVC2013 fails to compile separate overloads for bool and char_type so
+    // use std::is_same instead.
+    if (std::is_same<T, bool>::value) {
+      format_specs& fmt_specs = *this->specs();
+      if (fmt_specs.type != 's') return base::operator()(value ? 1 : 0);
+      fmt_specs.type = 0;
+      this->write(value != 0);
+    } else if (std::is_same<T, char_type>::value) {
+      format_specs& fmt_specs = *this->specs();
+      if (fmt_specs.type && fmt_specs.type != 'c')
+        return (*this)(static_cast<int>(value));
+      fmt_specs.sign = sign::none;
+      fmt_specs.alt = false;
+      fmt_specs.align = align::right;
+      return base::operator()(value);
+    } else {
+      return base::operator()(value);
+    }
+    return this->out();
+  }
+
+  template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+  iterator operator()(T value) {
+    return base::operator()(value);
+  }
+
+  /** Formats a null-terminated C string. */
+  iterator operator()(const char* value) {
+    if (value)
+      base::operator()(value);
+    else if (this->specs()->type == 'p')
+      write_null_pointer(char_type());
+    else
+      this->write("(null)");
+    return this->out();
+  }
+
+  /** Formats a null-terminated wide C string. */
+  iterator operator()(const wchar_t* value) {
+    if (value)
+      base::operator()(value);
+    else if (this->specs()->type == 'p')
+      write_null_pointer(char_type());
+    else
+      this->write(L"(null)");
+    return this->out();
+  }
+
+  iterator operator()(basic_string_view<char_type> value) {
+    return base::operator()(value);
+  }
+
+  iterator operator()(monostate value) { return base::operator()(value); }
+
+  /** Formats a pointer. */
+  iterator operator()(const void* value) {
+    if (value) return base::operator()(value);
+    this->specs()->type = 0;
+    write_null_pointer(char_type());
+    return this->out();
+  }
+
+  /** Formats an argument of a custom (user-defined) type. */
+  iterator operator()(typename basic_format_arg<context_type>::handle handle) {
+    handle.format(context_.parse_context(), context_);
+    return this->out();
+  }
+};
+
+template <typename T> struct printf_formatter {
+  printf_formatter() = delete;
+
+  template <typename ParseContext>
+  auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const T& value, FormatContext& ctx) -> decltype(ctx.out()) {
+    internal::format_value(internal::get_container(ctx.out()), value);
+    return ctx.out();
+  }
+};
+
+/** This template formats data and writes the output to a writer. */
+template <typename OutputIt, typename Char> class basic_printf_context {
+ public:
+  /** The character type for the output. */
+  using char_type = Char;
+  using iterator = OutputIt;
+  using format_arg = basic_format_arg<basic_printf_context>;
+  template <typename T> using formatter_type = printf_formatter<T>;
+
+ private:
+  using format_specs = basic_format_specs<char_type>;
+
+  OutputIt out_;
+  basic_format_args<basic_printf_context> args_;
+  basic_format_parse_context<Char> parse_ctx_;
+
+  static void parse_flags(format_specs& specs, const Char*& it,
+                          const Char* end);
+
+  // Returns the argument with specified index or, if arg_index is -1, the next
+  // argument.
+  format_arg get_arg(int arg_index = -1);
+
+  // Parses argument index, flags and width and returns the argument index.
+  int parse_header(const Char*& it, const Char* end, format_specs& specs);
+
+ public:
+  /**
+   \rst
+   Constructs a ``printf_context`` object. References to the arguments and
+   the writer are stored in the context object so make sure they have
+   appropriate lifetimes.
+   \endrst
+   */
+  basic_printf_context(OutputIt out, basic_string_view<char_type> format_str,
+                       basic_format_args<basic_printf_context> args)
+      : out_(out), args_(args), parse_ctx_(format_str) {}
+
+  OutputIt out() { return out_; }
+  void advance_to(OutputIt it) { out_ = it; }
+
+  internal::locale_ref locale() { return {}; }
+
+  format_arg arg(int id) const { return args_.get(id); }
+
+  basic_format_parse_context<Char>& parse_context() { return parse_ctx_; }
+
+  FMT_CONSTEXPR void on_error(const char* message) {
+    parse_ctx_.on_error(message);
+  }
+
+  /** Formats stored arguments and writes the output to the range. */
+  template <typename ArgFormatter = printf_arg_formatter<buffer_range<Char>>>
+  OutputIt format();
+};
+
+template <typename OutputIt, typename Char>
+void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
+                                                       const Char*& it,
+                                                       const Char* end) {
+  for (; it != end; ++it) {
+    switch (*it) {
+    case '-':
+      specs.align = align::left;
+      break;
+    case '+':
+      specs.sign = sign::plus;
+      break;
+    case '0':
+      specs.fill[0] = '0';
+      break;
+    case ' ':
+      specs.sign = sign::space;
+      break;
+    case '#':
+      specs.alt = true;
+      break;
+    default:
+      return;
+    }
+  }
+}
+
+template <typename OutputIt, typename Char>
+typename basic_printf_context<OutputIt, Char>::format_arg
+basic_printf_context<OutputIt, Char>::get_arg(int arg_index) {
+  if (arg_index < 0)
+    arg_index = parse_ctx_.next_arg_id();
+  else
+    parse_ctx_.check_arg_id(--arg_index);
+  return internal::get_arg(*this, arg_index);
+}
+
+template <typename OutputIt, typename Char>
+int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it,
+                                                       const Char* end,
+                                                       format_specs& specs) {
+  int arg_index = -1;
+  char_type c = *it;
+  if (c >= '0' && c <= '9') {
+    // Parse an argument index (if followed by '$') or a width possibly
+    // preceded with '0' flag(s).
+    internal::error_handler eh;
+    int value = parse_nonnegative_int(it, end, eh);
+    if (it != end && *it == '$') {  // value is an argument index
+      ++it;
+      arg_index = value;
+    } else {
+      if (c == '0') specs.fill[0] = '0';
+      if (value != 0) {
+        // Nonzero value means that we parsed width and don't need to
+        // parse it or flags again, so return now.
+        specs.width = value;
+        return arg_index;
+      }
+    }
+  }
+  parse_flags(specs, it, end);
+  // Parse width.
+  if (it != end) {
+    if (*it >= '0' && *it <= '9') {
+      internal::error_handler eh;
+      specs.width = parse_nonnegative_int(it, end, eh);
+    } else if (*it == '*') {
+      ++it;
+      specs.width = static_cast<int>(visit_format_arg(
+          internal::printf_width_handler<char_type>(specs), get_arg()));
+    }
+  }
+  return arg_index;
+}
+
+template <typename OutputIt, typename Char>
+template <typename ArgFormatter>
+OutputIt basic_printf_context<OutputIt, Char>::format() {
+  auto out = this->out();
+  const Char* start = parse_ctx_.begin();
+  const Char* end = parse_ctx_.end();
+  auto it = start;
+  while (it != end) {
+    char_type c = *it++;
+    if (c != '%') continue;
+    if (it != end && *it == c) {
+      out = std::copy(start, it, out);
+      start = ++it;
+      continue;
+    }
+    out = std::copy(start, it - 1, out);
+
+    format_specs specs;
+    specs.align = align::right;
+
+    // Parse argument index, flags and width.
+    int arg_index = parse_header(it, end, specs);
+    if (arg_index == 0) on_error("argument index out of range");
+
+    // Parse precision.
+    if (it != end && *it == '.') {
+      ++it;
+      c = it != end ? *it : 0;
+      if ('0' <= c && c <= '9') {
+        internal::error_handler eh;
+        specs.precision = parse_nonnegative_int(it, end, eh);
+      } else if (c == '*') {
+        ++it;
+        specs.precision = static_cast<int>(
+            visit_format_arg(internal::printf_precision_handler(), get_arg()));
+      } else {
+        specs.precision = 0;
+      }
+    }
+
+    format_arg arg = get_arg(arg_index);
+    if (specs.alt && visit_format_arg(internal::is_zero_int(), arg))
+      specs.alt = false;
+    if (specs.fill[0] == '0') {
+      if (arg.is_arithmetic())
+        specs.align = align::numeric;
+      else
+        specs.fill[0] = ' ';  // Ignore '0' flag for non-numeric types.
+    }
+
+    // Parse length and convert the argument to the required type.
+    c = it != end ? *it++ : 0;
+    char_type t = it != end ? *it : 0;
+    using internal::convert_arg;
+    switch (c) {
+    case 'h':
+      if (t == 'h') {
+        ++it;
+        t = it != end ? *it : 0;
+        convert_arg<signed char>(arg, t);
+      } else {
+        convert_arg<short>(arg, t);
+      }
+      break;
+    case 'l':
+      if (t == 'l') {
+        ++it;
+        t = it != end ? *it : 0;
+        convert_arg<long long>(arg, t);
+      } else {
+        convert_arg<long>(arg, t);
+      }
+      break;
+    case 'j':
+      convert_arg<intmax_t>(arg, t);
+      break;
+    case 'z':
+      convert_arg<std::size_t>(arg, t);
+      break;
+    case 't':
+      convert_arg<std::ptrdiff_t>(arg, t);
+      break;
+    case 'L':
+      // printf produces garbage when 'L' is omitted for long double, no
+      // need to do the same.
+      break;
+    default:
+      --it;
+      convert_arg<void>(arg, c);
+    }
+
+    // Parse type.
+    if (it == end) FMT_THROW(format_error("invalid format string"));
+    specs.type = static_cast<char>(*it++);
+    if (arg.is_integral()) {
+      // Normalize type.
+      switch (specs.type) {
+      case 'i':
+      case 'u':
+        specs.type = 'd';
+        break;
+      case 'c':
+        visit_format_arg(internal::char_converter<basic_printf_context>(arg),
+                         arg);
+        break;
+      }
+    }
+
+    start = it;
+
+    // Format argument.
+    visit_format_arg(ArgFormatter(out, specs, *this), arg);
+  }
+  return std::copy(start, it, out);
+}
+
+template <typename Char>
+using basic_printf_context_t =
+    basic_printf_context<std::back_insert_iterator<internal::buffer<Char>>,
+                         Char>;
+
+using printf_context = basic_printf_context_t<char>;
+using wprintf_context = basic_printf_context_t<wchar_t>;
+
+using printf_args = basic_format_args<printf_context>;
+using wprintf_args = basic_format_args<wprintf_context>;
+
+/**
+  \rst
+  Constructs an `~fmt::format_arg_store` object that contains references to
+  arguments and can be implicitly converted to `~fmt::printf_args`.
+  \endrst
+ */
+template <typename... Args>
+inline format_arg_store<printf_context, Args...> make_printf_args(
+    const Args&... args) {
+  return {args...};
+}
+
+/**
+  \rst
+  Constructs an `~fmt::format_arg_store` object that contains references to
+  arguments and can be implicitly converted to `~fmt::wprintf_args`.
+  \endrst
+ */
+template <typename... Args>
+inline format_arg_store<wprintf_context, Args...> make_wprintf_args(
+    const Args&... args) {
+  return {args...};
+}
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vsprintf(
+    const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  printf(buffer, to_string_view(format), args);
+  return to_string(buffer);
+}
+
+/**
+  \rst
+  Formats arguments and returns the result as a string.
+
+  **Example**::
+
+    std::string message = fmt::sprintf("The answer is %d", 42);
+  \endrst
+*/
+template <typename S, typename... Args,
+          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+inline std::basic_string<Char> sprintf(const S& format, const Args&... args) {
+  using context = basic_printf_context_t<Char>;
+  return vsprintf(to_string_view(format), make_format_args<context>(args...));
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vfprintf(
+    std::FILE* f, const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  printf(buffer, to_string_view(format), args);
+  std::size_t size = buffer.size();
+  return std::fwrite(buffer.data(), sizeof(Char), size, f) < size
+             ? -1
+             : static_cast<int>(size);
+}
+
+/**
+  \rst
+  Prints formatted data to the file *f*.
+
+  **Example**::
+
+    fmt::fprintf(stderr, "Don't %s!", "panic");
+  \endrst
+ */
+template <typename S, typename... Args,
+          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+inline int fprintf(std::FILE* f, const S& format, const Args&... args) {
+  using context = basic_printf_context_t<Char>;
+  return vfprintf(f, to_string_view(format),
+                  make_format_args<context>(args...));
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vprintf(
+    const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  return vfprintf(stdout, to_string_view(format), args);
+}
+
+/**
+  \rst
+  Prints formatted data to ``stdout``.
+
+  **Example**::
+
+    fmt::printf("Elapsed time: %.2f seconds", 1.23);
+  \endrst
+ */
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_string<S>::value)>
+inline int printf(const S& format_str, const Args&... args) {
+  using context = basic_printf_context_t<char_t<S>>;
+  return vprintf(to_string_view(format_str),
+                 make_format_args<context>(args...));
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vfprintf(
+    std::basic_ostream<Char>& os, const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  printf(buffer, to_string_view(format), args);
+  internal::write(os, buffer);
+  return static_cast<int>(buffer.size());
+}
+
+/** Formats arguments and writes the output to the range. */
+template <typename ArgFormatter, typename Char,
+          typename Context =
+              basic_printf_context<typename ArgFormatter::iterator, Char>>
+typename ArgFormatter::iterator vprintf(
+    internal::buffer<Char>& out, basic_string_view<Char> format_str,
+    basic_format_args<type_identity_t<Context>> args) {
+  typename ArgFormatter::iterator iter(out);
+  Context(iter, format_str, args).template format<ArgFormatter>();
+  return iter;
+}
+
+/**
+  \rst
+  Prints formatted data to the stream *os*.
+
+  **Example**::
+
+    fmt::fprintf(cerr, "Don't %s!", "panic");
+  \endrst
+ */
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline int fprintf(std::basic_ostream<Char>& os, const S& format_str,
+                   const Args&... args) {
+  using context = basic_printf_context_t<Char>;
+  return vfprintf(os, to_string_view(format_str),
+                  make_format_args<context>(args...));
+}
+FMT_END_NAMESPACE
+
+#endif  // FMT_PRINTF_H_

dep/fmt/include/fmt/ranges.h

@@ -0,0 +1,387 @@
+// Formatting library for C++ - experimental range support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+//
+// Copyright (c) 2018 - present, Remotion (Igor Schulz)
+// All Rights Reserved
+// {fmt} support for ranges, containers and types tuple interface.
+
+#ifndef FMT_RANGES_H_
+#define FMT_RANGES_H_
+
+#include <initializer_list>
+#include <type_traits>
+
+#include "format.h"
+
+// output only up to N items from the range.
+#ifndef FMT_RANGE_OUTPUT_LENGTH_LIMIT
+#  define FMT_RANGE_OUTPUT_LENGTH_LIMIT 256
+#endif
+
+FMT_BEGIN_NAMESPACE
+
+template <typename Char> struct formatting_base {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+};
+
+template <typename Char, typename Enable = void>
+struct formatting_range : formatting_base<Char> {
+  static FMT_CONSTEXPR_DECL const std::size_t range_length_limit =
+      FMT_RANGE_OUTPUT_LENGTH_LIMIT;  // output only up to N items from the
+                                      // range.
+  Char prefix;
+  Char delimiter;
+  Char postfix;
+  formatting_range() : prefix('{'), delimiter(','), postfix('}') {}
+  static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
+  static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
+};
+
+template <typename Char, typename Enable = void>
+struct formatting_tuple : formatting_base<Char> {
+  Char prefix;
+  Char delimiter;
+  Char postfix;
+  formatting_tuple() : prefix('('), delimiter(','), postfix(')') {}
+  static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
+  static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
+};
+
+namespace internal {
+
+template <typename RangeT, typename OutputIterator>
+OutputIterator copy(const RangeT& range, OutputIterator out) {
+  for (auto it = range.begin(), end = range.end(); it != end; ++it)
+    *out++ = *it;
+  return out;
+}
+
+template <typename OutputIterator>
+OutputIterator copy(const char* str, OutputIterator out) {
+  while (*str) *out++ = *str++;
+  return out;
+}
+
+template <typename OutputIterator>
+OutputIterator copy(char ch, OutputIterator out) {
+  *out++ = ch;
+  return out;
+}
+
+/// Return true value if T has std::string interface, like std::string_view.
+template <typename T> class is_like_std_string {
+  template <typename U>
+  static auto check(U* p)
+      -> decltype((void)p->find('a'), p->length(), (void)p->data(), int());
+  template <typename> static void check(...);
+
+ public:
+  static FMT_CONSTEXPR_DECL const bool value =
+      is_string<T>::value || !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+template <typename Char>
+struct is_like_std_string<fmt::basic_string_view<Char>> : std::true_type {};
+
+template <typename... Ts> struct conditional_helper {};
+
+template <typename T, typename _ = void> struct is_range_ : std::false_type {};
+
+#if !FMT_MSC_VER || FMT_MSC_VER > 1800
+template <typename T>
+struct is_range_<
+    T, conditional_t<false,
+                     conditional_helper<decltype(std::declval<T>().begin()),
+                                        decltype(std::declval<T>().end())>,
+                     void>> : std::true_type {};
+#endif
+
+/// tuple_size and tuple_element check.
+template <typename T> class is_tuple_like_ {
+  template <typename U>
+  static auto check(U* p) -> decltype(std::tuple_size<U>::value, int());
+  template <typename> static void check(...);
+
+ public:
+  static FMT_CONSTEXPR_DECL const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+// Check for integer_sequence
+#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VER >= 1900
+template <typename T, T... N>
+using integer_sequence = std::integer_sequence<T, N...>;
+template <std::size_t... N> using index_sequence = std::index_sequence<N...>;
+template <std::size_t N>
+using make_index_sequence = std::make_index_sequence<N>;
+#else
+template <typename T, T... N> struct integer_sequence {
+  using value_type = T;
+
+  static FMT_CONSTEXPR std::size_t size() { return sizeof...(N); }
+};
+
+template <std::size_t... N>
+using index_sequence = integer_sequence<std::size_t, N...>;
+
+template <typename T, std::size_t N, T... Ns>
+struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {};
+template <typename T, T... Ns>
+struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {};
+
+template <std::size_t N>
+using make_index_sequence = make_integer_sequence<std::size_t, N>;
+#endif
+
+template <class Tuple, class F, size_t... Is>
+void for_each(index_sequence<Is...>, Tuple&& tup, F&& f) FMT_NOEXCEPT {
+  using std::get;
+  // using free function get<I>(T) now.
+  const int _[] = {0, ((void)f(get<Is>(tup)), 0)...};
+  (void)_;  // blocks warnings
+}
+
+template <class T>
+FMT_CONSTEXPR make_index_sequence<std::tuple_size<T>::value> get_indexes(
+    T const&) {
+  return {};
+}
+
+template <class Tuple, class F> void for_each(Tuple&& tup, F&& f) {
+  const auto indexes = get_indexes(tup);
+  for_each(indexes, std::forward<Tuple>(tup), std::forward<F>(f));
+}
+
+template <typename Arg, FMT_ENABLE_IF(!is_like_std_string<
+                                      typename std::decay<Arg>::type>::value)>
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
+  return add_space ? " {}" : "{}";
+}
+
+template <typename Arg, FMT_ENABLE_IF(is_like_std_string<
+                                      typename std::decay<Arg>::type>::value)>
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
+  return add_space ? " \"{}\"" : "\"{}\"";
+}
+
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char*) {
+  return add_space ? " \"{}\"" : "\"{}\"";
+}
+FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t*) {
+  return add_space ? L" \"{}\"" : L"\"{}\"";
+}
+
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char) {
+  return add_space ? " '{}'" : "'{}'";
+}
+FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t) {
+  return add_space ? L" '{}'" : L"'{}'";
+}
+
+}  // namespace internal
+
+template <typename T> struct is_tuple_like {
+  static FMT_CONSTEXPR_DECL const bool value =
+      internal::is_tuple_like_<T>::value && !internal::is_range_<T>::value;
+};
+
+template <typename TupleT, typename Char>
+struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> {
+ private:
+  // C++11 generic lambda for format()
+  template <typename FormatContext> struct format_each {
+    template <typename T> void operator()(const T& v) {
+      if (i > 0) {
+        if (formatting.add_prepostfix_space) {
+          *out++ = ' ';
+        }
+        out = internal::copy(formatting.delimiter, out);
+      }
+      out = format_to(out,
+                      internal::format_str_quoted(
+                          (formatting.add_delimiter_spaces && i > 0), v),
+                      v);
+      ++i;
+    }
+
+    formatting_tuple<Char>& formatting;
+    std::size_t& i;
+    typename std::add_lvalue_reference<decltype(
+        std::declval<FormatContext>().out())>::type out;
+  };
+
+ public:
+  formatting_tuple<Char> formatting;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return formatting.parse(ctx);
+  }
+
+  template <typename FormatContext = format_context>
+  auto format(const TupleT& values, FormatContext& ctx) -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    std::size_t i = 0;
+    internal::copy(formatting.prefix, out);
+
+    internal::for_each(values, format_each<FormatContext>{formatting, i, out});
+    if (formatting.add_prepostfix_space) {
+      *out++ = ' ';
+    }
+    internal::copy(formatting.postfix, out);
+
+    return ctx.out();
+  }
+};
+
+template <typename T, typename Char> struct is_range {
+  static FMT_CONSTEXPR_DECL const bool value =
+      internal::is_range_<T>::value &&
+      !internal::is_like_std_string<T>::value &&
+      !std::is_convertible<T, std::basic_string<Char>>::value &&
+      !std::is_constructible<internal::std_string_view<Char>, T>::value;
+};
+
+template <typename RangeT, typename Char>
+struct formatter<RangeT, Char,
+                 enable_if_t<fmt::is_range<RangeT, Char>::value>> {
+  formatting_range<Char> formatting;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return formatting.parse(ctx);
+  }
+
+  template <typename FormatContext>
+  typename FormatContext::iterator format(const RangeT& values,
+                                          FormatContext& ctx) {
+    auto out = internal::copy(formatting.prefix, ctx.out());
+    std::size_t i = 0;
+    for (auto it = values.begin(), end = values.end(); it != end; ++it) {
+      if (i > 0) {
+        if (formatting.add_prepostfix_space) *out++ = ' ';
+        out = internal::copy(formatting.delimiter, out);
+      }
+      out = format_to(out,
+                      internal::format_str_quoted(
+                          (formatting.add_delimiter_spaces && i > 0), *it),
+                      *it);
+      if (++i > formatting.range_length_limit) {
+        out = format_to(out, " ... <other elements>");
+        break;
+      }
+    }
+    if (formatting.add_prepostfix_space) *out++ = ' ';
+    return internal::copy(formatting.postfix, out);
+  }
+};
+
+template <typename Char, typename... T> struct tuple_arg_join : internal::view {
+  const std::tuple<T...>& tuple;
+  basic_string_view<Char> sep;
+
+  tuple_arg_join(const std::tuple<T...>& t, basic_string_view<Char> s)
+      : tuple{t}, sep{s} {}
+};
+
+template <typename Char, typename... T>
+struct formatter<tuple_arg_join<Char, T...>, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  typename FormatContext::iterator format(
+      const tuple_arg_join<Char, T...>& value, FormatContext& ctx) {
+    return format(value, ctx, internal::make_index_sequence<sizeof...(T)>{});
+  }
+
+ private:
+  template <typename FormatContext, size_t... N>
+  typename FormatContext::iterator format(
+      const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
+      internal::index_sequence<N...>) {
+    return format_args(value, ctx, std::get<N>(value.tuple)...);
+  }
+
+  template <typename FormatContext>
+  typename FormatContext::iterator format_args(
+      const tuple_arg_join<Char, T...>&, FormatContext& ctx) {
+    // NOTE: for compilers that support C++17, this empty function instantiation
+    // can be replaced with a constexpr branch in the variadic overload.
+    return ctx.out();
+  }
+
+  template <typename FormatContext, typename Arg, typename... Args>
+  typename FormatContext::iterator format_args(
+      const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
+      const Arg& arg, const Args&... args) {
+    using base = formatter<typename std::decay<Arg>::type, Char>;
+    auto out = ctx.out();
+    out = base{}.format(arg, ctx);
+    if (sizeof...(Args) > 0) {
+      out = std::copy(value.sep.begin(), value.sep.end(), out);
+      ctx.advance_to(out);
+      return format_args(value, ctx, args...);
+    }
+    return out;
+  }
+};
+
+/**
+  \rst
+  Returns an object that formats `tuple` with elements separated by `sep`.
+
+  **Example**::
+
+    std::tuple<int, char> t = {1, 'a'};
+    fmt::print("{}", fmt::join(t, ", "));
+    // Output: "1, a"
+  \endrst
+ */
+template <typename... T>
+FMT_CONSTEXPR tuple_arg_join<char, T...> join(const std::tuple<T...>& tuple,
+                                              string_view sep) {
+  return {tuple, sep};
+}
+
+template <typename... T>
+FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple,
+                                                 wstring_view sep) {
+  return {tuple, sep};
+}
+
+/**
+  \rst
+  Returns an object that formats `initializer_list` with elements separated by
+  `sep`.
+
+  **Example**::
+
+    fmt::print("{}", fmt::join({1, 2, 3}, ", "));
+    // Output: "1, 2, 3"
+  \endrst
+ */
+template <typename T>
+arg_join<internal::iterator_t<const std::initializer_list<T>>, char> join(
+    std::initializer_list<T> list, string_view sep) {
+  return join(std::begin(list), std::end(list), sep);
+}
+
+template <typename T>
+arg_join<internal::iterator_t<const std::initializer_list<T>>, wchar_t> join(
+    std::initializer_list<T> list, wstring_view sep) {
+  return join(std::begin(list), std::end(list), sep);
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_RANGES_H_

dep/fmt/src/format.cc

@@ -0,0 +1,176 @@
+// Formatting library for C++
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#include "fmt/format-inl.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+template <typename T>
+int format_float(char* buf, std::size_t size, const char* format, int precision,
+                 T value) {
+#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
+  if (precision > 100000)
+    throw std::runtime_error(
+        "fuzz mode - avoid large allocation inside snprintf");
+#endif
+  // Suppress the warning about nonliteral format string.
+  int (*snprintf_ptr)(char*, size_t, const char*, ...) = FMT_SNPRINTF;
+  return precision < 0 ? snprintf_ptr(buf, size, format, value)
+                       : snprintf_ptr(buf, size, format, precision, value);
+}
+struct sprintf_specs {
+  int precision;
+  char type;
+  bool alt : 1;
+
+  template <typename Char>
+  constexpr sprintf_specs(basic_format_specs<Char> specs)
+      : precision(specs.precision), type(specs.type), alt(specs.alt) {}
+
+  constexpr bool has_precision() const { return precision >= 0; }
+};
+
+// This is deprecated and is kept only to preserve ABI compatibility.
+template <typename Double>
+char* sprintf_format(Double value, internal::buffer<char>& buf,
+                     sprintf_specs specs) {
+  // Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
+  FMT_ASSERT(buf.capacity() != 0, "empty buffer");
+
+  // Build format string.
+  enum { max_format_size = 10 };  // longest format: %#-*.*Lg
+  char format[max_format_size];
+  char* format_ptr = format;
+  *format_ptr++ = '%';
+  if (specs.alt || !specs.type) *format_ptr++ = '#';
+  if (specs.precision >= 0) {
+    *format_ptr++ = '.';
+    *format_ptr++ = '*';
+  }
+  if (std::is_same<Double, long double>::value) *format_ptr++ = 'L';
+
+  char type = specs.type;
+
+  if (type == '%')
+    type = 'f';
+  else if (type == 0 || type == 'n')
+    type = 'g';
+#if FMT_MSC_VER
+  if (type == 'F') {
+    // MSVC's printf doesn't support 'F'.
+    type = 'f';
+  }
+#endif
+  *format_ptr++ = type;
+  *format_ptr = '\0';
+
+  // Format using snprintf.
+  char* start = nullptr;
+  char* decimal_point_pos = nullptr;
+  for (;;) {
+    std::size_t buffer_size = buf.capacity();
+    start = &buf[0];
+    int result =
+        format_float(start, buffer_size, format, specs.precision, value);
+    if (result >= 0) {
+      unsigned n = internal::to_unsigned(result);
+      if (n < buf.capacity()) {
+        // Find the decimal point.
+        auto p = buf.data(), end = p + n;
+        if (*p == '+' || *p == '-') ++p;
+        if (specs.type != 'a' && specs.type != 'A') {
+          while (p < end && *p >= '0' && *p <= '9') ++p;
+          if (p < end && *p != 'e' && *p != 'E') {
+            decimal_point_pos = p;
+            if (!specs.type) {
+              // Keep only one trailing zero after the decimal point.
+              ++p;
+              if (*p == '0') ++p;
+              while (p != end && *p >= '1' && *p <= '9') ++p;
+              char* where = p;
+              while (p != end && *p == '0') ++p;
+              if (p == end || *p < '0' || *p > '9') {
+                if (p != end) std::memmove(where, p, to_unsigned(end - p));
+                n -= static_cast<unsigned>(p - where);
+              }
+            }
+          }
+        }
+        buf.resize(n);
+        break;  // The buffer is large enough - continue with formatting.
+      }
+      buf.reserve(n + 1);
+    } else {
+      // If result is negative we ask to increase the capacity by at least 1,
+      // but as std::vector, the buffer grows exponentially.
+      buf.reserve(buf.capacity() + 1);
+    }
+  }
+  return decimal_point_pos;
+}
+}  // namespace internal
+
+template FMT_API char* internal::sprintf_format(double, internal::buffer<char>&,
+                                                sprintf_specs);
+template FMT_API char* internal::sprintf_format(long double,
+                                                internal::buffer<char>&,
+                                                sprintf_specs);
+
+template struct FMT_INSTANTIATION_DEF_API internal::basic_data<void>;
+
+// Workaround a bug in MSVC2013 that prevents instantiation of format_float.
+int (*instantiate_format_float)(double, int, internal::float_specs,
+                                internal::buffer<char>&) =
+    internal::format_float;
+
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+template FMT_API internal::locale_ref::locale_ref(const std::locale& loc);
+template FMT_API std::locale internal::locale_ref::get<std::locale>() const;
+#endif
+
+// Explicit instantiations for char.
+
+template FMT_API std::string internal::grouping_impl<char>(locale_ref);
+template FMT_API char internal::thousands_sep_impl(locale_ref);
+template FMT_API char internal::decimal_point_impl(locale_ref);
+
+template FMT_API void internal::buffer<char>::append(const char*, const char*);
+
+template FMT_API void internal::arg_map<format_context>::init(
+    const basic_format_args<format_context>& args);
+
+template FMT_API std::string internal::vformat<char>(
+    string_view, basic_format_args<format_context>);
+
+template FMT_API format_context::iterator internal::vformat_to(
+    internal::buffer<char>&, string_view, basic_format_args<format_context>);
+
+template FMT_API int internal::snprintf_float(double, int,
+                                              internal::float_specs,
+                                              internal::buffer<char>&);
+template FMT_API int internal::snprintf_float(long double, int,
+                                              internal::float_specs,
+                                              internal::buffer<char>&);
+template FMT_API int internal::format_float(double, int, internal::float_specs,
+                                            internal::buffer<char>&);
+template FMT_API int internal::format_float(long double, int,
+                                            internal::float_specs,
+                                            internal::buffer<char>&);
+
+// Explicit instantiations for wchar_t.
+
+template FMT_API std::string internal::grouping_impl<wchar_t>(locale_ref);
+template FMT_API wchar_t internal::thousands_sep_impl(locale_ref);
+template FMT_API wchar_t internal::decimal_point_impl(locale_ref);
+
+template FMT_API void internal::buffer<wchar_t>::append(const wchar_t*,
+                                                        const wchar_t*);
+
+template FMT_API std::wstring internal::vformat<wchar_t>(
+    wstring_view, basic_format_args<wformat_context>);
+FMT_END_NAMESPACE

