Migrate spelling-0.0.21 changes from main

This reverts commit 31f09fe12d.

.github/actions/spelling/README.md

@@ -0,0 +1,15 @@
+# check-spelling/check-spelling configuration
+
+File | Purpose | Format | Info
+-|-|-|-
+[allow/*.txt](allow/) | Add words to the dictionary | one word per line (only letters and `'`s allowed) | [allow](https://github.com/check-spelling/check-spelling/wiki/Configuration#allow)
+[reject.txt](reject.txt) | Remove words from the dictionary (after allow) | grep pattern matching whole dictionary words | [reject](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-reject)
+[excludes.txt](excludes.txt) | Files to ignore entirely | perl regular expression | [excludes](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-excludes)
+[patterns/*.txt](patterns/) | Patterns to ignore from checked lines | perl regular expression (order matters, first match wins) | [patterns](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-patterns)
+[candidate.patterns](candidate.patterns) | Patterns that might be worth adding to [patterns.txt](patterns.txt) | perl regular expression with optional comment block introductions (all matches will be suggested) | [candidates](https://github.com/check-spelling/check-spelling/wiki/Feature:-Suggest-patterns)
+[line_forbidden.patterns](line_forbidden.patterns) | Patterns to flag in checked lines | perl regular expression (order matters, first match wins) | [patterns](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-patterns)
+[expect/*.txt](expect.txt) | Expected words that aren't in the dictionary | one word per line (sorted, alphabetically) | [expect](https://github.com/check-spelling/check-spelling/wiki/Configuration#expect)
+[advice.md](advice.md) | Supplement for GitHub comment when unrecognized words are found | GitHub Markdown | [advice](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-advice)
+
+Note: you can replace any of these files with a directory by the same name (minus the suffix)
+and then include multiple files inside that directory (with that suffix) to merge multiple files together.

.github/actions/spelling/advice.md

@@ -0,0 +1,48 @@
+<!-- See https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples%3A-advice --> <!-- markdownlint-disable MD033 MD041 -->
+<details>
+<summary>
+:pencil2: Contributor please read this
+</summary>
+
+By default the command suggestion will generate a file named based on your commit. That's generally ok as long as you add the file to your commit. Someone can reorganize it later.
+
+:warning: The command is written for posix shells. If it doesn't work for you, you can manually _add_ (one word per line) / _remove_ items to `expect.txt` and the `excludes.txt` files.
+
+If the listed items are:
+
+* ... **misspelled**, then please *correct* them instead of using the command.
+* ... *names*, please add them to `.github/actions/spelling/allow/names.txt`.
+* ... APIs, you can add them to a file in `.github/actions/spelling/allow/`.
+* ... just things you're using, please add them to an appropriate file in `.github/actions/spelling/expect/`.
+* ... tokens you only need in one place and shouldn't *generally be used*, you can add an item in an appropriate file in `.github/actions/spelling/patterns/`.
+
+See the `README.md` in each directory for more information.
+
+:microscope: You can test your commits **without** *appending* to a PR by creating a new branch with that extra change and pushing it to your fork. The [check-spelling](https://github.com/marketplace/actions/check-spelling) action will run in response to your **push** -- it doesn't require an open pull request. By using such a branch, you can limit the number of typos your peers see you make. :wink:
+
+
+<details><summary>If the flagged items are :exploding_head: false positives</summary>
+
+If items relate to a ...
+* binary file (or some other file you wouldn't want to check at all).
+
+  Please add a file path to the `excludes.txt` file matching the containing file.
+
+  File paths are Perl 5 Regular Expressions - you can [test](
+https://www.regexplanet.com/advanced/perl/) yours before committing to verify it will match your files.
+
+  `^` refers to the file's path from the root of the repository, so `^README\.md$` would exclude [README.md](
+../tree/HEAD/README.md) (on whichever branch you're using).
+
+* well-formed pattern.
+
+  If you can write a [pattern](https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples:-patterns) that would match it,
+  try adding it to the `patterns.txt` file.
+
+  Patterns are Perl 5 Regular Expressions - you can [test](
+https://www.regexplanet.com/advanced/perl/) yours before committing to verify it will match your lines.
+
+  Note that patterns can't match multiline strings.
+</details>
+
+</details>

.github/actions/spelling/allow/README.md

@@ -0,0 +1,21 @@
+# Allow files are lists of words to accept unconditionally
+
+While check spelling will complain about an expected word
+which is no longer present, you can include things here even if
+they are not otherwise present in the repository.
+
+E.g., you could include a list of system APIs here, or potential
+contributors (so that if a future commit includes their name,
+it'll be accepted).
+
+## Files
+
+| File | Description |
+| ---- | ----------- |
+| [Allow](allow.txt) | Supplements to the dictionary |
+| [Chinese](chinese.txt) | Chinese words |
+| [Japanese](japanese.txt) | Japanese words |
+| [Microsoft](microsoft.txt) | Microsoft brand items |
+| [Fonts](fonts.txt) | Font names |
+| [Names](names.txt) | Names of people |
+| [Colors](colors.txt) | Names of color |

.github/actions/spelling/allow/allow.txt

@@ -0,0 +1,108 @@
+admins
+allcolors
+Apc
+apc
+breadcrumb
+breadcrumbs
+bsd
+calt
+ccmp
+changelog
+clickable
+clig
+CMMI
+copyable
+cybersecurity
+dalet
+Dcs
+dcs
+dialytika
+dje
+downside
+downsides
+dze
+dzhe
+EDDB
+EDDC
+Enum'd
+Fitt
+formattings
+FTCS
+ftp
+fvar
+gantt
+gcc
+geeksforgeeks
+ghe
+github
+gje
+godbolt
+hostname
+hostnames
+https
+hyperlink
+hyperlinking
+hyperlinks
+iconify
+img
+inlined
+It'd
+kje
+libfuzzer
+libuv
+liga
+lje
+Llast
+llvm
+Lmid
+locl
+lol
+lorem
+Lorigin
+maxed
+minimalistic
+mkmk
+mnt
+mru
+nje
+noreply
+ogonek
+ok'd
+overlined
+pipeline
+postmodern
+ptys
+qof
+qps
+rclt
+reimplementation
+reserialization
+reserialize
+reserializes
+rlig
+runtimes
+shcha
+slnt
+Sos
+ssh
+timeline
+timelines
+timestamped
+TLDR
+tokenizes
+tonos
+toolset
+tshe
+ubuntu
+uiatextrange
+UIs
+und
+unregister
+versioned
+vsdevcmd
+We'd
+wildcards
+XBox
+YBox
+yeru
+zhe

.github/actions/spelling/allow/apis.txt

@@ -0,0 +1,248 @@
+ACCEPTFILES
+ACCESSDENIED
+acl
+aclapi
+alignas
+alignof
+APPLYTOSUBMENUS
+appxrecipe
+bitfield
+bitfields
+BUILDBRANCH
+BUILDMSG
+BUILDNUMBER
+BYCOMMAND
+BYPOSITION
+charconv
+CLASSNOTAVAILABLE
+CLOSEAPP
+cmdletbinding
+COLORPROPERTY
+colspan
+COMDLG
+commandlinetoargv
+comparand
+cstdint
+CXICON
+CYICON
+Dacl
+dataobject
+dcomp
+DERR
+dlldata
+DNE
+DONTADDTORECENT
+DWMSBT
+DWMWA
+DWMWA
+DWORDLONG
+endfor
+ENDSESSION
+enumset
+environstrings
+EXPCMDFLAGS
+EXPCMDSTATE
+filetime
+FILTERSPEC
+FORCEFILESYSTEM
+FORCEMINIMIZE
+frac
+fullkbd
+futex
+GETDESKWALLPAPER
+GETHIGHCONTRAST
+GETMOUSEHOVERTIME
+Hashtable
+HIGHCONTRASTON
+HIGHCONTRASTW
+hotkeys
+href
+hrgn
+HTCLOSE
+hwinsta
+HWINSTA
+IActivation
+IApp
+IAppearance
+IAsync
+IBind
+IBox
+IClass
+IComparable
+IComparer
+IConnection
+ICustom
+IDialog
+IDirect
+IExplorer
+IFACEMETHOD
+IFile
+IGraphics
+IInheritable
+IMap
+IMonarch
+IObject
+iosfwd
+IPackage
+IPeasant
+ISetup
+isspace
+IStorage
+istream
+IStringable
+ITab
+ITaskbar
+itow
+IUri
+IVirtual
+KEYSELECT
+LCID
+llabs
+llu
+localtime
+lround
+Lsa
+lsass
+LSHIFT
+LTGRAY
+MAINWINDOW
+memchr
+memicmp
+MENUCOMMAND
+MENUDATA
+MENUINFO
+MENUITEMINFOW
+mmeapi
+MOUSELEAVE
+mov
+mptt
+msappx
+MULTIPLEUSE
+NCHITTEST
+NCLBUTTONDBLCLK
+NCMOUSELEAVE
+NCMOUSEMOVE
+NCRBUTTONDBLCLK
+NIF
+NIN
+NOAGGREGATION
+NOASYNC
+NOCHANGEDIR
+NOPROGRESS
+NOREDIRECTIONBITMAP
+NOREPEAT
+NOTIFYBYPOS
+NOTIFYICON
+NOTIFYICONDATA
+ntprivapi
+oaidl
+ocidl
+ODR
+offsetof
+ofstream
+onefuzz
+osver
+OSVERSIONINFOEXW
+otms
+OUTLINETEXTMETRICW
+overridable
+PACL
+PAGESCROLL
+PATINVERT
+PEXPLICIT
+PICKFOLDERS
+pmr
+ptstr
+QUERYENDSESSION
+rcx
+REGCLS
+RETURNCMD
+rfind
+ROOTOWNER
+roundf
+RSHIFT
+SACL
+schandle
+semver
+serializer
+SETVERSION
+SHELLEXECUTEINFOW
+shobjidl
+SHOWHIDE
+SHOWMINIMIZED
+SHOWTIP
+SINGLEUSE
+SIZENS
+smoothstep
+snprintf
+spsc
+sregex
+SRWLOC
+SRWLOCK
+STDCPP
+STDMETHOD
+strchr
+strcpy
+streambuf
+strtoul
+Stubless
+Subheader
+Subpage
+syscall
+SYSTEMBACKDROP
+TABROW
+TASKBARCREATED
+TBPF
+THEMECHANGED
+tlg
+TME
+tmp
+tmpdir
+tolower
+toupper
+TRACKMOUSEEVENT
+TTask
+TVal
+UChar
+UFIELD
+ULARGE
+UOI
+UPDATEINIFILE
+userenv
+USEROBJECTFLAGS
+Viewbox
+virtualalloc
+wcsstr
+wcstoui
+winmain
+winsta
+winstamin
+wmemcmp
+wpc
+WSF
+wsregex
+wwinmain
+xchg
+XDocument
+XElement
+xfacet
+xhash
+XIcon
+xiosbase
+xlocale
+xlocbuf
+xlocinfo
+xlocmes
+xlocmon
+xlocnum
+xloctime
+XMax
+xmemory
+XParse
+xpath
+xstddef
+xstring
+xtree
+xutility
+YIcon
+YMax

.github/actions/spelling/allow/chinese.txt

@@ -0,0 +1,5 @@
+CHINESEBIG
+choseong
+Jongseong
+Jungseong
+ssangtikeut

.github/actions/spelling/allow/colors.txt

@@ -0,0 +1,117 @@
+alice
+aliceblue
+antiquewhite
+blanchedalmond
+blueviolet
+burlywood
+cadetblue
+cornflowerblue
+cornsilk
+cyan
+darkblue
+darkcyan
+darkgoldenrod
+darkgray
+darkgreen
+darkgrey
+darkkhaki
+darkmagenta
+darkolivegreen
+darkorange
+darkorchid
+darkred
+darksalmon
+darkseagreen
+darkslateblue
+darkslategray
+darkslategrey
+darkturquoise
+darkviolet
+deeppink
+deepskyblue
+dimgray
+dimgrey
+dodgerblue
+firebrick
+floralwhite
+forestgreen
+gainsboro
+ghostwhite
+greenyellow
+hotpink
+indian
+indianred
+lavenderblush
+lawngreen
+lemonchiffon
+lightblue
+lightcoral
+lightcyan
+lightgoldenrod
+lightgoldenrodyellow
+lightgray
+lightgreen
+lightgrey
+lightpink
+lightsalmon
+lightseagreen
+lightskyblue
+lightslateblue
+lightslategray
+lightslategrey
+lightsteelblue
+lightyellow
+limegreen
+mediumaquamarine
+mediumblue
+mediumorchid
+mediumpurple
+mediumseagreen
+mediumslateblue
+mediumspringgreen
+mediumturquoise
+mediumvioletred
+midnightblue
+mintcream
+mistyrose
+navajo
+navajowhite
+navyblue
+oldlace
+olivedrab
+orangered
+palegoldenrod
+palegreen
+paleturquoise
+palevioletred
+papayawhip
+peachpuff
+peru
+powderblue
+rebecca
+rebeccapurple
+rosybrown
+royalblue
+saddlebrown
+sandybrown
+seagreen
+sienna
+skyblue
+slateblue
+slategray
+slategrey
+springgreen
+steelblue
+violetred
+webgray
+webgreen
+webgrey
+webmaroon
+webpurple
+whitesmoke
+xaroon
+xray
+xreen
+xrey
+xurple
+yellowgreen