dep/fmt/src/os.cc

@@ -0,0 +1,316 @@
+// Formatting library for C++ - optional OS-specific functionality
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+// Disable bogus MSVC warnings.
+#if !defined(_CRT_SECURE_NO_WARNINGS) && defined(_MSC_VER)
+#  define _CRT_SECURE_NO_WARNINGS
+#endif
+
+#include "fmt/os.h"
+
+#include <climits>
+
+#if FMT_USE_FCNTL
+#  include <sys/stat.h>
+#  include <sys/types.h>
+
+#  ifndef _WIN32
+#    include <unistd.h>
+#  else
+#    ifndef WIN32_LEAN_AND_MEAN
+#      define WIN32_LEAN_AND_MEAN
+#    endif
+#    include <io.h>
+#    include <windows.h>
+
+#    define O_CREAT _O_CREAT
+#    define O_TRUNC _O_TRUNC
+
+#    ifndef S_IRUSR
+#      define S_IRUSR _S_IREAD
+#    endif
+
+#    ifndef S_IWUSR
+#      define S_IWUSR _S_IWRITE
+#    endif
+
+#    ifdef __MINGW32__
+#      define _SH_DENYNO 0x40
+#    endif
+#  endif  // _WIN32
+#endif    // FMT_USE_FCNTL
+
+#ifdef _WIN32
+#  include <windows.h>
+#endif
+
+#ifdef fileno
+#  undef fileno
+#endif
+
+namespace {
+#ifdef _WIN32
+// Return type of read and write functions.
+using RWResult = int;
+
+// On Windows the count argument to read and write is unsigned, so convert
+// it from size_t preventing integer overflow.
+inline unsigned convert_rwcount(std::size_t count) {
+  return count <= UINT_MAX ? static_cast<unsigned>(count) : UINT_MAX;
+}
+#else
+// Return type of read and write functions.
+using RWResult = ssize_t;
+
+inline std::size_t convert_rwcount(std::size_t count) { return count; }
+#endif
+}  // namespace
+
+FMT_BEGIN_NAMESPACE
+
+#ifdef _WIN32
+internal::utf16_to_utf8::utf16_to_utf8(wstring_view s) {
+  if (int error_code = convert(s)) {
+    FMT_THROW(windows_error(error_code,
+                            "cannot convert string from UTF-16 to UTF-8"));
+  }
+}
+
+int internal::utf16_to_utf8::convert(wstring_view s) {
+  if (s.size() > INT_MAX) return ERROR_INVALID_PARAMETER;
+  int s_size = static_cast<int>(s.size());
+  if (s_size == 0) {
+    // WideCharToMultiByte does not support zero length, handle separately.
+    buffer_.resize(1);
+    buffer_[0] = 0;
+    return 0;
+  }
+
+  int length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, nullptr, 0,
+                                   nullptr, nullptr);
+  if (length == 0) return GetLastError();
+  buffer_.resize(length + 1);
+  length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, &buffer_[0],
+                               length, nullptr, nullptr);
+  if (length == 0) return GetLastError();
+  buffer_[length] = 0;
+  return 0;
+}
+
+void windows_error::init(int err_code, string_view format_str,
+                         format_args args) {
+  error_code_ = err_code;
+  memory_buffer buffer;
+  internal::format_windows_error(buffer, err_code, vformat(format_str, args));
+  std::runtime_error& base = *this;
+  base = std::runtime_error(to_string(buffer));
+}
+
+void internal::format_windows_error(internal::buffer<char>& out, int error_code,
+                                    string_view message) FMT_NOEXCEPT {
+  FMT_TRY {
+    wmemory_buffer buf;
+    buf.resize(inline_buffer_size);
+    for (;;) {
+      wchar_t* system_message = &buf[0];
+      int result = FormatMessageW(
+          FORMAT_MESSAGE_FROM_SYSTEM | FORMAT_MESSAGE_IGNORE_INSERTS, nullptr,
+          error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT), system_message,
+          static_cast<uint32_t>(buf.size()), nullptr);
+      if (result != 0) {
+        utf16_to_utf8 utf8_message;
+        if (utf8_message.convert(system_message) == ERROR_SUCCESS) {
+          internal::writer w(out);
+          w.write(message);
+          w.write(": ");
+          w.write(utf8_message);
+          return;
+        }
+        break;
+      }
+      if (GetLastError() != ERROR_INSUFFICIENT_BUFFER)
+        break;  // Can't get error message, report error code instead.
+      buf.resize(buf.size() * 2);
+    }
+  }
+  FMT_CATCH(...) {}
+  format_error_code(out, error_code, message);
+}
+
+void report_windows_error(int error_code,
+                          fmt::string_view message) FMT_NOEXCEPT {
+  report_error(internal::format_windows_error, error_code, message);
+}
+#endif  // _WIN32
+
+buffered_file::~buffered_file() FMT_NOEXCEPT {
+  if (file_ && FMT_SYSTEM(fclose(file_)) != 0)
+    report_system_error(errno, "cannot close file");
+}
+
+buffered_file::buffered_file(cstring_view filename, cstring_view mode) {
+  FMT_RETRY_VAL(file_, FMT_SYSTEM(fopen(filename.c_str(), mode.c_str())),
+                nullptr);
+  if (!file_)
+    FMT_THROW(system_error(errno, "cannot open file {}", filename.c_str()));
+}
+
+void buffered_file::close() {
+  if (!file_) return;
+  int result = FMT_SYSTEM(fclose(file_));
+  file_ = nullptr;
+  if (result != 0) FMT_THROW(system_error(errno, "cannot close file"));
+}
+
+// A macro used to prevent expansion of fileno on broken versions of MinGW.
+#define FMT_ARGS
+
+int buffered_file::fileno() const {
+  int fd = FMT_POSIX_CALL(fileno FMT_ARGS(file_));
+  if (fd == -1) FMT_THROW(system_error(errno, "cannot get file descriptor"));
+  return fd;
+}
+
+#if FMT_USE_FCNTL
+file::file(cstring_view path, int oflag) {
+  int mode = S_IRUSR | S_IWUSR;
+#  if defined(_WIN32) && !defined(__MINGW32__)
+  fd_ = -1;
+  FMT_POSIX_CALL(sopen_s(&fd_, path.c_str(), oflag, _SH_DENYNO, mode));
+#  else
+  FMT_RETRY(fd_, FMT_POSIX_CALL(open(path.c_str(), oflag, mode)));
+#  endif
+  if (fd_ == -1)
+    FMT_THROW(system_error(errno, "cannot open file {}", path.c_str()));
+}
+
+file::~file() FMT_NOEXCEPT {
+  // Don't retry close in case of EINTR!
+  // See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
+  if (fd_ != -1 && FMT_POSIX_CALL(close(fd_)) != 0)
+    report_system_error(errno, "cannot close file");
+}
+
+void file::close() {
+  if (fd_ == -1) return;
+  // Don't retry close in case of EINTR!
+  // See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
+  int result = FMT_POSIX_CALL(close(fd_));
+  fd_ = -1;
+  if (result != 0) FMT_THROW(system_error(errno, "cannot close file"));
+}
+
+long long file::size() const {
+#  ifdef _WIN32
+  // Use GetFileSize instead of GetFileSizeEx for the case when _WIN32_WINNT
+  // is less than 0x0500 as is the case with some default MinGW builds.
+  // Both functions support large file sizes.
+  DWORD size_upper = 0;
+  HANDLE handle = reinterpret_cast<HANDLE>(_get_osfhandle(fd_));
+  DWORD size_lower = FMT_SYSTEM(GetFileSize(handle, &size_upper));
+  if (size_lower == INVALID_FILE_SIZE) {
+    DWORD error = GetLastError();
+    if (error != NO_ERROR)
+      FMT_THROW(windows_error(GetLastError(), "cannot get file size"));
+  }
+  unsigned long long long_size = size_upper;
+  return (long_size << sizeof(DWORD) * CHAR_BIT) | size_lower;
+#  else
+  using Stat = struct stat;
+  Stat file_stat = Stat();
+  if (FMT_POSIX_CALL(fstat(fd_, &file_stat)) == -1)
+    FMT_THROW(system_error(errno, "cannot get file attributes"));
+  static_assert(sizeof(long long) >= sizeof(file_stat.st_size),
+                "return type of file::size is not large enough");
+  return file_stat.st_size;
+#  endif
+}
+
+std::size_t file::read(void* buffer, std::size_t count) {
+  RWResult result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(read(fd_, buffer, convert_rwcount(count))));
+  if (result < 0) FMT_THROW(system_error(errno, "cannot read from file"));
+  return internal::to_unsigned(result);
+}
+
+std::size_t file::write(const void* buffer, std::size_t count) {
+  RWResult result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(write(fd_, buffer, convert_rwcount(count))));
+  if (result < 0) FMT_THROW(system_error(errno, "cannot write to file"));
+  return internal::to_unsigned(result);
+}
+
+file file::dup(int fd) {
+  // Don't retry as dup doesn't return EINTR.
+  // http://pubs.opengroup.org/onlinepubs/009695399/functions/dup.html
+  int new_fd = FMT_POSIX_CALL(dup(fd));
+  if (new_fd == -1)
+    FMT_THROW(system_error(errno, "cannot duplicate file descriptor {}", fd));
+  return file(new_fd);
+}
+
+void file::dup2(int fd) {
+  int result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
+  if (result == -1) {
+    FMT_THROW(system_error(errno, "cannot duplicate file descriptor {} to {}",
+                           fd_, fd));
+  }
+}
+
+void file::dup2(int fd, error_code& ec) FMT_NOEXCEPT {
+  int result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
+  if (result == -1) ec = error_code(errno);
+}
+
+void file::pipe(file& read_end, file& write_end) {
+  // Close the descriptors first to make sure that assignments don't throw
+  // and there are no leaks.
+  read_end.close();
+  write_end.close();
+  int fds[2] = {};
+#  ifdef _WIN32
+  // Make the default pipe capacity same as on Linux 2.6.11+.
+  enum { DEFAULT_CAPACITY = 65536 };
+  int result = FMT_POSIX_CALL(pipe(fds, DEFAULT_CAPACITY, _O_BINARY));
+#  else
+  // Don't retry as the pipe function doesn't return EINTR.
+  // http://pubs.opengroup.org/onlinepubs/009696799/functions/pipe.html
+  int result = FMT_POSIX_CALL(pipe(fds));
+#  endif
+  if (result != 0) FMT_THROW(system_error(errno, "cannot create pipe"));
+  // The following assignments don't throw because read_fd and write_fd
+  // are closed.
+  read_end = file(fds[0]);
+  write_end = file(fds[1]);
+}
+
+buffered_file file::fdopen(const char* mode) {
+  // Don't retry as fdopen doesn't return EINTR.
+  FILE* f = FMT_POSIX_CALL(fdopen(fd_, mode));
+  if (!f)
+    FMT_THROW(
+        system_error(errno, "cannot associate stream with file descriptor"));
+  buffered_file bf(f);
+  fd_ = -1;
+  return bf;
+}
+
+long getpagesize() {
+#  ifdef _WIN32
+  SYSTEM_INFO si;
+  GetSystemInfo(&si);
+  return si.dwPageSize;
+#  else
+  long size = FMT_POSIX_CALL(sysconf(_SC_PAGESIZE));
+  if (size < 0) FMT_THROW(system_error(errno, "cannot get memory page size"));
+  return size;
+#  endif
+}
+#endif  // FMT_USE_FCNTL
+FMT_END_NAMESPACE

doc/cascadia/SettingsSchema.md

@@ -7,19 +7,21 @@ Properties listed below affect the entire window, regardless of the profile sett
 | -------- | --------- | ---- | ------- | ----------- |
 | `alwaysShowTabs` | _Required_ | Boolean | `true` | When set to `true`, tabs are always displayed. When set to `false` and `showTabsInTitlebar` is set to `false`, tabs only appear after typing <kbd>Ctrl</kbd> + <kbd>T</kbd>. |
 | `copyOnSelect` | Optional | Boolean | `false` | When set to `true`, a selection is immediately copied to your clipboard upon creation. When set to `false`, the selection persists and awaits further action. |
+| `copyFormatting` | Optional | Boolean | `false` | When set to `true`, the color and font formatting of selected text is also copied to your clipboard. When set to `false`, only plain text is copied to your clipboard. |
 | `defaultProfile` | _Required_ | String | PowerShell guid | Sets the default profile. Opens by typing <kbd>Ctrl</kbd> + <kbd>T</kbd> or by clicking the '+' icon. The guid of the desired default profile is used as the value. |
 | `initialCols` | _Required_ | Integer | `120` | The number of columns displayed in the window upon first load. |
 | `initialPosition` | Optional | String | `","` | The position of the top left corner of the window upon first load. On a system with multiple displays, these coordinates are relative to the top left of the primary display. If `launchMode` is set to `"maximized"`, the window will be maximized on the monitor specified by those coordinates. |
 | `initialRows` | _Required_ | Integer | `30` | The number of rows displayed in the window upon first load. |
 | `launchMode` | Optional | String | `default` | Defines whether the Terminal will launch as maximized or not. Possible values: `"default"`, `"maximized"` |
 | `rowsToScroll` | Optional | Integer | `system` | The number of rows to scroll at a time with the mouse wheel. This will override the system setting if the value is not zero or "system". |
-| `requestedTheme` | _Required_ | String | `system` | Sets the theme of the application. Possible values: `"light"`, `"dark"`, `"system"` |
+| `theme` | _Required_ | String | `system` | Sets the theme of the application. Possible values: `"light"`, `"dark"`, `"system"` |
 | `showTerminalTitleInTitlebar` | _Required_ | Boolean | `true` | When set to `true`, titlebar displays the title of the selected tab. When set to `false`, titlebar displays "Windows Terminal". |
 | `showTabsInTitlebar` | Optional | Boolean | `true` | When set to `true`, the tabs are moved into the titlebar and the titlebar disappears. When set to `false`, the titlebar sits above the tabs. |
 | `snapToGridOnResize` | Optional | Boolean | `false` | When set to `true`, the window will snap to the nearest character boundary on resize. When `false`, the window will resize "smoothly" |
 | `tabWidthMode` | Optional | String | `equal` | Sets the width of the tabs. Possible values: `"equal"`, `"titleLength"` |
 | `wordDelimiters` | Optional | String | <code>&nbsp;&#x2f;&#x5c;&#x28;&#x29;&#x22;&#x27;&#x2d;&#x3a;&#x2c;&#x2e;&#x3b;&#x3c;&#x3e;&#x7e;&#x21;&#x40;&#x23;&#x24;&#x25;&#x5e;&#x26;&#x2a;&#x7c;&#x2b;&#x3d;&#x5b;&#x5d;&#x7b;&#x7d;&#x7e;&#x3f;│</code><br>_(`│` is `U+2502 BOX DRAWINGS LIGHT VERTICAL`)_ | Determines the delimiters used in a double click selection. |
 | `confirmCloseAllTabs` | Optional | Boolean | `true` | When set to `true` closing a window with multiple tabs open WILL require confirmation.  When set to `false` closing a window with multiple tabs open WILL NOT require confirmation. |
+| `disabledProfileSources` | Optional | Array[String] | `[]` | Disables all the dynamic profile generators in this list, preventing them from adding their profiles to the list of profiles on startup. This array can contain any combination of `Windows.Terminal.Wsl`, `Windows.Terminal.Azure`, or `Windows.Terminal.PowershellCore`. For more information, see [UsingJsonSettings.md](https://github.com/microsoft/terminal/blob/master/doc/user-docs/UsingJsonSettings.md#dynamic-profiles) |
 
 ## Profiles
 Properties listed below are specific to each unique profile.
@@ -37,24 +39,23 @@ Properties listed below are specific to each unique profile.
 | `backgroundImageStretchMode` | Optional | String | `uniformToFill` | Sets how the background image is resized to fill the window. Possible values: `"none"`, `"fill"`, `"uniform"`, `"uniformToFill"` |
 | `closeOnExit` | Optional | String | `graceful` | Sets how the profile reacts to termination or failure to launch. Possible values: `"graceful"` (close when `exit` is typed or the process exits normally), `"always"` (always close) and `"never"` (never close). `true` and `false` are accepted as synonyms for `"graceful"` and `"never"` respectively. |
 | `colorScheme` | Optional | String | `Campbell` | Name of the terminal color scheme to use. Color schemes are defined under `schemes`. |
-| `colorTable` | Optional | Array[String] | | Array of colors used in the profile if `colorscheme` is not set. Array follows the format defined in `schemes`. |
 | `commandline` | Optional | String | | Executable used in the profile. |
 | `cursorColor` | Optional | String | | Sets the cursor color of the profile. Overrides `cursorColor` set in color scheme if `colorscheme` is set. Uses hex color format: `"#rrggbb"`. |
 | `cursorHeight` | Optional | Integer | | Sets the percentage height of the cursor starting from the bottom. Only works when `cursorShape` is set to `"vintage"`. Accepts values from 25-100. |
 | `cursorShape` | Optional | String | `bar` | Sets the cursor shape for the profile. Possible values: `"vintage"` ( &#x2583; ), `"bar"` ( &#x2503; ), `"underscore"` ( &#x2581; ), `"filledBox"` ( &#x2588; ), `"emptyBox"` ( &#x25AF; ) |
-| `fontFace` | Optional | String | `Cascadia Code` | Name of the font face used in the profile. We will try to fallback to Consolas if this can't be found or is invalid. |
+| `fontFace` | Optional | String | `Cascadia Mono` | Name of the font face used in the profile. We will try to fallback to Consolas if this can't be found or is invalid. |
 | `fontSize` | Optional | Integer | `12` | Sets the font size. |
 | `foreground` | Optional | String | | Sets the foreground color of the profile. Overrides `foreground` set in color scheme if `colorscheme` is set. Uses hex color format: `#rgb` or `"#rrggbb"`. |
 | `hidden` | Optional | Boolean | `false` | If set to true, the profile will not appear in the list of profiles. This can be used to hide default profiles and dynamically generated profiles, while leaving them in your settings file. |
 | `historySize` | Optional | Integer | `9001` | The number of lines above the ones displayed in the window you can scroll back to. |
 | `icon` | Optional | String | | Image file location of the icon used in the profile. Displays within the tab and the dropdown menu. |
 | `padding` | Optional | String | `8, 8, 8, 8` | Sets the padding around the text within the window. Can have three different formats: `"#"` sets the same padding for all sides, `"#, #"` sets the same padding for left-right and top-bottom, and `"#, #, #, #"` sets the padding individually for left, top, right, and bottom. |
-| `scrollbarState` | Optional | String | | Defines the visibility of the scrollbar. Possible values: `"visible"`, `"hidden"` |
+| `scrollbarState` | Optional | String | `"visible"` | Defines the visibility of the scrollbar. Possible values: `"visible"`, `"hidden"` |
 | `selectionBackground` | Optional | String | | Sets the selection background color of the profile. Overrides `selectionBackground` set in color scheme if `colorscheme` is set. Uses hex color format: `"#rrggbb"`. |
 | `snapOnInput` | Optional | Boolean | `true` | When set to `true`, the window will scroll to the command input line when typing. When set to `false`, the window will not scroll when you start typing. |
 | `source` | Optional | String | | Stores the name of the profile generator that originated this profile. _There are no discoverable values for this field._ |
 | `startingDirectory` | Optional | String | `%USERPROFILE%` | The directory the shell starts in when it is loaded. |
-| `suppressApplicationTitle` | Optional | Boolean | | When set to `true`, `tabTitle` overrides the default title of the tab and any title change messages from the application will be suppressed. When set to `false`, `tabTitle` behaves as normal. |
+| `suppressApplicationTitle` | Optional | Boolean | `false` | When set to `true`, `tabTitle` overrides the default title of the tab and any title change messages from the application will be suppressed. When set to `false`, `tabTitle` behaves as normal. |
 | `tabTitle` | Optional | String | | If set, will replace the `name` as the title to pass to the shell on startup. Some shells (like `bash`) may choose to ignore this initial value, while others (`cmd`, `powershell`) may use this value over the lifetime of the application.  |
 | `useAcrylic` | Optional | Boolean | `false` | When set to `true`, the window will have an acrylic background. When set to `false`, the window will have a plain, untextured background. The transparency only applies to focused windows due to OS limitation. |
 | `experimental.retroTerminalEffect` | Optional | Boolean | `false` | When set to `true`, enable retro terminal effects. This is an experimental feature, and its continued existence is not guaranteed. |
@@ -92,7 +93,7 @@ Properties listed below are specific to each custom key binding.
 | Property | Necessity | Type | Description |
 | -------- | ---- | ----------- | ----------- |
 | `command` | _Required_ | String | The command executed when the associated key bindings are pressed. |
-| `keys` | _Required_ | Array[String] | Defines the key combinations used to call the command. |
+| `keys` | _Required_ | Array[String] or String | Defines the key combinations used to call the command. |
 | `action` | Optional | String | Adds additional functionality to certain commands. |
 
 ### Implemented Commands and Actions
@@ -111,14 +112,13 @@ For commands with arguments:
 
 | Command | Command Description | Action (*=required) | Action Arguments | Argument Descriptions |
 | ------- | ------------------- | ------ | ---------------- | ----------------- |
+| `adjustFontSize` | Change the text size by a specified point amount. | `delta` | integer | Amount of size change per command invocation. |
 | `closePane` | Close the active pane. | | | |
 | `closeTab` | Close the current tab. | | | |
 | `closeWindow` | Close the current window and all tabs within it. | | | |
-| `copy` | Copy the selected terminal content to your Windows Clipboard. | `trimWhitespace` | boolean | When `true`, newlines persist from the selected text. When `false`, copied content will paste on one line. |
-| `decreaseFontSize` | Make the text smaller by one delta. | `delta` | integer | Amount of size decrease per command invocation. |
+| `copy` | Copy the selected terminal content to your Windows Clipboard. | `singleLine` | boolean | When `true`, the copied content will be copied as a single line. When `false`, newlines persist from the selected text. |
 | `duplicateTab` | Make a copy and open the current tab. | | | |
 | `find` | Open the search dialog box. | | | |
-| `increaseFontSize` | Make the text larger by one delta. | `delta` | integer | Amount of size increase per command invocation. |
 | `moveFocus` | Focus on a different pane depending on direction. | `direction`* | `left`, `right`, `up`, `down` | Direction in which the focus will move. |
 | `newTab` | Create a new tab. Without any arguments, this will open the default profile in a new tab. | 1. `commandLine`<br>2. `startingDirectory`<br>3. `tabTitle`<br>4. `index`<br>5. `profile` | 1. string<br>2. string<br>3. string<br>4. integer<br>5. string | 1. Executable run within the tab.<br>2. Directory in which the tab will open.<br>3. Title of the new tab.<br>4. Profile that will open based on its position in the dropdown (starting at 0).<br>5. Profile that will open based on its GUID or name. |
 | `nextTab` | Open the tab to the right of the current one. | | | |
@@ -132,7 +132,7 @@ For commands with arguments:
 | `scrollUp` | Move the screen up. | | | |
 | `scrollUpPage` | Move the screen up a whole page. | | | |
 | `scrollDownPage` | Move the screen down a whole page. | | | |
-| `splitPane` | Halve the size of the active pane and open another. Without any arguments, this will open the default profile in the new pane. | 1. `split`*<br>2. `commandLine`<br>3. `startingDirectory`<br>4. `tabTitle`<br>5. `index`<br>6. `profile` | 1. `vertical`, `horizontal`, `auto`<br>2. string<br>3. string<br>4. string<br>5. integer<br>6. string | 1. How the pane will split. `auto` will split in the direction that provides the most surface area.<br>2. Executable run within the pane.<br>3. Directory in which the pane will open.<br>4. Title of the tab when the new pane is focused.<br>5. Profile that will open based on its position in the dropdown (starting at 0).<br>6. Profile that will open based on its GUID or name. |
+| `splitPane` | Halve the size of the active pane and open another. Without any arguments, this will open the default profile in the new pane. | 1. `split`*<br>2. `commandLine`<br>3. `startingDirectory`<br>4. `tabTitle`<br>5. `index`<br>6. `profile`<br>7. `splitMode` | 1. `vertical`, `horizontal`, `auto`<br>2. string<br>3. string<br>4. string<br>5. integer<br>6. string<br>7. string | 1. How the pane will split. `auto` will split in the direction that provides the most surface area.<br>2. Executable run within the pane.<br>3. Directory in which the pane will open.<br>4. Title of the tab when the new pane is focused.<br>5. Profile that will open based on its position in the dropdown (starting at 0).<br>6. Profile that will open based on its GUID or name.<br>7. Controls how the pane splits. Only accepts `duplicate` which will duplicate the focused pane's profile into a new pane. |
 | `switchToTab` | Open a specific tab depending on index. | `index`* | integer | Tab that will open based on its position in the tab bar (starting at 0). |
 | `toggleFullscreen` | Switch between fullscreen and default window sizes. | | | |
 | `unbound` | Unbind the associated keys from any command. | | | |

doc/cascadia/profiles.schema.json

@@ -1,7 +1,7 @@
 {
   "$id": "https://github.com/microsoft/terminal/blob/master/doc/cascadia/profiles.schema.json",
   "$schema": "http://json-schema.org/draft-07/schema#",
-  "title": "Microsoft's Windows Terminal Settings Profile Schema'",
+  "title": "Microsoft's Windows Terminal Settings Profile Schema",
   "definitions": {
     "KeyChordSegment": {
       "pattern": "^(?<modifier>(ctrl|alt|shift)(?:\\+(ctrl|alt|shift)(?<!\\2))?(?:\\+(ctrl|alt|shift)(?<!\\2|\\3))?\\+)?(?<key>[^\\s+]|backspace|tab|enter|esc|escape|space|pgup|pageup|pgdn|pagedown|end|home|left|up|right|down|insert|delete|(?<!shift.+)(?:numpad_?[0-9]|numpad_(?:period|decimal))|numpad_(?:multiply|plus|add|minus|subtract|divide)|f[1-9]|f1[0-9]|f2[0-4]|plus)$",
@@ -18,6 +18,14 @@
       "pattern": "^(-?\\d+)?(,\\s?(-?\\d+)?)?$",
       "type": "string"
     },
+    "DynamicProfileSource": {
+      "enum": [
+        "Windows.Terminal.Wsl",
+        "Windows.Terminal.Azure",
+        "Windows.Terminal.PowershellCore"
+      ],
+      "type": "string"
+    },
     "ProfileGuid": {
       "default": "{}",
       "pattern": "^\\{[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}\\}$",
@@ -25,29 +33,15 @@
     },
     "ShortcutActionName": {
       "enum": [
+        "adjustFontSize",
         "closePane",
         "closeTab",
         "closeWindow",
         "copy",
-        "copyTextWithoutNewlines",
         "decreaseFontSize",
         "duplicateTab",
-        "increaseFontSize",
         "moveFocus",
-        "moveFocusDown",
-        "moveFocusLeft",
-        "moveFocusRight",
-        "moveFocusUp",
         "newTab",
-        "newTabProfile0",
-        "newTabProfile1",
-        "newTabProfile2",
-        "newTabProfile3",
-        "newTabProfile4",
-        "newTabProfile5",
-        "newTabProfile6",
-        "newTabProfile7",
-        "newTabProfile8",
         "nextTab",
         "openNewTabDropdown",
         "openSettings",
@@ -55,29 +49,15 @@
         "prevTab",
         "resetFontSize",
         "resizePane",
-        "resizePaneDown",
-        "resizePaneLeft",
-        "resizePaneRight",
-        "resizePaneUp",
         "scrollDown",
         "scrollDownPage",
         "scrollUp",
         "scrollUpPage",
-        "splitHorizontal",
-        "splitVertical",
         "splitPane",
         "switchToTab",
-        "switchToTab0",
-        "switchToTab1",
-        "switchToTab2",
-        "switchToTab3",
-        "switchToTab4",
-        "switchToTab5",
-        "switchToTab6",
-        "switchToTab7",
-        "switchToTab8",
         "toggleFullscreen",
-        "find"
+        "find",
+        "unbound"
       ],
       "type": "string"
     },
@@ -118,7 +98,7 @@
         },
         "index": {
           "type": "integer",
-          "description": "The index of the profile in the new tab dropdown to open"
+          "description": "The index of the profile in the new tab dropdown (starting at 0)"
         }
       },
       "type": "object"
@@ -135,6 +115,23 @@
       ],
       "type": "object"
     },
+    "AdjustFontSizeAction": {
+      "description": "Arguments corresponding to an Adjust Font Size Action",
+      "allOf": [
+        { "$ref": "#/definitions/ShortcutAction" },
+        {
+          "properties": {
+            "action": { "type": "string", "pattern": "adjustFontSize" },
+            "delta": {
+              "type": "integer",
+              "default": 0,
+              "description": "How much to change the current font point size"
+            }
+          }
+        }
+      ],
+      "required": [ "delta" ]
+    },
     "CopyAction": {
       "description": "Arguments corresponding to a Copy Text Action",
       "allOf": [
@@ -142,10 +139,10 @@
         {
           "properties": {
             "action": { "type": "string", "pattern": "copy" },
-            "trimWhitespace": {
+            "singleLine": {
               "type": "boolean",
-              "default": true,
-              "description": "If true, whitespace is removed and newlines are maintained. If false, newlines are removed and whitespace is maintained."
+              "default": false,
+              "description": "If true, the copied content will be copied as a single line (even if there are hard line breaks present in the text). If false, newlines persist from the selected text."
             }
           }
         }
@@ -225,12 +222,15 @@
             "split": {
               "$ref": "#/definitions/SplitState",
               "default": "auto",
-              "description": "The orientation to split the pane in, either vertical (think [|]), horizontal (think [-]), or auto (splits pane based on remaining space)"
+              "description": "The orientation to split the pane in. Possible values:\n -\"auto\" (splits pane based on remaining space)\n -\"horizontal\" (think [-])\n -\"vertical\" (think [|])"
+            },
+            "splitMode": {
+              "default": "duplicate",
+              "description": "Control how the pane splits. Only accepts \"duplicate\" which will duplicate the focused pane's profile into a new pane."
             }
           }
         }
-      ],
-      "required": [ "split" ]
+      ]
     },
     "Keybinding": {
       "additionalProperties": false,
@@ -238,17 +238,19 @@
         "command": {
           "description": "The action executed when the associated key bindings are pressed.",
             "oneOf": [
+              { "$ref": "#/definitions/AdjustFontSizeAction" },
               { "$ref": "#/definitions/CopyAction" },
               { "$ref": "#/definitions/ShortcutActionName" },
               { "$ref": "#/definitions/NewTabAction" },
               { "$ref": "#/definitions/SwitchToTabAction" },
               { "$ref": "#/definitions/MoveFocusAction" },
               { "$ref": "#/definitions/ResizePaneAction" },
-              { "$ref": "#/definitions/SplitPaneAction" }
+              { "$ref": "#/definitions/SplitPaneAction" },
+              { "type": "null" }
             ]
         },
         "keys": {
-          "description": "Defines the key combinations used to call the command.",
+          "description": "Defines the key combinations used to call the command. It must be composed of...\n -any number of modifiers (ctrl/alt/shift)\n -a non-modifier key",
           "oneOf": [
             {
               "$ref": "#/definitions/KeyChordSegment"
@@ -275,7 +277,7 @@
       "properties": {
         "alwaysShowTabs": {
           "default": true,
-          "description": "When set to true, tabs are always displayed. When set to false and showTabsInTitlebar is set to false, tabs only appear after opening a new tab.",
+          "description": "When set to true, tabs are always displayed. When set to false and \"showTabsInTitlebar\" is set to false, tabs only appear after opening a new tab.",
           "type": "boolean"
         },
         "copyOnSelect": {
@@ -283,9 +285,21 @@
           "description": "When set to true, a selection is immediately copied to your clipboard upon creation. When set to false, the selection persists and awaits further action.",
           "type": "boolean"
         },
+        "copyFormatting": {
+          "default": true,
+          "description": "When set to `true`, the color and font formatting of selected text is also copied to your clipboard. When set to `false`, only plain text is copied to your clipboard.",
+          "type": "boolean"
+        },
         "defaultProfile": {
           "$ref": "#/definitions/ProfileGuid",
-          "description": "Sets the default profile. Opens by clicking the '+' icon or typing the key binding assigned to 'newTab'. The guid of the desired default profile is used as the value."
+          "description": "Sets the default profile. Opens by clicking the \"+\" icon or typing the key binding assigned to \"newTab\". The \"guid\" of the desired default profile is used as the value."
+        },
+        "disabledProfileSources": {
+          "description": "Disables all the dynamic profile generators in this list, preventing them from adding their profiles to the list of profiles on startup.",
+          "items": {
+            "$ref": "#/definitions/DynamicProfileSource"
+          },
+          "type": "array"
         },
         "initialCols": {
           "default": 120,
@@ -296,7 +310,7 @@
         },
         "initialPosition": {
           "$ref": "#/definitions/Coordinates",
-          "description": "The position of the top left corner of the window upon first load. On a system with multiple displays, these coordinates are relative to the top left of the primary display. If launchMode is set to maximized, the window will be maximized on the monitor specified by those coordinates."
+          "description": "The position of the top left corner of the window upon first load. On a system with multiple displays, these coordinates are relative to the top left of the primary display. If \"launchMode\" is set to maximized, the window will be maximized on the monitor specified by those coordinates."
         },
         "initialRows": {
           "default": 30,
@@ -316,7 +330,7 @@
         },
         "rowsToScroll": {
           "default": "system",
-          "description": "The number of rows to scroll at a time with the mouse wheel. This will override the system setting if the value is not zero or 'system'.",
+          "description": "The number of rows to scroll at a time with the mouse wheel. This will override the system setting if the value is not zero or \"system\".",
           "maximum": 999,
           "minimum": 0,
           "type": ["integer", "string"]
@@ -328,9 +342,9 @@
           },
           "type": "array"
         },
-        "requestedTheme": {
+        "theme": {
           "default": "system",
-          "description": "Sets the theme of the application.",
+          "description": "Sets the theme of the application. The special value \"system\" refers to the active Windows system theme.",
           "enum": [
             "light",
             "dark",
@@ -345,17 +359,17 @@
         },
         "showTerminalTitleInTitlebar": {
           "default": true,
-          "description": "When set to true, titlebar displays the title of the selected tab. When set to false, titlebar displays 'Windows Terminal'.",
+          "description": "When set to true, titlebar displays the title of the selected tab. When set to false, titlebar displays \"Windows Terminal\".",
           "type": "boolean"
         },
         "snapToGridOnResize": {
           "default": false,
-          "description": "When set to true, the window will snap to the nearest character boundary on resize. When false, the window will resize 'smoothly'",
+          "description": "When set to true, the window will snap to the nearest character boundary on resize. When false, the window will resize smoothly",
           "type": "boolean"
         },
         "tabWidthMode": {
           "default": "equal",
-          "description": "Sets the width of the tabs.",
+          "description": "Sets the width of the tabs. Possible values include:\n -\"equal\" sizes each tab to the same width\n -\"titleLength\" sizes each tab to the length of its title",
           "enum": [
             "equal",
             "titleLength"
@@ -369,7 +383,7 @@
         },
         "confirmCloseAllTabs": {
           "default": true,
-          "description": " When set to `true` closing a window with multiple tabs open WILL require confirmation.  When set to `false` closing a window with multiple tabs open WILL NOT require confirmation.",
+          "description": "When set to \"true\" closing a window with multiple tabs open will require confirmation.  When set to \"false\", the confirmation dialog will not appear.",
           "type":"boolean"
         }
       },
@@ -402,12 +416,12 @@
         "background": {
           "$ref": "#/definitions/Color",
           "default": "#0c0c0c",
-          "description": "Sets the background color of the profile. Overrides background set in color scheme if colorscheme is set. Uses hex color format: \"#rrggbb\".",
+          "description": "Sets the background color of the text. Overrides \"background\" from the color scheme. Uses hex color format: \"#rrggbb\".",
           "type": ["string", "null"]
         },
         "backgroundImage": {
-          "description": "Sets the file location of the Image to draw over the window background.",
-          "type": "string"
+          "description": "Sets the file location of the image to draw over the window background.",
+          "type": ["string", "null"]
         },
         "backgroundImageAlignment": {
           "default": "center",
@@ -422,12 +436,14 @@
             "topLeft",
             "topRight"
           ],
+          "description": "Sets how the background image aligns to the boundaries of the window. Possible values: \"center\", \"left\", \"top\", \"right\", \"bottom\", \"topLeft\", \"topRight\", \"bottomLeft\", \"bottomRight\"",
           "type": "string"
         },
         "backgroundImageOpacity": {
-          "description": "(Not in SettingsSchema.md)",
-          "maximum": 1,
-          "minimum": 0,
+          "default": 1.0,
+          "description": "Sets the transparency of the background image. Accepts floating point values from 0-1.",
+          "maximum": 1.0,
+          "minimum": 0.0,
           "type": "number"
         },
         "backgroundImageStretchMode": {
@@ -443,7 +459,7 @@
         },
         "closeOnExit": {
           "default": "graceful",
-          "description": "Sets how the profile reacts to termination or failure to launch. Possible values: \"graceful\" (close when exit is typed or the process exits normally), \"always\" (always close) and \"never\" (never close). true and false are accepted as synonyms for \"graceful\" and \"never\" respectively.",
+          "description": "Sets how the profile reacts to termination or failure to launch. Possible values:\n -\"graceful\" (close when exit is typed or the process exits normally)\n -\"always\" (always close)\n -\"never\" (never close).\ntrue and false are accepted as synonyms for \"graceful\" and \"never\" respectively.",
           "oneOf": [
             {
               "enum": [
@@ -463,109 +479,27 @@
           "description": "Name of the terminal color scheme to use. Color schemes are defined under \"schemes\".",
           "type": "string"
         },
-        "colorTable": {
-          "description": "Array of colors used in the profile if colorscheme is not set. Colors use hex color format: \"#rrggbb\". Ordering is as follows: [black, red, green, yellow, blue, magenta, cyan, white, bright black, bright red, bright green, bright yellow, bright blue, bright magenta, bright cyan, bright white]",
-          "items": {
-            "additionalProperties": false,
-            "properties": {
-              "background": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the background color of the color table."
-              },
-              "black": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI black."
-              },
-              "blue": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI blue."
-              },
-              "brightBlack": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright black."
-              },
-              "brightBlue": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright blue."
-              },
-              "brightCyan": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright cyan."
-              },
-              "brightGreen": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright green."
-              },
-              "brightPurple": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright purple."
-              },
-              "brightRed": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright red."
-              },
-              "brightWhite": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright white."
-              },
-              "brightYellow": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright yellow."
-              },
-              "cyan": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI cyan."
-              },
-              "foreground": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the foreground color of the color table."
-              },
-              "green": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI green."
-              },
-              "purple": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI purple."
-              },
-              "red": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI red."
-              },
-              "white": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI white."
-              },
-              "yellow": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI yellow."
-              }
-            },
-            "type": "object"
-          },
-          "type": "array"
-        },
         "commandline": {
           "description": "Executable used in the profile.",
           "type": "string"
         },
-        "connectionType": {
-          "$ref": "#/definitions/ProfileGuid",
-          "description": "A GUID reference to a connection type. Currently undocumented as of 0.3, this is used for Azure Cloud Shell"
-        },
         "cursorColor": {
-          "$ref": "#/definitions/Color",
-          "description": "Sets the cursor color of the profile. Overrides cursor color set in color scheme if colorscheme is set. Uses hex color format: \"#rrggbb\"."
+          "oneOf": [
+            { "$ref": "#/definitions/Color" },
+            {"type": "null"}
+          ],
+          "description": "Sets the color of the cursor. Overrides the cursor color from the color scheme. Uses hex color format: \"#rrggbb\"."
         },
         "cursorHeight": {
           "description": "Sets the percentage height of the cursor starting from the bottom. Only works when cursorShape is set to \"vintage\". Accepts values from 25-100.",
           "maximum": 100,
           "minimum": 25,
-          "type": "integer"
+          "type": ["integer","null"],
+          "default": 25
         },
         "cursorShape": {
           "default": "bar",
-          "description": "Sets the cursor shape for the profile. Possible values: \"vintage\" ( ▃ ), \"bar\" ( ┃, default ), \"underscore\" ( ▁ ), \"filledBox\" ( █ ), \"emptyBox\" ( ▯ )",
+          "description": "Sets the shape of the cursor. Possible values:\n -\"bar\" ( ┃, default )\n -\"emptyBox\" ( ▯ )\n -\"filledBox\" ( █ )\n -\"underscore\" ( ▁ )\n -\"vintage\" ( ▃ )",
           "enum": [
             "bar",
             "emptyBox",
@@ -580,20 +514,20 @@
           "type": "boolean"
         },
         "fontFace": {
-          "default": "Cascadia Code",
+          "default": "Cascadia Mono",
           "description": "Name of the font face used in the profile.",
           "type": "string"
         },
         "fontSize": {
           "default": 12,
-          "description": "Sets the font size.",
+          "description": "Size of the font in points.",
           "minimum": 1,
           "type": "integer"
         },
         "foreground": {
           "$ref": "#/definitions/Color",
           "default": "#cccccc",
-          "description": "Sets the foreground color of the profile. Overrides foreground set in color scheme if colorscheme is set. Uses hex color format: \"#rrggbb\".",
+          "description": "Sets the text color. Overrides \"foreground\" from the color scheme. Uses hex color format: \"#rrggbb\".",
           "type": ["string", "null"]
         },
         "guid": {
@@ -613,7 +547,7 @@
         },
         "icon": {
           "description": "Image file location of the icon used in the profile. Displays within the tab and the dropdown menu.",
-          "type": "string"
+          "type": ["string", "null"]
         },
         "name": {
           "description": "Name of the profile. Displays in the dropdown menu.",
@@ -622,7 +556,7 @@
         },
         "padding": {
           "default": "8, 8, 8, 8",
-          "description": "Sets the padding around the text within the window. Can have three different formats: \"#\" sets the same padding for all sides, \"#, #\" sets the same padding for left-right and top-bottom, and \"#, #, #, #\" sets the padding individually for left, top, right, and bottom.",
+          "description": "Sets the padding around the text within the window. Can have three different formats:\n -\"#\" sets the same padding for all sides \n -\"#, #\" sets the same padding for left-right and top-bottom\n -\"#, #, #, #\" sets the padding individually for left, top, right, and bottom.",
           "pattern": "^-?[0-9]+(\\.[0-9]+)?( *, *-?[0-9]+(\\.[0-9]+)?|( *, *-?[0-9]+(\\.[0-9]+)?){3})?$",
           "type": "string"
         },
@@ -636,8 +570,11 @@
           "type": "string"
         },
         "selectionBackground": {
-          "$ref": "#/definitions/Color",
-          "description": "Sets the selection background color of the profile. Overrides selection background set in color scheme if colorscheme is set. Uses hex color format: \"#rrggbb\"."
+          "oneOf": [
+            {"$ref": "#/definitions/Color"},
+            { "type": "null" }
+          ],
+          "description": "Sets the background color of selected text. Overrides selectionBackground set in the color scheme. Uses hex color format: \"#rrggbb\"."
         },
         "snapOnInput": {
           "default": true,
@@ -646,7 +583,7 @@
         },
         "source": {
           "description": "Stores the name of the profile generator that originated this profile.",
-          "type": "string"
+          "type": ["string", "null"]
         },
         "startingDirectory": {
           "description": "The directory the shell starts in when it is loaded.",
@@ -654,11 +591,12 @@
         },
         "suppressApplicationTitle": {
           "description": "When set to true, tabTitle overrides the default title of the tab and any title change messages from the application will be suppressed. When set to false, tabTitle behaves as normal.",
-          "type": "boolean"
+          "type": "boolean",
+          "default": false
         },
         "tabTitle": {
           "description": "If set, will replace the name as the title to pass to the shell on startup. Some shells (like bash) may choose to ignore this initial value, while others (cmd, powershell) may use this value over the lifetime of the application.",
-          "type": "string"
+          "type": ["string", "null"]
         },
         "useAcrylic": {
           "default": false,
@@ -789,37 +727,15 @@
       "type": "array"
     }
   },
-  "oneOf": [
+  "allOf": [
+    { "$ref": "#/definitions/Globals" },
     {
-      "allOf": [
-        { "$ref": "#/definitions/Globals" },
-        {
-          "additionalItems": true,
-          "properties": {
-            "profiles": {
-              "oneOf": [
-              { "$ref": "#/definitions/ProfileList" },
-              { "$ref": "#/definitions/ProfilesObject" }
-              ]
-            },
-            "schemes": { "$ref": "#/definitions/SchemeList" }
-          },
-          "required": [
-            "profiles",
-            "schemes",
-            "defaultProfile"
-          ]
-        }
-      ]
-    },
-    {
-      "additionalItems": false,
+      "additionalItems": true,
       "properties": {
-        "globals": { "$ref": "#/definitions/Globals" },
         "profiles": {
           "oneOf": [
-          { "$ref": "#/definitions/ProfileList" },
-          { "$ref": "#/definitions/ProfilesObject" }
+            { "$ref": "#/definitions/ProfileList" },
+            { "$ref": "#/definitions/ProfilesObject" }
           ]
         },
         "schemes": { "$ref": "#/definitions/SchemeList" }
@@ -827,7 +743,7 @@
       "required": [
         "profiles",
         "schemes",
-        "globals"
+        "defaultProfile"
       ]
     }
   ]

doc/specs/#4191 - Formatted Copy/spec.md

@@ -0,0 +1,88 @@
+---
+author: Kayla Cinnamon @cinnamon-msft
+created on: 2020-04-01
+last updated: 2020-04-07
+issue id: #4191
+---
+
+# Formatted Copy
+
+## Abstract
+
+When copying text, the Terminal should provide the option of including formatting. Not all apps that receive text allow for picking which format you want when pasting. The default should be to only copy plain text, based on the response from this poll on Twitter.
+
+![Twitter poll](twitter-poll.png)
+
+## Solution Proposals
+
+A proposal for the right click behavior as well as two user settings proposals are described below. The conclusion the team arrived at is at the bottom under the [Conclusions section](#conclusions).
+
+1. [Settings option 1 - global setting](#settings-option-1---global-setting)
+2. [Settings option 2 - key binding argument](#settings-option-2---key-binding-argument)
+3. [Right click behavior](#right-click-behavior)
+
+### Settings option 1 - global setting
+
+We could have a global setting that when enabled, would copy formatting to the clipboard on all copy operations.
+
+### Settings option 2 - key binding argument
+
+We could add an argument to the `copy` key binding argument to allow for formatted copying when the user chooses to do so.
+
+### Right click behavior
+
+By default, right clicking to copy would only copy the plain text.
+
+## UI/UX Design
+
+### Settings option 1 - global setting
+
+a. The user could list which kinds of formats they want included when they copy. When right clicking, they would copy with these formats.
+
+`"copyFormats": ["html","rtf","plain"]`
+
+b. We could also just combine html and rtf into a single boolean. Users would either get plain text only (`false`) or all formatting (`true`) onto their clipboard. If this is set to `true`, the default right click behavior is reversed: right clicking copies the formatting.
+
+`"copyFormatting": true`
+
+### Settings option 2 - key binding argument
+
+a. Just like the `trimWhitespace` argument you can add to the `copy` key binding, we could add one for text formatting. This would not change the right click behavior.
+
+`{"command": {"action": "copy", "keepFormatting": true}, "keys": "ctrl+a"}`
+
+b. We could also split out the html and rtf formats. The right click behavior would still stay as default.
+
+`{"command": {"action": "copy", "formats": ["html","rtf","plain"]}, "keys": "ctrl+a"}`
+
+## Capabilities
+
+### Accessibility
+
+This shouldn't affect accessibility.
+
+### Security
+
+This does not affect security.
+
+### Reliability
+
+This does not affect reliability.
+
+### Compatibility
+
+This breaks the existing behavior of always copying the formatting. The justification for breaking this default behavior is in response to the community saying the default should be plain text only.
+
+### Performance, Power, and Efficiency
+
+## Potential Issues
+
+One possible issue is that discovering how to copy the formatting might be difficult to find. We could mitigate this by adding it into the settings.json file and commenting it out.
+
+## Conclusions
+
+The team has decided to have plain text as the default copy behavior and to enable formatted copying with a global setting that accepts a boolean value (settings option 1 - global setting, option b). In the future, we can modify this setting to also accept an array, so the user can specify which formats they would like to copy. Additionally, a key binding can be added to allow for greater flexibility.
+
+## Future considerations
+
+We could always add an additional option if people want more flexibility. For example, if we ship a global setting now, we could ship a key binding later that lets you choose how you want to copy, and vice versa. Additionally, we can add functionality to the global setting that allows for specific formats or styles to be copied.

doc/specs/#607 - Commandline Arguments for the Windows Terminal.md

@@ -507,7 +507,7 @@ runtimeclass TerminalParameters {
 * [ ] Add a `ShortcutAction` for `FocusPane`, which accepts a single parameter
   `index`.
   - We'll need to track each `Pane`'s ID as `Pane`s are created, so that we can
-    quickly switch to the i'th `Pane`.
+    quickly switch to the nth `Pane`.
   - This is in order to support the `-t,--target` parameter of `split-pane`.
 
 ## Capabilities

doc/specs/drafts/#2046 - Command Palette.md

@@ -0,0 +1,427 @@
+---
+author: Mike Griese @zadjii-msft
+created on: 2019-08-01
+last updated: 2020-04-13
+issue id: 2046
+---
+
+_This is a draft spec. It should be considered a work-in-progress._
+
+# Command Palette
+
+## Abstract
+
+This spec covers the addition of a "command palette" to the Windows Terminal.
+The Command Palette is a GUI that the user can activate to search for and
+execute commands. Beneficially, the command palette allows the user to execute
+commands _even if they aren't bound to a keybinding_.
+
+## Inspiration
+
+This feature is largely inspired by the "Command Palette" in text editors like
+VsCode, Sublime Text and others.
+
+This spec was initially drafted in [a
+comment](https://github.com/microsoft/terminal/issues/2046#issuecomment-514219791)
+in [#2046]. That was authored during the annual Microsoft Hackathon, where I
+proceeded to prototype the solution. This spec is influenced by things I learned
+prototyping.
+
+## Solution Design
+
+First off, for the sake of clarity, we'll rename the `command` of a keybinding
+to `action`. This will help keep the mental model between commands and actions
+clearer. When deserializing keybindings, we'll include a check for the old
+`command` key to migrate it.
+
+We'll introduce a new top-level array to the user settings, under the key
+`commands`. `commands` will contain an array of commands, each with the
+following schema:
+
+```js
+{
+    "name": string,
+    "action": string,
+    "icon": string
+    "args": object?,
+}
+```
+
+Command names should be human-friendly names of actions, though they don't need
+to necessarily be related to the action that it fires. For example, a command
+with `newTab` as the action could have `"Open New Tab"` as the name.
+
+The command will be parsed into a new class, `Command`:
+
+```c++
+class Command
+{
+    winrt::hstring Name();
+    winrt::TerminalApp::ActionAndArgs ActionAndArgs();
+    winrt::hstring IconSource();
+}
+```
+
+We'll add another structure in GlobalAppSettings to hold all these actions. It
+will just be a `std::vector<Command>` in `GlobalAppSettings`.
+
+We'll need app to be able to turn this vector into a `ListView`, or similar, so
+that we can display this list of actions. Each element in the view will be
+intrinsically associated with the `Command` object it's associated with. In
+order to support this, we'll make `Command` a winrt type that implements
+`Windows.UI.Xaml.Data.INotifyPropertyChanged`. This will let us bind the XAML
+element to the winrt type.
+
+When an element is clicked on in the list of commands, we'll raise the event
+corresponding to that `ShortcutAction`. `AppKeyBindings` already does a great
+job of dispatching `ShortcutActions` (and their associated arguments), so we'll
+re-use that. We'll pull the basic parts of dispatching `ActionAndArgs`
+callbacks into another class, `ShortcutActionDispatch`, with a single
+`PerformAction(ActionAndArgs)` method (and events for each action).
+`AppKeyBindings` will be initialized with a reference to the
+`ShortcutActionDispatch` object, so that it can call `PerformAction` on it.
+Additionally, by having a singular `ShortcutActionDispatch` instance, we won't
+need to re-hook up the ShortcutAction keybindings each time we re-load the
+settings.
+
+In `App`, when someone clicks on an item in the list, we'll get the
+`ActionAndArgs` associated with that list element, and call PerformAction on
+the app's `ShortcutActionDispatch`. This will trigger the event handler just the
+same as pressing the keybinding.
+
+### Commands for each profile?
+
+[#3879] Is a request for being able to launch a profile directly, via the
+command palette. Essentially, the user will type the name of a profile, and hit
+enter to launch that profile. I quite like this idea, but with the current spec,
+this won't work great. We'd need to manually have one entry in the command
+palette for each profile, and every time the user adds a profile, they'd need to
+update the list of commands to add a new entry for that profile as well.
+
+This is a fairly complicated addition to this feature, so I'd hold it for
+"Command Palette v2", though I believe it's solution deserves special
+consideration from the outset.
+
+I suggest that we need a mechanism by which the user can specify a single
+command that would be expanded to one command for every profile in the list of
+profiles. Consider the following sample:
+
+```json
+    "commands": [
+        {
+            "expandOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": "New Tab with ${profile.name}",
+            "command": { "action": "newTab", "profile": "${profile.name}" }
+        },
+        {
+            "expandOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": "New Vertical Split with ${profile.name}",
+            "command": { "action": "splitPane", "split":"vertical", "profile": "${profile.name}" }
+        }
+    ],
+```
+
+In this example:
+* The `"expandOn": "profiles"` property indicates that each command should be
+  repeated for each individual profile.
+* The `${profile.name}` value is treated as "when expanded, use the given
+  profile's name". This allows each command to use the `name` and `icon`
+  properties of a `Profile` to customize the text of the command.
+
+To ensure that this works correctly, we'll need to make sure to expand these
+commands after all the other settings have been parsed, presumably in the
+`Validate` phase. If we do it earlier, it's possible that not all the profiles
+from various sources will have been added yet, which would lead to an incomplete
+command list.
+
+We'll need to have a placeholder property to indicate that a command should be
+expanded for each `Profile`. When the command is first parsed, we'll leave the
+format strings `${...}` unexpanded at this time. Then, in the validate phase,
+when we encounter a `"expandOn": "profiles"` command, we'll remove it from the
+list, and use it as a prototype to generate commands for every `Profile` in our
+profiles list. We'll do a string find-and-replace on the format strings to
+replace them with the values from the profile, before adding the completed
+command to the list of commands.
+
+Of course, how does this work with localization? Considering the [section
+below](#localization), we'd update the built-in commands to the following:
+
+```json
+    "commands": [
+        {
+            "iterateOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": { "key": "NewTabWithProfileCommandName" },
+            "command": { "action": "newTab", "profile": "${profile.name}" }
+        },
+        {
+            "iterateOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": { "key": "NewVerticalSplitWithProfileCommandName" },
+            "command": { "action": "splitPane", "split":"vertical", "profile": "${profile.name}" }
+        }
+    ],
+```
+
+In this example, we'll look up the `NewTabWithProfileCommandName` resource when
+we're first parsing the command, to find a string similar to `"New Tab with
+${profile.name}"`. When we then later expand the command, we'll see the
+`${profile.name}` bit from the resource, and expand that like we normally would.
+
+Trickily, we'll need to make sure to have a helper for replacing strings like
+this that can be used for general purpose arg parsing. As you can see, the
+`profile` property of the `newTab` command also needs the name of the profile.
+Either the command validation will need to go through and update these strings
+manually, or we'll need another of enabling these `IActionArgs` classes to fill
+those parameters in based on the profile being used. Perhaps the command
+pre-expansion could just stash the json for the action, then expand it later?
+This implementation detail is why this particular feature is not slated for
+inclusion in an initial Command Palette implementation.
+
+## UI/UX Design
+
+We'll add another action that can be used to toggle the visibility of the
+command palette. Pressing that keybinding will bring up the command palette.
+
+When the command palette appears, we'll want it to appear as a single overlay
+over all of the panes of the Terminal. The drop-down will be centered
+horizontally, dropping down from the top (from the tab row). When commands are
+entered, it will be implied that they are delivered to the focused terminal
+pane. This will help avoid two problematic scenarios that could arise from
+having the command palette attache to a single pane:
+  * When attached to a single pane, it might be very easy for the UI to quickly
+    become cluttered, especially at smaller pane sizes.
+  * This avoids the "find the overlay problem" which is common in editors like
+    VS where the dialog appears attached to the active editor pane.
+
+The palette will consist of two main UI elements: a text box for searching for
+commands, and a list of commands.
+
+The list of commands will be populated with all the commands by default. Each
+command will appear like a `MenuFlyoutItem`, with an icon at the left (if it has
+one) and the name visible. When opened, the palette will automatically highlight
+the first entry in the list.
+
+The user can navigate the list of entries with the arrow keys. Hitting enter
+will close the palette and execute the action that's highlighted. Hitting escape
+will dismiss the palette, returning control to the terminal. When the palette is
+closed for any reason (executing a command, dismissing with either escape or the
+`toggleCommandPalette` keybinding), we'll clear out any search text from the
+palette, so the user can start fresh again.
+
+We'll also want to enable the command palette to be filterable, so that the user
+can type the name of a command, and the command palette will automatically
+filter the list of commands. This should be more powerful then just a simple
+string compare - the user should be able to type a search string, and get all
+the commands that match a "fuzzy search" for that string. This will allow users
+to find the command they're looking for without needing to type the entire
+command.
+
+For example, consider the following list of commands:
+
+```json
+    "commands": [
+        { "icon": null, "name": "New Tab", "action": "newTab" },
+        { "icon": null, "name": "Close Tab", "action": "closeTab" },
+        { "icon": null, "name": "Close Pane", "action": "closePane" },
+        { "icon": null, "name": "[-] Split Horizontal", "action": "splitHorizontal" },
+        { "icon": null, "name": "[ | ] Split Vertical", "action": "splitVertical" },
+        { "icon": null, "name": "Next Tab", "action": "nextTab" },
+        { "icon": null, "name": "Prev Tab", "action": "prevTab" },
+        { "icon": null, "name": "Open Settings", "action": "openSettings" },
+        { "icon": null, "name": "Open Media Controls", "action": "openTestPane" }
+    ],
+```
+
+* "open" should return both "**Open** Settings" and "**Open** Media Controls".
+* "Tab" would return "New **Tab**", "Close **Tab**", "Next **Tab**" and "Prev
+  **Tab**".
+* "P" would return "Close **P**ane", "[-] S**p**lit Horizontal", "[ | ]
+  S**p**lit Vertical", "**P**rev Tab", "O**p**en Settings" and "O**p**en Media
+  Controls".
+* Even more powerfully, "sv" would return "[ | ] Split Vertical" (by matching
+  the **S** in "Split", then the **V** in "Vertical"). This is a great example
+  of how a user could execute a command with very few keystrokes.
+
+As the user types, we should **bold** each matching character in the command
+name, to show how their input correlates to the results on screen.
+
+## Capabilities
+
+### Accessibility
+
+As the entire command palette will be a native XAML element, it'll automatically
+be hooked up to the UIA tree, allowing for screen readers to naturally find it.
+ * When the palette is opened, it will automatically receive focus.
+ * The terminal panes will not be able to be interacted with while the palette
+   is open, which will help keep the UIA tree simple while the palette is open.
+
+### Security
+
+This should not introduce any _new_ security concerns. We're relying on the
+security of jsoncpp for parsing json. Adding new keys to the settings file
+will rely on jsoncpp's ability to securely parse those json values.
+
+### Reliability
+
+We'll need to make sure that invalid commands are ignored. A command could be
+invalid because:
+* it has a null `name`, or a name with the empty string for a value.
+* it has a null `action`, or an action specified that's not an actual
+  `ShortcutAction`.
+
+We'll ignore invalid commands from the user's settings, instead of hard
+crashing. I don't believe this is a scenario that warrants an error dialog to
+indicate to the user that there's a problem with the json.
+
+### Compatibility
+
+We will need to define default _commands_ for all the existing keybinding
+commands. With #754, we could add all the actions (that make sense) as commands
+to the commands list, so that everyone wouldn't need to define them manually.
+
+### Performance, Power, and Efficiency
+
+We'll be adding a few extra XAML elements to our tree which will certainly
+increase our runtime memory footprint while the palette is open.
+
+We'll additionally be introducing a few extra json values to parse, so that could
+increase our load times (though this will likely be negligible).
+
+## Potential Issues
+
+This will first require the work in [#1205] to work properly. Right now we
+heavily lean on the "focused" element to determine which terminal is "active".
+However, when the command palette is opened, focus will move out of the terminal
+control into the command palette, which leads to some hard to debug crashes.
+
+Additionally, we'll need to ensure that the "fuzzy search" algorithm proposed
+above will work for non-english languages, where a single character might be
+multiple `char`s long. As we'll be using a standard XAML text box for input, we
+won't need to worry about handling the input ourselves.
+
+### Localization
+
+Because we'll be shipping a set of default commands with the terminal, we should
+make sure that list of commands can be localizable. Each of the names we'll give
+to the commands should be locale-specific.
+
+To facilitate this, we'll use a special type of object in JSON that will let us
+specify a resource name in JSON. We'll use a syntax like the following to
+suggest that we should load a string from our resources, as opposed to using the
+value from the file:
+
+```json
+    "commands": [
+        { "icon": null, "name": { "key": "NewTabCommandName" }, "action": "newTab" },
+        { "icon": null, "name": { "key": "CloseTabCommandKey" }, "action": "closeTab" },
+        { "icon": null, "name": { "key": "ClosePaneCommandKey" }, "action": "closePane" },
+        { "icon": null, "name": { "key": "SplitHorizontalCommandKey" }, "action": "splitHorizontal" },
+        { "icon": null, "name": { "key": "SplitVerticalCommandKey" }, "action": "splitVertical" },
+        { "icon": null, "name": { "key": "NextTabCommandKey" }, "action": "nextTab" },
+        { "icon": null, "name": { "key": "PrevTabCommandKey" }, "action": "prevTab" },
+        { "icon": null, "name": { "key": "OpenSettingsCommandKey" }, "action": "openSettings" },
+    ],
+```
+
+We'll check at parse time if the `name` property is a string or an object. If
+it's a string, we'll treat that string as the literal text. Otherwise, if it's
+an object, we'll attempt to use the `key` property of that object to look up a
+string from our `ResourceDictionary`. This way, we'll be able to ship localized
+strings for all the built-in commands, while also allowing the user to easily
+add their own commands.
+
+During the spec review process, we considered other options for localization as
+well. The original proposal included options such as having one `defaults.json`
+file per-locale, and building the Terminal independently for each locale. Those
+were not really feasible options, so we instead settled on this solution, as it
+allowed us to leverage the existing localization support provided to us by the
+platform.
+
+The `{ "key": "resourceName" }` solution proposed here was also touched on in
+[#5280].
+
+
+## Future considerations
+
+* Commands will provide an easy point for allowing an extension to add its
+  actions to the UI, without forcing the user to bind the extension's actions to
+  a keybinding
+* Also discussed in [#2046] was the potential for adding a command that inputs a
+  certain commandline to be run by the shell. I felt that was out of scope for
+  this spec, so I'm not including it in detail. I believe that would be
+  accomplished by adding a `inputCommand` action, with two args: `commandline`,
+  a string, and `suppressNewline`, an optional bool, defaulted to false. The
+  `inputCommand` action would deliver the given `commandline` as input to the
+  connection, followed by a newline (as to execute the command).
+  `suppressNewline` would prevent the newline from being added. This would work
+  relatively well, so long as you're sitting at a shell prompt. If you were in
+  an application like `vim`, this might be handy for executing a sequence of
+  vim-specific keybindings. Otherwise, you're just going to end up writing a
+  commandline to the buffer of vim. It would be weird, but not unexpected.
+* Additionally mentioned in [#2046] was the potential for profile-scoped
+  commands. While that's a great idea, I believe it's out of scope for this
+  spec.
+* Once [#754] lands, we'll need to make sure to include commands for each action
+  manually in the default settings. This will add some overhead that the
+  developer will need to do whenever they add an action. That's unfortunate, but
+  will be largely beneficial to the end user.
+* We could theoretically also display the keybinding for a certain command in
+  the `ListViewItem` for the command. We'd need some way to correlate a
+  command's action to a keybinding's action. This could be done in a follow-up
+  task.
+* We might want to alter the fuzzy-search algorithm, to give higher precedence
+  in the results list to commands with more consecutive matching characters.
+  Alternatively we could give more weight to commands where the search matched
+  the initial character of words in the command.
+  - For example: `ot` would give more weight to "**O**pen **T**ab" than
+    "**O**pen Se**t**tings").
+* Another idea for a future spec is the concept of "nested commands", where a
+  single command has many sub-commands. This would hide the children commands
+  from the entire list of commands, allowing for much more succinct top-level
+  list of commands, and allowing related commands to be grouped together.
+  - For example, I have a text editor plugin that enables rendering markdown to
+    a number of different styles. To use that command in my text editor, first I
+    hit enter on the "Render Markdown..." command, then I select which style I
+    want to render to, in another list of options. This way, I don't need to
+    have three options for "Render Markdown to github", "Render Markdown to
+    gitlab", all in the top-level list.
+  - We probably also want to allow a nested command set to be evaluated at
+    runtime somehow. Like if we had a "Open New Tab..." command that then had a
+    nested menu with the list of profiles.
+* We may want to add a button to the New Tab Button's dropdown to "Show Command
+  Palette". I'm hesitant to keep adding new buttons to that UI, but the command
+  palette is otherwise not highly discoverable.
+  - We could add another button to the UI to toggle the visibility of the
+    command palette. This was the idea initially proposed in [#2046].
+  - For both these options, we may want a global setting to hide that button, to
+    keep the UI as minimal as possible.
+* [#1571] is a request for customizing the "new tab dropdown" menu. When we get
+  to discussing that design, we should consider also enabling users to add
+  commands from their list of commands to that menu as well.
+
+## Resources
+Initial post that inspired this spec: #[2046](https://github.com/microsoft/terminal/issues/2046)
+
+Keybindings args: #[1349](https://github.com/microsoft/terminal/pull/1349)
+
+Cascading User & Default Settings: #[754](https://github.com/microsoft/terminal/issues/754)
+
+Untie "active control" from "currently XAML-focused control" #[1205](https://github.com/microsoft/terminal/issues/1205)
+
+Allow dropdown menu customization in profiles.json [#1571](https://github.com/microsoft/terminal/issues/1571)
+
+Search or run a command in Dropdown menu [#3879]
+
+Spec: Introduce a mini-specification for localized resource use from JSON [#5280]
+
+<!-- Footnotes -->
+[#754]: https://github.com/microsoft/terminal/issues/754
+[#1205]: https://github.com/microsoft/terminal/issues/1205
+[#1142]: https://github.com/microsoft/terminal/pull/1349
+[#2046]: https://github.com/microsoft/terminal/issues/2046
+[#1571]: https://github.com/microsoft/terminal/issues/1571
+[#3879]: https://github.com/microsoft/terminal/issues/3879
+[#5280]: https://github.com/microsoft/terminal/pull/5280