.github/actions/spelling/allow/fonts.txt

@@ -0,0 +1,10 @@
+Consolas
+emoji
+emojis
+Extralight
+Gabriola
+Iosevka
+MDL
+Monofur
+Segoe
+wght

.github/actions/spelling/allow/japanese.txt

@@ -0,0 +1,4 @@
+arigatoo
+doomo
+Kaomojis
+TATEGAKI

.github/actions/spelling/allow/math.txt

@@ -0,0 +1,11 @@
+atan
+CPrime
+HBar
+HPrime
+isnan
+LPrime
+LStep
+powf
+RSub
+sqrtf
+ULP

.github/actions/spelling/allow/microsoft.txt

@@ -0,0 +1,85 @@
+ACLs
+ADMINS
+advapi
+altform
+altforms
+appendwttlogging
+appx
+appxbundle
+appxerror
+appxmanifest
+ATL
+backplating
+bitmaps
+BOMs
+CPLs
+cpptools
+cppvsdbg
+CPRs
+cryptbase
+DACL
+DACLs
+defaultlib
+diffs
+disposables
+dotnetfeed
+DTDs
+DWINRT
+enablewttlogging
+Intelli
+IVisual
+libucrt
+libucrtd
+LKG
+LOCKFILE
+Lxss
+mfcribbon
+microsoft
+microsoftonline
+MSAA
+msixbundle
+MSVC
+MSVCP
+muxc
+netcore
+Onefuzz
+osgvsowi
+PFILETIME
+pgc
+pgo
+pgosweep
+powerrename
+powershell
+propkey
+pscustomobject
+QWORD
+regedit
+robocopy
+SACLs
+sdkddkver
+Shobjidl
+Skype
+SRW
+sxs
+Sysinternals
+sysnative
+systemroot
+taskkill
+tasklist
+tdbuildteamid
+ucrt
+ucrtd
+unvirtualized
+VCRT
+vcruntime
+Virtualization
+visualstudio
+vscode
+VSTHRD
+winsdkver
+wlk
+wslpath
+wtl
+wtt
+wttlog
+Xamarin

.github/actions/spelling/allow/names.txt

@@ -0,0 +1,91 @@
+Anup
+austdi
+arkthur
+Ballmer
+bhoj
+Bhojwani
+Bluloco
+carlos
+dhowett
+Diviness
+dsafa
+duhowett
+DXP
+ekg
+eryksun
+ethanschoonover
+Firefox
+Gatta
+glsl
+Gravell
+Grie
+Griese
+Hernan
+Howett
+Illhardt
+iquilezles
+italo
+jantari
+jerrysh
+Kaiyu
+kimwalisch
+KMehrain
+KODELIFE
+Kodelife
+Kourosh
+kowalczyk
+leonmsft
+Lepilleur
+lhecker
+lukesampson
+Macbook
+Manandhar
+masserano
+mbadolato
+Mehrain
+menger
+mgravell
+michaelniksa
+michkap
+migrie
+mikegr
+mikemaccana
+miloush
+miniksa
+niksa
+nvaccess
+nvda
+oising
+oldnewthing
+opengl
+osgwiki
+pabhojwa
+panos
+paulcam
+pauldotknopf
+PGP
+Pham
+Rincewind
+rprichard
+Schoonover
+shadertoy
+Shomnipotence
+simioni
+Somuah
+sonph
+sonpham
+stakx
+talo
+thereses
+Walisch
+WDX
+Wellons
+Wirt
+Wojciech
+zadjii
+Zamor
+Zamora
+zamora
+Zoey
+zorio
+Zverovich

.github/actions/spelling/candidate.patterns

@@ -0,0 +1,523 @@
+# marker to ignore all code on line
+^.*/\* #no-spell-check-line \*/.*$
+# marker for ignoring a comment to the end of the line
+// #no-spell-check.*$
+
+# patch hunk comments
+^\@\@ -\d+(?:,\d+|) \+\d+(?:,\d+|) \@\@ .*
+# git index header
+index [0-9a-z]{7,40}\.\.[0-9a-z]{7,40}
+
+# cid urls
+(['"])cid:.*?\g{-1}
+
+# data url in parens
+\(data:[^)]*?(?:[A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,})[^)]*\)
+# data url in quotes
+([`'"])data:.*?(?:[A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,}).*\g{-1}
+# data url
+data:[-a-zA-Z=;:/0-9+]*,\S*
+
+# mailto urls
+mailto:[-a-zA-Z=;:/?%&0-9+@.]{3,}
+
+# magnet urls
+magnet:[?=:\w]+
+
+# magnet urls
+"magnet:[^"]+"
+
+# obs:
+"obs:[^"]*"
+
+# The `\b` here means a break, it's the fancy way to handle urls, but it makes things harder to read
+# In this examples content, I'm using a number of different ways to match things to show various approaches
+# asciinema
+\basciinema\.org/a/[0-9a-zA-Z]+
+
+# apple
+\bdeveloper\.apple\.com/[-\w?=/]+
+# Apple music
+\bembed\.music\.apple\.com/fr/playlist/usr-share/[-\w.]+
+
+# appveyor api
+\bci\.appveyor\.com/api/projects/status/[0-9a-z]+
+# appveyor project
+\bci\.appveyor\.com/project/(?:[^/\s"]*/){2}builds?/\d+/job/[0-9a-z]+
+
+# Amazon
+
+# Amazon
+\bamazon\.com/[-\w]+/(?:dp/[0-9A-Z]+|)
+# AWS S3
+\b\w*\.s3[^.]*\.amazonaws\.com/[-\w/&#%_?:=]*
+# AWS execute-api
+\b[0-9a-z]{10}\.execute-api\.[-0-9a-z]+\.amazonaws\.com\b
+# AWS ELB
+\b\w+\.[-0-9a-z]+\.elb\.amazonaws\.com\b
+# AWS SNS
+\bsns\.[-0-9a-z]+.amazonaws\.com/[-\w/&#%_?:=]*
+# AWS VPC
+vpc-\w+
+
+# While you could try to match `http://` and `https://` by using `s?` in `https?://`, sometimes there
+# YouTube url
+\b(?:(?:www\.|)youtube\.com|youtu.be)/(?:channel/|embed/|user/|playlist\?list=|watch\?v=|v/|)[-a-zA-Z0-9?&=_%]*
+# YouTube music
+\bmusic\.youtube\.com/youtubei/v1/browse(?:[?&]\w+=[-a-zA-Z0-9?&=_]*)
+# YouTube tag
+<\s*youtube\s+id=['"][-a-zA-Z0-9?_]*['"]
+# YouTube image
+\bimg\.youtube\.com/vi/[-a-zA-Z0-9?&=_]*
+# Google Accounts
+\baccounts.google.com/[-_/?=.:;+%&0-9a-zA-Z]*
+# Google Analytics
+\bgoogle-analytics\.com/collect.[-0-9a-zA-Z?%=&_.~]*
+# Google APIs
+\bgoogleapis\.(?:com|dev)/[a-z]+/(?:v\d+/|)[a-z]+/[-@:./?=\w+|&]+
+# Google Storage
+\b[-a-zA-Z0-9.]*\bstorage\d*\.googleapis\.com(?:/\S*|)
+# Google Calendar
+\bcalendar\.google\.com/calendar(?:/u/\d+|)/embed\?src=[@./?=\w&%]+
+\w+\@group\.calendar\.google\.com\b
+# Google DataStudio
+\bdatastudio\.google\.com/(?:(?:c/|)u/\d+/|)(?:embed/|)(?:open|reporting|datasources|s)/[-0-9a-zA-Z]+(?:/page/[-0-9a-zA-Z]+|)
+# The leading `/` here is as opposed to the `\b` above
+# ... a short way to match `https://` or `http://` since most urls have one of those prefixes
+# Google Docs
+/docs\.google\.com/[a-z]+/(?:ccc\?key=\w+|(?:u/\d+|d/(?:e/|)[0-9a-zA-Z_-]+/)?(?:edit\?[-\w=#.]*|/\?[\w=&]*|))
+# Google Drive
+\bdrive\.google\.com/(?:file/d/|open)[-0-9a-zA-Z_?=]*
+# Google Groups
+\bgroups\.google\.com/(?:(?:forum/#!|d/)(?:msg|topics?|searchin)|a)/[^/\s"]+/[-a-zA-Z0-9$]+(?:/[-a-zA-Z0-9]+)*
+# Google Maps
+\bmaps\.google\.com/maps\?[\w&;=]*
+# Google themes
+themes\.googleusercontent\.com/static/fonts/[^/\s"]+/v\d+/[^.]+.
+# Google CDN
+\bclients2\.google(?:usercontent|)\.com[-0-9a-zA-Z/.]*
+# Goo.gl
+/goo\.gl/[a-zA-Z0-9]+
+# Google Chrome Store
+\bchrome\.google\.com/webstore/detail/[-\w]*(?:/\w*|)
+# Google Books
+\bgoogle\.(?:\w{2,4})/books(?:/\w+)*\?[-\w\d=&#.]*
+# Google Fonts
+\bfonts\.(?:googleapis|gstatic)\.com/[-/?=:;+&0-9a-zA-Z]*
+# Google Forms
+\bforms\.gle/\w+
+# Google Scholar
+\bscholar\.google\.com/citations\?user=[A-Za-z0-9_]+
+# Google Colab Research Drive
+\bcolab\.research\.google\.com/drive/[-0-9a-zA-Z_?=]*
+
+# GitHub SHAs (api)
+\bapi.github\.com/repos(?:/[^/\s"]+){3}/[0-9a-f]+\b
+# GitHub SHAs (markdown)
+(?:\[`?[0-9a-f]+`?\]\(https:/|)/(?:www\.|)github\.com(?:/[^/\s"]+){2,}(?:/[^/\s")]+)(?:[0-9a-f]+(?:[-0-9a-zA-Z/#.]*|)\b|)
+# GitHub SHAs
+\bgithub\.com(?:/[^/\s"]+){2}[@#][0-9a-f]+\b
+# GitHub wiki
+\bgithub\.com/(?:[^/]+/){2}wiki/(?:(?:[^/]+/|)_history|[^/]+(?:/_compare|)/[0-9a-f.]{40,})\b
+# githubusercontent
+/[-a-z0-9]+\.githubusercontent\.com/[-a-zA-Z0-9?&=_\/.]*
+# githubassets
+\bgithubassets.com/[0-9a-f]+(?:[-/\w.]+)
+# gist github
+\bgist\.github\.com/[^/\s"]+/[0-9a-f]+
+# git.io
+\bgit\.io/[0-9a-zA-Z]+
+# GitHub JSON
+"node_id": "[-a-zA-Z=;:/0-9+]*"
+# Contributor
+\[[^\]]+\]\(https://github\.com/[^/\s"]+\)
+# GHSA
+GHSA(?:-[0-9a-z]{4}){3}
+
+# GitLab commit
+\bgitlab\.[^/\s"]*/\S+/\S+/commit/[0-9a-f]{7,16}#[0-9a-f]{40}\b
+# GitLab merge requests
+\bgitlab\.[^/\s"]*/\S+/\S+/-/merge_requests/\d+/diffs#[0-9a-f]{40}\b
+# GitLab uploads
+\bgitlab\.[^/\s"]*/uploads/[-a-zA-Z=;:/0-9+]*
+# GitLab commits
+\bgitlab\.[^/\s"]*/(?:[^/\s"]+/){2}commits?/[0-9a-f]+\b
+
+# binanace
+accounts.binance.com/[a-z/]*oauth/authorize\?[-0-9a-zA-Z&%]*
+
+# bitbucket diff
+\bapi\.bitbucket\.org/\d+\.\d+/repositories/(?:[^/\s"]+/){2}diff(?:stat|)(?:/[^/\s"]+){2}:[0-9a-f]+
+# bitbucket repositories commits
+\bapi\.bitbucket\.org/\d+\.\d+/repositories/(?:[^/\s"]+/){2}commits?/[0-9a-f]+
+# bitbucket commits
+\bbitbucket\.org/(?:[^/\s"]+/){2}commits?/[0-9a-f]+
+
+# bit.ly
+\bbit\.ly/\w+
+
+# bitrise
+\bapp\.bitrise\.io/app/[0-9a-f]*/[\w.?=&]*
+
+# bootstrapcdn.com
+\bbootstrapcdn\.com/[-./\w]+
+
+# cdn.cloudflare.com
+\bcdnjs\.cloudflare\.com/[./\w]+
+
+# circleci
+\bcircleci\.com/gh(?:/[^/\s"]+){1,5}.[a-z]+\?[-0-9a-zA-Z=&]+
+
+# gitter
+\bgitter\.im(?:/[^/\s"]+){2}\?at=[0-9a-f]+
+
+# gravatar
+\bgravatar\.com/avatar/[0-9a-f]+
+
+# ibm
+[a-z.]*ibm\.com/[-_#=:%!?~.\\/\d\w]*
+
+# imgur
+\bimgur\.com/[^.]+
+
+# Internet Archive
+\barchive\.org/web/\d+/(?:[-\w.?,'/\\+&%$#_:]*)
+
+# discord
+/discord(?:app\.com|\.gg)/(?:invite/)?[a-zA-Z0-9]{7,}
+
+# Disqus
+\bdisqus\.com/[-\w/%.()!?&=_]*
+
+# medium link
+\blink\.medium\.com/[a-zA-Z0-9]+
+# medium
+\bmedium\.com/\@?[^/\s"]+/[-\w]+
+
+# microsoft
+\b(?:https?://|)(?:(?:download\.visualstudio|docs|msdn2?|research)\.microsoft|blogs\.msdn)\.com/[-_a-zA-Z0-9()=./%]*
+# powerbi
+\bapp\.powerbi\.com/reportEmbed/[^"' ]*
+# vs devops
+\bvisualstudio.com(?::443|)/[-\w/?=%&.]*
+# microsoft store
+\bmicrosoft\.com/store/apps/\w+
+
+# mvnrepository.com
+\bmvnrepository\.com/[-0-9a-z./]+
+
+# now.sh
+/[0-9a-z-.]+\.now\.sh\b
+
+# oracle
+\bdocs\.oracle\.com/[-0-9a-zA-Z./_?#&=]*
+
+# chromatic.com
+/\S+.chromatic.com\S*[")]
+
+# codacy
+\bapi\.codacy\.com/project/badge/Grade/[0-9a-f]+
+
+# compai
+\bcompai\.pub/v1/png/[0-9a-f]+
+
+# mailgun api
+\.api\.mailgun\.net/v3/domains/[0-9a-z]+\.mailgun.org/messages/[0-9a-zA-Z=@]*
+# mailgun
+\b[0-9a-z]+.mailgun.org
+
+# /message-id/
+/message-id/[-\w@./%]+
+
+# Reddit
+\breddit\.com/r/[/\w_]*
+
+# requestb.in
+\brequestb\.in/[0-9a-z]+
+
+# sched
+\b[a-z0-9]+\.sched\.com\b
+
+# Slack url
+slack://[a-zA-Z0-9?&=]+
+# Slack
+\bslack\.com/[-0-9a-zA-Z/_~?&=.]*
+# Slack edge
+\bslack-edge\.com/[-a-zA-Z0-9?&=%./]+
+# Slack images
+\bslack-imgs\.com/[-a-zA-Z0-9?&=%.]+
+
+# shields.io
+\bshields\.io/[-\w/%?=&.:+;,]*
+
+# stackexchange -- https://stackexchange.com/feeds/sites
+\b(?:askubuntu|serverfault|stack(?:exchange|overflow)|superuser).com/(?:questions/\w+/[-\w]+|a/)
+
+# Sentry
+[0-9a-f]{32}\@o\d+\.ingest\.sentry\.io\b
+
+# Twitter markdown
+\[\@[^[/\]:]*?\]\(https://twitter.com/[^/\s"')]*(?:/status/\d+(?:\?[-_0-9a-zA-Z&=]*|)|)\)
+# Twitter hashtag
+\btwitter\.com/hashtag/[\w?_=&]*
+# Twitter status
+\btwitter\.com/[^/\s"')]*(?:/status/\d+(?:\?[-_0-9a-zA-Z&=]*|)|)
+# Twitter profile images
+\btwimg\.com/profile_images/[_\w./]*
+# Twitter media
+\btwimg\.com/media/[-_\w./?=]*
+# Twitter link shortened
+\bt\.co/\w+
+
+# facebook
+\bfburl\.com/[0-9a-z_]+
+# facebook CDN
+\bfbcdn\.net/[\w/.,]*
+# facebook watch
+\bfb\.watch/[0-9A-Za-z]+
+
+# dropbox
+\bdropbox\.com/sh?/[^/\s"]+/[-0-9A-Za-z_.%?=&;]+
+
+# ipfs protocol
+ipfs://[0-9a-z]*
+# ipfs url
+/ipfs/[0-9a-z]*
+
+# w3
+\bw3\.org/[-0-9a-zA-Z/#.]+
+
+# loom
+\bloom\.com/embed/[0-9a-f]+
+
+# regex101
+\bregex101\.com/r/[^/\s"]+/\d+
+
+# figma
+\bfigma\.com/file(?:/[0-9a-zA-Z]+/)+
+
+# freecodecamp.org
+\bfreecodecamp\.org/[-\w/.]+
+
+# image.tmdb.org
+\bimage\.tmdb\.org/[/\w.]+
+
+# mermaid
+\bmermaid\.ink/img/[-\w]+|\bmermaid-js\.github\.io/mermaid-live-editor/#/edit/[-\w]+
+
+# Wikipedia
+\ben\.wikipedia\.org/wiki/[-\w%.#]+
+
+# gitweb
+[^"\s]+/gitweb/\S+;h=[0-9a-f]+
+
+# HyperKitty lists
+/archives/list/[^@/]+\@[^/\s"]*/message/[^/\s"]*/
+
+# lists
+/thread\.html/[^"\s]+
+
+# list-management
+\blist-manage\.com/subscribe(?:[?&](?:u|id)=[0-9a-f]+)+
+
+# kubectl.kubernetes.io/last-applied-configuration
+"kubectl.kubernetes.io/last-applied-configuration": ".*"
+
+# pgp
+\bgnupg\.net/pks/lookup[?&=0-9a-zA-Z]*
+
+# Spotify
+\bopen\.spotify\.com/embed/playlist/\w+
+
+# Mastodon
+\bmastodon\.[-a-z.]*/(?:media/|\@)[?&=0-9a-zA-Z_]*
+
+# scastie
+\bscastie\.scala-lang\.org/[^/]+/\w+
+
+# images.unsplash.com
+\bimages\.unsplash\.com/(?:(?:flagged|reserve)/|)[-\w./%?=%&.;]+
+
+# pastebin
+\bpastebin\.com/[\w/]+
+
+# heroku
+\b\w+\.heroku\.com/source/archive/\w+
+
+# quip
+\b\w+\.quip\.com/\w+(?:(?:#|/issues/)\w+)?
+
+# badgen.net
+\bbadgen\.net/badge/[^")\]'\s]+
+
+# statuspage.io
+\w+\.statuspage\.io\b
+
+# media.giphy.com
+\bmedia\.giphy\.com/media/[^/]+/[\w.?&=]+
+
+# tinyurl
+\btinyurl\.com/\w+
+
+# getopts
+\bgetopts\s+(?:"[^"]+"|'[^']+')
+
+# ANSI color codes
+(?:\\(?:u00|x)1b|\x1b)\[\d+(?:;\d+|)m
+
+# URL escaped characters
+\%[0-9A-F][A-F]
+# IPv6
+\b(?:[0-9a-fA-F]{0,4}:){3,7}[0-9a-fA-F]{0,4}\b
+# c99 hex digits (not the full format, just one I've seen)
+0x[0-9a-fA-F](?:\.[0-9a-fA-F]*|)[pP]
+# Punycode
+\bxn--[-0-9a-z]+
+# sha
+sha\d+:[0-9]*[a-f]{3,}[0-9a-f]*
+# sha-... -- uses a fancy capture
+(['"]|&quot;)[0-9a-f]{40,}\g{-1}
+# hex runs
+\b[0-9a-fA-F]{16,}\b
+# hex in url queries
+=[0-9a-fA-F]*?(?:[A-F]{3,}|[a-f]{3,})[0-9a-fA-F]*?&
+# ssh
+(?:ssh-\S+|-nistp256) [-a-zA-Z=;:/0-9+]{12,}
+
+# PGP
+\b(?:[0-9A-F]{4} ){9}[0-9A-F]{4}\b
+# GPG keys
+\b(?:[0-9A-F]{4} ){5}(?: [0-9A-F]{4}){5}\b
+# Well known gpg keys
+.well-known/openpgpkey/[\w./]+
+
+# uuid:
+\b[0-9a-fA-F]{8}-(?:[0-9a-fA-F]{4}-){3}[0-9a-fA-F]{12}\b
+# hex digits including css/html color classes:
+(?:[\\0][xX]|\\u|[uU]\+|#x?|\%23)[0-9_a-fA-FgGrR]*?[a-fA-FgGrR]{2,}[0-9_a-fA-FgGrR]*(?:[uUlL]{0,3}|u\d+)\b
+# integrity
+integrity="sha\d+-[-a-zA-Z=;:/0-9+]{40,}"
+
+# https://www.gnu.org/software/groff/manual/groff.html
+# man troff content
+\\f[BCIPR]
+# '
+\\\(aq
+
+# .desktop mime types
+^MimeTypes?=.*$
+# .desktop localized entries
+^[A-Z][a-z]+\[[a-z]+\]=.*$
+# Localized .desktop content
+Name\[[^\]]+\]=.*
+
+# IServiceProvider
+\bI(?=(?:[A-Z][a-z]{2,})+\b)
+
+# crypt
+"\$2[ayb]\$.{56}"
+
+# scrypt / argon
+\$(?:scrypt|argon\d+[di]*)\$\S+
+
+# Input to GitHub JSON
+content: "[-a-zA-Z=;:/0-9+]*="
+
+# Python stringprefix / binaryprefix
+# Note that there's a high false positive rate, remove the `?=` and search for the regex to see if the matches seem like reasonable strings
+(?<!')\b(?:B|BR|Br|F|FR|Fr|R|RB|RF|Rb|Rf|U|UR|Ur|b|bR|br|f|fR|fr|r|rB|rF|rb|rf|u|uR|ur)'(?:[A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,})
+
+# Regular expressions for (P|p)assword
+\([A-Z]\|[a-z]\)[a-z]+
+
+# JavaScript regular expressions
+# javascript test regex
+/.*/[gim]*\.test\(
+# javascript match regex
+\.match\(/[^/\s"]*/[gim]*\s*
+# javascript match regex
+\.match\(/\\[b].*?/[gim]*\s*\)(?:;|$)
+# javascript regex
+^\s*/\\[b].*/[gim]*\s*(?:\)(?:;|$)|,$)
+# javascript replace regex
+\.replace\(/[^/\s"]*/[gim]*\s*,
+
+# Go regular expressions
+regexp?\.MustCompile\(`[^`]*`\)
+
+# sed regular expressions
+sed 's/(?:[^/]*?[a-zA-Z]{3,}[^/]*?/){2}
+
+# go install
+go install(?:\s+[a-z]+\.[-@\w/.]+)+
+
+# kubernetes pod status lists
+# https://kubernetes.io/docs/concepts/workloads/pods/pod-lifecycle/#pod-phase
+\w+(?:-\w+)+\s+\d+/\d+\s+(?:Running|Pending|Succeeded|Failed|Unknown)\s+
+
+# kubectl - pods in CrashLoopBackOff
+\w+-[0-9a-f]+-\w+\s+\d+/\d+\s+CrashLoopBackOff\s+
+
+# kubernetes object suffix
+-[0-9a-f]{10}-\w{5}\s
+
+# posthog secrets
+posthog\.init\((['"])phc_[^"',]+\g{-1},
+
+# xcode
+
+# xcodeproject scenes
+(?:Controller|ID|id)="\w{3}-\w{2}-\w{3}"
+
+# xcode api botches
+customObjectInstantitationMethod
+
+# font awesome classes
+\.fa-[-a-z0-9]+
+
+# Update Lorem based on your content (requires `ge` and `w` from https://github.com/jsoref/spelling; and `review` from https://github.com/check-spelling/check-spelling/wiki/Looking-for-items-locally )
+# grep '^[^#].*lorem' .github/actions/spelling/patterns.txt|perl -pne 's/.*i..\?://;s/\).*//' |tr '|' "\n"|sort -f |xargs -n1 ge|perl -pne 's/^[^:]*://'|sort -u|w|sed -e 's/ .*//'|w|review -
+# Warning, while `(?i)` is very neat and fancy, if you have some binary files that aren't proper unicode, you might run into:
+## Operation "substitution (s///)" returns its argument for non-Unicode code point 0x1C19AE (the code point will vary).
+## You could manually change `(?i)X...` to use `[Xx]...`
+## or you could add the files to your `excludes` file (a version after 0.0.19 should identify the file path)
+# Lorem
+(?:\w|\s|[,.])*\b(?i)(?:amet|consectetur|cursus|dolor|eros|ipsum|lacus|libero|ligula|lorem|magna|neque|nulla|suscipit|tempus)\b(?:\w|\s|[,.])*
+
+# Non-English
+[a-zA-Z]*[ÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź][a-zA-Z]{3}[a-zA-ZÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź]*
+
+# French
+# This corpus only had capital letters, but you probably want lowercase ones as well.
+\b[LN]'+[a-z]{2,}\b
+
+# latex
+\\(?:n(?:ew|ormal|osub)|r(?:enew)|t(?:able(?:of|)|he|itle))(?=[a-z]+)
+
+# the negative lookahead here is to allow catching 'templatesz' as a misspelling
+# but to otherwise recognize a Windows path with \templates\foo.template or similar:
+\\(?:necessary|r(?:eport|esolve[dr]?|esult)|t(?:arget|emplates?))(?![a-z])
+# ignore long runs of a single character:
+\b([A-Za-z])\g{-1}{3,}\b
+# Note that the next example is no longer necessary if you are using
+# to match a string starting with a `#`, use a character-class:
+[#]backwards
+# version suffix <word>v#
+(?:(?<=[A-Z]{2})V|(?<=[a-z]{2}|[A-Z]{2})v)\d+(?:\b|(?=[a-zA-Z_]))
+# Compiler flags (Scala)
+(?:^|[\t ,>"'`=(])-J-[DPWXY](?=[A-Z]{2,}|[A-Z][a-z]|[a-z]{2,})
+# Compiler flags
+#(?:^|[\t ,"'`=(])-[DPWXYLlf](?=[A-Z]{2,}|[A-Z][a-z]|[a-z]{2,})
+
+# Compiler flags (linker)
+,-B
+# curl arguments
+\b(?:\\n|)curl(?:\s+-[a-zA-Z]{1,2}\b)*(?:\s+-[a-zA-Z]{3,})(?:\s+-[a-zA-Z]+)*
+# set arguments
+\bset(?:\s+-[abefimouxE]{1,2})*\s+-[abefimouxE]{3,}(?:\s+-[abefimouxE]+)*
+# tar arguments
+\b(?:\\n|)g?tar(?:\.exe|)(?:(?:\s+--[-a-zA-Z]+|\s+-[a-zA-Z]+|\s[ABGJMOPRSUWZacdfh-pr-xz]+\b)(?:=[^ ]*|))+
+# tput arguments -- https://man7.org/linux/man-pages/man5/terminfo.5.html -- technically they can be more than 5 chars long...
+\btput\s+(?:(?:-[SV]|-T\s*\w+)\s+)*\w{3,5}\b
+# macOS temp folders
+/var/folders/\w\w/[+\w]+/(?:T|-Caches-)/