doc/specs/drafts/576-ProfilesJumplistSpec.md

@@ -0,0 +1,127 @@
+---
+author: Brandon Chong @dsafa
+created on: 2019-06-20
+last updated: 2019-06-20
+issue id: 576
+---
+
+# Add Profiles To Jumplist
+
+## Abstract
+
+This spec outlines adding support for launching a profile from the jumplist. The main two points that will be detailed are:
+1. Adding jumplist support
+2. Adding the ability to open a profile from the jumplist
+
+The profiles available in the jumplist will match the profiles available in the application from the + dropdown. The scope of the jumplist feature is limited to desktop devices.
+
+## Inspiration
+The inspiration is to be able to quickly open the terminal with one of the configured profiles.
+
+## Terminology
+- Jumplist: This is the menu that appears when the application is right-clicked on the taskbar or the start menu.
+
+## Solution Design
+
+### Overview
+The jumplist has to be created/modified during the life-cycle of the application. The following is an outline of the steps to be performed (more details below)
+1. Load settings / profiles
+2. Create the jumplist with the initial profiles
+3. Maintain sync between the jumplist and profiles throughout the life of the application
+
+### Jumplist integration
+UWP provides an API to access to the jumplist through the [Windows.UI.StartScreen.JumpList class](https://docs.microsoft.com/en-us/uwp/api/windows.ui.startscreen.jumplist), however from previous attempts [1], the api does not work for the project architecture.
+Instead, we'll use the COM interface [ICustomDestinationList](https://docs.microsoft.com/en-us/windows/desktop/api/shobjidl_core/nn-shobjidl_core-icustomdestinationlist) [2] directly to create the jumplist. Since we are using Win32 apis, the work should be done in the `WindowsTerminal` project.
+
+Using `ICustomDestinationList` is straightforward with a few additions discussed in this section [below](#Implementation-notes). Resources for using the jumplist can be found [here](https://msdn.microsoft.com/en-us/library/windows/desktop/gg281362.aspx) and [here](https://www.codeproject.com/Articles/36561/Windows-7-Goodies-in-C-Jump-Lists).
+
+The basic overview:
+1. Get an instance of the `ICustomDestinationList` COM object
+2. Call `ICustomDestinationList.BeginList`
+3. Create an `IObjectCollection` COM object
+4. Create `IShellLink` COM objects for each profile and add them to the `IObjectCollection`
+5. Add the `IObjectCollection` to the `ICustomDestinationList`
+6. Call `ICustomDestination.CommitList`
+
+Note that the jumplist is replaced each time, instead of being updated.
+
+#### Approach
+One approach is to wrap the COM interfaces in a jumplist class and use that to add and remove items.
+
+#### What if there are multiple instances of the terminal application?
+There maybe multiple instances trying to update the jumplist at the same time.
+
+### Adding profiles to the jumplist
+To add the profiles to the jumplist there are some prerequisites that are needed
+- Be able to access settings / profiles from the `WindowsTerminal` project.
+- Detect when profiles are modified
+  - Created: Add a new profile to the jumplist when a new profile is created by the user
+  - Deleted: Remove the profile from the jumplist when the profile is removed by the user
+  - Modified: We'll have to sync profile name changes / icon changes with the jump list
+
+There are also different "categories" that we could add the profiles to. A jumplist can have items in a system category such as `Recent` or `Frequent` or a custom category. Jumplist items can also be a task. The difference between adding an item to a category or the task list is that items in a category can be `pinned` and `removed` from the jumplist by the user. Here is a summary of the two from the documentation [2]:
+- `Destinations can be files, folders, websites, or other content-based items, but are not necessarily file-backed. Destinations can be thought of as things or nouns`
+- `Tasks are common actions performed in an application that apply to all users of that application regardless of an individual's usage patterns. Tasks can be thought of as actions or verbs`
+
+Following this, it would be more appropriate to add the profiles to the `Tasks` list as we are launching a profile. Essentially each item in the jumplist will be a shortcut that opens the terminal and provides command line arguments.
+
+#### Implementation notes
+When specifying the icon to use in the `IShellLink` object, it does not appear to be able to read `ms-appx://` URIs such as ones for the default profile icons and also only able to read `.ico` files. The way that the UWP api is able to do it is by adding additional `PropertyKey`s to the `IShellLink` object [3]. Using these tools [JumpList](https://github.com/EricZimmerman/JumpList) and [Lnk Explorer](https://github.com/EricZimmerman/LECmd), we can examine what is different with UWP jumplists. When we examine the `.lnk` items that the jumplist uses, we can see that additional properties are added to the property store.
+
+| Property Key (Format ID\Property ID)     | Description                                  | Example Value                                                      |
+| ---------------------------------------- | -------------------------------------------- | ------------------------------------------------------------------ |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\28  | App User Model DestList Provided Description |                                                                    |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\27  | App User Model DestList Provided Title       | Windows PowerShell                                                 |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\30  | App User Model DestList Provided Group Name  | Profiles                                                           |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\29  | App User Model DestList Logo Uri             | ms-appx:///ProfileIcons/{61c54bbd-c2c6-5271-96e7-009a87ff44bf}.png |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\5   | App User Model ID                            | WindowsTerminalDev_8wekyb3d8bbwe!App                               |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\20  | App User Model Activation Context            | {61c54bbd-c2c6-5271-96e7-009a87ff44bf}                             |
+| {436F2667-14E2-4FEB-B30A-146C53B5B674}\100 | Link Arguments                               | {61c54bbd-c2c6-5271-96e7-009a87ff44bf}                             |
+| {F29F85E0-4FF9-1068-AB91-08002B27B3D9}\2   | (Description not available)                  | Windows PowerShell                                                 |
+
+If we look at the property key `9f4c2855-9f79-4b39-a8d0-e1d42de1d5f3\29`, it specifies the uri for the icon and supports the `ms-appx://` scheme. So for icon support we can add that property key when creating the `IShellLink`. Also note that with this approach, it needs the `file://` uri scheme in the path for custom icons.
+
+### Launching the terminal from the jumplist
+The jumplist will launch the terminal by calling the executable alias `wt.exe` with arguments to indicate the profile. The command line arguments to use are tracked in issue [#607](https://github.com/microsoft/terminal/issues/607)
+
+## UI/UX Design
+No UI changes are needed. The jumplist is provided by Windows.
+
+### Localization
+Depending on how the jump list items will be worded.
+
+### Profile order
+The order of the profiles in the jumplist should match the order within the application.
+
+## Capabilities
+
+### Accessibility
+Will be provided by what Windows supports for jump lists
+
+### Security
+Should not introduce any new security issues
+
+### Reliability
+Should not introduce any new reliability issues
+
+### Compatibility
+Will have to add the ability to get notified of changes to the profile settings.
+
+### Performance, Power, and Efficiency
+The jumplist will have to be saved each time a profile change occurs but the frequency would be expected to be low.
+
+## Potential Issues
+
+#### Should it open a new instance of the terminal or open in a new tab?
+
+#### What should happen if a non existant profile is launched
+The jumplist is only updated when the application is running so the profiles could be modified or deleted outside and the jumplist will not be updated. Handling will be done by whatever handles the command line parsing.
+
+## Future considerations
+Other things could potentially be added to the jumplist other than profiles.
+
+## Resources
+
+- [1] [Original feature request: issue #576](https://github.com/microsoft/terminal/issues/576)
+- [2] [ICustomDestinationList](https://docs.microsoft.com/en-us/windows/desktop/api/shobjidl_core/nn-shobjidl_core-icustomdestinationlist)
+- [3] [Windows property system](https://docs.microsoft.com/en-us/windows/desktop/properties/property-system-overview)

doc/user-docs/ThirdPartyToolProfiles.md

@@ -2,7 +2,7 @@
 
 This doc will hopefully provide a useful guide for adding profiles for common
 third-party tools to your
-[profiles.json](https://github.com/microsoft/terminal/blob/master/doc/user-docs/UsingJsonSettings.md)
+[settings.json](https://github.com/microsoft/terminal/blob/master/doc/user-docs/UsingJsonSettings.md)
 file.
 
 All of these profiles are provided _without_ their `guid` set. If you'd like to

doc/user-docs/UsingJsonSettings.md

@@ -1,15 +1,15 @@
 # Editing Windows Terminal JSON Settings
 
 One way (currently the only way) to configure Windows Terminal is by editing the
-`profiles.json` settings file. At the time of writing you can open the settings
+`settings.json` settings file. At the time of writing you can open the settings
 file in your default editor by selecting `Settings` from the WT pull down menu.
 
-The settings are stored in the file `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe\LocalState\profiles.json`.
+The settings are stored in the file `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe\LocalState\settings.json`.
 
 As of [#2515](https://github.com/microsoft/terminal/pull/2515), the settings are
-split into _two_ files: a hardcoded `defaults.json`, and `profiles.json`, which
+split into _two_ files: a hardcoded `defaults.json`, and `settings.json`, which
 contains the user settings. Users should only be concerned with the contents of
-the `profiles.json`, which contains their customizations. The `defaults.json`
+the `settings.json`, which contains their customizations. The `defaults.json`
 file is only provided as a reference of what the default settings are. For more
 details on how these two files work, see [Settings
 Layering](#settings-layering). To view the default settings file, click on the
@@ -164,7 +164,7 @@ The values for background image stretch mode are documented [here](https://docs.
 ### Hiding a profile
 
 If you want to remove a profile from the list of profiles in the new tab
-dropdown, but keep the profile around in your `profiles.json` file, you can add
+dropdown, but keep the profile around in your `settings.json` file, you can add
 the property `"hidden": true` to the profile's json. This can also be used to
 remove the default `cmd` and PowerShell profiles, if the user does not wish to
 see them.
@@ -198,10 +198,10 @@ The runtime settings are actually constructed from _three_ sources:
   profiles for both Windows PowerShell and Command Prompt (`cmd.exe`).
 * Dynamic Profiles, which are generated at runtime. These include Powershell
   Core, the Azure Cloud Shell connector, and profiles for and WSL distros.
-* The user settings from `profiles.json`.
+* The user settings from `settings.json`.
 
 Settings from each of these sources are "layered" upon the settings from
-previous sources. In this manner, the user settings in `profiles.json` can
+previous sources. In this manner, the user settings in `settings.json` can
 contain _only the changes from the default settings_. For example, if a user
 would like to only change the color scheme of the default `cmd` profile to
 "Solarized Dark", you could change your cmd profile to the following:
@@ -220,7 +220,7 @@ with that GUID will all be treated as the same object. Any changes in that
 profile will overwrite those from the defaults.
 
 Similarly, you can overwrite settings from a color scheme by defining a color
-scheme in `profiles.json` with the same name as a default color scheme.
+scheme in `settings.json` with the same name as a default color scheme.
 
 If you'd like to unbind a keystroke that's bound to an action in the default
 keybindings, you can set the `"command"` to `"unbound"` or `null`. This will
@@ -230,9 +230,9 @@ performing the default action.
 ### Dynamic Profiles
 
 When dynamic profiles are created at runtime, they'll be added to the
-`profiles.json` file. You can identify these profiles by the presence of a
+`settings.json` file. You can identify these profiles by the presence of a
 `"source"` property. These profiles are tied to their source - if you uninstall
-a linux distro, then the profile will remain in your `profiles.json` file, but
+a linux distro, then the profile will remain in your `settings.json` file, but
 the profile will be hidden.
 
 The Windows Terminal uses the `guid` property of these dynamically-generated
@@ -246,7 +246,7 @@ like to hide all the WSL profiles, you could add the following setting:
 
 ```json
 
-    "disabledProfileSources": ["Microsoft.Terminal.WSL"],
+    "disabledProfileSources": ["Windows.Terminal.WSL"],
     ...
 
 ```
@@ -371,7 +371,7 @@ In the above settings, the `"fontFace"` in the `cmd.exe` profile overrides the
 1. Download the [Debian JPG logo](https://www.debian.org/logos/openlogo-100.jpg)
 2. Put the image in the
  `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_<randomString>\LocalState\`
- directory (same directory as your `profiles.json` file).
+ directory (same directory as your `settings.json` file).
 
     __NOTE__:  You can put the image anywhere you like, the above suggestion happens to be convenient.
 3. Open your WT json properties file.
@@ -392,7 +392,7 @@ Notes:
 
 1. You will need to experiment with different color settings
 and schemes to make your terminal text visible on top of your image
-2. If you store the image in the UWP directory (the same directory as your profiles.json file),
+2. If you store the image in the UWP directory (the same directory as your settings.json file),
 then you should use the URI style path name given in the above example.
 More information about UWP URI schemes [here](https://docs.microsoft.com/en-us/windows/uwp/app-resources/uri-schemes).
 3. Instead of using a UWP URI you can use a:
@@ -414,7 +414,7 @@ following objects into your `globals.keybindings` array:
 { "command": "paste", "keys": ["ctrl+shift+v"] }
 ```
 
-> 👉 **Note**: you can also add a keybinding for the `copyTextWithoutNewlines` command. This removes newlines as the text is copied to your clipboard.
+> 👉 **Note**: you can also add a keybinding for the `copy` command with the argument `"trimWhitespace": true`. This removes newlines as the text is copied to your clipboard.
 
 This will add copy and paste on <kbd>ctrl+shift+c</kbd>
 and <kbd>ctrl+shift+v</kbd> respectively.

doc/user-docs/index.md

@@ -65,7 +65,7 @@ Not currently supported "out of the box". See issue [#1060](https://github.com/m
 
 ## Configuring Windows Terminal
 
-All Windows Terminal settings are currently managed using the `profiles.json` file, located within `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe/LocalState`.
+All Windows Terminal settings are currently managed using the `settings.json` file, located within `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe/LocalState`.
 
 To open the settings file from Windows Terminal:
 
@@ -73,7 +73,7 @@ To open the settings file from Windows Terminal:
 2. From the dropdown list, click `Settings`. You can also use a shortcut: <kbd>Ctrl</kbd>+<kbd>,</kbd>.
 3. Your default `json` editor will open the settings file.
 
-For an introduction to the various settings, see [Using Json Settings](UsingJsonSettings.md). The list of valid settings can be found in the [profiles.json documentation](../cascadia/SettingsSchema.md) section.
+For an introduction to the various settings, see [Using Json Settings](UsingJsonSettings.md). The list of valid settings can be found in the [settings.json documentation](../cascadia/SettingsSchema.md) section.
 
 ## Tips and Tricks
 

res/README.md

@@ -17,5 +17,5 @@ Please consult the [license](https://raw.githubusercontent.com/microsoft/cascadi
 
 ### Fonts Included
 
-* Cascadia Code
+* Cascadia Code, Cascadia Mono
    * from microsoft/cascadia-code@d733599504811e8f3969de20368817d20e162dba

src/buffer/out/textBuffer.cpp

@@ -1967,11 +1967,8 @@ HRESULT TextBuffer::Reflow(TextBuffer& oldBuffer,
                            const std::optional<Viewport> lastCharacterViewport,
                            std::optional<std::reference_wrapper<PositionInformation>> positionInfo)
 {
-    Cursor& oldCursor = oldBuffer.GetCursor();
+    const Cursor& oldCursor = oldBuffer.GetCursor();
     Cursor& newCursor = newBuffer.GetCursor();
-    // skip any drawing updates that might occur as we manipulate the new buffer
-    oldCursor.StartDeferDrawing();
-    newCursor.StartDeferDrawing();
 
     // We need to save the old cursor position so that we can
     // place the new cursor back on the equivalent character in
@@ -2197,8 +2194,5 @@ HRESULT TextBuffer::Reflow(TextBuffer& oldBuffer,
         newCursor.SetSize(ulSize);
     }
 
-    newCursor.EndDeferDrawing();
-    oldCursor.EndDeferDrawing();
-
     return hr;
 }

src/cascadia/CascadiaPackage/Package.appxmanifest

@@ -74,6 +74,7 @@
     <uap7:Extension Category="windows.sharedFonts">
       <uap7:SharedFonts>
         <uap4:Font File="Cascadia.ttf" />
+        <uap4:Font File="CascadiaMono.ttf" />
       </uap7:SharedFonts>
     </uap7:Extension>
   </Extensions>

src/cascadia/CascadiaResources.build.items

@@ -11,6 +11,10 @@
       <DeploymentContent>true</DeploymentContent>
       <Link>%(RecursiveDir)%(FileName)%(Extension)</Link>
     </Content>
+    <Content Include="$(OpenConsoleDir)res\CascadiaMono.ttf" Condition="'$(WindowsTerminalReleaseBuild)'=='true'">
+      <DeploymentContent>true</DeploymentContent>
+      <Link>%(RecursiveDir)%(FileName)%(Extension)</Link>
+    </Content>
     <!-- Profile Icons -->
     <Content Include="$(OpenConsoleDir)src\cascadia\CascadiaPackage\ProfileIcons\**\*">
       <DeploymentContent>true</DeploymentContent>

src/cascadia/LocalTests_TerminalApp/CommandlineTest.cpp

@@ -590,7 +590,7 @@ namespace TerminalAppLocalTests
             VERIFY_IS_NOT_NULL(actionAndArgs.Args());
             auto myArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
             VERIFY_IS_NOT_NULL(myArgs);
-            VERIFY_ARE_EQUAL(SplitState::Vertical, myArgs.SplitStyle());
+            VERIFY_ARE_EQUAL(SplitState::Automatic, myArgs.SplitStyle());
             VERIFY_IS_NOT_NULL(myArgs.TerminalArgs());
         }
         {
@@ -650,7 +650,7 @@ namespace TerminalAppLocalTests
             VERIFY_IS_NOT_NULL(actionAndArgs.Args());
             auto myArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
             VERIFY_IS_NOT_NULL(myArgs);
-            VERIFY_ARE_EQUAL(SplitState::Vertical, myArgs.SplitStyle());
+            VERIFY_ARE_EQUAL(SplitState::Automatic, myArgs.SplitStyle());
             VERIFY_IS_NOT_NULL(myArgs.TerminalArgs());
             VERIFY_IS_FALSE(myArgs.TerminalArgs().Commandline().empty());
             VERIFY_IS_TRUE(myArgs.TerminalArgs().StartingDirectory().empty());
@@ -704,7 +704,7 @@ namespace TerminalAppLocalTests
             VERIFY_IS_NOT_NULL(actionAndArgs.Args());
             auto myArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
             VERIFY_IS_NOT_NULL(myArgs);
-            VERIFY_ARE_EQUAL(SplitState::Vertical, myArgs.SplitStyle());
+            VERIFY_ARE_EQUAL(SplitState::Automatic, myArgs.SplitStyle());
             VERIFY_IS_NOT_NULL(myArgs.TerminalArgs());
             VERIFY_IS_FALSE(myArgs.TerminalArgs().Commandline().empty());
             VERIFY_IS_TRUE(myArgs.TerminalArgs().StartingDirectory().empty());

src/cascadia/LocalTests_TerminalApp/KeyBindingsTests.cpp

@@ -170,21 +170,18 @@ namespace TerminalAppLocalTests
     {
         const std::string bindings0String{ R"([
             { "command": "copy", "keys": ["ctrl+c"] },
-            { "command": "copyTextWithoutNewlines", "keys": ["alt+c"] },
-            { "command": { "action": "copy", "trimWhitespace": false }, "keys": ["ctrl+shift+c"] },
-            { "command": { "action": "copy", "trimWhitespace": true }, "keys": ["alt+shift+c"] },
+            { "command": { "action": "copy", "singleLine": false }, "keys": ["ctrl+shift+c"] },
+            { "command": { "action": "copy", "singleLine": true }, "keys": ["alt+shift+c"] },
 
             { "command": "newTab", "keys": ["ctrl+t"] },
             { "command": { "action": "newTab", "index": 0 }, "keys": ["ctrl+shift+t"] },
-            { "command": "newTabProfile0", "keys": ["alt+shift+t"] },
             { "command": { "action": "newTab", "index": 11 }, "keys": ["ctrl+shift+y"] },
-            { "command": "newTabProfile8", "keys": ["alt+shift+y"] },
 
             { "command": { "action": "copy", "madeUpBool": true }, "keys": ["ctrl+b"] },
             { "command": { "action": "copy" }, "keys": ["ctrl+shift+b"] },
 
-            { "command": "increaseFontSize", "keys": ["ctrl+f"] },
-            { "command": "decreaseFontSize", "keys": ["ctrl+g"] }
+            { "command": { "action": "adjustFontSize", "delta": 1 }, "keys": ["ctrl+f"] },
+            { "command": { "action": "adjustFontSize", "delta": -1 }, "keys": ["ctrl+g"] }
 
         ])" };
 
@@ -194,28 +191,17 @@ namespace TerminalAppLocalTests
         VERIFY_IS_NOT_NULL(appKeyBindings);
         VERIFY_ARE_EQUAL(0u, appKeyBindings->_keyShortcuts.size());
         appKeyBindings->LayerJson(bindings0Json);
-        VERIFY_ARE_EQUAL(13u, appKeyBindings->_keyShortcuts.size());
+        VERIFY_ARE_EQUAL(10u, appKeyBindings->_keyShortcuts.size());
 
         {
             Log::Comment(NoThrowString().Format(
-                L"Verify that `copy` without args parses as Copy(TrimWhitespace=true)"));
+                L"Verify that `copy` without args parses as Copy(SingleLine=false)"));
             KeyChord kc{ true, false, false, static_cast<int32_t>('C') };
             auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
             const auto& realArgs = actionAndArgs.Args().try_as<CopyTextArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_IS_TRUE(realArgs.TrimWhitespace());
-        }
-
-        {
-            Log::Comment(NoThrowString().Format(
-                L"Verify that `copyTextWithoutNewlines` parses as Copy(TrimWhitespace=false)"));
-            KeyChord kc{ false, true, false, static_cast<int32_t>('C') };
-            auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
-            const auto& realArgs = actionAndArgs.Args().try_as<CopyTextArgs>();
-            VERIFY_IS_NOT_NULL(realArgs);
-            // Verify the args have the expected value
-            VERIFY_IS_FALSE(realArgs.TrimWhitespace());
+            VERIFY_IS_FALSE(realArgs.SingleLine());
         }
 
         {
@@ -226,7 +212,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<CopyTextArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_IS_FALSE(realArgs.TrimWhitespace());
+            VERIFY_IS_FALSE(realArgs.SingleLine());
         }
 
         {
@@ -237,7 +223,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<CopyTextArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_IS_TRUE(realArgs.TrimWhitespace());
+            VERIFY_IS_TRUE(realArgs.SingleLine());
         }
 
         {
@@ -265,19 +251,6 @@ namespace TerminalAppLocalTests
             VERIFY_IS_NOT_NULL(realArgs.TerminalArgs().ProfileIndex());
             VERIFY_ARE_EQUAL(0, realArgs.TerminalArgs().ProfileIndex().Value());
         }
-        {
-            Log::Comment(NoThrowString().Format(
-                L"Verify that `newTabProfile0` parses as NewTab(Index=0)"));
-            KeyChord kc{ false, true, true, static_cast<int32_t>('T') };
-            auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
-            VERIFY_ARE_EQUAL(ShortcutAction::NewTabProfile0, actionAndArgs.Action());
-            const auto& realArgs = actionAndArgs.Args().try_as<NewTabArgs>();
-            VERIFY_IS_NOT_NULL(realArgs);
-            // Verify the args have the expected value
-            VERIFY_IS_NOT_NULL(realArgs.TerminalArgs());
-            VERIFY_IS_NOT_NULL(realArgs.TerminalArgs().ProfileIndex());
-            VERIFY_ARE_EQUAL(0, realArgs.TerminalArgs().ProfileIndex().Value());
-        }
         {
             Log::Comment(NoThrowString().Format(
                 L"Verify that `newTab` with an index greater than the legacy "
@@ -292,19 +265,6 @@ namespace TerminalAppLocalTests
             VERIFY_IS_NOT_NULL(realArgs.TerminalArgs().ProfileIndex());
             VERIFY_ARE_EQUAL(11, realArgs.TerminalArgs().ProfileIndex().Value());
         }
-        {
-            Log::Comment(NoThrowString().Format(
-                L"Verify that `newTabProfile8` parses as NewTab(Index=8)"));
-            KeyChord kc{ false, true, true, static_cast<int32_t>('Y') };
-            auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
-            VERIFY_ARE_EQUAL(ShortcutAction::NewTabProfile8, actionAndArgs.Action());
-            const auto& realArgs = actionAndArgs.Args().try_as<NewTabArgs>();
-            VERIFY_IS_NOT_NULL(realArgs);
-            // Verify the args have the expected value
-            VERIFY_IS_NOT_NULL(realArgs.TerminalArgs());
-            VERIFY_IS_NOT_NULL(realArgs.TerminalArgs().ProfileIndex());
-            VERIFY_ARE_EQUAL(8, realArgs.TerminalArgs().ProfileIndex().Value());
-        }
 
         {
             Log::Comment(NoThrowString().Format(
@@ -315,7 +275,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<CopyTextArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_IS_TRUE(realArgs.TrimWhitespace());
+            VERIFY_IS_FALSE(realArgs.SingleLine());
         }
 
         {
@@ -327,15 +287,15 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<CopyTextArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_IS_TRUE(realArgs.TrimWhitespace());
+            VERIFY_IS_FALSE(realArgs.SingleLine());
         }
 
         {
             Log::Comment(NoThrowString().Format(
-                L"Verify that `increaseFontSize` without args parses as AdjustFontSize(Delta=1)"));
+                L"Verify that `adjustFontSize` with a positive delta parses args correctly"));
             KeyChord kc{ true, false, false, static_cast<int32_t>('F') };
             auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
-            VERIFY_ARE_EQUAL(ShortcutAction::IncreaseFontSize, actionAndArgs.Action());
+            VERIFY_ARE_EQUAL(ShortcutAction::AdjustFontSize, actionAndArgs.Action());
             const auto& realArgs = actionAndArgs.Args().try_as<AdjustFontSizeArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
@@ -344,10 +304,10 @@ namespace TerminalAppLocalTests
 
         {
             Log::Comment(NoThrowString().Format(
-                L"Verify that `decreaseFontSize` without args parses as AdjustFontSize(Delta=-1)"));
+                L"Verify that `adjustFontSize` with a negative delta parses args correctly"));
             KeyChord kc{ true, false, false, static_cast<int32_t>('G') };
             auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
-            VERIFY_ARE_EQUAL(ShortcutAction::DecreaseFontSize, actionAndArgs.Action());
+            VERIFY_ARE_EQUAL(ShortcutAction::AdjustFontSize, actionAndArgs.Action());
             const auto& realArgs = actionAndArgs.Args().try_as<AdjustFontSizeArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
@@ -358,8 +318,6 @@ namespace TerminalAppLocalTests
     void KeyBindingsTests::TestSplitPaneArgs()
     {
         const std::string bindings0String{ R"([
-            { "keys": ["ctrl+a"], "command": "splitVertical" },
-            { "keys": ["ctrl+b"], "command": "splitHorizontal" },
             { "keys": ["ctrl+c"], "command": { "action": "splitPane", "split": null } },
             { "keys": ["ctrl+d"], "command": { "action": "splitPane", "split": "vertical" } },
             { "keys": ["ctrl+e"], "command": { "action": "splitPane", "split": "horizontal" } },
@@ -375,26 +333,8 @@ namespace TerminalAppLocalTests
         VERIFY_IS_NOT_NULL(appKeyBindings);
         VERIFY_ARE_EQUAL(0u, appKeyBindings->_keyShortcuts.size());
         appKeyBindings->LayerJson(bindings0Json);
-        VERIFY_ARE_EQUAL(9u, appKeyBindings->_keyShortcuts.size());
+        VERIFY_ARE_EQUAL(7u, appKeyBindings->_keyShortcuts.size());
 
-        {
-            KeyChord kc{ true, false, false, static_cast<int32_t>('A') };
-            auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
-            VERIFY_ARE_EQUAL(ShortcutAction::SplitVertical, actionAndArgs.Action());
-            const auto& realArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
-            VERIFY_IS_NOT_NULL(realArgs);
-            // Verify the args have the expected value
-            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::Vertical, realArgs.SplitStyle());
-        }
-        {
-            KeyChord kc{ true, false, false, static_cast<int32_t>('B') };
-            auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
-            VERIFY_ARE_EQUAL(ShortcutAction::SplitHorizontal, actionAndArgs.Action());
-            const auto& realArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
-            VERIFY_IS_NOT_NULL(realArgs);
-            // Verify the args have the expected value
-            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::Horizontal, realArgs.SplitStyle());
-        }
         {
             KeyChord kc{ true, false, false, static_cast<int32_t>('C') };
             auto actionAndArgs = TestUtils::GetActionAndArgs(*appKeyBindings, kc);
@@ -402,7 +342,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::None, realArgs.SplitStyle());
+            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::Automatic, realArgs.SplitStyle());
         }
         {
             KeyChord kc{ true, false, false, static_cast<int32_t>('D') };
@@ -429,7 +369,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::None, realArgs.SplitStyle());
+            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::Automatic, realArgs.SplitStyle());
         }
         {
             KeyChord kc{ true, false, false, static_cast<int32_t>('G') };
@@ -438,7 +378,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::None, realArgs.SplitStyle());
+            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::Automatic, realArgs.SplitStyle());
         }
         {
             KeyChord kc{ true, false, false, static_cast<int32_t>('H') };
@@ -456,7 +396,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<SplitPaneArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::None, realArgs.SplitStyle());
+            VERIFY_ARE_EQUAL(winrt::TerminalApp::SplitState::Automatic, realArgs.SplitStyle());
         }
     }
 
@@ -480,7 +420,7 @@ namespace TerminalAppLocalTests
             const auto& realArgs = actionAndArgs.Args().try_as<CopyTextArgs>();
             VERIFY_IS_NOT_NULL(realArgs);
             // Verify the args have the expected value
-            VERIFY_IS_TRUE(realArgs.TrimWhitespace());
+            VERIFY_IS_FALSE(realArgs.SingleLine());
         }
     }
 }

src/cascadia/LocalTests_TerminalApp/SettingsTests.cpp

@@ -56,8 +56,6 @@ namespace TerminalAppLocalTests
         TEST_METHOD(TestInvalidColorSchemeName);
         TEST_METHOD(TestHelperFunctions);
 
-        TEST_METHOD(TestLayerGlobalsOnRoot);
-
         TEST_METHOD(TestProfileIconWithEnvVar);
         TEST_METHOD(TestProfileBackgroundImageWithEnvVar);
 
@@ -78,6 +76,8 @@ namespace TerminalAppLocalTests
 
         TEST_METHOD(ValidateKeybindingsWarnings);
 
+        TEST_METHOD(ValidateLegacyGlobalsWarning);
+
         TEST_CLASS_SETUP(ClassSetup)
         {
             InitializeJsonReader();
@@ -160,9 +160,7 @@ namespace TerminalAppLocalTests
     {
         const std::string goodProfiles{ R"(
         {
-            "globals": {
-                "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}"
-            },
+            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
             "profiles": [
                 {
                     "name" : "profile0",
@@ -177,9 +175,7 @@ namespace TerminalAppLocalTests
 
         const std::string badProfiles{ R"(
         {
-            "globals": {
-                "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}"
-            },
+            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
             "profiles": [
                 {
                     "name" : "profile0",
@@ -194,9 +190,7 @@ namespace TerminalAppLocalTests
 
         const std::string noDefaultAtAll{ R"(
         {
-            "globals": {
-                "alwaysShowTabs": true
-            },
+            "alwaysShowTabs": true,
             "profiles": [
                 {
                     "name" : "profile0",
@@ -388,9 +382,7 @@ namespace TerminalAppLocalTests
     {
         const std::string badProfiles{ R"(
         {
-            "globals": {
-                "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}"
-            },
+            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
             "profiles": [
                 {
                     "name" : "profile0",
@@ -438,21 +430,17 @@ namespace TerminalAppLocalTests
     {
         const std::string settings0String{ R"(
         {
-            "globals": {
-                "alwaysShowTabs": true,
-                "initialCols" : 120,
-                "initialRows" : 30,
-                "rowsToScroll" :  4
-            }
+            "alwaysShowTabs": true,
+            "initialCols" : 120,
+            "initialRows" : 30,
+            "rowsToScroll" :  4
         })" };
         const std::string settings1String{ R"(
         {
-            "globals": {
-                "showTabsInTitlebar": false,
-                "initialCols" : 240,
-                "initialRows" : 60,
-                "rowsToScroll" : 8
-            }
+            "showTabsInTitlebar": false,
+            "initialCols" : 240,
+            "initialRows" : 60,
+            "rowsToScroll" : 8
         })" };
         const auto settings0Json = VerifyParseSucceeded(settings0String);
         const auto settings1Json = VerifyParseSucceeded(settings1String);
@@ -1348,114 +1336,6 @@ namespace TerminalAppLocalTests
         VERIFY_ARE_EQUAL(name2, prof2->GetName());
     }
 
-    void SettingsTests::TestLayerGlobalsOnRoot()
-    {
-        // Test for microsoft/terminal#2906. We added the ability for the root
-        // to be used as the globals object in #2515. However, if you have a
-        // globals object, then the settings in the root would get ignored.
-        // This test ensures that settings from a child "globals" element
-        // _layer_ on top of root properties, and they don't cause the root
-        // properties to be totally ignored.
-
-        const std::string settings0String{ R"(
-        {
-            "globals": {
-                "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-                "initialRows": 123
-            }
-        })" };
-        const std::string settings1String{ R"(
-        {
-            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-            "initialRows": 234
-        })" };
-        const std::string settings2String{ R"(
-        {
-            "defaultProfile": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-            "initialRows": 345,
-            "globals": {
-                "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}"
-                // initialRows should not be cleared here
-            }
-        })" };
-        const std::string settings3String{ R"(
-        {
-            "defaultProfile": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-            "globals": {
-                "initialRows": 456
-                // defaultProfile should not be cleared here
-            }
-        })" };
-        const std::string settings4String{ R"(
-        {
-            "defaultProfile": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-            "globals": {
-                "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}"
-            },
-            "defaultProfile": "{6239a42c-3333-49a3-80bd-e8fdd045185c}"
-        })" };
-        const std::string settings5String{ R"(
-        {
-            "globals": {
-                "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}"
-            },
-            "defaultProfile": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-            "globals": {
-                "defaultProfile": "{6239a42c-3333-49a3-80bd-e8fdd045185c}"
-            }
-        })" };
-
-        VerifyParseSucceeded(settings0String);
-        VerifyParseSucceeded(settings1String);
-        VerifyParseSucceeded(settings2String);
-        VerifyParseSucceeded(settings3String);
-        VerifyParseSucceeded(settings4String);
-        VerifyParseSucceeded(settings5String);
-        const auto guid1 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-1111-49a3-80bd-e8fdd045185c}");
-        const auto guid2 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-2222-49a3-80bd-e8fdd045185c}");
-        const auto guid3 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-3333-49a3-80bd-e8fdd045185c}");
-
-        {
-            CascadiaSettings settings;
-            settings._ParseJsonString(settings0String, false);
-            settings.LayerJson(settings._userSettings);
-            VERIFY_ARE_EQUAL(guid1, settings._globals._defaultProfile);
-            VERIFY_ARE_EQUAL(123, settings._globals._initialRows);
-        }
-        {
-            CascadiaSettings settings;
-            settings._ParseJsonString(settings1String, false);
-            settings.LayerJson(settings._userSettings);
-            VERIFY_ARE_EQUAL(guid1, settings._globals._defaultProfile);
-            VERIFY_ARE_EQUAL(234, settings._globals._initialRows);
-        }
-        {
-            CascadiaSettings settings;
-            settings._ParseJsonString(settings2String, false);
-            settings.LayerJson(settings._userSettings);
-            VERIFY_ARE_EQUAL(guid1, settings._globals._defaultProfile);
-            VERIFY_ARE_EQUAL(345, settings._globals._initialRows);
-        }
-        {
-            CascadiaSettings settings;
-            settings._ParseJsonString(settings3String, false);
-            settings.LayerJson(settings._userSettings);
-            VERIFY_ARE_EQUAL(guid2, settings._globals._defaultProfile);
-            VERIFY_ARE_EQUAL(456, settings._globals._initialRows);
-        }
-        {
-            CascadiaSettings settings;
-            settings._ParseJsonString(settings4String, false);
-            settings.LayerJson(settings._userSettings);
-            VERIFY_ARE_EQUAL(guid1, settings._globals._defaultProfile);
-        }
-        {
-            CascadiaSettings settings;
-            settings._ParseJsonString(settings5String, false);
-            settings.LayerJson(settings._userSettings);
-            VERIFY_ARE_EQUAL(guid3, settings._globals._defaultProfile);
-        }
-    }
     void SettingsTests::TestProfileIconWithEnvVar()
     {
         const auto expectedPath = wil::ExpandEnvironmentStringsW<std::wstring>(L"%WINDIR%\\System32\\x_80.png");
@@ -2311,9 +2191,7 @@ namespace TerminalAppLocalTests
     {
         const std::string badSettings{ R"(
         {
-            "globals": {
-                "defaultProfile": "{6239a42c-2222-49a3-80bd-e8fdd045185c}"
-            },
+            "defaultProfile": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
             "profiles": [
                 {
                     "name" : "profile0",
@@ -2349,4 +2227,40 @@ namespace TerminalAppLocalTests
         VERIFY_ARE_EQUAL(::TerminalApp::SettingsLoadWarnings::MissingRequiredParameter, settings->_warnings.at(2));
         VERIFY_ARE_EQUAL(::TerminalApp::SettingsLoadWarnings::MissingRequiredParameter, settings->_warnings.at(3));
     }
+
+    void SettingsTests::ValidateLegacyGlobalsWarning()
+    {
+        const std::string badSettings{ R"(
+        {
+            "globals": {},
+            "defaultProfile": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
+            "profiles": [
+                {
+                    "name" : "profile0",
+                    "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}"
+                },
+                {
+                    "name" : "profile1",
+                    "guid": "{6239a42c-3333-49a3-80bd-e8fdd045185c}"
+                }
+            ],
+            "keybindings": []
+        })" };
+
+        // Create the default settings
+        CascadiaSettings settings;
+        settings._ParseJsonString(DefaultJson, true);
+        settings.LayerJson(settings._defaultSettings);
+
+        settings._ValidateNoGlobalsKey();
+        VERIFY_ARE_EQUAL(0u, settings._warnings.size());
+
+        // Now layer on the user's settings
+        settings._ParseJsonString(badSettings, false);
+        settings.LayerJson(settings._userSettings);
+
+        settings._ValidateNoGlobalsKey();
+        VERIFY_ARE_EQUAL(1u, settings._warnings.size());
+        VERIFY_ARE_EQUAL(::TerminalApp::SettingsLoadWarnings::LegacyGlobalsProperty, settings._warnings.at(0));
+    }
 }

src/cascadia/LocalTests_TerminalApp/TabTests.cpp

@@ -277,219 +277,227 @@ namespace TerminalAppLocalTests
 
     void TabTests::TryDuplicateBadTab()
     {
-        // * Create a tab with a profile with GUID 1
-        // * Reload the settings so that GUID 1 is no longer in the list of profiles
-        // * Try calling _DuplicateTabViewItem on tab 1
-        // * No new tab should be created (and more importantly, the app should not crash)
-        //
-        // Created to test GH#2455
+        Log::Comment(L"This test regressed recently - it is temporarily disabled while GH#5169 is investigated");
+        Log::Result(WEX::Logging::TestResults::Skipped);
+        return;
 
-        const std::string settingsJson0{ R"(
-        {
-            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-            "profiles": [
-                {
-                    "name" : "profile0",
-                    "guid": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-                    "historySize": 1
-                },
-                {
-                    "name" : "profile1",
-                    "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-                    "historySize": 2
-                }
-            ]
-        })" };
+        // // * Create a tab with a profile with GUID 1
+        // // * Reload the settings so that GUID 1 is no longer in the list of profiles
+        // // * Try calling _DuplicateTabViewItem on tab 1
+        // // * No new tab should be created (and more importantly, the app should not crash)
+        // //
+        // // Created to test GH#2455
 
-        const std::string settingsJson1{ R"(
-        {
-            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-            "profiles": [
-                {
-                    "name" : "profile1",
-                    "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-                    "historySize": 2
-                }
-            ]
-        })" };
+        // const std::string settingsJson0{ R"(
+        // {
+        //     "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
+        //     "profiles": [
+        //         {
+        //             "name" : "profile0",
+        //             "guid": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
+        //             "historySize": 1
+        //         },
+        //         {
+        //             "name" : "profile1",
+        //             "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
+        //             "historySize": 2
+        //         }
+        //     ]
+        // })" };
 
-        VerifyParseSucceeded(settingsJson0);
-        auto settings0 = std::make_shared<CascadiaSettings>(false);
-        VERIFY_IS_NOT_NULL(settings0);
-        settings0->_ParseJsonString(settingsJson0, false);
-        settings0->LayerJson(settings0->_userSettings);
-        settings0->_ValidateSettings();
+        // const std::string settingsJson1{ R"(
+        // {
+        //     "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
+        //     "profiles": [
+        //         {
+        //             "name" : "profile1",
+        //             "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
+        //             "historySize": 2
+        //         }
+        //     ]
+        // })" };
 
-        VerifyParseSucceeded(settingsJson1);
-        auto settings1 = std::make_shared<CascadiaSettings>(false);
-        VERIFY_IS_NOT_NULL(settings1);
-        settings1->_ParseJsonString(settingsJson1, false);
-        settings1->LayerJson(settings1->_userSettings);
-        settings1->_ValidateSettings();
+        // VerifyParseSucceeded(settingsJson0);
+        // auto settings0 = std::make_shared<CascadiaSettings>(false);
+        // VERIFY_IS_NOT_NULL(settings0);
+        // settings0->_ParseJsonString(settingsJson0, false);
+        // settings0->LayerJson(settings0->_userSettings);
+        // settings0->_ValidateSettings();
 
-        const auto guid1 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-1111-49a3-80bd-e8fdd045185c}");
-        const auto guid2 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-2222-49a3-80bd-e8fdd045185c}");
-        const auto guid3 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-3333-49a3-80bd-e8fdd045185c}");
+        // VerifyParseSucceeded(settingsJson1);
+        // auto settings1 = std::make_shared<CascadiaSettings>(false);
+        // VERIFY_IS_NOT_NULL(settings1);
+        // settings1->_ParseJsonString(settingsJson1, false);
+        // settings1->LayerJson(settings1->_userSettings);
+        // settings1->_ValidateSettings();
 
-        // This is super wacky, but we can't just initialize the
-        // com_ptr<impl::TerminalPage> in the lambda and assign it back out of
-        // the lambda. We'll crash trying to get a weak_ref to the TerminalPage
-        // during TerminalPage::Create() below.
-        //
-        // Instead, create the winrt object, then get a com_ptr to the
-        // implementation _from_ the winrt object. This seems to work, even if
-        // it's weird.
-        winrt::com_ptr<winrt::TerminalApp::implementation::TerminalPage> page{ nullptr };
-        _initializeTerminalPage(page, settings0);
+        // const auto guid1 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-1111-49a3-80bd-e8fdd045185c}");
+        // const auto guid2 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-2222-49a3-80bd-e8fdd045185c}");
+        // const auto guid3 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-3333-49a3-80bd-e8fdd045185c}");
 
-        auto result = RunOnUIThread([&page]() {
-            VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
-        });
-        VERIFY_SUCCEEDED(result);
+        // // This is super wacky, but we can't just initialize the
+        // // com_ptr<impl::TerminalPage> in the lambda and assign it back out of
+        // // the lambda. We'll crash trying to get a weak_ref to the TerminalPage
+        // // during TerminalPage::Create() below.
+        // //
+        // // Instead, create the winrt object, then get a com_ptr to the
+        // // implementation _from_ the winrt object. This seems to work, even if
+        // // it's weird.
+        // winrt::com_ptr<winrt::TerminalApp::implementation::TerminalPage> page{ nullptr };
+        // _initializeTerminalPage(page, settings0);
 
-        Log::Comment(L"Duplicate the first tab");
-        result = RunOnUIThread([&page]() {
-            page->_DuplicateTabViewItem();
-            VERIFY_ARE_EQUAL(2u, page->_tabs.Size());
-        });
-        VERIFY_SUCCEEDED(result);
+        // auto result = RunOnUIThread([&page]() {
+        //     VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
+        // });
+        // VERIFY_SUCCEEDED(result);
 
-        Log::Comment(NoThrowString().Format(
-            L"Change the settings of the TerminalPage so the first profile is "
-            L"no longer in the list of profiles"));
-        result = RunOnUIThread([&page, settings1]() {
-            page->_settings = settings1;
-        });
-        VERIFY_SUCCEEDED(result);
+        // Log::Comment(L"Duplicate the first tab");
+        // result = RunOnUIThread([&page]() {
+        //     page->_DuplicateTabViewItem();
+        //     VERIFY_ARE_EQUAL(2u, page->_tabs.Size());
+        // });
+        // VERIFY_SUCCEEDED(result);
 
-        Log::Comment(L"Duplicate the tab, and don't crash");
-        result = RunOnUIThread([&page]() {
-            page->_DuplicateTabViewItem();
-            VERIFY_ARE_EQUAL(2u, page->_tabs.Size(), L"We should gracefully do nothing here - the profile no longer exists.");
-        });
-        VERIFY_SUCCEEDED(result);
+        // Log::Comment(NoThrowString().Format(
+        //     L"Change the settings of the TerminalPage so the first profile is "
+        //     L"no longer in the list of profiles"));
+        // result = RunOnUIThread([&page, settings1]() {
+        //     page->_settings = settings1;
+        // });
+        // VERIFY_SUCCEEDED(result);
+
+        // Log::Comment(L"Duplicate the tab, and don't crash");
+        // result = RunOnUIThread([&page]() {
+        //     page->_DuplicateTabViewItem();
+        //     VERIFY_ARE_EQUAL(2u, page->_tabs.Size(), L"We should gracefully do nothing here - the profile no longer exists.");
+        // });
+        // VERIFY_SUCCEEDED(result);
     }
 
     void TabTests::TryDuplicateBadPane()
     {
-        // * Create a tab with a profile with GUID 1
-        // * Reload the settings so that GUID 1 is no longer in the list of profiles
-        // * Try calling _SplitPane(Duplicate) on tab 1
-        // * No new pane should be created (and more importantly, the app should not crash)
-        //
-        // Created to test GH#2455
+        Log::Comment(L"This test regressed recently - it is temporarily disabled while GH#5169 is investigated");
+        Log::Result(WEX::Logging::TestResults::Skipped);
+        return;
 
-        const std::string settingsJson0{ R"(
-        {
-            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-            "profiles": [
-                {
-                    "name" : "profile0",
-                    "guid": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-                    "historySize": 1
-                },
-                {
-                    "name" : "profile1",
-                    "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-                    "historySize": 2
-                }
-            ]
-        })" };
+        // // * Create a tab with a profile with GUID 1
+        // // * Reload the settings so that GUID 1 is no longer in the list of profiles
+        // // * Try calling _SplitPane(Duplicate) on tab 1
+        // // * No new pane should be created (and more importantly, the app should not crash)
+        // //
+        // // Created to test GH#2455
 
-        const std::string settingsJson1{ R"(
-        {
-            "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
-            "profiles": [
-                {
-                    "name" : "profile1",
-                    "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
-                    "historySize": 2
-                }
-            ]
-        })" };
+        // const std::string settingsJson0{ R"(
+        // {
+        //     "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
+        //     "profiles": [
+        //         {
+        //             "name" : "profile0",