.github/actions/spelling/excludes.txt

@@ -0,0 +1,117 @@
+# See https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples:-excludes
+(?:(?i)\.png$)
+(?:^|/)(?i)COPYRIGHT
+(?:^|/)(?i)LICEN[CS]E
+(?:^|/)3rdparty/
+(?:^|/)dirs$
+(?:^|/)go\.mod$
+(?:^|/)go\.sum$
+(?:^|/)package(?:-lock|)\.json$
+(?:^|/)sources(?:|\.dep)$
+(?:^|/)vendor/
+\.a$
+\.ai$
+\.avi$
+\.bmp$
+\.bz2$
+\.cer$
+\.class$
+\.crl$
+\.crt$
+\.csr$
+\.dll$
+\.docx?$
+\.drawio$
+\.DS_Store$
+\.eot$
+\.eps$
+\.exe$
+\.gif$
+\.gitattributes$
+\.graffle$
+\.gz$
+\.icns$
+\.ico$
+\.jar$
+\.jks$
+\.jpeg$
+\.jpg$
+\.key$
+\.lib$
+\.lock$
+\.map$
+\.min\..
+\.mod$
+\.mp3$
+\.mp4$
+\.o$
+\.ocf$
+\.otf$
+\.pbxproj$
+\.pdf$
+\.pem$
+\.png$
+\.psd$
+\.pyc$
+\.runsettings$
+\.s$
+\.sig$
+\.so$
+\.svg$
+\.svgz$
+\.svgz?$
+\.tar$
+\.tgz$
+\.tiff?$
+\.ttf$
+\.vsdx$
+\.wav$
+\.webm$
+\.webp$
+\.woff
+\.woff2?$
+\.xcf$
+\.xls
+\.xlsx?$
+\.xpm$
+\.yml$
+\.zip$
+^\.github/actions/spelling/
+^\.github/fabricbot.json$
+^\.gitignore$
+^\Q.git-blame-ignore-revs\E$
+^\Q.github/workflows/spelling.yml\E$
+^\Qdoc/reference/windows-terminal-logo.ans\E$
+^\Qsamples/ConPTY/EchoCon/EchoCon/EchoCon.vcxproj.filters\E$
+^\Qsrc/host/exe/Host.EXE.vcxproj.filters\E$
+^\Qsrc/host/ft_host/chafa.txt\E$
+^\Qsrc/tools/closetest/CloseTest.vcxproj.filters\E$
+^\XamlStyler.json$
+^build/config/
+^consolegit2gitfilters\.json$
+^dep/
+^doc/reference/master-sequence-list.csv$
+^doc/reference/UTF8-torture-test\.txt$
+^oss/
+^src/host/ft_uia/run\.bat$
+^src/host/runft\.bat$
+^src/host/runut\.bat$
+^src/interactivity/onecore/BgfxEngine\.
+^src/renderer/atlas/
+^src/renderer/wddmcon/WddmConRenderer\.
+^src/terminal/adapter/ut_adapter/run\.bat$
+^src/terminal/parser/delfuzzpayload\.bat$
+^src/terminal/parser/ft_fuzzer/run\.bat$
+^src/terminal/parser/ft_fuzzer/VTCommandFuzzer\.cpp$
+^src/terminal/parser/ft_fuzzwrapper/run\.bat$
+^src/terminal/parser/ut_parser/Base64Test.cpp$
+^src/terminal/parser/ut_parser/run\.bat$
+^src/tools/integrity/packageuwp/ConsoleUWP\.appxSources$
+^src/tools/lnkd/lnkd\.bat$
+^src/tools/pixels/pixels\.bat$
+^src/tools/texttests/fira\.txt$
+^src/tools/U8U16Test/(?:fr|ru|zh)\.txt$
+^src/types/ut_types/UtilsTests.cpp$
+^tools/ReleaseEngineering/ServicingPipeline.ps1$
+ignore$
+SUMS$

.github/actions/spelling/expect/README.md

@@ -0,0 +1,13 @@
+The contents of each `.txt` file in this directory are merged together.
+
+* [alphabet](alphabet.txt) is a sample for alphabet related items
+* [web](web.txt) is a sample for web/html related items
+* [expect](expect.txt) is the main list of expected items -- there is nothing
+particularly special about the file name (beyond the extension which is
+important).
+
+These terms are things which temporarily exist in the project, but which
+aren't necessarily words.
+
+If something is a word that could come and go, it probably belongs in a
+[dictionary](../dictionary/README.md).

.github/actions/spelling/expect/alphabet.txt

@@ -0,0 +1,40 @@
+AAAa
+AAAAA
+AAAAAAAAAAAAA
+AAAAAABBBBBBCCC
+AAAAABBBBBBCCC
+abcd
+abcd
+ABCDEFGHIJ
+abcdefghijk
+ABCDEFGHIJKLMNO
+abcdefghijklmnop
+ABCDEFGHIJKLMNOPQRST
+ABCG
+ABE
+abf
+BBBBB
+BBBBBBBB
+BBBBBCCC
+BBBBCCCCC
+BBGGRR
+EFG
+EFGh
+QQQQQQQQQQABCDEFGHIJ
+QQQQQQQQQQABCDEFGHIJKLMNOPQRSTQQQQQQQQQ
+QQQQQQQQQQABCDEFGHIJKLMNOPQRSTQQQQQQQQQQ
+QQQQQQQQQQABCDEFGHIJPQRSTQQQQQQQQQQ
+qrstuvwxyz
+qwerty
+qwertyuiopasdfg
+YYYYYYYDDDDDDDDDDD
+ZAAZZ
+ZABBZ
+ZBAZZ
+ZBBBZ
+ZBBZZ
+ZYXWVUT
+ZZBBZ
+ZZZBB
+ZZZBZ
+ZZZZZ

.github/actions/spelling/expect/web.txt

@@ -0,0 +1,6 @@
+WCAG
+winui
+appshellintegration
+mdtauk
+gfycat
+Guake

.github/actions/spelling/line_forbidden.patterns

@@ -0,0 +1,62 @@
+# reject `m_data` as there's a certain OS which has evil defines that break things if it's used elsewhere
+# \bm_data\b
+
+# If you have a framework that uses `it()` for testing and `fit()` for debugging a specific test,
+# you might not want to check in code where you were debugging w/ `fit()`, in which case, you might want
+# to use this:
+#\bfit\(
+
+# s.b. GitHub
+\bGithub\b
+
+# s.b. GitLab
+\bGitlab\b
+
+# s.b. JavaScript
+\bJavascript\b
+
+# s.b. Microsoft
+\bMicroSoft\b
+
+# s.b. another
+\ban[- ]other\b
+
+# s.b. greater than
+\bgreater then\b
+
+# s.b. into
+#\sin to\s
+
+# s.b. opt-in
+\sopt in\s
+
+# s.b. less than
+\bless then\b
+
+# s.b. otherwise
+\bother[- ]wise\b
+
+# s.b. nonexistent
+\bnon existing\b
+\b[Nn]o[nt][- ]existent\b
+
+# s.b. preexisting
+[Pp]re[- ]existing
+
+# s.b. preempt
+[Pp]re[- ]empt\b
+
+# s.b. preemptively
+[Pp]re[- ]emptively
+
+# s.b. reentrancy
+[Rr]e[- ]entrancy
+
+# s.b. reentrant
+[Rr]e[- ]entrant
+
+# s.b. workaround(s)
+#\bwork[- ]arounds?\b
+
+# Reject duplicate words
+\s([A-Z]{3,}|[A-Z][a-z]{2,}|[a-z]{3,})\s\g{-1}\s

.github/actions/spelling/patterns/0_n.txt

@@ -0,0 +1,2 @@
+\\native(?![a-z])
+\\nihilist(?![a-z])

.github/actions/spelling/patterns/0_r.txt

@@ -0,0 +1,8 @@
+\\registry(?![a-z])
+\\release(?![a-z])
+\\resources?(?![a-z])
+\\result(?![a-z])
+\\resultmacros(?![a-z])
+\\rules(?![a-z])
+\\renderer(?![a-z])
+\\rectread(?![a-z])

.github/actions/spelling/patterns/0_t.txt

@@ -0,0 +1,13 @@
+\\telemetry(?![a-z])
+\\templates(?![a-z])
+\\term(?![a-z])
+\\terminal(?![a-z])
+\\terminalcore(?![a-z])
+\\terminalinput(?![a-z])
+\\testlist(?![a-z])
+\\testmd(?![a-z])
+\\testpasses(?![a-z])
+\\tests(?![a-z])
+\\thread(?![a-z])
+\\tools(?![a-z])
+\\types(?![a-z])

.github/actions/spelling/patterns/README.md

@@ -0,0 +1,16 @@
+The contents of each `.txt` file in this directory are merged together.
+Each line is a Perl 5 regular expression.
+Nothing is guaranteed about the order in which they're merged.
+-- If this is a problem, please reach out.
+
+Note: order of the contents of these files can matter.
+Lines from an individual file are handled in file order.
+Files are selected in alphabetical order.
+
+* [n](0_n.txt), [r](0_r.txt), and [t](0_t.txt) are specifically to work around
+a quirk in the spell checker:
+it often sees C strings of the form "Hello\nwerld". And would prefer to
+spot the typo of `werld`.
+* [patterns](patterns.txt) is the main list -- there is nothing
+particularly special about the file name (beyond the extension which is
+important).