+        //             "guid": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
+        //             "historySize": 1
+        //         },
+        //         {
+        //             "name" : "profile1",
+        //             "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
+        //             "historySize": 2
+        //         }
+        //     ]
+        // })" };
 
-        VerifyParseSucceeded(settingsJson0);
-        auto settings0 = std::make_shared<CascadiaSettings>(false);
-        VERIFY_IS_NOT_NULL(settings0);
-        settings0->_ParseJsonString(settingsJson0, false);
-        settings0->LayerJson(settings0->_userSettings);
-        settings0->_ValidateSettings();
+        // const std::string settingsJson1{ R"(
+        // {
+        //     "defaultProfile": "{6239a42c-1111-49a3-80bd-e8fdd045185c}",
+        //     "profiles": [
+        //         {
+        //             "name" : "profile1",
+        //             "guid": "{6239a42c-2222-49a3-80bd-e8fdd045185c}",
+        //             "historySize": 2
+        //         }
+        //     ]
+        // })" };
 
-        VerifyParseSucceeded(settingsJson1);
-        auto settings1 = std::make_shared<CascadiaSettings>(false);
-        VERIFY_IS_NOT_NULL(settings1);
-        settings1->_ParseJsonString(settingsJson1, false);
-        settings1->LayerJson(settings1->_userSettings);
-        settings1->_ValidateSettings();
+        // VerifyParseSucceeded(settingsJson0);
+        // auto settings0 = std::make_shared<CascadiaSettings>(false);
+        // VERIFY_IS_NOT_NULL(settings0);
+        // settings0->_ParseJsonString(settingsJson0, false);
+        // settings0->LayerJson(settings0->_userSettings);
+        // settings0->_ValidateSettings();
 
-        const auto guid1 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-1111-49a3-80bd-e8fdd045185c}");
-        const auto guid2 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-2222-49a3-80bd-e8fdd045185c}");
-        const auto guid3 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-3333-49a3-80bd-e8fdd045185c}");
+        // VerifyParseSucceeded(settingsJson1);
+        // auto settings1 = std::make_shared<CascadiaSettings>(false);
+        // VERIFY_IS_NOT_NULL(settings1);
+        // settings1->_ParseJsonString(settingsJson1, false);
+        // settings1->LayerJson(settings1->_userSettings);
+        // settings1->_ValidateSettings();
 
-        // This is super wacky, but we can't just initialize the
-        // com_ptr<impl::TerminalPage> in the lambda and assign it back out of
-        // the lambda. We'll crash trying to get a weak_ref to the TerminalPage
-        // during TerminalPage::Create() below.
-        //
-        // Instead, create the winrt object, then get a com_ptr to the
-        // implementation _from_ the winrt object. This seems to work, even if
-        // it's weird.
-        winrt::com_ptr<winrt::TerminalApp::implementation::TerminalPage> page{ nullptr };
-        _initializeTerminalPage(page, settings0);
+        // const auto guid1 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-1111-49a3-80bd-e8fdd045185c}");
+        // const auto guid2 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-2222-49a3-80bd-e8fdd045185c}");
+        // const auto guid3 = Microsoft::Console::Utils::GuidFromString(L"{6239a42c-3333-49a3-80bd-e8fdd045185c}");
 
-        auto result = RunOnUIThread([&page]() {
-            VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
-        });
-        VERIFY_SUCCEEDED(result);
+        // // This is super wacky, but we can't just initialize the
+        // // com_ptr<impl::TerminalPage> in the lambda and assign it back out of
+        // // the lambda. We'll crash trying to get a weak_ref to the TerminalPage
+        // // during TerminalPage::Create() below.
+        // //
+        // // Instead, create the winrt object, then get a com_ptr to the
+        // // implementation _from_ the winrt object. This seems to work, even if
+        // // it's weird.
+        // winrt::com_ptr<winrt::TerminalApp::implementation::TerminalPage> page{ nullptr };
+        // _initializeTerminalPage(page, settings0);
 
-        result = RunOnUIThread([&page]() {
-            VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
-            auto tab = page->_GetStrongTabImpl(0);
-            VERIFY_ARE_EQUAL(1, tab->_GetLeafPaneCount());
-        });
-        VERIFY_SUCCEEDED(result);
+        // auto result = RunOnUIThread([&page]() {
+        //     VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
+        // });
+        // VERIFY_SUCCEEDED(result);
 
-        Log::Comment(NoThrowString().Format(L"Duplicate the first pane"));
-        result = RunOnUIThread([&page]() {
-            page->_SplitPane(SplitState::Automatic, SplitType::Duplicate, nullptr);
+        // result = RunOnUIThread([&page]() {
+        //     VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
+        //     auto tab = page->_GetStrongTabImpl(0);
+        //     VERIFY_ARE_EQUAL(1, tab->_GetLeafPaneCount());
+        // });
+        // VERIFY_SUCCEEDED(result);
 
-            VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
-            auto tab = page->_GetStrongTabImpl(0);
-            VERIFY_ARE_EQUAL(2, tab->_GetLeafPaneCount());
-        });
-        VERIFY_SUCCEEDED(result);
+        // Log::Comment(NoThrowString().Format(L"Duplicate the first pane"));
+        // result = RunOnUIThread([&page]() {
+        //     page->_SplitPane(SplitState::Automatic, SplitType::Duplicate, nullptr);
 
-        Log::Comment(NoThrowString().Format(
-            L"Change the settings of the TerminalPage so the first profile is "
-            L"no longer in the list of profiles"));
-        result = RunOnUIThread([&page, settings1]() {
-            page->_settings = settings1;
-        });
-        VERIFY_SUCCEEDED(result);
+        //     VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
+        //     auto tab = page->_GetStrongTabImpl(0);
+        //     VERIFY_ARE_EQUAL(2, tab->_GetLeafPaneCount());
+        // });
+        // VERIFY_SUCCEEDED(result);
 
-        Log::Comment(NoThrowString().Format(L"Duplicate the pane, and don't crash"));
-        result = RunOnUIThread([&page]() {
-            page->_SplitPane(SplitState::Automatic, SplitType::Duplicate, nullptr);
+        // Log::Comment(NoThrowString().Format(
+        //     L"Change the settings of the TerminalPage so the first profile is "
+        //     L"no longer in the list of profiles"));
+        // result = RunOnUIThread([&page, settings1]() {
+        //     page->_settings = settings1;
+        // });
+        // VERIFY_SUCCEEDED(result);
 
-            VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
-            auto tab = page->_GetStrongTabImpl(0);
-            VERIFY_ARE_EQUAL(2,
-                             tab->_GetLeafPaneCount(),
-                             L"We should gracefully do nothing here - the profile no longer exists.");
-        });
-        VERIFY_SUCCEEDED(result);
+        // Log::Comment(NoThrowString().Format(L"Duplicate the pane, and don't crash"));
+        // result = RunOnUIThread([&page]() {
+        //     page->_SplitPane(SplitState::Automatic, SplitType::Duplicate, nullptr);
 
-        auto cleanup = wil::scope_exit([] {
-            auto result = RunOnUIThread([]() {
-                // There's something causing us to crash north of
-                // TSFInputControl::NotifyEnter, or LayoutRequested. It's very
-                // unclear what that issue is. Since these tests don't run in
-                // CI, simply log a message so that the dev running these tests
-                // knows it's expected.
-                Log::Comment(L"This test often crashes on cleanup, even when it succeeds. If it succeeded, then crashes, that's okay.");
-            });
-            VERIFY_SUCCEEDED(result);
-        });
+        //     VERIFY_ARE_EQUAL(1u, page->_tabs.Size());
+        //     auto tab = page->_GetStrongTabImpl(0);
+        //     VERIFY_ARE_EQUAL(2,
+        //                      tab->_GetLeafPaneCount(),
+        //                      L"We should gracefully do nothing here - the profile no longer exists.");
+        // });
+        // VERIFY_SUCCEEDED(result);
+
+        // auto cleanup = wil::scope_exit([] {
+        //     auto result = RunOnUIThread([]() {
+        //         // There's something causing us to crash north of
+        //         // TSFInputControl::NotifyEnter, or LayoutRequested. It's very
+        //         // unclear what that issue is. Since these tests don't run in
+        //         // CI, simply log a message so that the dev running these tests
+        //         // knows it's expected.
+        //         Log::Comment(L"This test often crashes on cleanup, even when it succeeds. If it succeeded, then crashes, that's okay.");
+        //     });
+        //     VERIFY_SUCCEEDED(result);
+        // });
     }
 
 }

src/cascadia/PublicTerminalCore/HwndTerminal.cpp

@@ -16,6 +16,14 @@ using namespace ::Microsoft::Terminal::Core;
 
 static LPCWSTR term_window_class = L"HwndTerminalClass";
 
+static constexpr bool _IsMouseMessage(UINT uMsg)
+{
+    return uMsg == WM_LBUTTONDOWN || uMsg == WM_LBUTTONUP || uMsg == WM_LBUTTONDBLCLK ||
+           uMsg == WM_MBUTTONDOWN || uMsg == WM_MBUTTONUP || uMsg == WM_MBUTTONDBLCLK ||
+           uMsg == WM_RBUTTONDOWN || uMsg == WM_RBUTTONUP || uMsg == WM_RBUTTONDBLCLK ||
+           uMsg == WM_MOUSEMOVE || uMsg == WM_MOUSEWHEEL;
+}
+
 LRESULT CALLBACK HwndTerminal::HwndTerminalWndProc(
     HWND hwnd,
     UINT uMsg,
@@ -27,6 +35,14 @@ LRESULT CALLBACK HwndTerminal::HwndTerminalWndProc(
 
     if (terminal)
     {
+        if (_IsMouseMessage(uMsg) && terminal->_CanSendVTMouseInput())
+        {
+            if (terminal->_SendMouseEvent(uMsg, wParam, lParam))
+            {
+                return 0;
+            }
+        }
+
         switch (uMsg)
         {
         case WM_GETOBJECT:
@@ -38,6 +54,9 @@ LRESULT CALLBACK HwndTerminal::HwndTerminalWndProc(
         case WM_LBUTTONDOWN:
             LOG_IF_FAILED(terminal->_StartSelection(lParam));
             return 0;
+        case WM_LBUTTONUP:
+            terminal->_singleClickTouchdownPos = std::nullopt;
+            break;
         case WM_MOUSEMOVE:
             if (WI_IsFlagSet(wParam, MK_LBUTTON))
             {
@@ -94,7 +113,8 @@ HwndTerminal::HwndTerminal(HWND parentHwnd) :
     _uiaProvider{ nullptr },
     _uiaProviderInitialized{ false },
     _currentDpi{ USER_DEFAULT_SCREEN_DPI },
-    _pfnWriteCallback{ nullptr }
+    _pfnWriteCallback{ nullptr },
+    _multiClickTime{ 500 } // this will be overwritten by the windows system double-click time
 {
     HINSTANCE hInstance = wil::GetModuleInstanceHandle();
 
@@ -160,6 +180,8 @@ HRESULT HwndTerminal::Initialize()
     _terminal->SetWriteInputCallback([=](std::wstring & input) noexcept { _WriteTextToConnection(input); });
     localPointerToThread->EnablePainting();
 
+    _multiClickTime = std::chrono::milliseconds{ GetDoubleClickTime() };
+
     return S_OK;
 }
 
@@ -241,6 +263,8 @@ HRESULT HwndTerminal::Refresh(const SIZE windowSize, _Out_ COORD* dimensions)
 
     auto lock = _terminal->LockForWriting();
 
+    _terminal->ClearSelection();
+
     RETURN_IF_FAILED(_renderEngine->SetWindowSize(windowSize));
 
     // Invalidate everything
@@ -346,26 +370,59 @@ void _stdcall TerminalUserScroll(void* terminal, int viewTop)
     publicTerminal->_terminal->UserScrollViewport(viewTop);
 }
 
+const unsigned int HwndTerminal::_NumberOfClicks(til::point point, std::chrono::steady_clock::time_point timestamp) noexcept
+{
+    // if click occurred at a different location or past the multiClickTimer...
+    const auto delta{ timestamp - _lastMouseClickTimestamp };
+    if (point != _lastMouseClickPos || delta > _multiClickTime)
+    {
+        // exit early. This is a single click.
+        _multiClickCounter = 1;
+    }
+    else
+    {
+        _multiClickCounter++;
+    }
+    return _multiClickCounter;
+}
+
 HRESULT HwndTerminal::_StartSelection(LPARAM lParam) noexcept
 try
 {
-    const bool altPressed = GetKeyState(VK_MENU) < 0;
-    COORD cursorPosition{
+    const til::point cursorPosition{
         GET_X_LPARAM(lParam),
         GET_Y_LPARAM(lParam),
     };
 
-    const auto fontSize = this->_actualFont.GetSize();
+    auto lock = _terminal->LockForWriting();
+    const bool altPressed = GetKeyState(VK_MENU) < 0;
+    const til::size fontSize{ this->_actualFont.GetSize() };
 
-    RETURN_HR_IF(E_NOT_VALID_STATE, fontSize.X == 0);
-    RETURN_HR_IF(E_NOT_VALID_STATE, fontSize.Y == 0);
-
-    cursorPosition.X /= fontSize.X;
-    cursorPosition.Y /= fontSize.Y;
-
-    this->_terminal->SetSelectionAnchor(cursorPosition);
     this->_terminal->SetBlockSelection(altPressed);
 
+    const auto clickCount{ _NumberOfClicks(cursorPosition, std::chrono::steady_clock::now()) };
+
+    // This formula enables the number of clicks to cycle properly between single-, double-, and triple-click.
+    // To increase the number of acceptable click states, simply increment MAX_CLICK_COUNT and add another if-statement
+    const unsigned int MAX_CLICK_COUNT = 3;
+    const auto multiClickMapper = clickCount > MAX_CLICK_COUNT ? ((clickCount + MAX_CLICK_COUNT - 1) % MAX_CLICK_COUNT) + 1 : clickCount;
+
+    if (multiClickMapper == 3)
+    {
+        _terminal->MultiClickSelection(cursorPosition / fontSize, ::Terminal::SelectionExpansionMode::Line);
+    }
+    else if (multiClickMapper == 2)
+    {
+        _terminal->MultiClickSelection(cursorPosition / fontSize, ::Terminal::SelectionExpansionMode::Word);
+    }
+    else
+    {
+        this->_terminal->ClearSelection();
+        _singleClickTouchdownPos = cursorPosition;
+
+        _lastMouseClickTimestamp = std::chrono::steady_clock::now();
+        _lastMouseClickPos = cursorPosition;
+    }
     this->_renderer->TriggerSelection();
 
     return S_OK;
@@ -375,20 +432,29 @@ CATCH_RETURN();
 HRESULT HwndTerminal::_MoveSelection(LPARAM lParam) noexcept
 try
 {
-    COORD cursorPosition{
+    const til::point cursorPosition{
         GET_X_LPARAM(lParam),
         GET_Y_LPARAM(lParam),
     };
 
-    const auto fontSize = this->_actualFont.GetSize();
+    auto lock = _terminal->LockForWriting();
+    const til::size fontSize{ this->_actualFont.GetSize() };
 
-    RETURN_HR_IF(E_NOT_VALID_STATE, fontSize.X == 0);
-    RETURN_HR_IF(E_NOT_VALID_STATE, fontSize.Y == 0);
+    RETURN_HR_IF(E_NOT_VALID_STATE, fontSize.area() == 0); // either dimension = 0, area == 0
 
-    cursorPosition.X /= fontSize.X;
-    cursorPosition.Y /= fontSize.Y;
+    if (this->_singleClickTouchdownPos)
+    {
+        const auto& touchdownPoint{ *this->_singleClickTouchdownPos };
+        const auto distance{ std::sqrtf(std::powf(cursorPosition.x<float>() - touchdownPoint.x<float>(), 2) + std::powf(cursorPosition.y<float>() - touchdownPoint.y<float>(), 2)) };
+        if (distance >= (std::min(fontSize.width(), fontSize.height()) / 4.f))
+        {
+            _terminal->SetSelectionAnchor(touchdownPoint / fontSize);
+            // stop tracking the touchdown point
+            _singleClickTouchdownPos = std::nullopt;
+        }
+    }
 
-    this->_terminal->SetSelectionEnd(cursorPosition);
+    this->_terminal->SetSelectionEnd(cursorPosition / fontSize);
     this->_renderer->TriggerSelection();
 
     return S_OK;
@@ -427,10 +493,8 @@ const wchar_t* _stdcall TerminalGetSelection(void* terminal)
     return returnText.release();
 }
 
-void _stdcall TerminalSendKeyEvent(void* terminal, WPARAM wParam)
+static ControlKeyStates getControlKeyState() noexcept
 {
-    const auto publicTerminal = static_cast<const HwndTerminal*>(terminal);
-    const auto scanCode = MapVirtualKeyW((UINT)wParam, MAPVK_VK_TO_VSC);
     struct KeyModifier
     {
         int vkey;
@@ -458,18 +522,82 @@ void _stdcall TerminalSendKeyEvent(void* terminal, WPARAM wParam)
         }
     }
 
-    publicTerminal->_terminal->SendKeyEvent((WORD)wParam, (WORD)scanCode, flags);
+    return flags;
 }
 
-void _stdcall TerminalSendCharEvent(void* terminal, wchar_t ch)
+bool HwndTerminal::_CanSendVTMouseInput() const noexcept
 {
-    if (ch == '\t')
+    // Only allow the transit of mouse events if shift isn't pressed.
+    const bool shiftPressed = GetKeyState(VK_SHIFT) < 0;
+    return !shiftPressed && _focused && _terminal->IsTrackingMouseInput();
+}
+
+bool HwndTerminal::_SendMouseEvent(UINT uMsg, WPARAM wParam, LPARAM lParam) noexcept
+try
+{
+    const til::point cursorPosition{
+        GET_X_LPARAM(lParam),
+        GET_Y_LPARAM(lParam),
+    };
+
+    const til::size fontSize{ this->_actualFont.GetSize() };
+    short wheelDelta{ 0 };
+    if (uMsg == WM_MOUSEWHEEL)
     {
+        wheelDelta = HIWORD(wParam);
+    }
+
+    return _terminal->SendMouseEvent(cursorPosition / fontSize, uMsg, getControlKeyState(), wheelDelta);
+}
+catch (...)
+{
+    LOG_CAUGHT_EXCEPTION();
+    return false;
+}
+
+void HwndTerminal::_SendKeyEvent(WORD vkey, WORD scanCode) noexcept
+try
+{
+    const auto flags = getControlKeyState();
+    _terminal->SendKeyEvent(vkey, scanCode, flags);
+}
+CATCH_LOG();
+
+void HwndTerminal::_SendCharEvent(wchar_t ch, WORD scanCode) noexcept
+try
+{
+    if (_terminal->IsSelectionActive())
+    {
+        _terminal->ClearSelection();
+        if (ch == UNICODE_ESC)
+        {
+            // ESC should clear any selection before it triggers input.
+            // Other characters pass through.
+            return;
+        }
+    }
+
+    if (ch == UNICODE_TAB)
+    {
+        // TAB was handled as a keydown event (cf. Terminal::SendKeyEvent)
         return;
     }
 
-    const auto publicTerminal = static_cast<const HwndTerminal*>(terminal);
-    publicTerminal->_terminal->SendCharEvent(ch);
+    const auto flags = getControlKeyState();
+    _terminal->SendCharEvent(ch, scanCode, flags);
+}
+CATCH_LOG();
+
+void _stdcall TerminalSendKeyEvent(void* terminal, WORD vkey, WORD scanCode)
+{
+    const auto publicTerminal = static_cast<HwndTerminal*>(terminal);
+    publicTerminal->_SendKeyEvent(vkey, scanCode);
+}
+
+void _stdcall TerminalSendCharEvent(void* terminal, wchar_t ch, WORD scanCode)
+{
+    const auto publicTerminal = static_cast<HwndTerminal*>(terminal);
+    publicTerminal->_SendCharEvent(ch, scanCode);
 }
 
 void _stdcall DestroyTerminal(void* terminal)
@@ -516,6 +644,10 @@ HRESULT _stdcall TerminalResize(void* terminal, COORD dimensions)
 {
     const auto publicTerminal = static_cast<const HwndTerminal*>(terminal);
 
+    auto lock = publicTerminal->_terminal->LockForWriting();
+    publicTerminal->_terminal->ClearSelection();
+    publicTerminal->_renderer->TriggerRedrawAll();
+
     return publicTerminal->_terminal->UserResize(dimensions);
 }
 
@@ -536,6 +668,18 @@ void _stdcall TerminalSetCursorVisible(void* terminal, const bool visible)
     publicTerminal->_terminal->SetCursorOn(visible);
 }
 
+void __stdcall TerminalSetFocus(void* terminal)
+{
+    auto publicTerminal = static_cast<HwndTerminal*>(terminal);
+    publicTerminal->_focused = true;
+}
+
+void __stdcall TerminalKillFocus(void* terminal)
+{
+    auto publicTerminal = static_cast<HwndTerminal*>(terminal);
+    publicTerminal->_focused = false;
+}
+
 // Routine Description:
 // - Copies the text given onto the global system clipboard.
 // Arguments:

src/cascadia/PublicTerminalCore/HwndTerminal.hpp

@@ -34,10 +34,12 @@ __declspec(dllexport) bool _stdcall TerminalIsSelectionActive(void* terminal);
 __declspec(dllexport) void _stdcall DestroyTerminal(void* terminal);
 __declspec(dllexport) void _stdcall TerminalSetTheme(void* terminal, TerminalTheme theme, LPCWSTR fontFamily, short fontSize, int newDpi);
 __declspec(dllexport) void _stdcall TerminalRegisterWriteCallback(void* terminal, const void __stdcall callback(wchar_t*));
-__declspec(dllexport) void _stdcall TerminalSendKeyEvent(void* terminal, WPARAM wParam);
-__declspec(dllexport) void _stdcall TerminalSendCharEvent(void* terminal, wchar_t ch);
+__declspec(dllexport) void _stdcall TerminalSendKeyEvent(void* terminal, WORD vkey, WORD scanCode);
+__declspec(dllexport) void _stdcall TerminalSendCharEvent(void* terminal, wchar_t ch, WORD scanCode);
 __declspec(dllexport) void _stdcall TerminalBlinkCursor(void* terminal);
 __declspec(dllexport) void _stdcall TerminalSetCursorVisible(void* terminal, const bool visible);
+__declspec(dllexport) void _stdcall TerminalSetFocus(void* terminal);
+__declspec(dllexport) void _stdcall TerminalKillFocus(void* terminal);
 };
 
 struct HwndTerminal : ::Microsoft::Console::Types::IControlAccessibilityInfo
@@ -75,6 +77,14 @@ private:
     std::unique_ptr<::Microsoft::Console::Render::Renderer> _renderer;
     std::unique_ptr<::Microsoft::Console::Render::DxEngine> _renderEngine;
 
+    bool _focused{ false };
+
+    std::chrono::milliseconds _multiClickTime;
+    unsigned int _multiClickCounter{};
+    std::chrono::steady_clock::time_point _lastMouseClickTimestamp{};
+    std::optional<til::point> _lastMouseClickPos;
+    std::optional<til::point> _singleClickTouchdownPos;
+
     friend HRESULT _stdcall CreateTerminal(HWND parentHwnd, _Out_ void** hwnd, _Out_ void** terminal);
     friend HRESULT _stdcall TerminalResize(void* terminal, COORD dimensions);
     friend void _stdcall TerminalDpiChanged(void* terminal, int newDpi);
@@ -82,11 +92,13 @@ private:
     friend void _stdcall TerminalClearSelection(void* terminal);
     friend const wchar_t* _stdcall TerminalGetSelection(void* terminal);
     friend bool _stdcall TerminalIsSelectionActive(void* terminal);
-    friend void _stdcall TerminalSendKeyEvent(void* terminal, WPARAM wParam);
-    friend void _stdcall TerminalSendCharEvent(void* terminal, wchar_t ch);
+    friend void _stdcall TerminalSendKeyEvent(void* terminal, WORD vkey, WORD scanCode);
+    friend void _stdcall TerminalSendCharEvent(void* terminal, wchar_t ch, WORD scanCode);
     friend void _stdcall TerminalSetTheme(void* terminal, TerminalTheme theme, LPCWSTR fontFamily, short fontSize, int newDpi);
     friend void _stdcall TerminalBlinkCursor(void* terminal);
     friend void _stdcall TerminalSetCursorVisible(void* terminal, const bool visible);
+    friend void _stdcall TerminalSetFocus(void* terminal);
+    friend void _stdcall TerminalKillFocus(void* terminal);
 
     void _UpdateFont(int newDpi);
     void _WriteTextToConnection(const std::wstring& text) noexcept;
@@ -95,10 +107,17 @@ private:
     void _PasteTextFromClipboard() noexcept;
     void _StringPaste(const wchar_t* const pData) noexcept;
 
+    const unsigned int _NumberOfClicks(til::point clickPos, std::chrono::steady_clock::time_point clickTime) noexcept;
     HRESULT _StartSelection(LPARAM lParam) noexcept;
     HRESULT _MoveSelection(LPARAM lParam) noexcept;
     IRawElementProviderSimple* _GetUiaProvider() noexcept;
 
+    bool _CanSendVTMouseInput() const noexcept;
+    bool _SendMouseEvent(UINT uMsg, WPARAM wParam, LPARAM lParam) noexcept;
+
+    void _SendKeyEvent(WORD vkey, WORD scanCode) noexcept;
+    void _SendCharEvent(wchar_t ch, WORD scanCode) noexcept;
+
     // Inherited via IControlAccessibilityInfo
     COORD GetFontSize() const override;
     RECT GetBounds() const noexcept override;

src/cascadia/TerminalApp/ActionArgs.h

@@ -93,9 +93,9 @@ namespace winrt::TerminalApp::implementation
     struct CopyTextArgs : public CopyTextArgsT<CopyTextArgs>
     {
         CopyTextArgs() = default;
-        GETSET_PROPERTY(bool, TrimWhitespace, true);
+        GETSET_PROPERTY(bool, SingleLine, false);
 
-        static constexpr std::string_view TrimWhitespaceKey{ "trimWhitespace" };
+        static constexpr std::string_view SingleLineKey{ "singleLine" };
 
     public:
         bool Equals(const IActionArgs& other)
@@ -103,7 +103,7 @@ namespace winrt::TerminalApp::implementation
             auto otherAsUs = other.try_as<CopyTextArgs>();
             if (otherAsUs)
             {
-                return otherAsUs->_TrimWhitespace == _TrimWhitespace;
+                return otherAsUs->_SingleLine == _SingleLine;
             }
             return false;
         };
@@ -111,9 +111,9 @@ namespace winrt::TerminalApp::implementation
         {
             // LOAD BEARING: Not using make_self here _will_ break you in the future!
             auto args = winrt::make_self<CopyTextArgs>();
-            if (auto trimWhitespace{ json[JsonKey(TrimWhitespaceKey)] })
+            if (auto singleLine{ json[JsonKey(SingleLineKey)] })
             {
-                args->_TrimWhitespace = trimWhitespace.asBool();
+                args->_SingleLine = singleLine.asBool();
             }
             return { *args, {} };
         }
@@ -328,7 +328,7 @@ namespace winrt::TerminalApp::implementation
             return TerminalApp::SplitState::Automatic;
         }
         // default behavior for invalid data
-        return TerminalApp::SplitState::None;
+        return TerminalApp::SplitState::Automatic;
     };
 
     // Possible SplitType values
@@ -345,7 +345,7 @@ namespace winrt::TerminalApp::implementation
     struct SplitPaneArgs : public SplitPaneArgsT<SplitPaneArgs>
     {
         SplitPaneArgs() = default;
-        GETSET_PROPERTY(winrt::TerminalApp::SplitState, SplitStyle, winrt::TerminalApp::SplitState::None);
+        GETSET_PROPERTY(winrt::TerminalApp::SplitState, SplitStyle, winrt::TerminalApp::SplitState::Automatic);
         GETSET_PROPERTY(winrt::TerminalApp::NewTerminalArgs, TerminalArgs, nullptr);
         GETSET_PROPERTY(winrt::TerminalApp::SplitType, SplitMode, winrt::TerminalApp::SplitType::Manual);
 

src/cascadia/TerminalApp/ActionArgs.idl

@@ -56,7 +56,7 @@ namespace TerminalApp
 
     [default_interface] runtimeclass CopyTextArgs : IActionArgs
     {
-        Boolean TrimWhitespace { get; };
+        Boolean SingleLine { get; };
     };
 
     [default_interface] runtimeclass NewTabArgs : IActionArgs

src/cascadia/TerminalApp/AppActionHandlers.cpp

@@ -198,7 +198,7 @@ namespace winrt::TerminalApp::implementation
     {
         if (const auto& realArgs = args.ActionArgs().try_as<TerminalApp::CopyTextArgs>())
         {
-            const auto handled = _CopyText(realArgs.TrimWhitespace());
+            const auto handled = _CopyText(realArgs.SingleLine());
             args.Handled(handled);
         }
     }

src/cascadia/TerminalApp/AppCommandlineArgs.cpp

@@ -217,7 +217,7 @@ void AppCommandlineArgs::_buildSplitPaneParser()
         args->SplitStyle(SplitState::Automatic);
         // Make sure to use the `Option`s here to check if they were set -
         // _getNewTerminalArgs might reset them while parsing a commandline
-        if ((*_horizontalOption || *_verticalOption) && (_splitHorizontal))
+        if ((*_horizontalOption || *_verticalOption))
         {
             if (_splitHorizontal)
             {
@@ -225,7 +225,7 @@ void AppCommandlineArgs::_buildSplitPaneParser()
             }
             else if (_splitVertical)
             {
-                args->SplitStyle(SplitState::Horizontal);
+                args->SplitStyle(SplitState::Vertical);
             }
         }
 

src/cascadia/TerminalApp/AppKeyBindingsSerialization.cpp

@@ -25,20 +25,10 @@ static constexpr std::string_view ActionKey{ "action" };
 static constexpr std::string_view UnboundKey{ "unbound" };
 
 static constexpr std::string_view CopyTextKey{ "copy" };
-static constexpr std::string_view CopyTextWithoutNewlinesKey{ "copyTextWithoutNewlines" }; // Legacy
 static constexpr std::string_view PasteTextKey{ "paste" };
 static constexpr std::string_view OpenNewTabDropdownKey{ "openNewTabDropdown" };
 static constexpr std::string_view DuplicateTabKey{ "duplicateTab" };
 static constexpr std::string_view NewTabKey{ "newTab" };
-static constexpr std::string_view NewTabWithProfile0Key{ "newTabProfile0" }; // Legacy
-static constexpr std::string_view NewTabWithProfile1Key{ "newTabProfile1" }; // Legacy
-static constexpr std::string_view NewTabWithProfile2Key{ "newTabProfile2" }; // Legacy
-static constexpr std::string_view NewTabWithProfile3Key{ "newTabProfile3" }; // Legacy
-static constexpr std::string_view NewTabWithProfile4Key{ "newTabProfile4" }; // Legacy
-static constexpr std::string_view NewTabWithProfile5Key{ "newTabProfile5" }; // Legacy
-static constexpr std::string_view NewTabWithProfile6Key{ "newTabProfile6" }; // Legacy
-static constexpr std::string_view NewTabWithProfile7Key{ "newTabProfile7" }; // Legacy
-static constexpr std::string_view NewTabWithProfile8Key{ "newTabProfile8" }; // Legacy
 static constexpr std::string_view NewWindowKey{ "newWindow" };
 static constexpr std::string_view CloseWindowKey{ "closeWindow" };
 static constexpr std::string_view CloseTabKey{ "closeTab" };
@@ -46,37 +36,17 @@ static constexpr std::string_view ClosePaneKey{ "closePane" };
 static constexpr std::string_view SwitchtoTabKey{ "switchToTab" };
 static constexpr std::string_view NextTabKey{ "nextTab" };
 static constexpr std::string_view PrevTabKey{ "prevTab" };
-static constexpr std::string_view IncreaseFontSizeKey{ "increaseFontSize" };
-static constexpr std::string_view DecreaseFontSizeKey{ "decreaseFontSize" };
+static constexpr std::string_view AdjustFontSizeKey{ "adjustFontSize" };
 static constexpr std::string_view ResetFontSizeKey{ "resetFontSize" };
 static constexpr std::string_view ScrollupKey{ "scrollUp" };
 static constexpr std::string_view ScrolldownKey{ "scrollDown" };
 static constexpr std::string_view ScrolluppageKey{ "scrollUpPage" };
 static constexpr std::string_view ScrolldownpageKey{ "scrollDownPage" };
 static constexpr std::string_view SwitchToTabKey{ "switchToTab" };
-static constexpr std::string_view SwitchToTab0Key{ "switchToTab0" }; // Legacy
-static constexpr std::string_view SwitchToTab1Key{ "switchToTab1" }; // Legacy
-static constexpr std::string_view SwitchToTab2Key{ "switchToTab2" }; // Legacy
-static constexpr std::string_view SwitchToTab3Key{ "switchToTab3" }; // Legacy
-static constexpr std::string_view SwitchToTab4Key{ "switchToTab4" }; // Legacy
-static constexpr std::string_view SwitchToTab5Key{ "switchToTab5" }; // Legacy
-static constexpr std::string_view SwitchToTab6Key{ "switchToTab6" }; // Legacy
-static constexpr std::string_view SwitchToTab7Key{ "switchToTab7" }; // Legacy
-static constexpr std::string_view SwitchToTab8Key{ "switchToTab8" }; // Legacy
-static constexpr std::string_view OpenSettingsKey{ "openSettings" }; // Legacy
+static constexpr std::string_view OpenSettingsKey{ "openSettings" }; // TODO GH#2557: Add args for OpenSettings
 static constexpr std::string_view SplitPaneKey{ "splitPane" };
-static constexpr std::string_view SplitHorizontalKey{ "splitHorizontal" }; // Legacy
-static constexpr std::string_view SplitVerticalKey{ "splitVertical" }; // Legacy
 static constexpr std::string_view ResizePaneKey{ "resizePane" };
-static constexpr std::string_view ResizePaneLeftKey{ "resizePaneLeft" }; // Legacy
-static constexpr std::string_view ResizePaneRightKey{ "resizePaneRight" }; // Legacy
-static constexpr std::string_view ResizePaneUpKey{ "resizePaneUp" }; // Legacy
-static constexpr std::string_view ResizePaneDownKey{ "resizePaneDown" }; // Legacy
 static constexpr std::string_view MoveFocusKey{ "moveFocus" };
-static constexpr std::string_view MoveFocusLeftKey{ "moveFocusLeft" }; // Legacy
-static constexpr std::string_view MoveFocusRightKey{ "moveFocusRight" }; // Legacy
-static constexpr std::string_view MoveFocusUpKey{ "moveFocusUp" }; // Legacy
-static constexpr std::string_view MoveFocusDownKey{ "moveFocusDown" }; // Legacy
 static constexpr std::string_view FindKey{ "find" };
 static constexpr std::string_view ToggleFullscreenKey{ "toggleFullscreen" };
 
@@ -90,55 +60,25 @@ static constexpr std::string_view ToggleFullscreenKey{ "toggleFullscreen" };
 // about here.
 static const std::map<std::string_view, ShortcutAction, std::less<>> commandNames{
     { CopyTextKey, ShortcutAction::CopyText },
-    { CopyTextWithoutNewlinesKey, ShortcutAction::CopyTextWithoutNewlines },
     { PasteTextKey, ShortcutAction::PasteText },
     { OpenNewTabDropdownKey, ShortcutAction::OpenNewTabDropdown },
     { DuplicateTabKey, ShortcutAction::DuplicateTab },
     { NewTabKey, ShortcutAction::NewTab },
-    { NewTabWithProfile0Key, ShortcutAction::NewTabProfile0 },
-    { NewTabWithProfile1Key, ShortcutAction::NewTabProfile1 },
-    { NewTabWithProfile2Key, ShortcutAction::NewTabProfile2 },
-    { NewTabWithProfile3Key, ShortcutAction::NewTabProfile3 },
-    { NewTabWithProfile4Key, ShortcutAction::NewTabProfile4 },
-    { NewTabWithProfile5Key, ShortcutAction::NewTabProfile5 },
-    { NewTabWithProfile6Key, ShortcutAction::NewTabProfile6 },
-    { NewTabWithProfile7Key, ShortcutAction::NewTabProfile7 },
-    { NewTabWithProfile8Key, ShortcutAction::NewTabProfile8 },
     { NewWindowKey, ShortcutAction::NewWindow },
     { CloseWindowKey, ShortcutAction::CloseWindow },
     { CloseTabKey, ShortcutAction::CloseTab },
     { ClosePaneKey, ShortcutAction::ClosePane },
     { NextTabKey, ShortcutAction::NextTab },
     { PrevTabKey, ShortcutAction::PrevTab },
-    { IncreaseFontSizeKey, ShortcutAction::IncreaseFontSize },
-    { DecreaseFontSizeKey, ShortcutAction::DecreaseFontSize },
+    { AdjustFontSizeKey, ShortcutAction::AdjustFontSize },
     { ResetFontSizeKey, ShortcutAction::ResetFontSize },
     { ScrollupKey, ShortcutAction::ScrollUp },
     { ScrolldownKey, ShortcutAction::ScrollDown },
     { ScrolluppageKey, ShortcutAction::ScrollUpPage },
     { ScrolldownpageKey, ShortcutAction::ScrollDownPage },
     { SwitchToTabKey, ShortcutAction::SwitchToTab },
-    { SwitchToTab0Key, ShortcutAction::SwitchToTab0 },
-    { SwitchToTab1Key, ShortcutAction::SwitchToTab1 },
-    { SwitchToTab2Key, ShortcutAction::SwitchToTab2 },
-    { SwitchToTab3Key, ShortcutAction::SwitchToTab3 },
-    { SwitchToTab4Key, ShortcutAction::SwitchToTab4 },
-    { SwitchToTab5Key, ShortcutAction::SwitchToTab5 },
-    { SwitchToTab6Key, ShortcutAction::SwitchToTab6 },
-    { SwitchToTab7Key, ShortcutAction::SwitchToTab7 },
-    { SwitchToTab8Key, ShortcutAction::SwitchToTab8 },
-    { SplitHorizontalKey, ShortcutAction::SplitHorizontal },
-    { SplitVerticalKey, ShortcutAction::SplitVertical },
     { ResizePaneKey, ShortcutAction::ResizePane },
-    { ResizePaneLeftKey, ShortcutAction::ResizePaneLeft },
-    { ResizePaneRightKey, ShortcutAction::ResizePaneRight },
-    { ResizePaneUpKey, ShortcutAction::ResizePaneUp },
-    { ResizePaneDownKey, ShortcutAction::ResizePaneDown },
     { MoveFocusKey, ShortcutAction::MoveFocus },
-    { MoveFocusLeftKey, ShortcutAction::MoveFocusLeft },
-    { MoveFocusRightKey, ShortcutAction::MoveFocusRight },
-    { MoveFocusUpKey, ShortcutAction::MoveFocusUp },
-    { MoveFocusDownKey, ShortcutAction::MoveFocusDown },
     { OpenSettingsKey, ShortcutAction::OpenSettings },
     { ToggleFullscreenKey, ShortcutAction::ToggleFullscreen },
     { SplitPaneKey, ShortcutAction::SplitPane },
@@ -149,146 +89,6 @@ static const std::map<std::string_view, ShortcutAction, std::less<>> commandName
 using ParseResult = std::tuple<IActionArgs, std::vector<TerminalApp::SettingsLoadWarnings>>;
 using ParseActionFunction = std::function<ParseResult(const Json::Value&)>;
 
-// Function Description:
-// - Creates a function that can be used to generate a SplitPaneArgs for the
-//   legacy Split[SplitState] actions. These actions don't accept args from
-//   json, instead, they just return a SplitPaneArgs with the style already
-//   pre-defined, based on the input param.
-// - TODO: GH#1069 Remove this before 1.0, and force an upgrade to the new args.
-// Arguments:
-// - style: the split style to create the parse function for.
-// Return Value:
-// - A function that can be used to "parse" json into one of the legacy
-//   Split[SplitState] args.
-ParseActionFunction LegacyParseSplitPaneArgs(SplitState style)
-{
-    auto pfn = [style](const Json::Value & /*value*/) -> ParseResult {
-        auto args = winrt::make_self<winrt::TerminalApp::implementation::SplitPaneArgs>();
-        args->SplitStyle(style);
-        return { *args, {} };
-    };
-    return pfn;
-}
-
-// Function Description:
-// - Creates a function that can be used to generate a MoveFocusArgs for the
-//   legacy MoveFocus[Direction] actions. These actions don't accept args from
-//   json, instead, they just return a MoveFocusArgs with the Direction already
-//   per-defined, based on the input param.
-// - TODO: GH#1069 Remove this before 1.0, and force an upgrade to the new args.
-// Arguments:
-// - direction: the direction to create the parse function for.
-// Return Value:
-// - A function that can be used to "parse" json into one of the legacy
-//   MoveFocus[Direction] args.
-ParseActionFunction LegacyParseMoveFocusArgs(Direction direction)
-{
-    auto pfn = [direction](const Json::Value & /*value*/) -> ParseResult {
-        auto args = winrt::make_self<winrt::TerminalApp::implementation::MoveFocusArgs>();
-        args->Direction(direction);
-        return { *args, {} };
-    };
-    return pfn;
-}
-
-// Function Description:
-// - Creates a function that can be used to generate a ResizePaneArgs for the
-//   legacy ResizePane[Direction] actions. These actions don't accept args from
-//   json, instead, they just return a ResizePaneArgs with the Direction already
-//   per-defined, based on the input param.
-// - TODO: GH#1069 Remove this before 1.0, and force an upgrade to the new args.
-// Arguments:
-// - direction: the direction to create the parse function for.
-// Return Value:
-// - A function that can be used to "parse" json into one of the legacy
-//   ResizePane[Direction] args.
-ParseActionFunction LegacyParseResizePaneArgs(Direction direction)
-{
-    auto pfn = [direction](const Json::Value & /*value*/) -> ParseResult {
-        auto args = winrt::make_self<winrt::TerminalApp::implementation::ResizePaneArgs>();
-        args->Direction(direction);
-        return { *args, {} };
-    };
-    return pfn;
-}
-
-// Function Description:
-// - Creates a function that can be used to generate a NewTabWithProfileArgs for
-//   the legacy NewTabWithProfile[Index] actions. These actions don't accept
-//   args from json, instead, they just return a NewTabWithProfileArgs with the
-//   index already per-defined, based on the input param.
-// - TODO: GH#1069 Remove this before 1.0, and force an upgrade to the new args.
-// Arguments:
-// - index: the profile index to create the parse function for.
-// Return Value:
-// - A function that can be used to "parse" json into one of the legacy
-//   NewTabWithProfile[Index] args.
-ParseActionFunction LegacyParseNewTabWithProfileArgs(int index)
-{
-    auto pfn = [index](const Json::Value & /*value*/) -> ParseResult {
-        auto args = winrt::make_self<winrt::TerminalApp::implementation::NewTabArgs>();
-        auto newTerminalArgs = winrt::make_self<winrt::TerminalApp::implementation::NewTerminalArgs>();
-        newTerminalArgs->ProfileIndex(index);
-        args->TerminalArgs(*newTerminalArgs);
-        return { *args, {} };
-    };
-    return pfn;
-}
-
-// Function Description:
-// - Creates a function that can be used to generate a SwitchToTabArgs for the
-//   legacy SwitchToTab[Index] actions. These actions don't accept args from
-//   json, instead, they just return a SwitchToTabArgs with the index already
-//   per-defined, based on the input param.
-// - TODO: GH#1069 Remove this before 1.0, and force an upgrade to the new args.
-// Arguments:
-// - index: the tab index to create the parse function for.
-// Return Value:
-// - A function that can be used to "parse" json into one of the legacy
-//   SwitchToTab[Index] args.
-ParseActionFunction LegacyParseSwitchToTabArgs(int index)
-{
-    auto pfn = [index](const Json::Value & /*value*/) -> ParseResult {
-        auto args = winrt::make_self<winrt::TerminalApp::implementation::SwitchToTabArgs>();
-        args->TabIndex(index);
-        return { *args, {} };
-    };
-    return pfn;
-}
-
-// Function Description:
-// - Used to generate a CopyTextArgs for the legacy CopyTextWithoutNewlines
-//   action.
-// - TODO: GH#1069 Remove this before 1.0, and force an upgrade to the new args.
-// Arguments:
-// - direction: the direction to create the parse function for.
-// Return Value:
-// - A CopyTextArgs with TrimWhitespace set to true, to emulate "CopyTextWithoutNewlines".
-ParseResult LegacyParseCopyTextWithoutNewlinesArgs(const Json::Value& /*json*/)
-{
-    auto args = winrt::make_self<winrt::TerminalApp::implementation::CopyTextArgs>();
-    args->TrimWhitespace(false);
-    return { *args, {} };
-};
-
-// Function Description:
-// - Used to generate a AdjustFontSizeArgs for IncreaseFontSize/DecreaseFontSize
-//   actions with a delta of 1/-1.
-// - TODO: GH#1069 Remove this before 1.0, and force an upgrade to the new args.
-// Arguments:
-// - delta: the font size delta to create the parse function for.
-// Return Value:
-// - A function that can be used to "parse" json into an AdjustFontSizeArgs.
-ParseActionFunction LegacyParseAdjustFontSizeArgs(int delta)
-{
-    auto pfn = [delta](const Json::Value & /*value*/) -> ParseResult {
-        auto args = winrt::make_self<winrt::TerminalApp::implementation::AdjustFontSizeArgs>();
-        args->Delta(delta);
-        return { *args, {} };
-    };
-    return pfn;
-}
-
 // This is a map of ShortcutAction->function<IActionArgs(Json::Value)>. It holds
 // a set of deserializer functions that can be used to deserialize a IActionArgs
 // from json. Each type of IActionArgs that can accept arbitrary args should be
@@ -296,48 +96,18 @@ ParseActionFunction LegacyParseAdjustFontSizeArgs(int delta)
 // value.
 static const std::map<ShortcutAction, ParseActionFunction, std::less<>> argParsers{
     { ShortcutAction::CopyText, winrt::TerminalApp::implementation::CopyTextArgs::FromJson },
-    { ShortcutAction::CopyTextWithoutNewlines, LegacyParseCopyTextWithoutNewlinesArgs },
 
     { ShortcutAction::NewTab, winrt::TerminalApp::implementation::NewTabArgs::FromJson },
-    { ShortcutAction::NewTabProfile0, LegacyParseNewTabWithProfileArgs(0) },
-    { ShortcutAction::NewTabProfile1, LegacyParseNewTabWithProfileArgs(1) },
-    { ShortcutAction::NewTabProfile2, LegacyParseNewTabWithProfileArgs(2) },
-    { ShortcutAction::NewTabProfile3, LegacyParseNewTabWithProfileArgs(3) },
-    { ShortcutAction::NewTabProfile4, LegacyParseNewTabWithProfileArgs(4) },
-    { ShortcutAction::NewTabProfile5, LegacyParseNewTabWithProfileArgs(5) },
-    { ShortcutAction::NewTabProfile6, LegacyParseNewTabWithProfileArgs(6) },
-    { ShortcutAction::NewTabProfile7, LegacyParseNewTabWithProfileArgs(7) },
-    { ShortcutAction::NewTabProfile8, LegacyParseNewTabWithProfileArgs(8) },
 
     { ShortcutAction::SwitchToTab, winrt::TerminalApp::implementation::SwitchToTabArgs::FromJson },
-    { ShortcutAction::SwitchToTab0, LegacyParseSwitchToTabArgs(0) },
-    { ShortcutAction::SwitchToTab1, LegacyParseSwitchToTabArgs(1) },
-    { ShortcutAction::SwitchToTab2, LegacyParseSwitchToTabArgs(2) },
-    { ShortcutAction::SwitchToTab3, LegacyParseSwitchToTabArgs(3) },
-    { ShortcutAction::SwitchToTab4, LegacyParseSwitchToTabArgs(4) },
-    { ShortcutAction::SwitchToTab5, LegacyParseSwitchToTabArgs(5) },
-    { ShortcutAction::SwitchToTab6, LegacyParseSwitchToTabArgs(6) },
-    { ShortcutAction::SwitchToTab7, LegacyParseSwitchToTabArgs(7) },
-    { ShortcutAction::SwitchToTab8, LegacyParseSwitchToTabArgs(8) },
 
     { ShortcutAction::ResizePane, winrt::TerminalApp::implementation::ResizePaneArgs::FromJson },
-    { ShortcutAction::ResizePaneLeft, LegacyParseResizePaneArgs(Direction::Left) },
-    { ShortcutAction::ResizePaneRight, LegacyParseResizePaneArgs(Direction::Right) },
-    { ShortcutAction::ResizePaneUp, LegacyParseResizePaneArgs(Direction::Up) },
-    { ShortcutAction::ResizePaneDown, LegacyParseResizePaneArgs(Direction::Down) },
 
     { ShortcutAction::MoveFocus, winrt::TerminalApp::implementation::MoveFocusArgs::FromJson },
-    { ShortcutAction::MoveFocusLeft, LegacyParseMoveFocusArgs(Direction::Left) },
-    { ShortcutAction::MoveFocusRight, LegacyParseMoveFocusArgs(Direction::Right) },
-    { ShortcutAction::MoveFocusUp, LegacyParseMoveFocusArgs(Direction::Up) },
-    { ShortcutAction::MoveFocusDown, LegacyParseMoveFocusArgs(Direction::Down) },
 
-    { ShortcutAction::DecreaseFontSize, LegacyParseAdjustFontSizeArgs(-1) },
-    { ShortcutAction::IncreaseFontSize, LegacyParseAdjustFontSizeArgs(1) },
+    { ShortcutAction::AdjustFontSize, winrt::TerminalApp::implementation::AdjustFontSizeArgs::FromJson },
 
     { ShortcutAction::SplitPane, winrt::TerminalApp::implementation::SplitPaneArgs::FromJson },
-    { ShortcutAction::SplitVertical, LegacyParseSplitPaneArgs(SplitState::Vertical) },
-    { ShortcutAction::SplitHorizontal, LegacyParseSplitPaneArgs(SplitState::Horizontal) },
 
     { ShortcutAction::Invalid, nullptr },
 };

src/cascadia/TerminalApp/AppLogic.cpp

@@ -35,7 +35,8 @@ static const std::array<std::wstring_view, static_cast<uint32_t>(SettingsLoadWar
     USES_RESOURCE(L"InvalidIcon"),
     USES_RESOURCE(L"AtLeastOneKeybindingWarning"),
     USES_RESOURCE(L"TooManyKeysForChord"),
-    USES_RESOURCE(L"MissingRequiredParameter")
+    USES_RESOURCE(L"MissingRequiredParameter"),
+    USES_RESOURCE(L"LegacyGlobalsProperty")
 };
 static const std::array<std::wstring_view, static_cast<uint32_t>(SettingsLoadErrors::ERRORS_SIZE)> settingsLoadErrorsLabels {
     USES_RESOURCE(L"NoProfilesText"),
@@ -138,6 +139,29 @@ catch (...)
 
 namespace winrt::TerminalApp::implementation
 {
+    // Function Description:
+    // - Get the AppLogic for the current active Xaml application, or null if there isn't one.
+    // Return value:
+    // - A pointer (bare) to the applogic, or nullptr. The app logic outlives all other objects,
+    //   unless the application is in a terrible way, so this is "safe."
+    AppLogic* AppLogic::Current() noexcept
+    try
+    {
+        if (auto currentXamlApp{ winrt::Windows::UI::Xaml::Application::Current().try_as<winrt::TerminalApp::App>() })
+        {
+            if (auto appLogicPointer{ winrt::get_self<AppLogic>(currentXamlApp.Logic()) })
+            {
+                return appLogicPointer;
+            }
+        }
+        return nullptr;
+    }
+    catch (...)
+    {
+        LOG_CAUGHT_EXCEPTION();
+        return nullptr;
+    }
+
     AppLogic::AppLogic() :
         _dialogLock{},
         _loadedInitialSettings{ false },
@@ -218,7 +242,7 @@ namespace winrt::TerminalApp::implementation
         _root->Loaded({ this, &AppLogic::_OnLoaded });
         _root->Create();
 
-        _ApplyTheme(_settings->GlobalSettings().GetRequestedTheme());
+        _ApplyTheme(_settings->GlobalSettings().GetTheme());
 
         TraceLoggingWrite(
             g_hTerminalAppProvider,
@@ -260,7 +284,27 @@ namespace winrt::TerminalApp::implementation
         // IMPORTANT: Set the requested theme of the dialog, because the
         // PopupRoot isn't directly in the Xaml tree of our root. So the dialog
         // won't inherit our RequestedTheme automagically.
-        dialog.RequestedTheme(_settings->GlobalSettings().GetRequestedTheme());
+        // GH#5195, GH#3654 Because we cannot set RequestedTheme at the application level,
+        // we occasionally run into issues where parts of our UI end up themed incorrectly.
+        // Dialogs, for example, live under a different Xaml root element than the rest of
+        // our application. This makes our popup menus and buttons "disappear" when the
+        // user wants Terminal to be in a different theme than the rest of the system.
+        // This hack---and it _is_ a hack--walks up a dialog's ancestry and forces the
+        // theme on each element up to the root. We're relying a bit on Xaml's implementation
+        // details here, but it does have the desired effect.
+        // It's not enough to set the theme on the dialog alone.
+        auto themingLambda{ [this](const Windows::Foundation::IInspectable& sender, const RoutedEventArgs&) {
+            auto theme{ _settings->GlobalSettings().GetTheme() };
+            auto element{ sender.try_as<winrt::Windows::UI::Xaml::FrameworkElement>() };
+            while (element)
+            {
+                element.RequestedTheme(theme);
+                element = element.Parent().try_as<winrt::Windows::UI::Xaml::FrameworkElement>();
+            }
+        } };
+
+        themingLambda(dialog, nullptr); // if it's already in the tree
+        auto loadedRevoker{ dialog.Loaded(winrt::auto_revoke, themingLambda) }; // if it's not yet in the tree
 
         // Display the dialog.
         co_await dialog.ShowAsync(Controls::ContentDialogPlacement::Popup);
@@ -296,12 +340,14 @@ namespace winrt::TerminalApp::implementation
         const auto errorLabel = GetLibraryResourceString(contentKey);
         errorRun.Text(errorLabel);
         warningsTextBlock.Inlines().Append(errorRun);
+        warningsTextBlock.Inlines().Append(Documents::LineBreak{});
 
         if (FAILED(settingsLoadedResult))
         {
             if (!_settingsLoadExceptionText.empty())
             {
                 warningsTextBlock.Inlines().Append(_BuildErrorRun(_settingsLoadExceptionText, ::winrt::Windows::UI::Xaml::Application::Current().as<::winrt::TerminalApp::App>().Resources()));
+                warningsTextBlock.Inlines().Append(Documents::LineBreak{});
             }
         }
 
@@ -309,6 +355,7 @@ namespace winrt::TerminalApp::implementation
         winrt::Windows::UI::Xaml::Documents::Run usingDefaultsRun;
         const auto usingDefaultsText = RS_(L"UsingDefaultSettingsText");
         usingDefaultsRun.Text(usingDefaultsText);
+        warningsTextBlock.Inlines().Append(Documents::LineBreak{});
         warningsTextBlock.Inlines().Append(usingDefaultsRun);
 
         Controls::ContentDialog dialog;
@@ -345,6 +392,28 @@ namespace winrt::TerminalApp::implementation
             if (!warningText.empty())
             {
                 warningsTextBlock.Inlines().Append(_BuildErrorRun(warningText, ::winrt::Windows::UI::Xaml::Application::Current().as<::winrt::TerminalApp::App>().Resources()));
+
+                // The "LegacyGlobalsProperty" warning is special - it has a URL
+                // that goes with it. So we need to manually construct a
+                // Hyperlink and insert it along with the warning text.
+                if (warning == SettingsLoadWarnings::LegacyGlobalsProperty)
+                {
+                    // Add the URL here too
+                    const auto legacyGlobalsLinkLabel = RS_(L"LegacyGlobalsPropertyHrefLabel");
+                    const auto legacyGlobalsLinkUriValue = RS_(L"LegacyGlobalsPropertyHrefUrl");
+
+                    winrt::Windows::UI::Xaml::Documents::Run legacyGlobalsLinkText;
+                    winrt::Windows::UI::Xaml::Documents::Hyperlink legacyGlobalsLink;
+                    winrt::Windows::Foundation::Uri legacyGlobalsLinkUri{ legacyGlobalsLinkUriValue };
+
+                    legacyGlobalsLinkText.Text(legacyGlobalsLinkLabel);
+                    legacyGlobalsLink.NavigateUri(legacyGlobalsLinkUri);
+                    legacyGlobalsLink.Inlines().Append(legacyGlobalsLinkText);
+
+                    warningsTextBlock.Inlines().Append(legacyGlobalsLink);
+                }
+
+                warningsTextBlock.Inlines().Append(Documents::LineBreak{});
             }
         }
 
@@ -502,7 +571,7 @@ namespace winrt::TerminalApp::implementation
             LoadSettings();
         }
 
-        return _settings->GlobalSettings().GetRequestedTheme();
+        return _settings->GlobalSettings().GetTheme();
     }
 
     bool AppLogic::GetShowTabsInTitlebar()
@@ -617,7 +686,7 @@ namespace winrt::TerminalApp::implementation
     void AppLogic::_RegisterSettingsChange()
     {
         // Get the containing folder.
-        std::filesystem::path settingsPath{ CascadiaSettings::GetSettingsPath() };
+        const auto settingsPath{ CascadiaSettings::GetSettingsPath() };
         const auto folder = settingsPath.parent_path();
 
         _reader.create(folder.c_str(),
@@ -683,7 +752,7 @@ namespace winrt::TerminalApp::implementation
         co_await winrt::resume_foreground(_root->Dispatcher());
 
         // Refresh the UI theme
-        _ApplyTheme(_settings->GlobalSettings().GetRequestedTheme());
+        _ApplyTheme(_settings->GlobalSettings().GetTheme());
     }
 
     // Method Description:
@@ -842,6 +911,65 @@ namespace winrt::TerminalApp::implementation
         return { L"" };
     }
 
+    winrt::hstring AppLogic::ApplicationDisplayName() const
+    {
+        try
+        {
+            const auto package{ winrt::Windows::ApplicationModel::Package::Current() };
+            return package.DisplayName();
+        }
+        CATCH_LOG();
+
+        return RS_(L"ApplicationDisplayNameUnpackaged");
+    }
+
+    winrt::hstring AppLogic::ApplicationVersion() const
+    {
+        try
+        {
+            const auto package{ winrt::Windows::ApplicationModel::Package::Current() };
+            const auto version{ package.Id().Version() };
+            winrt::hstring formatted{ wil::str_printf<std::wstring>(L"%u.%u.%u.%u", version.Major, version.Minor, version.Build, version.Revision) };
+            return formatted;
+        }
+        CATCH_LOG();
+
+        // Try to get the version the old-fashioned way
+        try
+        {
+            struct LocalizationInfo
+            {
+                WORD language, codepage;
+            };
+            // Use the current module instance handle for TerminalApp.dll, nullptr for WindowsTerminal.exe
+            auto filename{ wil::GetModuleFileNameW<std::wstring>(wil::GetModuleInstanceHandle()) };
+            auto size{ GetFileVersionInfoSizeExW(0, filename.c_str(), nullptr) };
+            THROW_LAST_ERROR_IF(size == 0);
+            auto versionBuffer{ std::make_unique<std::byte[]>(size) };
+            THROW_IF_WIN32_BOOL_FALSE(GetFileVersionInfoExW(0, filename.c_str(), 0, size, versionBuffer.get()));
+
+            // Get the list of Version localizations
+            LocalizationInfo* pVarLocalization{ nullptr };
+            UINT varLen{ 0 };
+            THROW_IF_WIN32_BOOL_FALSE(VerQueryValueW(versionBuffer.get(), L"\\VarFileInfo\\Translation", reinterpret_cast<void**>(&pVarLocalization), &varLen));
+            THROW_HR_IF(E_UNEXPECTED, varLen < sizeof(*pVarLocalization)); // there must be at least one translation
+
+            // Get the product version from the localized version compartment
+            // We're using String/ProductVersion here because our build pipeline puts more rich information in it (like the branch name)
+            // than in the unlocalized numeric version fields.
+            WCHAR* pProductVersion{ nullptr };
+            UINT versionLen{ 0 };
+            const auto localizedVersionName{ wil::str_printf<std::wstring>(L"\\StringFileInfo\\%04x%04x\\ProductVersion",
+                                                                           pVarLocalization->language ? pVarLocalization->language : 0x0409, // well-known en-US LCID
+                                                                           pVarLocalization->codepage) };
+            THROW_IF_WIN32_BOOL_FALSE(VerQueryValueW(versionBuffer.get(), localizedVersionName.c_str(), reinterpret_cast<void**>(&pProductVersion), &versionLen));
+            return { pProductVersion };
+        }
+        CATCH_LOG();
+
+        return RS_(L"ApplicationVersionUnknown");
+    }
+
     // -------------------------------- WinRT Events ---------------------------------
     // Winrt events need a method for adding a callback to the event and removing the callback.
     // These macros will define them both for you.

src/cascadia/TerminalApp/AppLogic.h

@@ -15,6 +15,8 @@ namespace winrt::TerminalApp::implementation
     struct AppLogic : AppLogicT<AppLogic>
     {
     public:
+        static AppLogic* Current() noexcept;
+
         AppLogic();
         ~AppLogic() = default;
 
@@ -28,6 +30,9 @@ namespace winrt::TerminalApp::implementation
         int32_t SetStartupCommandline(array_view<const winrt::hstring> actions);
         winrt::hstring EarlyExitMessage();
 
+        winrt::hstring ApplicationDisplayName() const;
+        winrt::hstring ApplicationVersion() const;
+
         Windows::Foundation::Point GetLaunchDimensions(uint32_t dpi);
         winrt::Windows::Foundation::Point GetLaunchInitialPositions(int32_t defaultInitialX, int32_t defaultInitialY);
         winrt::Windows::UI::Xaml::ElementTheme GetRequestedTheme();

src/cascadia/TerminalApp/AppLogic.idl

@@ -35,6 +35,9 @@ namespace TerminalApp
 
         String Title { get; };
 
+        String ApplicationDisplayName { get; };
+        String ApplicationVersion { get; };
+
         Windows.Foundation.Point GetLaunchDimensions(UInt32 dpi);
         Windows.Foundation.Point GetLaunchInitialPositions(Int32 defaultInitialX, Int32 defaultInitialY);
         Windows.UI.Xaml.ElementTheme GetRequestedTheme();

src/cascadia/TerminalApp/CascadiaSettings.cpp

@@ -11,6 +11,7 @@
 #include "../../inc/DefaultSettings.h"
 #include "AppLogic.h"
 #include "Utils.h"
+#include "LibraryResources.h"
 
 #include "PowershellCoreProfileGenerator.h"
 #include "WslDistroGenerator.h"
@@ -27,18 +28,17 @@ static constexpr std::wstring_view PACKAGED_PROFILE_ICON_PATH{ L"ms-appx:///Prof
 static constexpr std::wstring_view PACKAGED_PROFILE_ICON_EXTENSION{ L".png" };
 static constexpr std::wstring_view DEFAULT_LINUX_ICON_GUID{ L"{9acb9455-ca41-5af7-950f-6bca1bc9722f}" };
 
+// make sure this matches defaults.json.
+static constexpr std::wstring_view DEFAULT_WINDOWS_POWERSHELL_GUID{ L"{61c54bbd-c2c6-5271-96e7-009a87ff44bf}" };
+
 // Method Description:
 // - Returns the settings currently in use by the entire Terminal application.
 // Throws:
 // - HR E_INVALIDARG if the app isn't up and running.
 const CascadiaSettings& CascadiaSettings::GetCurrentAppSettings()
 {
-    auto currentXamlApp{ winrt::Windows::UI::Xaml::Application::Current().as<winrt::TerminalApp::App>() };
-    THROW_HR_IF_NULL(E_INVALIDARG, currentXamlApp);
-
-    auto appLogic = winrt::get_self<winrt::TerminalApp::implementation::AppLogic>(currentXamlApp.Logic());
+    auto appLogic{ ::winrt::TerminalApp::implementation::AppLogic::Current() };
     THROW_HR_IF_NULL(E_INVALIDARG, appLogic);
-
     return *(appLogic->GetSettings());
 }
 
@@ -70,7 +70,7 @@ CascadiaSettings::CascadiaSettings(const bool addDynamicProfiles)
 // - profileName: the name of the profile's GUID to return.
 // Return Value:
 // - the GUID associated with the profile name.
-std::optional<GUID> CascadiaSettings::FindGuid(const std::wstring& profileName) const noexcept
+std::optional<GUID> CascadiaSettings::FindGuid(const std::wstring_view profileName) const noexcept
 {
     std::optional<GUID> profileGuid{};
 
@@ -211,6 +211,8 @@ void CascadiaSettings::_ValidateSettings()
     // warning if an action didn't have a required arg.
     // This will also catch other keybinding warnings, like from GH#4239
     _ValidateKeybindings();
+
+    _ValidateNoGlobalsKey();
 }
 
 // Method Description:
@@ -244,7 +246,7 @@ void CascadiaSettings::_ValidateProfilesHaveGuid()
 }
 
 // Method Description:
-// - Checks if the "globals.defaultProfile" is set to one of the profiles we
+// - Checks if the "defaultProfile" is set to one of the profiles we
 //   actually have. If the value is unset, or the value is set to something that
 //   doesn't exist in the list of profiles, we'll arbitrarily pick the first
 //   profile to use temporarily as the default.
@@ -673,3 +675,59 @@ void CascadiaSettings::_ValidateKeybindings()
         _warnings.insert(_warnings.end(), keybindingWarnings.begin(), keybindingWarnings.end());
     }
 }
+
+// Method Description:
+// - Checks for the presence of the legacy "globals" key in the user's
+//   settings.json. If this key is present, then they've probably got a pre-0.11
+//   settings file that won't work as expected anymore. We should warn them
+//   about that.
+// Arguments:
+// - <none>
+// Return Value:
+// - <none>
+// - Appends a SettingsLoadWarnings::LegacyGlobalsProperty to our list of warnings if
+//   we find any invalid background images.
+void CascadiaSettings::_ValidateNoGlobalsKey()
+{
+    if (auto oldGlobalsProperty{ _userSettings["globals"] })
+    {
+        _warnings.push_back(::TerminalApp::SettingsLoadWarnings::LegacyGlobalsProperty);
+    }
+}
+
+// Method Description
+// - Replaces known tokens DEFAULT_PROFILE, PRODUCT and VERSION in the settings template
+//   with their expected values. DEFAULT_PROFILE is updated to match PowerShell Core's GUID
+//   if such a profile is detected. If it isn't, it'll be set to Windows PowerShell's GUID.
+// Arguments:
+// - settingsTemplate: a settings template
+// Return value:
+// - The new settings string.
+std::string CascadiaSettings::_ApplyFirstRunChangesToSettingsTemplate(std::string_view settingsTemplate) const
+{
+    std::string finalSettings{ settingsTemplate };
+    auto replace{ [](std::string& haystack, std::string_view needle, std::string_view replacement) {
+        auto pos{ std::string::npos };
+        while ((pos = haystack.rfind(needle, pos)) != std::string::npos)
+        {
+            haystack.replace(pos, needle.size(), replacement);
+        }
+    } };
+
+    std::wstring defaultProfileGuid{ DEFAULT_WINDOWS_POWERSHELL_GUID };
+    if (const auto psCoreProfileGuid{ FindGuid(PowershellCoreProfileGenerator::GetPreferredPowershellProfileName()) })
+    {
+        defaultProfileGuid = Utils::GuidToString(*psCoreProfileGuid);
+    }
+
+    replace(finalSettings, "%DEFAULT_PROFILE%", til::u16u8(defaultProfileGuid));
+    if (const auto appLogic{ winrt::TerminalApp::implementation::AppLogic::Current() })
+    {
+        replace(finalSettings, "%VERSION%", til::u16u8(appLogic->ApplicationVersion()));
+        replace(finalSettings, "%PRODUCT%", til::u16u8(appLogic->ApplicationDisplayName()));
+    }
+
+    replace(finalSettings, "%COMMAND_PROMPT_LOCALIZED_NAME%", RS_A(L"CommandPromptDisplayName"));
+
+    return finalSettings;
+}

src/cascadia/TerminalApp/CascadiaSettings.h

@@ -66,10 +66,10 @@ public:
     static std::unique_ptr<CascadiaSettings> FromJson(const Json::Value& json);
     void LayerJson(const Json::Value& json);
 
-    static std::wstring GetSettingsPath(const bool useRoamingPath = false);
-    static std::wstring GetDefaultSettingsPath();
+    static std::filesystem::path GetSettingsPath();
+    static std::filesystem::path GetDefaultSettingsPath();
 
-    std::optional<GUID> FindGuid(const std::wstring& profileName) const noexcept;
+    std::optional<GUID> FindGuid(const std::wstring_view profileName) const noexcept;
     const Profile* FindProfile(GUID profileGuid) const noexcept;
 
     std::vector<TerminalApp::SettingsLoadWarnings>& GetWarnings();
@@ -95,6 +95,7 @@ private:
     static const Json::Value& _GetDisabledProfileSourcesJsonObject(const Json::Value& json);
     bool _PrependSchemaDirective();
     bool _AppendDynamicProfilesToUserSettings();
+    std::string _ApplyFirstRunChangesToSettingsTemplate(std::string_view settingsTemplate) const;
 
     void _ApplyDefaultsFromUserSettings();
 
@@ -118,6 +119,7 @@ private:
     void _ValidateAllSchemesExist();
     void _ValidateMediaResources();
     void _ValidateKeybindings();
+    void _ValidateNoGlobalsKey();
 
     friend class TerminalAppLocalTests::SettingsTests;
     friend class TerminalAppLocalTests::ProfileTests;

src/cascadia/TerminalApp/CascadiaSettingsSerialization.cpp

@@ -13,7 +13,7 @@
 // defaults.h is a file containing the default json settings in a std::string_view
 #include "defaults.h"
 #include "defaults-universal.h"
-// userDefault.h is like the above, but with a default template for the user's profiles.json.
+// userDefault.h is like the above, but with a default template for the user's settings.json.
 #include "userDefaults.h"
 // Both defaults.h and userDefaults.h are generated at build time into the
 // "Generated Files" directory.
@@ -23,7 +23,8 @@ using namespace winrt::Microsoft::Terminal::TerminalControl;
 using namespace winrt::TerminalApp;
 using namespace ::Microsoft::Console;
 
-static constexpr std::wstring_view SettingsFilename{ L"profiles.json" };
+static constexpr std::wstring_view SettingsFilename{ L"settings.json" };
+static constexpr std::wstring_view LegacySettingsFilename{ L"profiles.json" };
 static constexpr std::wstring_view UnpackagedSettingsFolderName{ L"Microsoft\\Windows Terminal\\" };
 
 static constexpr std::wstring_view DefaultsFilename{ L"defaults.json" };
@@ -33,7 +34,6 @@ static constexpr std::string_view ProfilesKey{ "profiles" };
 static constexpr std::string_view DefaultSettingsKey{ "defaults" };
 static constexpr std::string_view ProfilesListKey{ "list" };
 static constexpr std::string_view KeybindingsKey{ "keybindings" };
-static constexpr std::string_view GlobalsKey{ "globals" };
 static constexpr std::string_view SchemesKey{ "schemes" };
 
 static constexpr std::string_view DisabledProfileSourcesKey{ "disabledProfileSources" };
@@ -48,7 +48,7 @@ static constexpr std::string_view SettingsSchemaFragment{ "\n"
 //      it will load the settings from our packaged localappdata. If we're
 //      running as an unpackaged application, it will read it from the path
 //      we've set under localappdata.
-// - Loads both the settings from the defaults.json and the user's profiles.json
+// - Loads both the settings from the defaults.json and the user's settings.json
 // - Also runs and dynamic profile generators. If any of those generators create
 //   new profiles, we'll write the user settings back to the file, with the new
 //   profiles inserted into their list of profiles.
@@ -74,20 +74,22 @@ std::unique_ptr<CascadiaSettings> CascadiaSettings::LoadAll()
     {
         resultPtr->_ParseJsonString(fileData.value(), false);
     }
-    else
+
+    // Load profiles from dynamic profile generators. _userSettings should be
+    // created by now, because we're going to check in there for any generators
+    // that should be disabled (if the user had any settings.)
+    resultPtr->_LoadDynamicProfiles();
+
+    if (!fileHasData)
     {
         // We didn't find the user settings. We'll need to create a file
         // to use as the user defaults.
         // For now, just parse our user settings template as their user settings.
-        resultPtr->_ParseJsonString(UserSettingsJson, false);
+        auto userSettings{ resultPtr->_ApplyFirstRunChangesToSettingsTemplate(UserSettingsJson) };
+        resultPtr->_ParseJsonString(userSettings, false);
         needToWriteFile = true;
     }
 
-    // Load profiles from dynamic profile generators. _userSettings should be
-    // created by now, because we're going to check in there for any generators
-    // that should be disabled.
-    resultPtr->_LoadDynamicProfiles();
-
     // See microsoft/terminal#2325: find the defaultSettings from the user's
     // settings. Layer those settings upon all the existing profiles we have
     // (defaults and dynamic profiles). We'll also set
@@ -501,19 +503,8 @@ std::unique_ptr<CascadiaSettings> CascadiaSettings::FromJson(const Json::Value&
 // <none>
 void CascadiaSettings::LayerJson(const Json::Value& json)
 {
-    // microsoft/terminal#2906: First layer the root object as our globals. If
-    // there is also a `globals` object, layer that one on top of the settings
-    // from the root.
     _globals.LayerJson(json);
 
-    if (auto globals{ json[GlobalsKey.data()] })
-    {
-        if (globals.isObject())
-        {
-            _globals.LayerJson(globals);
-        }
-    }
-
     if (auto schemes{ json[SchemesKey.data()] })
     {
         for (auto schemeJson : schemes)
@@ -619,7 +610,6 @@ void CascadiaSettings::_ApplyDefaultsFromUserSettings()
     // If `profiles` was an object, then look for the `defaults` object
     // underneath it for the default profile settings.
     auto defaultSettings{ Json::Value::null };
-
     if (const auto profiles{ _userSettings[JsonKey(ProfilesKey)] })
     {
         if (profiles.isObject())
@@ -628,6 +618,8 @@ void CascadiaSettings::_ApplyDefaultsFromUserSettings()
         }
     }
 
+    // cache and apply default profile settings
+    // from user settings file
     if (defaultSettings)
     {
         _userDefaultProfileSettings = defaultSettings;
@@ -757,33 +749,31 @@ std::optional<std::string> CascadiaSettings::_ReadUserSettings()
 
     if (!hFile)
     {
-        // GH#1770 - Now that we're _not_ roaming our settings, do a quick check
-        // to see if there's a file in the Roaming App data folder. If there is
-        // a file there, but not in the LocalAppData, it's likely the user is
-        // upgrading from a version of the terminal from before this change.
-        // We'll try moving the file from the Roaming app data folder to the
-        // local appdata folder.
+        // GH#5186 - We moved from profiles.json to settings.json; we want to
+        // migrate any file we find. We're using MoveFile in case their settings.json
+        // is a symbolic link.
+        auto pathToLegacySettingsFile{ pathToSettingsFile };
+        pathToLegacySettingsFile.replace_filename(LegacySettingsFilename);
 
-        const auto pathToRoamingSettingsFile{ CascadiaSettings::GetSettingsPath(true) };
-        wil::unique_hfile hRoamingFile{ CreateFileW(pathToRoamingSettingsFile.c_str(),
-                                                    GENERIC_READ,
-                                                    FILE_SHARE_READ | FILE_SHARE_WRITE,
-                                                    nullptr,
-                                                    OPEN_EXISTING,
-                                                    FILE_ATTRIBUTE_NORMAL,
-                                                    nullptr) };
+        wil::unique_hfile hLegacyFile{ CreateFileW(pathToLegacySettingsFile.c_str(),
+                                                   GENERIC_READ,
+                                                   FILE_SHARE_READ | FILE_SHARE_WRITE,
+                                                   nullptr,
+                                                   OPEN_EXISTING,
+                                                   FILE_ATTRIBUTE_NORMAL,
+                                                   nullptr) };
 
-        if (hRoamingFile)
+        if (hLegacyFile)
         {
             // Close the file handle, move it, and re-open the file in its new location.
-            hRoamingFile.reset();
+            hLegacyFile.reset();
 
             // Note: We're unsure if this is unsafe. Theoretically it's possible
             // that two instances of the app will try and move the settings file
             // simultaneously. We don't know what might happen in that scenario,
             // but we're also not sure how to safely lock the file to prevent
             // that from occurring.
-            THROW_LAST_ERROR_IF(!MoveFile(pathToRoamingSettingsFile.c_str(),
+            THROW_LAST_ERROR_IF(!MoveFile(pathToLegacySettingsFile.c_str(),
                                           pathToSettingsFile.c_str()));
 
             hFile.reset(CreateFileW(pathToSettingsFile.c_str(),
@@ -841,22 +831,18 @@ std::optional<std::string> CascadiaSettings::_ReadFile(HANDLE hFile)
 //   package, or in its unpackaged location. This path is under the "Local
 //   AppData" folder, so it _doesn't_ roam to other machines.
 // - If the application is unpackaged,
-//   the file will end up under e.g. C:\Users\admin\AppData\Local\Microsoft\Windows Terminal\profiles.json
+//   the file will end up under e.g. C:\Users\admin\AppData\Local\Microsoft\Windows Terminal\settings.json
 // Arguments:
 // - <none>
 // Return Value:
 // - the full path to the settings file
-std::wstring CascadiaSettings::GetSettingsPath(const bool useRoamingPath)
+std::filesystem::path CascadiaSettings::GetSettingsPath()
 {
     wil::unique_cotaskmem_string localAppDataFolder;
     // KF_FLAG_FORCE_APP_DATA_REDIRECTION, when engaged, causes SHGet... to return
     // the new AppModel paths (Packages/xxx/RoamingState, etc.) for standard path requests.
     // Using this flag allows us to avoid Windows.Storage.ApplicationData completely.
-    const auto knowFolderId = useRoamingPath ? FOLDERID_RoamingAppData : FOLDERID_LocalAppData;
-    if (FAILED(SHGetKnownFolderPath(knowFolderId, KF_FLAG_FORCE_APP_DATA_REDIRECTION, nullptr, &localAppDataFolder)))
-    {
-        THROW_LAST_ERROR();
-    }
+    THROW_IF_FAILED(SHGetKnownFolderPath(FOLDERID_LocalAppData, KF_FLAG_FORCE_APP_DATA_REDIRECTION, nullptr, &localAppDataFolder));
 
     std::filesystem::path parentDirectoryForSettingsFile{ localAppDataFolder.get() };
 
@@ -871,7 +857,7 @@ std::wstring CascadiaSettings::GetSettingsPath(const bool useRoamingPath)
     return parentDirectoryForSettingsFile / SettingsFilename;
 }
 
-std::wstring CascadiaSettings::GetDefaultSettingsPath()
+std::filesystem::path CascadiaSettings::GetDefaultSettingsPath()
 {
     // Both of these posts suggest getting the path to the exe, then removing
     // the exe's name to get the package root:
@@ -919,10 +905,9 @@ const Json::Value& CascadiaSettings::_GetProfilesJsonObject(const Json::Value& j
 //   given object
 const Json::Value& CascadiaSettings::_GetDisabledProfileSourcesJsonObject(const Json::Value& json)
 {
-    // Check the globals first, then look in the root.
-    if (json.isMember(JsonKey(GlobalsKey)))
+    if (!json)
     {
-        return json[JsonKey(GlobalsKey)][JsonKey(DisabledProfileSourcesKey)];
+        return Json::Value::nullSingleton();
     }
     return json[JsonKey(DisabledProfileSourcesKey)];
 }

src/cascadia/TerminalApp/ColorScheme.cpp

@@ -14,7 +14,6 @@ using namespace winrt::Microsoft::Terminal::Settings;
 using namespace winrt::Microsoft::Terminal::TerminalControl;
 
 static constexpr std::string_view NameKey{ "name" };
-static constexpr std::string_view TableKey{ "colors" };
 static constexpr std::string_view ForegroundKey{ "foreground" };
 static constexpr std::string_view BackgroundKey{ "background" };
 static constexpr std::string_view SelectionBackgroundKey{ "selectionBackground" };
@@ -177,22 +176,6 @@ void ColorScheme::LayerJson(const Json::Value& json)
         _cursorColor = color;
     }
 
-    // Legacy Deserialization. Leave in place to allow forward compatibility
-    if (auto table{ json[JsonKey(TableKey)] })
-    {
-        int i = 0;
-
-        for (const auto& tableEntry : table)
-        {
-            if (tableEntry.isString())
-            {
-                auto color = Utils::ColorFromHexString(tableEntry.asString());
-                _table.at(i) = color;
-            }
-            i++;
-        }
-    }
-
     int i = 0;
     for (const auto& current : TableColors)
     {

src/cascadia/TerminalApp/DefaultProfileUtils.cpp

@@ -21,7 +21,7 @@ TerminalApp::Profile CreateDefaultProfile(const std::wstring_view name)
                                                                     gsl::as_bytes(gsl::make_span(name))) };
     TerminalApp::Profile newProfile{ profileGuid };
 
-    newProfile.SetName(static_cast<std::wstring>(name));
+    newProfile.SetName(name);
 
     std::wstring iconPath{ PACKAGED_PROFILE_ICON_PATH };
     iconPath.append(Microsoft::Console::Utils::GuidToString(profileGuid));

src/cascadia/TerminalApp/GlobalAppSettings.cpp

@@ -25,13 +25,14 @@ static constexpr std::string_view InitialColsKey{ "initialCols" };
 static constexpr std::string_view RowsToScrollKey{ "rowsToScroll" };
 static constexpr std::string_view InitialPositionKey{ "initialPosition" };
 static constexpr std::string_view ShowTitleInTitlebarKey{ "showTerminalTitleInTitlebar" };
-static constexpr std::string_view RequestedThemeKey{ "requestedTheme" };
+static constexpr std::string_view ThemeKey{ "theme" };
 static constexpr std::string_view TabWidthModeKey{ "tabWidthMode" };
 static constexpr std::wstring_view EqualTabWidthModeValue{ L"equal" };
 static constexpr std::wstring_view TitleLengthTabWidthModeValue{ L"titleLength" };
 static constexpr std::string_view ShowTabsInTitlebarKey{ "showTabsInTitlebar" };
 static constexpr std::string_view WordDelimitersKey{ "wordDelimiters" };