.github/actions/spelling/patterns/patterns.txt

@@ -0,0 +1,96 @@
+# See https://github.com/check-spelling/check-spelling/wiki/Configuration-Examples:-patterns
+
+https?://\S+
+[Pp]ublicKeyToken="?[0-9a-fA-F]{16}"?
+(?:[{"]|UniqueIdentifier>)[0-9a-fA-F]{8}-(?:[0-9a-fA-F]{4}-){3}[0-9a-fA-F]{12}(?:[}"]|</UniqueIdentifier)
+(?:0[Xx]|\\x|U\+|#)[a-f0-9A-FGgRr]{2,}[Uu]?[Ll]{0,2}\b
+microsoft/cascadia-code\@[0-9a-fA-F]{40}
+\d+x\d+Logo
+Scro\&ll
+# selectionInput.cpp
+ :\\windows\\syste\b
+TestUtils::VerifyExpectedString\(tb, L"[^"]+"
+(?:hostSm|mach)\.ProcessString\(L"[^"]+"
+\b([A-Za-z])\g{-1}{3,}\b
+0x[0-9A-Za-z]+
+Base64::s_(?:En|De)code\(L"[^"]+"
+VERIFY_ARE_EQUAL\(L"[^"]+"
+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789\+/"
+std::memory_order_[\w]+
+D2DERR_SHADER_COMPILE_FAILED
+TIL_FEATURE_[0-9A-Z_]+
+vcvars\w*
+ROY\sG\.\sBIV
+!(?:(?i)ESC)!\[
+!(?:(?i)CSI)!(?:\d+(?:;\d+|)m|[ABCDF])
+
+# Python stringprefix / binaryprefix
+\b(?:B|BR|Br|F|FR|Fr|R|RB|RF|Rb|Rf|U|UR|Ur|b|bR|br|f|fR|fr|r|rB|rF|rb|rf|u|uR|ur)'
+
+# Automatically suggested patterns
+# hit-count: 3831 file-count: 582
+# IServiceProvider
+\bI(?=(?:[A-Z][a-z]{2,})+\b)
+
+# hit-count: 71 file-count: 35
+# Compiler flags
+(?:^|[\t ,"'`=(])-[D](?=[A-Z]{2,}|[A-Z][a-z])
+(?:^|[\t ,"'`=(])-[X](?=[A-Z]{2,}|[A-Z][a-z]|[a-z]{2,})
+
+# hit-count: 41 file-count: 28
+# version suffix <word>v#
+(?:(?<=[A-Z]{2})V|(?<=[a-z]{2}|[A-Z]{2})v)\d+(?:\b|(?=[a-zA-Z_]))
+
+# hit-count: 20 file-count: 9
+# hex runs
+\b[0-9a-fA-F]{16,}\b
+
+# hit-count: 10 file-count: 7
+# uuid:
+\b[0-9a-fA-F]{8}-(?:[0-9a-fA-F]{4}-){3}[0-9a-fA-F]{12}\b
+
+# hit-count: 4 file-count: 4
+# mailto urls
+mailto:[-a-zA-Z=;:/?%&0-9+@.]{3,}
+
+# hit-count: 4 file-count: 1
+# ANSI color codes
+(?:\\(?:u00|x)1b|\x1b)\[\d+(?:;\d+|)m
+
+# hit-count: 2 file-count: 1
+# latex
+\\(?:n(?:ew|ormal|osub)|r(?:enew)|t(?:able(?:of|)|he|itle))(?=[a-z]+)
+
+# hit-count: 1 file-count: 1
+# hex digits including css/html color classes:
+(?:[\\0][xX]|\\u|[uU]\+|#x?|\%23)[0-9_a-fA-FgGrR]*?[a-fA-FgGrR]{2,}[0-9_a-fA-FgGrR]*(?:[uUlL]{0,3}|u\d+)\b
+
+# hit-count: 1 file-count: 1
+# Non-English
+[a-zA-Z]*[ÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź][a-zA-Z]{3}[a-zA-ZÀÁÂÃÄÅÆÇÈÉÊËÌÍÎÏÐÑÒÓÔÕÖØÙÚÛÜÝßàáâãäåæçèéêëìíîïðñòóôõöøùúûüýÿĀāŁłŃńŅņŒœŚśŠšŜŝŸŽžź]*
+
+# hit-count: 1 file-count: 1
+# French
+# This corpus only had capital letters, but you probably want lowercase ones as well.
+\b[LN]'+[a-z]{2,}\b
+
+# acceptable duplicates
+# ls directory listings
+[-bcdlpsw](?:[-r][-w][-sx]){3}\s+\d+\s+(\S+)\s+\g{-1}\s+\d+\s+
+# C/idl types + English ...
+\s(Guid|long|LONG|that) \g{-1}\s
+
+# javadoc / .net
+(?:[\\@](?:groupname|param)|(?:public|private)(?:\s+static|\s+readonly)*)\s+(\w+)\s+\g{-1}\s
+
+# Commit message -- Signed-off-by and friends
+^\s*(?:(?:Based-on-patch|Co-authored|Helped|Mentored|Reported|Reviewed|Signed-off)-by|Thanks-to): (?:[^<]*<[^>]*>|[^<]*)\s*$
+
+# Autogenerated revert commit message
+^This reverts commit [0-9a-f]{40}\.$
+
+# vtmode
+--vtmode\s+(\w+)\s+\g{-1}\s
+
+# ignore long runs of a single character:
+\b([A-Za-z])\g{-1}{3,}\b

.github/actions/spelling/reject.txt

@@ -0,0 +1,12 @@
+^attache$
+^attacher$
+^attachers$
+benefitting
+occurences?
+^dependan.*
+^oer$
+Sorce
+^[Ss]pae.*
+^untill$
+^untilling$
+^wether.*

.github/workflows/spelling2.yml

@@ -0,0 +1,134 @@
+# spelling.yml is blocked per https://github.com/check-spelling/check-spelling/security/advisories/GHSA-g86g-chm8-7r2p
+name: Spell checking
+
+# Comment management is handled through a secondary job, for details see:
+# https://github.com/check-spelling/check-spelling/wiki/Feature%3A-Restricted-Permissions
+#
+# `jobs.comment-push` runs when a push is made to a repository and the `jobs.spelling` job needs to make a comment
+#   (in odd cases, it might actually run just to collapse a commment, but that's fairly rare)
+#   it needs `contents: write` in order to add a comment.
+#
+# `jobs.comment-pr` runs when a pull_request is made to a repository and the `jobs.spelling` job needs to make a comment
+#   or collapse a comment (in the case where it had previously made a comment and now no longer needs to show a comment)
+#   it needs `pull-requests: write` in order to manipulate those comments.
+
+# Updating pull request branches is managed via comment handling.
+# For details, see: https://github.com/check-spelling/check-spelling/wiki/Feature:-Update-expect-list
+#
+# These elements work together to make it happen:
+#
+# `on.issue_comment`
+#   This event listens to comments by users asking to update the metadata.
+#
+# `jobs.update`
+#   This job runs in response to an issue_comment and will push a new commit
+#   to update the spelling metadata.
+#
+# `with.experimental_apply_changes_via_bot`
+#   Tells the action to support and generate messages that enable it
+#   to make a commit to update the spelling metadata.
+#
+# `with.ssh_key`
+#   In order to trigger workflows when the commit is made, you can provide a
+#   secret (typically, a write-enabled github deploy key).
+#
+#   For background, see: https://github.com/check-spelling/check-spelling/wiki/Feature:-Update-with-deploy-key
+
+on:
+  push:
+    branches:
+    - "**"
+    tags-ignore:
+    - "**"
+  pull_request_target:
+    branches:
+    - "**"
+    tags-ignore:
+    - "**"
+    types:
+    - 'opened'
+    - 'reopened'
+    - 'synchronize'
+  issue_comment:
+    types:
+    - 'created'
+
+jobs:
+  spelling:
+    name: Spell checking
+    permissions:
+      contents: read
+      pull-requests: read
+      actions: read
+    outputs:
+      followup: ${{ steps.spelling.outputs.followup }}
+    runs-on: ubuntu-latest
+    if: "contains(github.event_name, 'pull_request') || github.event_name == 'push'"
+    concurrency:
+      group: spelling-${{ github.event.pull_request.number || github.ref }}
+      # note: If you use only_check_changed_files, you do not want cancel-in-progress
+      cancel-in-progress: true
+    steps:
+    - name: check-spelling
+      id: spelling
+      uses: check-spelling/check-spelling@v0.0.21
+      with:
+        suppress_push_for_open_pull_request: 1
+        checkout: true
+        check_file_names: 1
+        spell_check_this: check-spelling/spell-check-this@prerelease
+        post_comment: 0
+        use_magic_file: 1
+        extra_dictionary_limit: 10
+        extra_dictionaries:
+          cspell:software-terms/src/software-terms.txt
+          cspell:python/src/python/python-lib.txt
+          cspell:node/node.txt
+          cspell:cpp/src/stdlib-c.txt
+          cspell:cpp/src/stdlib-cpp.txt
+          cspell:fullstack/fullstack.txt
+          cspell:filetypes/filetypes.txt
+          cspell:html/html.txt
+          cspell:cpp/src/compiler-msvc.txt
+          cspell:python/src/common/extra.txt
+          cspell:powershell/powershell.txt
+          cspell:aws/aws.txt
+          cspell:cpp/src/lang-keywords.txt
+          cspell:npm/npm.txt
+          cspell:dotnet/dotnet.txt
+          cspell:python/src/python/python.txt
+          cspell:css/css.txt
+          cspell:cpp/src/stdlib-cmath.txt
+        check_extra_dictionaries: ''
+
+  comment-push:
+    name: Report (Push)
+    # If your workflow isn't running on push, you can remove this job
+    runs-on: ubuntu-latest
+    needs: spelling
+    permissions:
+      contents: write
+    if: (success() || failure()) && needs.spelling.outputs.followup && github.event_name == 'push'
+    steps:
+    - name: comment
+      uses: check-spelling/check-spelling@v0.0.21
+      with:
+        checkout: true
+        spell_check_this: check-spelling/spell-check-this@prerelease
+        task: ${{ needs.spelling.outputs.followup }}
+
+  comment-pr:
+    name: Report (PR)
+    # If you workflow isn't running on pull_request*, you can remove this job
+    runs-on: ubuntu-latest
+    needs: spelling
+    permissions:
+      pull-requests: write
+    if: (success() || failure()) && needs.spelling.outputs.followup && contains(github.event_name, 'pull_request')
+    steps:
+    - name: comment
+      uses: check-spelling/check-spelling@v0.0.21
+      with:
+        checkout: true
+        spell_check_this: check-spelling/spell-check-this@prerelease
+        task: ${{ needs.spelling.outputs.followup }}

.gitignore

@@ -48,6 +48,7 @@ dlldata.c
 project.lock.json
 artifacts/
 
+*_h.h
 *_i.c
 *_p.c
 *_i.h
@@ -144,13 +145,13 @@ publish/
 # Publish Web Output
 *.[Pp]ublish.xml
 *.azurePubxml
-# TODO: Comment the next line if you want to checkin your web deploy settings
+# TODO: Comment the next line if you want to check in your web deploy settings
 # but database connection strings (with potential passwords) will be unencrypted
 *.pubxml
 *.publishproj
 
 # Microsoft Azure Web App publish settings. Comment the next line if you want to
-# checkin your Azure Web App publish settings, but sensitive information contained
+# check in your Azure Web App publish settings, but sensitive information contained
 # in these scripts will be unencrypted
 PublishScripts/
 

CONTRIBUTING.md

@@ -125,7 +125,7 @@ Team members will be happy to help review specs and guide them to completion.
 
 ### Help Wanted
 
-Once the team have approved an issue/spec, development can proceed. If no developers are immediately available, the spec can be parked ready for a developer to get started. Parked specs' issues will be labeled "Help Wanted". To find a list of development opportunities waiting for developer involvement, visit the Issues and filter on [the Help-Wanted label](https://github.com/microsoft/terminal/labels/Help-Wanted).
+Once the team have approved an issue/spec, development can proceed. If no developers are immediately available, the spec can be parked ready for a developer to get started. Parked specs' issues will be labeled "Help Wanted". To find a list of development opportunities waiting for developer involvement, visit the Issues and filter on [the Help-Wanted label](https://github.com/microsoft/terminal/labels/Help%20Wanted).
 
 ---
 
@@ -155,4 +155,4 @@ Once your code has been reviewed and approved by the requisite number of team me
 
 ## Thank you
 
-Thank you in advance for your contribution! Now, [what's next on the list](https://github.com/microsoft/terminal/labels/Help-Wanted)? 😜
+Thank you in advance for your contribution! Now, [what's next on the list](https://github.com/microsoft/terminal/labels/Help%20Wanted)? 😜

NOTICE.md

@@ -80,7 +80,7 @@ SOFTWARE.
 
 ## chromium/base/numerics
 
-**Source**: 
+**Source**: https://github.com/chromium/chromium/tree/master/base/numerics
 
 ### License
 
@@ -112,4 +112,109 @@ DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
 THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
 (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
 OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
-```
+```
+
+## kimwalisch/libpopcnt
+
+**Source**: https://github.com/kimwalisch/libpopcnt
+
+### License
+
+```
+BSD 2-Clause License
+
+Copyright (c) 2016 - 2019, Kim Walisch
+Copyright (c) 2016 - 2019, Wojciech Muła
+
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+1. Redistributions of source code must retain the above copyright notice, this
+   list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright notice,
+   this list of conditions and the following disclaimer in the documentation
+   and/or other materials provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR
+ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+```
+
+## dynamic_bitset
+
+**Source**: https://github.com/pinam45/dynamic_bitset
+
+### License
+
+```
+MIT License
+
+Copyright (c) 2019 Maxime Pinard
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+
+```
+
+## {fmt}
+
+**Source**: https://github.com/fmtlib/fmt
+
+### License
+
+```
+MIT License
+
+Copyright (c) 2012 - present, Victor Zverovich
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+--- Optional exception to the license ---
+
+As an exception, if, as a result of your compiling your source code, portions
+of this Software are embedded into a machine-executable object form of such
+source code, you may redistribute such embedded portions in such object form
+without including the above copyright and permission notices.
+```

OpenConsole.sln

@@ -300,6 +300,8 @@ Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "winconpty.Tests.Feature", "
 EndProject
 Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "TerminalAzBridge", "src\cascadia\TerminalAzBridge\TerminalAzBridge.vcxproj", "{067F0A06-FCB7-472C-96E9-B03B54E8E18D}"
 EndProject
+Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "fmt", "src\dep\fmt\fmt.vcxproj", "{6BAE5851-50D5-4934-8D5E-30361A8A40F3}"
+EndProject
 Global
 	GlobalSection(SolutionConfigurationPlatforms) = preSolution
 		AuditMode|Any CPU = AuditMode|Any CPU
@@ -1485,6 +1487,27 @@ Global
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D}.Release|x64.Build.0 = Release|x64
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D}.Release|x86.ActiveCfg = Release|Win32
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D}.Release|x86.Build.0 = Release|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|Any CPU.ActiveCfg = AuditMode|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|ARM64.ActiveCfg = AuditMode|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|ARM64.Build.0 = AuditMode|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x64.ActiveCfg = AuditMode|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x64.Build.0 = AuditMode|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x86.ActiveCfg = AuditMode|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.AuditMode|x86.Build.0 = AuditMode|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|Any CPU.ActiveCfg = Debug|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|ARM64.ActiveCfg = Debug|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|ARM64.Build.0 = Debug|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x64.ActiveCfg = Debug|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x64.Build.0 = Debug|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x86.ActiveCfg = Debug|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Debug|x86.Build.0 = Debug|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|Any CPU.ActiveCfg = Release|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|ARM64.ActiveCfg = Release|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|ARM64.Build.0 = Release|ARM64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x64.ActiveCfg = Release|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x64.Build.0 = Release|x64
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x86.ActiveCfg = Release|Win32
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3}.Release|x86.Build.0 = Release|Win32
 	EndGlobalSection
 	GlobalSection(SolutionProperties) = preSolution
 		HideSolutionNode = FALSE
@@ -1562,6 +1585,7 @@ Global
 		{95B136F9-B238-490C-A7C5-5843C1FECAC4} = {05500DEF-2294-41E3-AF9A-24E580B82836}
 		{024052DE-83FB-4653-AEA4-90790D29D5BD} = {E8F24881-5E37-4362-B191-A3BA0ED7F4EB}
 		{067F0A06-FCB7-472C-96E9-B03B54E8E18D} = {59840756-302F-44DF-AA47-441A9D673202}
+		{6BAE5851-50D5-4934-8D5E-30361A8A40F3} = {81C352DB-1818-45B7-A284-18E259F1CC87}
 	EndGlobalSection
 	GlobalSection(ExtensibilityGlobals) = postSolution
 		SolutionGuid = {3140B1B7-C8EE-43D1-A772-D82A7061A271}

README.md

@@ -2,7 +2,8 @@
 
 This repository contains the source code for:
 
-* [Windows Terminal](https://www.microsoft.com/en-us/p/windows-terminal-preview/9n0dx20hk701)
+* [Windows Terminal](https://aka.ms/terminal)
+* [Windows Terminal Preview](https://aka.ms/terminal-preview)
 * The Windows console host (`conhost.exe`)
 * Components shared between the two projects
 * [ColorTool](https://github.com/Microsoft/Terminal/tree/master/src/tools/ColorTool)
@@ -10,6 +11,7 @@ This repository contains the source code for:
 
 Related repositories include:
 
+* [Windows Terminal Documentation](https://github.com/MicrosoftDocs/terminal)
 * [Console API Documentation](https://github.com/MicrosoftDocs/Console-Docs)
 * [Cascadia Code Font](https://github.com/Microsoft/Cascadia-Code)
 
@@ -19,7 +21,7 @@ Related repositories include:
 
 ### Microsoft Store [Recommended]
 
-Install the [Windows Terminal from the Microsoft Store][store-install-link]. This allows you to always be on the latest version when we release new builds with automatic upgrades. 
+Install the [Windows Terminal from the Microsoft Store][store-install-link]. This allows you to always be on the latest version when we release new builds with automatic upgrades.
 
 This is our preferred method.
 
@@ -61,12 +63,6 @@ ColorTool|![](https://microsoft.visualstudio.com/_apis/public/build/definitions/
 
 ---
 
-## Windows Terminal v1.0 Roadmap
-
-The plan for delivering Windows Terminal v1.0 [is described here](/doc/terminal-v1-roadmap.md), and will be updated as the project proceeds.
-
----
-
 ## Terminal & Console Overview
 
 Please take a few minutes to review the overview below before diving into the code:
@@ -131,7 +127,7 @@ Solution: Make sure you're building & deploying the `CascadiaPackage` project in
 
 ## Documentation
 
-All project documentation is located in the `./doc` folder. If you would like to contribute to the documentation, please submit a pull request.
+All project documentation is located at aka.ms/terminal-docs. If you would like to contribute to the documentation, please submit a pull request on the [Windows Terminal Documentation repo](https://github.com/MicrosoftDocs/terminal).
 
 ---
 
@@ -150,7 +146,6 @@ Please file new issues, feature requests and suggestions, but **DO search for si
 If you would like to ask a question that you feel doesn't warrant an issue (yet), please reach out to us via Twitter:
 
 * Kayla Cinnamon, Program Manager: [@cinnamon\_msft](https://twitter.com/cinnamon_msft)
-* Rich Turner, Program Manager: [@richturn\_ms](https://twitter.com/richturn_ms)
 * Dustin Howett, Engineering Lead: [@dhowett](https://twitter.com/DHowett)
 * Michael Niksa, Senior Developer: [@michaelniksa](https://twitter.com/MichaelNiksa)
 * Mike Griese, Developer: [@zadjii](https://twitter.com/zadjii)
@@ -227,4 +222,4 @@ For more information see the [Code of Conduct FAQ][conduct-FAQ] or contact [open
 [conduct-code]: https://opensource.microsoft.com/codeofconduct/
 [conduct-FAQ]: https://opensource.microsoft.com/codeofconduct/faq/
 [conduct-email]: mailto:opencode@microsoft.com
-[store-install-link]: https://aka.ms/windowsterminal
+[store-install-link]: https://aka.ms/terminal

build/config/LocConfig.xml

@@ -0,0 +1,15 @@
+<?xml version="1.0" encoding="utf-8"?>
+<Modules>
+  <Module name="Microsoft.WindowsTerminal" tdbuildteamid="7105">
+    <File location="TerminalApp"
+      path="%BUILD_SOURCESDIRECTORY%\src\cascadia\TerminalApp\Resources\en-US\Resources.resw" />
+    <File location="TerminalControl"
+      path="%BUILD_SOURCESDIRECTORY%\src\cascadia\TerminalControl\Resources\en-US\Resources.resw" />
+    <File location="TerminalConnection"
+      path="%BUILD_SOURCESDIRECTORY%\src\cascadia\TerminalConnection\Resources\en-US\Resources.resw" />
+    <File location="WindowsTerminalUniversal"
+      path="%BUILD_SOURCESDIRECTORY%\src\cascadia\WindowsTerminalUniversal\Resources\en-US\Resources.resw" />
+    <File location="CascadiaPackage"
+      path="%BUILD_SOURCESDIRECTORY%\src\cascadia\CascadiaPackage\Resources\en-US\Resources.resw" />
+  </Module>
+</Modules>

build/config/SignConfig.WindowsTerminal.xml

@@ -1,6 +1,5 @@
 <SignConfigXML>
   <job platform="" configuration="" certSubject="CN=Microsoft Corporation, O=Microsoft Corporation, L=Redmond, S=Washington, C=US" jobname="EngFunSimpleSign" approvers="">
-   <file src="__INPATHROOT__\Microsoft.WindowsTerminal_8wekyb3d8bbwe.msixbundle" signType="136020001" dest="__OUTPATHROOT__\Microsoft.WindowsTerminal_8wekyb3d8bbwe.msixbundle" /> 
-   <file src="__INPATHROOT__\Microsoft.WindowsTerminalUniversal_8wekyb3d8bbwe.msixbundle" signType="136020001" dest="__OUTPATHROOT__\Microsoft.WindowsTerminalUniversal_8wekyb3d8bbwe.msixbundle" /> 
+   <file src="__INPATHROOT__\Microsoft.WindowsTerminal*.msixbundle" signType="136020001" />
   </job>
 </SignConfigXML>

build/pipelines/ci.yml

@@ -27,21 +27,43 @@ variables:
 #     0.0.1904.0900
 name: 0.0.$(Date:yyMM).$(Date:dd)$(Rev:rr)
 
-jobs:
-  - template: ./templates/build-console-audit-job.yml
-    parameters:
-      platform: x64
+stages:
+  - stage: Audit_x64
+    displayName: Audit Mode
+    dependsOn: []
+    condition: succeeded()
+    jobs:
+      - template: ./templates/build-console-audit-job.yml
+        parameters:
+          platform: x64
+  - stage: Build_x64
+    displayName: Build x64
+    dependsOn: []
+    condition: succeeded()
+    jobs:
+      - template: ./templates/build-console-ci.yml
+        parameters:
+          platform: x64
+  - stage: Build_x86
+    displayName: Build x86
+    dependsOn: []
+    condition: not(eq(variables['Build.Reason'], 'PullRequest'))
+    jobs:
+      - template: ./templates/build-console-ci.yml
+        parameters:
+          platform: x86
+  - stage: Build_ARM64
+    displayName: Build ARM64
+    dependsOn: []
+    condition: not(eq(variables['Build.Reason'], 'PullRequest'))
+    jobs:
+      - template: ./templates/build-console-ci.yml
+        parameters:
+          platform: ARM64
+  - stage: Scripts
+    displayName: Code Health Scripts
+    dependsOn: []
+    condition: succeeded()
+    jobs:
+      - template: ./templates/check-formatting.yml
 
-  - template: ./templates/build-console-ci.yml
-    parameters:
-      platform: x64
-
-  - template: ./templates/build-console-ci.yml
-    parameters:
-      platform: x86
-
-  - template: ./templates/build-console-ci.yml
-    parameters:
-      platform: ARM64
-
-  - template: ./templates/check-formatting.yml

build/pipelines/release.yml

@@ -15,6 +15,14 @@ variables:
 # store publication machinery happy.
 name: 'Terminal_$(date:yyMM).$(date:dd)$(rev:rrr)'
 
+# Build Arguments:
+#   WindowsTerminalOfficialBuild=[true,false]
+#     true - this is running on our build agent
+#     false - running locally
+#   WindowsTerminalBranding=[Dev,Preview,Release]
+#     <none>  - Development build resources (default)
+#     Preview - Preview build resources
+#     Release - regular build resources
 jobs:
   - template: ./templates/build-console-audit-job.yml
     parameters:
@@ -23,17 +31,17 @@ jobs:
   - template: ./templates/build-console-int.yml
     parameters:
       platform: x64
-      additionalBuildArguments: /p:WindowsTerminalReleaseBuild=true
+      additionalBuildArguments: /p:WindowsTerminalOfficialBuild=true;WindowsTerminalBranding=Preview
 
   - template: ./templates/build-console-int.yml
     parameters:
       platform: x86
-      additionalBuildArguments: /p:WindowsTerminalReleaseBuild=true
+      additionalBuildArguments: /p:WindowsTerminalOfficialBuild=true;WindowsTerminalBranding=Preview
 
   - template: ./templates/build-console-int.yml
     parameters:
       platform: arm64
-      additionalBuildArguments: /p:WindowsTerminalReleaseBuild=true
+      additionalBuildArguments: /p:WindowsTerminalOfficialBuild=true;WindowsTerminalBranding=Preview
 
   - template: ./templates/check-formatting.yml
 

build/pipelines/templates/build-console-steps.yml

@@ -69,6 +69,14 @@ steps:
     arguments: -MatchPattern '*unit.test*.dll' -Platform '$(RationalizedBuildPlatform)' -Configuration '$(BuildConfiguration)'
   condition: and(succeeded(), or(eq(variables['BuildPlatform'], 'x64'), eq(variables['BuildPlatform'], 'x86')))
 
+- task: PowerShell@2
+  displayName: 'Run Local Tests'
+  inputs:
+    targetType: filePath
+    filePath: build\scripts\Run-Tests.ps1
+    arguments: -MatchPattern '*Local*.dll' -Platform '$(RationalizedBuildPlatform)' -Configuration '$(BuildConfiguration)' -SearchPath '.\$(RationalizedBuildPlatform)\$(BuildConfiguration)\TestHostApp'
+  condition: and(succeeded(), or(eq(variables['BuildPlatform'], 'x64'), eq(variables['BuildPlatform'], 'x86')))
+
 - task: PowerShell@2
   displayName: 'Run Feature Tests (x64 only)'
   inputs:

build/scripts/Generate-ThirdPartyNotices.ps1

@@ -0,0 +1,14 @@
+[CmdletBinding()]
+Param(
+    [Parameter(Position=0, Mandatory=$true)][string]$MarkdownNoticePath,
+    [Parameter(Position=1, Mandatory=$true)][string]$OutputPath
+)
+
+@"
+<html>
+  <head><title>Third-Party Notices</title></head>
+  <body>
+  $(ConvertFrom-Markdown $MarkdownNoticePath | Select -Expand Html)
+  </body>
+</html>
+"@ | Out-File -Encoding UTF-8 $OutputPath -Force

build/scripts/Run-Tests.ps1

@@ -2,10 +2,11 @@
 Param(
     [Parameter(Mandatory=$true, Position=0)][string]$MatchPattern,
     [Parameter(Mandatory=$true, Position=1)][string]$Platform,
-    [Parameter(Mandatory=$true, Position=2)][string]$Configuration
+    [Parameter(Mandatory=$true, Position=2)][string]$Configuration,
+    [Parameter(Mandatory=$false, Position=3)][string]$SearchPath=".\bin\$Platform\$Configuration"
 )
 
-$testdlls = Get-ChildItem -Path ".\bin\$Platform\$Configuration" -Recurse -Filter $MatchPattern
+$testdlls = Get-ChildItem -Path $SearchPath -Recurse -Filter $MatchPattern
 