 static constexpr std::string_view CopyOnSelectKey{ "copyOnSelect" };
+static constexpr std::string_view CopyFormattingKey{ "copyFormatting" };
 static constexpr std::string_view LaunchModeKey{ "launchMode" };
 static constexpr std::string_view ConfirmCloseAllKey{ "confirmCloseAllTabs" };
 static constexpr std::string_view SnapToGridOnResizeKey{ "snapToGridOnResize" };
@@ -63,10 +64,11 @@ GlobalAppSettings::GlobalAppSettings() :
     _initialY{},
     _showTitleInTitlebar{ true },
     _showTabsInTitlebar{ true },
-    _requestedTheme{ ElementTheme::Default },
+    _theme{ ElementTheme::Default },
     _tabWidthMode{ TabViewWidthMode::Equal },
     _wordDelimiters{ DEFAULT_WORD_DELIMITERS },
     _copyOnSelect{ false },
+    _copyFormatting{ false },
     _launchMode{ LaunchMode::DefaultMode },
     _debugFeatures{ debugFeaturesDefault }
 {
@@ -121,14 +123,14 @@ void GlobalAppSettings::SetShowTitleInTitlebar(const bool showTitleInTitlebar) n
     _showTitleInTitlebar = showTitleInTitlebar;
 }
 
-ElementTheme GlobalAppSettings::GetRequestedTheme() const noexcept
+ElementTheme GlobalAppSettings::GetTheme() const noexcept
 {
-    return _requestedTheme;
+    return _theme;
 }
 
-void GlobalAppSettings::SetRequestedTheme(const ElementTheme requestedTheme) noexcept
+void GlobalAppSettings::SetTheme(const ElementTheme theme) noexcept
 {
-    _requestedTheme = requestedTheme;
+    _theme = theme;
 }
 
 TabViewWidthMode GlobalAppSettings::GetTabWidthMode() const noexcept
@@ -161,6 +163,11 @@ void GlobalAppSettings::SetCopyOnSelect(const bool copyOnSelect) noexcept
     _copyOnSelect = copyOnSelect;
 }
 
+bool GlobalAppSettings::GetCopyFormatting() const noexcept
+{
+    return _copyFormatting;
+}
+
 LaunchMode GlobalAppSettings::GetLaunchMode() const noexcept
 {
     return _launchMode;
@@ -245,8 +252,9 @@ Json::Value GlobalAppSettings::ToJson() const
     jsonObject[JsonKey(ShowTabsInTitlebarKey)] = _showTabsInTitlebar;
     jsonObject[JsonKey(WordDelimitersKey)] = winrt::to_string(_wordDelimiters);
     jsonObject[JsonKey(CopyOnSelectKey)] = _copyOnSelect;
+    jsonObject[JsonKey(CopyFormattingKey)] = _copyFormatting;
     jsonObject[JsonKey(LaunchModeKey)] = winrt::to_string(_SerializeLaunchMode(_launchMode));
-    jsonObject[JsonKey(RequestedThemeKey)] = winrt::to_string(_SerializeTheme(_requestedTheme));
+    jsonObject[JsonKey(ThemeKey)] = winrt::to_string(_SerializeTheme(_theme));
     jsonObject[JsonKey(TabWidthModeKey)] = winrt::to_string(_SerializeTabWidthMode(_tabWidthMode));
     jsonObject[JsonKey(KeybindingsKey)] = _keybindings->ToJson();
     jsonObject[JsonKey(ConfirmCloseAllKey)] = _confirmCloseAllTabs;
@@ -311,14 +319,16 @@ void GlobalAppSettings::LayerJson(const Json::Value& json)
 
     JsonUtils::GetBool(json, CopyOnSelectKey, _copyOnSelect);
 
+    JsonUtils::GetBool(json, CopyFormattingKey, _copyFormatting);
+
     if (auto launchMode{ json[JsonKey(LaunchModeKey)] })
     {
         _launchMode = _ParseLaunchMode(GetWstringFromJson(launchMode));
     }
 
-    if (auto requestedTheme{ json[JsonKey(RequestedThemeKey)] })
+    if (auto theme{ json[JsonKey(ThemeKey)] })
     {
-        _requestedTheme = _ParseTheme(GetWstringFromJson(requestedTheme));
+        _theme = _ParseTheme(GetWstringFromJson(theme));
     }
 
     if (auto tabWidthMode{ json[JsonKey(TabWidthModeKey)] })

src/cascadia/TerminalApp/GlobalAppSettings.h

@@ -53,8 +53,10 @@ public:
     bool GetConfirmCloseAllTabs() const noexcept;
     void SetConfirmCloseAllTabs(const bool confirmCloseAllTabs) noexcept;
 
-    void SetRequestedTheme(const winrt::Windows::UI::Xaml::ElementTheme requestedTheme) noexcept;
+    winrt::Windows::UI::Xaml::ElementTheme GetTheme() const noexcept;
+    void SetTheme(const winrt::Windows::UI::Xaml::ElementTheme requestedTheme) noexcept;
 
+    winrt::Microsoft::UI::Xaml::Controls::TabViewWidthMode GetTabWidthMode() const noexcept;
     void SetTabWidthMode(const winrt::Microsoft::UI::Xaml::Controls::TabViewWidthMode tabWidthMode);
 
     bool GetShowTabsInTitlebar() const noexcept;
@@ -66,6 +68,8 @@ public:
     bool GetCopyOnSelect() const noexcept;
     void SetCopyOnSelect(const bool copyOnSelect) noexcept;
 
+    bool GetCopyFormatting() const noexcept;
+
     std::optional<int32_t> GetInitialX() const noexcept;
 
     std::optional<int32_t> GetInitialY() const noexcept;
@@ -73,10 +77,6 @@ public:
     winrt::TerminalApp::LaunchMode GetLaunchMode() const noexcept;
     void SetLaunchMode(const winrt::TerminalApp::LaunchMode launchMode);
 
-    winrt::Windows::UI::Xaml::ElementTheme GetRequestedTheme() const noexcept;
-
-    winrt::Microsoft::UI::Xaml::Controls::TabViewWidthMode GetTabWidthMode() const noexcept;
-
     bool DebugFeaturesEnabled() const noexcept;
 
     Json::Value ToJson() const;
@@ -112,7 +112,8 @@ private:
     bool _showTabsInTitlebar;
     std::wstring _wordDelimiters;
     bool _copyOnSelect;
-    winrt::Windows::UI::Xaml::ElementTheme _requestedTheme;
+    bool _copyFormatting;
+    winrt::Windows::UI::Xaml::ElementTheme _theme;
     winrt::Microsoft::UI::Xaml::Controls::TabViewWidthMode _tabWidthMode;
 
     winrt::TerminalApp::LaunchMode _launchMode;

src/cascadia/TerminalApp/PowershellCoreProfileGenerator.cpp

@@ -21,6 +21,7 @@ static constexpr std::wstring_view POWERSHELL_PREVIEW_PFN{ L"Microsoft.PowerShel
 static constexpr std::wstring_view PWSH_EXE{ L"pwsh.exe" };
 static constexpr std::wstring_view POWERSHELL_ICON{ L"ms-appx:///ProfileIcons/pwsh.png" };
 static constexpr std::wstring_view POWERSHELL_PREVIEW_ICON{ L"ms-appx:///ProfileIcons/pwsh-preview.png" };
+static constexpr std::wstring_view POWERSHELL_PREFERRED_PROFILE_NAME{ L"PowerShell" };
 
 namespace
 {
@@ -322,8 +323,17 @@ std::vector<TerminalApp::Profile> PowershellCoreProfileGenerator::GenerateProfil
         // (or the closest approximation thereof). It may choose a preview instance as the "best" if it is a higher version.
         auto firstProfile = profiles.begin();
         firstProfile->SetGuid(PowershellCoreGuid);
-        firstProfile->SetName(L"PowerShell");
+        firstProfile->SetName(POWERSHELL_PREFERRED_PROFILE_NAME);
     }
 
     return profiles;
 }
+
+// Function Description:
+// - Returns the thing it's named for.
+// Return value:
+// - the thing it says in the name
+const std::wstring_view PowershellCoreProfileGenerator::GetPreferredPowershellProfileName()
+{
+    return POWERSHELL_PREFERRED_PROFILE_NAME;
+}

src/cascadia/TerminalApp/PowershellCoreProfileGenerator.h

@@ -23,6 +23,8 @@ namespace TerminalApp
     class PowershellCoreProfileGenerator : public TerminalApp::IDynamicProfileGenerator
     {
     public:
+        static const std::wstring_view GetPreferredPowershellProfileName();
+
         PowershellCoreProfileGenerator() = default;
         ~PowershellCoreProfileGenerator() = default;
         std::wstring_view GetNamespace() override;

src/cascadia/TerminalApp/Profile.cpp

@@ -19,13 +19,11 @@ static constexpr std::string_view NameKey{ "name" };
 static constexpr std::string_view GuidKey{ "guid" };
 static constexpr std::string_view SourceKey{ "source" };
 static constexpr std::string_view ColorSchemeKey{ "colorScheme" };
-static constexpr std::string_view ColorSchemeKeyOld{ "colorscheme" };
 static constexpr std::string_view HiddenKey{ "hidden" };
 
 static constexpr std::string_view ForegroundKey{ "foreground" };
 static constexpr std::string_view BackgroundKey{ "background" };
 static constexpr std::string_view SelectionBackgroundKey{ "selectionBackground" };
-static constexpr std::string_view ColorTableKey{ "colorTable" };
 static constexpr std::string_view TabTitleKey{ "tabTitle" };
 static constexpr std::string_view SuppressApplicationTitleKey{ "suppressApplicationTitle" };
 static constexpr std::string_view HistorySizeKey{ "historySize" };
@@ -105,7 +103,6 @@ Profile::Profile(const std::optional<GUID>& guid) :
     _defaultBackground{},
     _selectionBackground{},
     _cursorColor{},
-    _colorTable{},
     _tabTitle{},
     _suppressApplicationTitle{},
     _historySize{ DEFAULT_HISTORY_SIZE },
@@ -171,11 +168,6 @@ TerminalSettings Profile::CreateTerminalSettings(const std::unordered_map<std::w
     TerminalSettings terminalSettings{};
 
     // Fill in the Terminal Setting's CoreSettings from the profile
-    auto const colorTableCount = gsl::narrow_cast<int>(_colorTable.size());
-    for (int i = 0; i < colorTableCount; i++)
-    {
-        terminalSettings.SetColorTableEntry(i, _colorTable[i]);
-    }
     terminalSettings.HistorySize(_historySize);
     terminalSettings.SnapOnInput(_snapOnInput);
     terminalSettings.CursorHeight(_cursorHeight);
@@ -308,15 +300,6 @@ Json::Value Profile::ToJson() const
         const auto scheme = winrt::to_string(_schemeName.value());
         root[JsonKey(ColorSchemeKey)] = scheme;
     }
-    else
-    {
-        Json::Value tableArray{};
-        for (auto& color : _colorTable)
-        {
-            tableArray.append(Utils::ColorToHexString(color));
-        }
-        root[JsonKey(ColorTableKey)] = tableArray;
-    }
     root[JsonKey(HistorySizeKey)] = _historySize;
     root[JsonKey(SnapOnInputKey)] = _snapOnInput;
     // Only add the cursor height property if we're a legacy-style cursor.
@@ -644,26 +627,6 @@ void Profile::LayerJson(const Json::Value& json)
     JsonUtils::GetOptionalColor(json, CursorColorKey, _cursorColor);
 
     JsonUtils::GetOptionalString(json, ColorSchemeKey, _schemeName);
-    // TODO:GH#1069 deprecate old settings key
-    JsonUtils::GetOptionalString(json, ColorSchemeKeyOld, _schemeName);
-
-    // Only look for the "table" if there's no "schemeName"
-    if (!(json.isMember(JsonKey(ColorSchemeKey))) &&
-        !(json.isMember(JsonKey(ColorSchemeKeyOld))) &&
-        json.isMember(JsonKey(ColorTableKey)))
-    {
-        auto colortable{ json[JsonKey(ColorTableKey)] };
-        int i = 0;
-        for (const auto& tableEntry : colortable)
-        {
-            if (tableEntry.isString())
-            {
-                const auto color = Utils::ColorFromHexString(tableEntry.asString());
-                _colorTable[i] = color;
-            }
-            i++;
-        }
-    }
 
     // TODO:MSFT:20642297 - Use a sentinel value (-1) for "Infinite scrollback"
     JsonUtils::GetInt(json, HistorySizeKey, _historySize);
@@ -755,9 +718,9 @@ void Profile::SetStartingDirectory(std::wstring startingDirectory) noexcept
     _startingDirectory = std::move(startingDirectory);
 }
 
-void Profile::SetName(std::wstring name) noexcept
+void Profile::SetName(const std::wstring_view name) noexcept
 {
-    _name = std::move(name);
+    _name = static_cast<std::wstring>(name);
 }
 
 void Profile::SetUseAcrylic(bool useAcrylic) noexcept

src/cascadia/TerminalApp/Profile.h

@@ -79,7 +79,7 @@ public:
     void SetAcrylicOpacity(double opacity) noexcept;
     void SetCommandline(std::wstring cmdline) noexcept;
     void SetStartingDirectory(std::wstring startingDirectory) noexcept;
-    void SetName(std::wstring name) noexcept;
+    void SetName(const std::wstring_view name) noexcept;
     void SetUseAcrylic(bool useAcrylic) noexcept;
     void SetDefaultForeground(COLORREF defaultForeground) noexcept;
     void SetDefaultBackground(COLORREF defaultBackground) noexcept;
@@ -143,7 +143,6 @@ private:
     std::optional<uint32_t> _defaultBackground;
     std::optional<uint32_t> _selectionBackground;
     std::optional<uint32_t> _cursorColor;
-    std::array<uint32_t, COLOR_TABLE_SIZE> _colorTable;
     std::optional<std::wstring> _tabTitle;
     bool _suppressApplicationTitle;
     int32_t _historySize;

src/cascadia/TerminalApp/Resources/en-US/Resources.resw

@@ -1,17 +1,17 @@
 <?xml version="1.0" encoding="utf-8"?>
 <root>
-  <!-- 
-    Microsoft ResX Schema 
-    
+  <!--
+    Microsoft ResX Schema
+
     Version 2.0
-    
-    The primary goals of this format is to allow a simple XML format 
-    that is mostly human readable. The generation and parsing of the 
-    various data types are done through the TypeConverter classes 
+
+    The primary goals of this format is to allow a simple XML format
+    that is mostly human readable. The generation and parsing of the
+    various data types are done through the TypeConverter classes
     associated with the data types.
-    
+
     Example:
-    
+
     ... ado.net/XML headers & schema ...
     <resheader name="resmimetype">text/microsoft-resx</resheader>
     <resheader name="version">2.0</resheader>
@@ -26,36 +26,36 @@
         <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
         <comment>This is a comment</comment>
     </data>
-                
-    There are any number of "resheader" rows that contain simple 
+
+    There are any number of "resheader" rows that contain simple
     name/value pairs.
-    
-    Each data row contains a name, and value. The row also contains a 
-    type or mimetype. Type corresponds to a .NET class that support 
-    text/value conversion through the TypeConverter architecture. 
-    Classes that don't support this are serialized and stored with the 
+
+    Each data row contains a name, and value. The row also contains a
+    type or mimetype. Type corresponds to a .NET class that support
+    text/value conversion through the TypeConverter architecture.
+    Classes that don't support this are serialized and stored with the
     mimetype set.
-    
-    The mimetype is used for serialized objects, and tells the 
-    ResXResourceReader how to depersist the object. This is currently not 
+
+    The mimetype is used for serialized objects, and tells the
+    ResXResourceReader how to depersist the object. This is currently not
     extensible. For a given mimetype the value must be set accordingly:
-    
-    Note - application/x-microsoft.net.object.binary.base64 is the format 
-    that the ResXResourceWriter will generate, however the reader can 
+
+    Note - application/x-microsoft.net.object.binary.base64 is the format
+    that the ResXResourceWriter will generate, however the reader can
     read any of the formats listed below.
-    
+
     mimetype: application/x-microsoft.net.object.binary.base64
-    value   : The object must be serialized with 
+    value   : The object must be serialized with
             : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
             : and then encoded with base64 encoding.
-    
+
     mimetype: application/x-microsoft.net.object.soap.base64
-    value   : The object must be serialized with 
+    value   : The object must be serialized with
             : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
             : and then encoded with base64 encoding.
 
     mimetype: application/x-microsoft.net.object.bytearray.base64
-    value   : The object must be serialized into a byte array 
+    value   : The object must be serialized into a byte array
             : using a System.ComponentModel.TypeConverter
             : and then encoded with base64 encoding.
     -->
@@ -118,37 +118,30 @@
     <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
   </resheader>
   <data name="InitialJsonParseErrorText" xml:space="preserve">
-    <value>Settings could not be loaded from file. Check for syntax errors, including trailing commas.
-</value>
+    <value>Settings could not be loaded from file. Check for syntax errors, including trailing commas.</value>
   </data>
   <data name="MissingDefaultProfileText" xml:space="preserve">
-    <value>Could not find your default profile in your list of profiles - using the first profile. Check to make sure the defaultProfile matches the GUID of one of your profiles.
-</value>
+    <value>Could not find your default profile in your list of profiles - using the first profile. Check to make sure the "defaultProfile" matches the GUID of one of your profiles.</value>
+    <comment>{Locked="\"defaultProfile\""}</comment>
   </data>
   <data name="DuplicateProfileText" xml:space="preserve">
-    <value>Found multiple profiles with the same GUID in your settings file - ignoring duplicates. Make sure each profile's GUID is unique.
-</value>
+    <value>Found multiple profiles with the same GUID in your settings file - ignoring duplicates. Make sure each profile's GUID is unique.</value>
   </data>
   <data name="UnknownColorSchemeText" xml:space="preserve">
-    <value>Found a profile with an invalid "colorScheme". Defaulting that profile to the default colors. Make sure that when setting a "colorScheme", the value matches the "name" of a color scheme in the "schemes" list.
-</value>
+    <value>Found a profile with an invalid "colorScheme". Defaulting that profile to the default colors. Make sure that when setting a "colorScheme", the value matches the "name" of a color scheme in the "schemes" list.</value>
+    <comment>{Locked="\"colorScheme\"","\"name\"","\"schemes\""}</comment>
   </data>
   <data name="NoProfilesText" xml:space="preserve">
-    <value>No profiles were found in your settings.
-</value>
+    <value>No profiles were found in your settings.</value>
   </data>
   <data name="AllProfilesHiddenText" xml:space="preserve">
-    <value>All profiles were hidden in your settings. You must have at least one non-hidden profile.
-</value>
+    <value>All profiles were hidden in your settings. You must have at least one non-hidden profile.</value>
   </data>
   <data name="ReloadJsonParseErrorText" xml:space="preserve">
-    <value>Settings could not be reloaded from file. Check for syntax errors, including trailing commas.
-</value>
+    <value>Settings could not be reloaded from file. Check for syntax errors, including trailing commas.</value>
   </data>
   <data name="UsingDefaultSettingsText" xml:space="preserve">
-    <value>
-Temporarily using the Windows Terminal default settings.
-</value>
+    <value>Temporarily using the Windows Terminal default settings.</value>
   </data>
   <data name="InitialJsonParseErrorTitle" xml:space="preserve">
     <value>Failed to load settings</value>
@@ -163,7 +156,8 @@ Temporarily using the Windows Terminal default settings.
     <value>Failed to reload settings</value>
   </data>
   <data name="FeedbackUriValue" xml:space="preserve">
-    <value>https://aka.ms/terminal-feedback</value>
+    <value>https://go.microsoft.com/fwlink/?linkid=2125419</value>
+    <comment>{Locked}This is a FWLink, so it will be localized with the fwlink tool</comment>
   </data>
   <data name="AboutMenuItem" xml:space="preserve">
     <value>About</value>
@@ -176,21 +170,33 @@ Temporarily using the Windows Terminal default settings.
   </data>
   <data name="InvalidBackgroundImage" xml:space="preserve">
     <value>Found a profile with an invalid "backgroundImage". Defaulting that profile to have no background image. Make sure that when setting a "backgroundImage", the value is a valid file path to an image.</value>
+    <comment>{Locked="\"backgroundImage\""}</comment>
   </data>
   <data name="InvalidIcon" xml:space="preserve">
     <value>Found a profile with an invalid "icon". Defaulting that profile to have no icon. Make sure that when setting an "icon", the value is a valid file path to an image.</value>
+    <comment>{Locked="\"icon\""} The word "icon" in quotes is locked, the word icon OUTSIDE of quotes should be localized.</comment>
   </data>
   <data name="AtLeastOneKeybindingWarning" xml:space="preserve">
-    <value>Warnings were found while parsing your keybindings:
-  </value>
+    <value>Warnings were found while parsing your keybindings:</value>
   </data>
   <data name="TooManyKeysForChord" xml:space="preserve">
-    <value>    Found a keybinding with too many strings for the "keys" array. There should only be one string value in the "keys" array.
-  </value>
+    <value>&#x2022; Found a keybinding with too many strings for the "keys" array. There should only be one string value in the "keys" array.</value>
+    <comment>{Locked="\"keys\"","&#x2022;"} This glyph is a bullet, used in a bulleted list.</comment>
   </data>
   <data name="MissingRequiredParameter" xml:space="preserve">
-    <value>    Found a keybinding that was missing a required parameter value. This keybinding will be ignored.
-  </value>
+    <value>&#x2022; Found a keybinding that was missing a required parameter value. This keybinding will be ignored.</value>
+    <comment>{Locked="&#x2022;"} This glyph is a bullet, used in a bulleted list.</comment>
+  </data>
+  <data name="LegacyGlobalsProperty" xml:space="preserve">
+    <value>The "globals" property is deprecated - your settings might need updating. </value>
+    <comment>{Locked="\"globals\""} </comment>
+  </data>
+  <data name="LegacyGlobalsPropertyHrefUrl" xml:space="preserve">
+    <value>https://go.microsoft.com/fwlink/?linkid=2128258</value>
+    <comment>{Locked}This is a FWLink, so it will be localized with the fwlink tool</comment>
+  </data>
+  <data name="LegacyGlobalsPropertyHrefLabel" xml:space="preserve">
+    <value>For more info, see this web page.</value>
   </data>
   <data name="CmdCommandArgDesc" xml:space="preserve">
     <value>An optional command, with arguments, to be spawned in the new tab or pane</value>
@@ -211,7 +217,7 @@ Temporarily using the Windows Terminal default settings.
     <value>Create a new tab</value>
   </data>
   <data name="CmdProfileArgDesc" xml:space="preserve">
-    <value>Open with the given profile. Accepts either the name or guid of a profile</value>
+    <value>Open with the given profile. Accepts either the name or GUID of a profile</value>
   </data>
   <data name="CmdSplitPaneDesc" xml:space="preserve">
     <value>Create a new split pane</value>
@@ -223,7 +229,8 @@ Temporarily using the Windows Terminal default settings.
     <value>Create the new pane as a vertical split (think [|])</value>
   </data>
   <data name="CmdStartingDirArgDesc" xml:space="preserve">
-    <value>Open in the given directory instead of the profile's set startingDirectory</value>
+    <value>Open in the given directory instead of the profile's set "startingDirectory"</value>
+    <comment>{Locked="\"startingDirectory\""}</comment>
   </data>
   <data name="NewTabSplitButton.[using:Windows.UI.Xaml.Automation]AutomationProperties.HelpText" xml:space="preserve">
     <value>Press the button to open a new terminal tab with your default profile. Open the flyout to select which profile you want to open.</value>
@@ -266,11 +273,11 @@ Temporarily using the Windows Terminal default settings.
     <value>Privacy Policy</value>
     <comment>A hyperlink name for the Terminal's privacy policy</comment>
   </data>
-  <data name="AboutDialog_DisplayNameUnpackaged" xml:space="preserve">
+  <data name="ApplicationDisplayNameUnpackaged" xml:space="preserve">
     <value>Windows Terminal (Unpackaged)</value>
     <comment>This display name is used when the application's name cannot be determined</comment>
   </data>
-  <data name="AboutDialog_VersionUnknown" xml:space="preserve">
+  <data name="ApplicationVersionUnknown" xml:space="preserve">
     <value>Unknown</value>
     <comment>This is displayed when the version of the application cannot be determined</comment>
   </data>
@@ -283,4 +290,8 @@ Temporarily using the Windows Terminal default settings.
   <data name="CloseAllDialog.Title" xml:space="preserve">
     <value>Do you want to close all tabs?</value>
   </data>
+  <data name="CommandPromptDisplayName" xml:space="preserve">
+    <value>Command Prompt</value>
+    <comment>This is the name of "Command Prompt", as localized in Windows. The localization here should match the one in the Windows product for "Command Prompt"</comment>
+  </data>
 </root>

src/cascadia/TerminalApp/ShortcutActionDispatch.cpp

@@ -33,11 +33,6 @@ namespace winrt::TerminalApp::implementation
             _CopyTextHandlers(*this, *eventArgs);
             break;
         }
-        case ShortcutAction::CopyTextWithoutNewlines:
-        {
-            _CopyTextHandlers(*this, *eventArgs);
-            break;
-        }
         case ShortcutAction::PasteText:
         {
             _PasteTextHandlers(*this, *eventArgs);
@@ -60,15 +55,6 @@ namespace winrt::TerminalApp::implementation
         }
 
         case ShortcutAction::NewTab:
-        case ShortcutAction::NewTabProfile0:
-        case ShortcutAction::NewTabProfile1:
-        case ShortcutAction::NewTabProfile2:
-        case ShortcutAction::NewTabProfile3:
-        case ShortcutAction::NewTabProfile4:
-        case ShortcutAction::NewTabProfile5:
-        case ShortcutAction::NewTabProfile6:
-        case ShortcutAction::NewTabProfile7:
-        case ShortcutAction::NewTabProfile8:
         {
             _NewTabHandlers(*this, *eventArgs);
             break;
@@ -136,46 +122,24 @@ namespace winrt::TerminalApp::implementation
         }
 
         case ShortcutAction::SwitchToTab:
-        case ShortcutAction::SwitchToTab0:
-        case ShortcutAction::SwitchToTab1:
-        case ShortcutAction::SwitchToTab2:
-        case ShortcutAction::SwitchToTab3:
-        case ShortcutAction::SwitchToTab4:
-        case ShortcutAction::SwitchToTab5:
-        case ShortcutAction::SwitchToTab6:
-        case ShortcutAction::SwitchToTab7:
-        case ShortcutAction::SwitchToTab8:
         {
             _SwitchToTabHandlers(*this, *eventArgs);
             break;
         }
 
         case ShortcutAction::ResizePane:
-        case ShortcutAction::ResizePaneLeft:
-        case ShortcutAction::ResizePaneRight:
-        case ShortcutAction::ResizePaneUp:
-        case ShortcutAction::ResizePaneDown:
         {
             _ResizePaneHandlers(*this, *eventArgs);
             break;
         }
 
         case ShortcutAction::MoveFocus:
-        case ShortcutAction::MoveFocusLeft:
-        case ShortcutAction::MoveFocusRight:
-        case ShortcutAction::MoveFocusUp:
-        case ShortcutAction::MoveFocusDown:
         {
             _MoveFocusHandlers(*this, *eventArgs);
             break;
         }
 
-        case ShortcutAction::IncreaseFontSize:
-        {
-            _AdjustFontSizeHandlers(*this, *eventArgs);
-            break;
-        }
-        case ShortcutAction::DecreaseFontSize:
+        case ShortcutAction::AdjustFontSize:
         {
             _AdjustFontSizeHandlers(*this, *eventArgs);
             break;

src/cascadia/TerminalApp/ShortcutActionDispatch.idl

@@ -11,20 +11,10 @@ namespace TerminalApp
     {
         Invalid = 0,
         CopyText,
-        CopyTextWithoutNewlines,
         PasteText,
         OpenNewTabDropdown,
         DuplicateTab,
         NewTab,
-        NewTabProfile0, // Legacy
-        NewTabProfile1, // Legacy
-        NewTabProfile2, // Legacy
-        NewTabProfile3, // Legacy
-        NewTabProfile4, // Legacy
-        NewTabProfile5, // Legacy
-        NewTabProfile6, // Legacy
-        NewTabProfile7, // Legacy
-        NewTabProfile8, // Legacy
         NewWindow,
         CloseWindow,
         CloseTab,
@@ -35,32 +25,14 @@ namespace TerminalApp
         SplitHorizontal,
         SplitPane,
         SwitchToTab,
-        SwitchToTab0, // Legacy
-        SwitchToTab1, // Legacy
-        SwitchToTab2, // Legacy
-        SwitchToTab3, // Legacy
-        SwitchToTab4, // Legacy
-        SwitchToTab5, // Legacy
-        SwitchToTab6, // Legacy
-        SwitchToTab7, // Legacy
-        SwitchToTab8, // Legacy
-        IncreaseFontSize,
-        DecreaseFontSize,
+        AdjustFontSize,
         ResetFontSize,
         ScrollUp,
         ScrollDown,
         ScrollUpPage,
         ScrollDownPage,
         ResizePane,
-        ResizePaneLeft, // Legacy
-        ResizePaneRight, // Legacy
-        ResizePaneUp, // Legacy
-        ResizePaneDown, // Legacy
         MoveFocus,
-        MoveFocusLeft, // Legacy
-        MoveFocusRight, // Legacy
-        MoveFocusUp, // Legacy
-        MoveFocusDown, // Legacy
         Find,
         ToggleFullscreen,
         OpenSettings

src/cascadia/TerminalApp/TerminalPage.cpp

@@ -5,6 +5,7 @@
 #include "TerminalPage.h"
 #include "ActionAndArgs.h"
 #include "Utils.h"
+#include "AppLogic.h"
 #include "../../types/inc/utils.hpp"
 
 #include <LibraryResources.h>
@@ -18,6 +19,7 @@
 #include "DebugTapConnection.h"
 
 using namespace winrt;
+using namespace winrt::Windows::Foundation::Collections;
 using namespace winrt::Windows::UI::Xaml;
 using namespace winrt::Windows::UI::Core;
 using namespace winrt::Windows::System;
@@ -74,7 +76,7 @@ namespace winrt::TerminalApp::implementation
             // Xaml tries to send a drag visual (to wit: a screenshot) to the drag hosting process,
             // but that process is running at a different IL than us.
             // For now, we're disabling elevated drag.
-            isElevated = ::winrt::Windows::UI::Xaml::Application::Current().as<::winrt::TerminalApp::App>().Logic().IsUwp();
+            isElevated = ::winrt::Windows::UI::Xaml::Application::Current().as<::winrt::TerminalApp::App>().Logic().IsElevated();
         }
         CATCH_LOG();
 
@@ -234,28 +236,22 @@ namespace winrt::TerminalApp::implementation
 
     winrt::hstring TerminalPage::ApplicationDisplayName()
     {
-        try
+        if (const auto appLogic{ implementation::AppLogic::Current() })
         {
-            const auto package{ winrt::Windows::ApplicationModel::Package::Current() };
-            return package.DisplayName();
+            return appLogic->ApplicationDisplayName();
         }
-        CATCH_LOG();
 
-        return RS_(L"AboutDialog_DisplayNameUnpackaged");
+        return RS_(L"ApplicationDisplayNameUnpackaged");
     }
 
     winrt::hstring TerminalPage::ApplicationVersion()
     {
-        try
+        if (const auto appLogic{ implementation::AppLogic::Current() })
         {
-            const auto package{ winrt::Windows::ApplicationModel::Package::Current() };
-            const auto version{ package.Id().Version() };
-            winrt::hstring formatted{ wil::str_printf<std::wstring>(L"%u.%u.%u.%u", version.Major, version.Minor, version.Build, version.Revision) };
-            return formatted;
+            return appLogic->ApplicationVersion();
         }
-        CATCH_LOG();
 
-        return RS_(L"AboutDialog_VersionUnknown");
+        return RS_(L"ApplicationVersionUnknown");
     }
 
     // Method Description:
@@ -292,25 +288,16 @@ namespace winrt::TerminalApp::implementation
             // add the keyboard shortcuts for the first 9 profiles
             if (profileIndex < 9)
             {
-                // enum value for ShortcutAction::NewTabProfileX; 0==NewTabProfile0
-                const auto action = static_cast<ShortcutAction>(profileIndex + static_cast<int>(ShortcutAction::NewTabProfile0));
-                // First, attempt to search for the keybinding for the simple
-                // NewTabProfile0-9 ShortcutActions.
-                auto profileKeyChord = keyBindings.GetKeyBindingForAction(action);
-                if (!profileKeyChord)
-                {
-                    // If NewTabProfileN didn't have a binding, look for a
-                    // keychord that is bound to the equivalent
-                    // NewTab(ProfileIndex=N) action
-                    auto actionAndArgs = winrt::make_self<winrt::TerminalApp::implementation::ActionAndArgs>();
-                    actionAndArgs->Action(ShortcutAction::NewTab);
-                    auto newTabArgs = winrt::make_self<winrt::TerminalApp::implementation::NewTabArgs>();
-                    auto newTerminalArgs = winrt::make_self<winrt::TerminalApp::implementation::NewTerminalArgs>();
-                    newTerminalArgs->ProfileIndex(profileIndex);
-                    newTabArgs->TerminalArgs(*newTerminalArgs);
-                    actionAndArgs->Args(*newTabArgs);
-                    profileKeyChord = keyBindings.GetKeyBindingForActionWithArgs(*actionAndArgs);
-                }
+                // Look for a keychord that is bound to the equivalent
+                // NewTab(ProfileIndex=N) action
+                auto actionAndArgs = winrt::make_self<winrt::TerminalApp::implementation::ActionAndArgs>();
+                actionAndArgs->Action(ShortcutAction::NewTab);
+                auto newTabArgs = winrt::make_self<winrt::TerminalApp::implementation::NewTabArgs>();
+                auto newTerminalArgs = winrt::make_self<winrt::TerminalApp::implementation::NewTerminalArgs>();
+                newTerminalArgs->ProfileIndex(profileIndex);
+                newTabArgs->TerminalArgs(*newTerminalArgs);
+                actionAndArgs->Args(*newTabArgs);
+                auto profileKeyChord{ keyBindings.GetKeyBindingForActionWithArgs(*actionAndArgs) };
 
                 // make sure we find one to display
                 if (profileKeyChord)
@@ -586,7 +573,13 @@ namespace winrt::TerminalApp::implementation
             // TODO GH#4661: Replace this with directly using the AzCon when our VT is better
             std::filesystem::path azBridgePath{ wil::GetModuleFileNameW<std::wstring>(nullptr) };
             azBridgePath.replace_filename(L"TerminalAzBridge.exe");
-            connection = TerminalConnection::ConptyConnection(azBridgePath.wstring(), L".", L"Azure", settings.InitialRows(), settings.InitialCols(), winrt::guid());
+            connection = TerminalConnection::ConptyConnection(azBridgePath.wstring(),
+                                                              L".",
+                                                              L"Azure",
+                                                              nullptr,
+                                                              settings.InitialRows(),
+                                                              settings.InitialCols(),
+                                                              winrt::guid());
         }
 
         else if (profile->HasConnectionType() &&
@@ -597,12 +590,21 @@ namespace winrt::TerminalApp::implementation
 
         else
         {
-            auto conhostConn = TerminalConnection::ConptyConnection(settings.Commandline(),
-                                                                    settings.StartingDirectory(),
-                                                                    settings.StartingTitle(),
-                                                                    settings.InitialRows(),
-                                                                    settings.InitialCols(),
-                                                                    winrt::guid());
+            std::wstring guidWString = Utils::GuidToString(profileGuid);
+
+            StringMap envMap{};
+            envMap.Insert(L"WT_PROFILE_ID", guidWString);
+            envMap.Insert(L"WSLENV", L"WT_PROFILE_ID");
+
+            auto conhostConn = TerminalConnection::ConptyConnection(
+                settings.Commandline(),
+                settings.StartingDirectory(),
+                settings.StartingTitle(),
+                envMap.GetView(),
+                settings.InitialRows(),
+                settings.InitialCols(),
+                winrt::guid());
+
             sessionGuid = conhostConn.Guid();
             connection = conhostConn;
         }
@@ -1324,18 +1326,21 @@ namespace winrt::TerminalApp::implementation
         // copy text to dataPack
         dataPack.SetText(copiedData.Text());
 
-        // copy html to dataPack
-        const auto htmlData = copiedData.Html();
-        if (!htmlData.empty())
+        if (_settings->GlobalSettings().GetCopyFormatting())
         {
-            dataPack.SetHtmlFormat(htmlData);
-        }
+            // copy html to dataPack
+            const auto htmlData = copiedData.Html();
+            if (!htmlData.empty())
+            {
+                dataPack.SetHtmlFormat(htmlData);
+            }
 
-        // copy rtf data to dataPack
-        const auto rtfData = copiedData.Rtf();
-        if (!rtfData.empty())
-        {
-            dataPack.SetRtf(rtfData);
+            // copy rtf data to dataPack
+            const auto rtfData = copiedData.Rtf();
+            if (!rtfData.empty())
+            {
+                dataPack.SetRtf(rtfData);
+            }
         }
 
         try
@@ -1385,14 +1390,13 @@ namespace winrt::TerminalApp::implementation
     // Method Description:
     // - Copy text from the focused terminal to the Windows Clipboard
     // Arguments:
-    // - trimTrailingWhitespace: enable removing any whitespace from copied selection
-    //    and get text to appear on separate lines.
+    // - singleLine: if enabled, copy contents as a single line of text
     // Return Value:
     // - true iff we we able to copy text (if a selection was active)
-    bool TerminalPage::_CopyText(const bool trimTrailingWhitespace)
+    bool TerminalPage::_CopyText(const bool singleLine)
     {
         const auto control = _GetActiveControl();
-        return control.CopySelectionToClipboard(!trimTrailingWhitespace);
+        return control.CopySelectionToClipboard(singleLine);
     }
 
     // Method Description:

src/cascadia/TerminalApp/TerminalPage.xaml

@@ -33,16 +33,16 @@ the MIT License. See LICENSE in the project root for license information. -->
                 </TextBlock>
                 <HyperlinkButton
                     x:Uid="AboutDialog_GettingStartedLink"
-                    NavigateUri="https://aka.ms/terminal-getting-started" />
+                    NavigateUri="https://go.microsoft.com/fwlink/?linkid=2125715" />
                 <HyperlinkButton
                     x:Uid="AboutDialog_DocumentationLink"
-                    NavigateUri="https://aka.ms/terminal-documentation" />
+                    NavigateUri="https://go.microsoft.com/fwlink/?linkid=2125416" />
                 <HyperlinkButton
                     x:Uid="AboutDialog_ReleaseNotesLink"
-                    NavigateUri="https://aka.ms/terminal-release-notes" />
+                    NavigateUri="https://go.microsoft.com/fwlink/?linkid=2125417" />
                 <HyperlinkButton
                     x:Uid="AboutDialog_PrivacyPolicyLink"
-                    NavigateUri="https://aka.ms/terminal-privacy-policy" />
+                    NavigateUri="https://go.microsoft.com/fwlink/?linkid=2125418" />
             </StackPanel>
         </ContentDialog>