 &".\bin\$Platform\$Configuration\te.exe" $testdlls.FullName
 

build/scripts/Test-WindowsTerminalPackage.ps1

@@ -68,6 +68,27 @@ Try {
         }
     }
 
+    $dependencies = $Manifest.Package.Dependencies.PackageDependency.Name
+    $depsHasVclibsDesktop = ("Microsoft.VCLibs.140.00.UWPDesktop" -in $dependencies) -or ("Microsoft.VCLibs.140.00.Debug.UWPDesktop" -in $dependencies)
+    $depsHasVcLibsAppX = ("Microsoft.VCLibs.140.00" -in $dependencies) -or ("Microsoft.VCLibs.140.00.Debug" -in $dependencies)
+    $filesHasVclibsDesktop = ($null -ne (Get-Item "$AppxPackageRootPath\vcruntime140.dll" -EA:Ignore)) -or ($null -ne (Get-Item "$AppxPackageRootPath\vcruntime140d.dll" -EA:Ignore))
+    $filesHasVclibsAppX = ($null -ne (Get-Item "$AppxPackageRootPath\vcruntime140_app.dll" -EA:Ignore)) -or ($null -ne (Get-Item "$AppxPackageRootPath\vcruntime140d_app.dll" -EA:Ignore))
+
+    If ($depsHasVclibsDesktop -Eq $filesHasVclibsDesktop) {
+        $eitherBoth = if ($depsHasVclibsDesktop) { "both" } else { "neither" }
+        $neitherNor = if ($depsHasVclibsDesktop) { "and" } else { "nor" }
+        Throw "Package has $eitherBoth Dependency $neitherNor Integrated Desktop VCLibs"
+    }
+
+    If ($depsHasVclibsAppx -Eq $filesHasVclibsAppx) {
+        if ($depsHasVclibsAppx) {
+            # We've shipped like this forever, so downgrade to warning.
+            Write-Warning "Package has both Dependency and Integrated AppX VCLibs"
+        } else {
+            Throw "Package has neither Dependency nor Integrated AppX VCLibs"
+        }
+    }
+
     ### Check that we have an App.xbf (which is a proxy for our resources having been merged)
     $resourceXpath = '/PriInfo/ResourceMap/ResourceMapSubtree[@name="Files"]/NamedResource[@name="App.xbf"]'
     $AppXbf = $PRIFile.SelectSingleNode($resourceXpath)

custom.props

@@ -4,8 +4,8 @@
   <PropertyGroup Label="Version">
     <XesUseOneStoreVersioning>true</XesUseOneStoreVersioning>
     <XesBaseYearForStoreVersion>2020</XesBaseYearForStoreVersion>
-    <VersionMajor>0</VersionMajor>
-    <VersionMinor>10</VersionMinor>
+    <VersionMajor>1</VersionMajor>
+    <VersionMinor>1</VersionMinor>
     <VersionInfoProductName>Windows Terminal</VersionInfoProductName>
   </PropertyGroup>
 </Project>

doc/building.md

@@ -57,3 +57,27 @@ Openconsole has three configuration types:
 - AuditMode
 
 AuditMode is an experimental mode that enables some additional static analysis from CppCoreCheck.
+
+## Updating Nuget package references
+Certain Nuget package references in this project, like `Microsoft.UI.Xaml`, must be updated outside of the Visual Studio NuGet package manager. This can be done using the snippet below.
+> Note that to run this snippet, you need to use WSL as the command uses `sed`.
+To update the version of a given package, use the following snippet
+
+`git grep -z -l $PackageName | xargs -0 sed -i -e 's/$OldVersionNumber/$NewVersionNumber/g'`
+
+where:
+- `$PackageName` is the name of the package, e.g. Microsoft.UI.Xaml
+- `$OldVersionNumber` is the version number currently used, e.g. 2.3.191217003-prerelease
+- `$NewVersionNumber` is the version number you want to migrate to, e.g. 2.4.200117003-prerelease
+
+Example usage:
+
+`git grep -z -l Microsoft.UI.Xaml | xargs -0 sed -i -e 's/2.3.191217003-prerelease/2.4.200117003-prerelease/g'`
+
+## Using .nupkg files instead of downloaded Nuget packages
+If you want to use .nupkg files instead of the downloaded Nuget package, you can do this with the following steps:
+
+1. Open the Nuget.config file and uncomment line 8 ("Static Package Dependencies")
+2. Create the folder /dep/packages
+3. Put your .nupkg files in /dep/packages
+4. If you are using different versions than those already being used, you need to update the references as well. How to do that is explained under "Updating Nuget package references".

doc/cascadia/SettingsSchema.md

@@ -1,4 +1,4 @@
-# Profiles.json Documentation
+# Settings.json Documentation
 
 ## Globals
 Properties listed below affect the entire window, regardless of the profile settings.
@@ -7,19 +7,23 @@ Properties listed below affect the entire window, regardless of the profile sett
 | -------- | --------- | ---- | ------- | ----------- |
 | `alwaysShowTabs` | _Required_ | Boolean | `true` | When set to `true`, tabs are always displayed. When set to `false` and `showTabsInTitlebar` is set to `false`, tabs only appear after typing <kbd>Ctrl</kbd> + <kbd>T</kbd>. |
 | `copyOnSelect` | Optional | Boolean | `false` | When set to `true`, a selection is immediately copied to your clipboard upon creation. When set to `false`, the selection persists and awaits further action. |
+| `copyFormatting` | Optional | Boolean | `false` | When set to `true`, the color and font formatting of selected text is also copied to your clipboard. When set to `false`, only plain text is copied to your clipboard. |
 | `defaultProfile` | _Required_ | String | PowerShell guid | Sets the default profile. Opens by typing <kbd>Ctrl</kbd> + <kbd>T</kbd> or by clicking the '+' icon. The guid of the desired default profile is used as the value. |
 | `initialCols` | _Required_ | Integer | `120` | The number of columns displayed in the window upon first load. |
 | `initialPosition` | Optional | String | `","` | The position of the top left corner of the window upon first load. On a system with multiple displays, these coordinates are relative to the top left of the primary display. If `launchMode` is set to `"maximized"`, the window will be maximized on the monitor specified by those coordinates. |
 | `initialRows` | _Required_ | Integer | `30` | The number of rows displayed in the window upon first load. |
 | `launchMode` | Optional | String | `default` | Defines whether the Terminal will launch as maximized or not. Possible values: `"default"`, `"maximized"` |
 | `rowsToScroll` | Optional | Integer | `system` | The number of rows to scroll at a time with the mouse wheel. This will override the system setting if the value is not zero or "system". |
-| `requestedTheme` | _Required_ | String | `system` | Sets the theme of the application. Possible values: `"light"`, `"dark"`, `"system"` |
+| `theme` | _Required_ | String | `system` | Sets the theme of the application. Possible values: `"light"`, `"dark"`, `"system"` |
 | `showTerminalTitleInTitlebar` | _Required_ | Boolean | `true` | When set to `true`, titlebar displays the title of the selected tab. When set to `false`, titlebar displays "Windows Terminal". |
 | `showTabsInTitlebar` | Optional | Boolean | `true` | When set to `true`, the tabs are moved into the titlebar and the titlebar disappears. When set to `false`, the titlebar sits above the tabs. |
 | `snapToGridOnResize` | Optional | Boolean | `false` | When set to `true`, the window will snap to the nearest character boundary on resize. When `false`, the window will resize "smoothly" |
 | `tabWidthMode` | Optional | String | `equal` | Sets the width of the tabs. Possible values: `"equal"`, `"titleLength"` |
 | `wordDelimiters` | Optional | String | <code>&nbsp;&#x2f;&#x5c;&#x28;&#x29;&#x22;&#x27;&#x2d;&#x3a;&#x2c;&#x2e;&#x3b;&#x3c;&#x3e;&#x7e;&#x21;&#x40;&#x23;&#x24;&#x25;&#x5e;&#x26;&#x2a;&#x7c;&#x2b;&#x3d;&#x5b;&#x5d;&#x7b;&#x7d;&#x7e;&#x3f;│</code><br>_(`│` is `U+2502 BOX DRAWINGS LIGHT VERTICAL`)_ | Determines the delimiters used in a double click selection. |
 | `confirmCloseAllTabs` | Optional | Boolean | `true` | When set to `true` closing a window with multiple tabs open WILL require confirmation.  When set to `false` closing a window with multiple tabs open WILL NOT require confirmation. |
+| `disabledProfileSources` | Optional | Array[String] | `[]` | Disables all the dynamic profile generators in this list, preventing them from adding their profiles to the list of profiles on startup. This array can contain any combination of `Windows.Terminal.Wsl`, `Windows.Terminal.Azure`, or `Windows.Terminal.PowershellCore`. For more information, see [UsingJsonSettings.md](https://github.com/microsoft/terminal/blob/master/doc/user-docs/UsingJsonSettings.md#dynamic-profiles) |
+| `experimental.rendering.forceFullRepaint` | Optional | Boolean | `false` | When set to true, we will redraw the entire screen each frame. When set to false, we will render only the updates to the screen between frames. |
+| `experimental.rendering.software` | Optional | Boolean | `false` | When set to true, we will use the software renderer (a.k.a. WARP) instead of the hardware one. |
 
 ## Profiles
 Properties listed below are specific to each unique profile.
@@ -37,24 +41,23 @@ Properties listed below are specific to each unique profile.
 | `backgroundImageStretchMode` | Optional | String | `uniformToFill` | Sets how the background image is resized to fill the window. Possible values: `"none"`, `"fill"`, `"uniform"`, `"uniformToFill"` |
 | `closeOnExit` | Optional | String | `graceful` | Sets how the profile reacts to termination or failure to launch. Possible values: `"graceful"` (close when `exit` is typed or the process exits normally), `"always"` (always close) and `"never"` (never close). `true` and `false` are accepted as synonyms for `"graceful"` and `"never"` respectively. |
 | `colorScheme` | Optional | String | `Campbell` | Name of the terminal color scheme to use. Color schemes are defined under `schemes`. |
-| `colorTable` | Optional | Array[String] | | Array of colors used in the profile if `colorscheme` is not set. Array follows the format defined in `schemes`. |
 | `commandline` | Optional | String | | Executable used in the profile. |
-| `cursorColor` | Optional | String | `#FFFFFF` | Sets the cursor color for the profile. Uses hex color format: `"#rrggbb"`. |
+| `cursorColor` | Optional | String | | Sets the cursor color of the profile. Overrides `cursorColor` set in color scheme if `colorscheme` is set. Uses hex color format: `"#rrggbb"`. |
 | `cursorHeight` | Optional | Integer | | Sets the percentage height of the cursor starting from the bottom. Only works when `cursorShape` is set to `"vintage"`. Accepts values from 25-100. |
 | `cursorShape` | Optional | String | `bar` | Sets the cursor shape for the profile. Possible values: `"vintage"` ( &#x2583; ), `"bar"` ( &#x2503; ), `"underscore"` ( &#x2581; ), `"filledBox"` ( &#x2588; ), `"emptyBox"` ( &#x25AF; ) |
-| `fontFace` | Optional | String | `Consolas` | Name of the font face used in the profile. We will try to fallback to Consolas if this can't be found or is invalid. |
+| `fontFace` | Optional | String | `Cascadia Mono` | Name of the font face used in the profile. We will try to fallback to Consolas if this can't be found or is invalid. |
 | `fontSize` | Optional | Integer | `12` | Sets the font size. |
 | `foreground` | Optional | String | | Sets the foreground color of the profile. Overrides `foreground` set in color scheme if `colorscheme` is set. Uses hex color format: `#rgb` or `"#rrggbb"`. |
 | `hidden` | Optional | Boolean | `false` | If set to true, the profile will not appear in the list of profiles. This can be used to hide default profiles and dynamically generated profiles, while leaving them in your settings file. |
 | `historySize` | Optional | Integer | `9001` | The number of lines above the ones displayed in the window you can scroll back to. |
 | `icon` | Optional | String | | Image file location of the icon used in the profile. Displays within the tab and the dropdown menu. |
 | `padding` | Optional | String | `8, 8, 8, 8` | Sets the padding around the text within the window. Can have three different formats: `"#"` sets the same padding for all sides, `"#, #"` sets the same padding for left-right and top-bottom, and `"#, #, #, #"` sets the padding individually for left, top, right, and bottom. |
-| `scrollbarState` | Optional | String | | Defines the visibility of the scrollbar. Possible values: `"visible"`, `"hidden"` |
+| `scrollbarState` | Optional | String | `"visible"` | Defines the visibility of the scrollbar. Possible values: `"visible"`, `"hidden"` |
 | `selectionBackground` | Optional | String | | Sets the selection background color of the profile. Overrides `selectionBackground` set in color scheme if `colorscheme` is set. Uses hex color format: `"#rrggbb"`. |
 | `snapOnInput` | Optional | Boolean | `true` | When set to `true`, the window will scroll to the command input line when typing. When set to `false`, the window will not scroll when you start typing. |
 | `source` | Optional | String | | Stores the name of the profile generator that originated this profile. _There are no discoverable values for this field._ |
 | `startingDirectory` | Optional | String | `%USERPROFILE%` | The directory the shell starts in when it is loaded. |
-| `suppressApplicationTitle` | Optional | Boolean | | When set to `true`, `tabTitle` overrides the default title of the tab and any title change messages from the application will be suppressed. When set to `false`, `tabTitle` behaves as normal. |
+| `suppressApplicationTitle` | Optional | Boolean | `false` | When set to `true`, `tabTitle` overrides the default title of the tab and any title change messages from the application will be suppressed. When set to `false`, `tabTitle` behaves as normal. |
 | `tabTitle` | Optional | String | | If set, will replace the `name` as the title to pass to the shell on startup. Some shells (like `bash`) may choose to ignore this initial value, while others (`cmd`, `powershell`) may use this value over the lifetime of the application.  |
 | `useAcrylic` | Optional | Boolean | `false` | When set to `true`, the window will have an acrylic background. When set to `false`, the window will have a plain, untextured background. The transparency only applies to focused windows due to OS limitation. |
 | `experimental.retroTerminalEffect` | Optional | Boolean | `false` | When set to `true`, enable retro terminal effects. This is an experimental feature, and its continued existence is not guaranteed. |
@@ -68,6 +71,7 @@ Properties listed below are specific to each color scheme. [ColorTool](https://g
 | `foreground` | _Required_ | String | Sets the foreground color of the color scheme. |
 | `background` | _Required_ | String | Sets the background color of the color scheme. |
 | `selectionBackground` | Optional | String | Sets the selection background color of the color scheme. |
+| `cursorColor` | Optional | String | Sets the cursor color of the color scheme. |
 | `black` | _Required_ | String | Sets the color used as ANSI black. |
 | `blue` | _Required_ | String | Sets the color used as ANSI blue. |
 | `brightBlack` | _Required_ | String | Sets the color used as ANSI bright black. |
@@ -91,7 +95,7 @@ Properties listed below are specific to each custom key binding.
 | Property | Necessity | Type | Description |
 | -------- | ---- | ----------- | ----------- |
 | `command` | _Required_ | String | The command executed when the associated key bindings are pressed. |
-| `keys` | _Required_ | Array[String] | Defines the key combinations used to call the command. |
+| `keys` | _Required_ | Array[String] or String | Defines the key combinations used to call the command. |
 | `action` | Optional | String | Adds additional functionality to certain commands. |
 
 ### Implemented Commands and Actions
@@ -110,14 +114,13 @@ For commands with arguments:
 
 | Command | Command Description | Action (*=required) | Action Arguments | Argument Descriptions |
 | ------- | ------------------- | ------ | ---------------- | ----------------- |
+| `adjustFontSize` | Change the text size by a specified point amount. | `delta` | integer | Amount of size change per command invocation. |
 | `closePane` | Close the active pane. | | | |
 | `closeTab` | Close the current tab. | | | |
 | `closeWindow` | Close the current window and all tabs within it. | | | |
-| `copy` | Copy the selected terminal content to your Windows Clipboard. | `trimWhitespace` | boolean | When `true`, newlines persist from the selected text. When `false`, copied content will paste on one line. |
-| `decreaseFontSize` | Make the text smaller by one delta. | `delta` | integer | Amount of size decrease per command invocation. |
+| `copy` | Copy the selected terminal content to your Windows Clipboard. | `singleLine` | boolean | When `true`, the copied content will be copied as a single line. When `false`, newlines persist from the selected text. |
 | `duplicateTab` | Make a copy and open the current tab. | | | |
 | `find` | Open the search dialog box. | | | |
-| `increaseFontSize` | Make the text larger by one delta. | `delta` | integer | Amount of size increase per command invocation. |
 | `moveFocus` | Focus on a different pane depending on direction. | `direction`* | `left`, `right`, `up`, `down` | Direction in which the focus will move. |
 | `newTab` | Create a new tab. Without any arguments, this will open the default profile in a new tab. | 1. `commandLine`<br>2. `startingDirectory`<br>3. `tabTitle`<br>4. `index`<br>5. `profile` | 1. string<br>2. string<br>3. string<br>4. integer<br>5. string | 1. Executable run within the tab.<br>2. Directory in which the tab will open.<br>3. Title of the new tab.<br>4. Profile that will open based on its position in the dropdown (starting at 0).<br>5. Profile that will open based on its GUID or name. |
 | `nextTab` | Open the tab to the right of the current one. | | | |
@@ -131,7 +134,7 @@ For commands with arguments:
 | `scrollUp` | Move the screen up. | | | |
 | `scrollUpPage` | Move the screen up a whole page. | | | |
 | `scrollDownPage` | Move the screen down a whole page. | | | |
-| `splitPane` | Halve the size of the active pane and open another. Without any arguments, this will open the default profile in the new pane. | 1. `split`*<br>2. `commandLine`<br>3. `startingDirectory`<br>4. `tabTitle`<br>5. `index`<br>6. `profile` | 1. `vertical`, `horizontal`, `auto`<br>2. string<br>3. string<br>4. string<br>5. integer<br>6. string | 1. How the pane will split. `auto` will split in the direction that provides the most surface area.<br>2. Executable run within the pane.<br>3. Directory in which the pane will open.<br>4. Title of the tab when the new pane is focused.<br>5. Profile that will open based on its position in the dropdown (starting at 0).<br>6. Profile that will open based on its GUID or name. |
+| `splitPane` | Halve the size of the active pane and open another. Without any arguments, this will open the default profile in the new pane. | 1. `split`*<br>2. `commandLine`<br>3. `startingDirectory`<br>4. `tabTitle`<br>5. `index`<br>6. `profile`<br>7. `splitMode` | 1. `vertical`, `horizontal`, `auto`<br>2. string<br>3. string<br>4. string<br>5. integer<br>6. string<br>7. string | 1. How the pane will split. `auto` will split in the direction that provides the most surface area.<br>2. Executable run within the pane.<br>3. Directory in which the pane will open.<br>4. Title of the tab when the new pane is focused.<br>5. Profile that will open based on its position in the dropdown (starting at 0).<br>6. Profile that will open based on its GUID or name.<br>7. Controls how the pane splits. Only accepts `duplicate` which will duplicate the focused pane's profile into a new pane. |
 | `switchToTab` | Open a specific tab depending on index. | `index`* | integer | Tab that will open based on its position in the tab bar (starting at 0). |
 | `toggleFullscreen` | Switch between fullscreen and default window sizes. | | | |
 | `unbound` | Unbind the associated keys from any command. | | | |
@@ -139,7 +142,7 @@ For commands with arguments:
 ### Accepted Modifiers and Keys
 
 #### Modifiers
-`Ctrl+`, `Shift+`, `Alt+`
+`ctrl+`, `shift+`, `alt+`
 
 #### Keys
 | Type | Keys |

doc/cascadia/profiles.schema.json

@@ -1,11 +1,12 @@
 {
   "$id": "https://github.com/microsoft/terminal/blob/master/doc/cascadia/profiles.schema.json",
   "$schema": "http://json-schema.org/draft-07/schema#",
-  "title": "Microsoft's Windows Terminal Settings Profile Schema'",
+  "title": "Microsoft's Windows Terminal Settings Profile Schema",
   "definitions": {
     "KeyChordSegment": {
-      "pattern": "^(?<modifier>(ctrl|alt|shift)\\+?((ctrl|alt|shift)(?<!\\2)\\+?)?((ctrl|alt|shift)(?<!\\2|\\4))?\\+?)?(?<key>[^+\\s]+?)?(?<=[^+\\s])$",
-      "type": "string"
+      "pattern": "^(?<modifier>(ctrl|alt|shift)(?:\\+(ctrl|alt|shift)(?<!\\2))?(?:\\+(ctrl|alt|shift)(?<!\\2|\\3))?\\+)?(?<key>[^\\s+]|backspace|tab|enter|esc|escape|space|pgup|pageup|pgdn|pagedown|end|home|left|up|right|down|insert|delete|(?<!shift.+)(?:numpad_?[0-9]|numpad_(?:period|decimal))|numpad_(?:multiply|plus|add|minus|subtract|divide)|f[1-9]|f1[0-9]|f2[0-4]|plus)$",
+      "type": "string",
+      "description": "The string should fit the format \"[ctrl+][alt+][shift+]<keyName>\", where each modifier is optional, separated by + symbols, and keyName is either one of the names listed in the table below, or any single key character. The string should be written in full lowercase.\nbackspace\tBACKSPACE key\ntab\tTAB key\nenter\tENTER key\nesc, escape\tESC key\nspace\tSPACEBAR\npgup, pageup\tPAGE UP key\npgdn, pagedown\tPAGE DOWN key\nend\tEND key\nhome\tHOME key\nleft\tLEFT ARROW key\nup\tUP ARROW key\nright\tRIGHT ARROW key\ndown\tDOWN ARROW key\ninsert\tINS key\ndelete\tDEL key\nnumpad_0-numpad_9, numpad0-numpad9\tNumeric keypad keys 0 to 9. Can't be combined with the shift modifier.\nnumpad_multiply\tNumeric keypad MULTIPLY key (*)\nnumpad_plus, numpad_add\tNumeric keypad ADD key (+)\nnumpad_minus, numpad_subtract\tNumeric keypad SUBTRACT key (-)\nnumpad_period, numpad_decimal\tNumeric keypad DECIMAL key (.). Can't be combined with the shift modifier.\nnumpad_divide\tNumeric keypad DIVIDE key (/)\nf1-f24\tF1 to F24 function keys\nplus\tADD key (+)"
     },
     "Color": {
       "default": "#",
@@ -17,6 +18,14 @@
       "pattern": "^(-?\\d+)?(,\\s?(-?\\d+)?)?$",
       "type": "string"
     },
+    "DynamicProfileSource": {
+      "enum": [
+        "Windows.Terminal.Wsl",
+        "Windows.Terminal.Azure",
+        "Windows.Terminal.PowershellCore"
+      ],
+      "type": "string"
+    },
     "ProfileGuid": {
       "default": "{}",
       "pattern": "^\\{[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}\\}$",
@@ -24,29 +33,14 @@
     },
     "ShortcutActionName": {
       "enum": [
+        "adjustFontSize",
         "closePane",
         "closeTab",
         "closeWindow",
         "copy",
-        "copyTextWithoutNewlines",
-        "decreaseFontSize",
         "duplicateTab",
-        "increaseFontSize",
         "moveFocus",
-        "moveFocusDown",
-        "moveFocusLeft",
-        "moveFocusRight",
-        "moveFocusUp",
         "newTab",
-        "newTabProfile0",
-        "newTabProfile1",
-        "newTabProfile2",
-        "newTabProfile3",
-        "newTabProfile4",
-        "newTabProfile5",
-        "newTabProfile6",
-        "newTabProfile7",
-        "newTabProfile8",
         "nextTab",
         "openNewTabDropdown",
         "openSettings",
@@ -54,29 +48,15 @@
         "prevTab",
         "resetFontSize",
         "resizePane",
-        "resizePaneDown",
-        "resizePaneLeft",
-        "resizePaneRight",
-        "resizePaneUp",
         "scrollDown",
         "scrollDownPage",
         "scrollUp",
         "scrollUpPage",
-        "splitHorizontal",
-        "splitVertical",
         "splitPane",
         "switchToTab",
-        "switchToTab0",
-        "switchToTab1",
-        "switchToTab2",
-        "switchToTab3",
-        "switchToTab4",
-        "switchToTab5",
-        "switchToTab6",
-        "switchToTab7",
-        "switchToTab8",
         "toggleFullscreen",
-        "find"
+        "find",
+        "unbound"
       ],
       "type": "string"
     },
@@ -117,7 +97,7 @@
         },
         "index": {
           "type": "integer",
-          "description": "The index of the profile in the new tab dropdown to open"
+          "description": "The index of the profile in the new tab dropdown (starting at 0)"
         }
       },
       "type": "object"
@@ -134,6 +114,23 @@
       ],
       "type": "object"
     },
+    "AdjustFontSizeAction": {
+      "description": "Arguments corresponding to an Adjust Font Size Action",
+      "allOf": [
+        { "$ref": "#/definitions/ShortcutAction" },
+        {
+          "properties": {
+            "action": { "type": "string", "pattern": "adjustFontSize" },
+            "delta": {
+              "type": "integer",
+              "default": 0,
+              "description": "How much to change the current font point size"
+            }
+          }
+        }
+      ],
+      "required": [ "delta" ]
+    },
     "CopyAction": {
       "description": "Arguments corresponding to a Copy Text Action",
       "allOf": [
@@ -141,10 +138,10 @@
         {
           "properties": {
             "action": { "type": "string", "pattern": "copy" },
-            "trimWhitespace": {
+            "singleLine": {
               "type": "boolean",
-              "default": true,
-              "description": "If true, whitespace is removed and newlines are maintained. If false, newlines are removed and whitespace is maintained."
+              "default": false,
+              "description": "If true, the copied content will be copied as a single line (even if there are hard line breaks present in the text). If false, newlines persist from the selected text."
             }
           }
         }
@@ -224,12 +221,15 @@
             "split": {
               "$ref": "#/definitions/SplitState",
               "default": "auto",
-              "description": "The orientation to split the pane in, either vertical (think [|]), horizontal (think [-]), or auto (splits pane based on remaining space)"
+              "description": "The orientation to split the pane in. Possible values:\n -\"auto\" (splits pane based on remaining space)\n -\"horizontal\" (think [-])\n -\"vertical\" (think [|])"
+            },
+            "splitMode": {
+              "default": "duplicate",
+              "description": "Control how the pane splits. Only accepts \"duplicate\" which will duplicate the focused pane's profile into a new pane."
             }
           }
         }
-      ],
-      "required": [ "split" ]
+      ]
     },
     "Keybinding": {
       "additionalProperties": false,
@@ -237,17 +237,19 @@
         "command": {
           "description": "The action executed when the associated key bindings are pressed.",
             "oneOf": [
+              { "$ref": "#/definitions/AdjustFontSizeAction" },
               { "$ref": "#/definitions/CopyAction" },
               { "$ref": "#/definitions/ShortcutActionName" },
               { "$ref": "#/definitions/NewTabAction" },
               { "$ref": "#/definitions/SwitchToTabAction" },
               { "$ref": "#/definitions/MoveFocusAction" },
               { "$ref": "#/definitions/ResizePaneAction" },
-              { "$ref": "#/definitions/SplitPaneAction" }
+              { "$ref": "#/definitions/SplitPaneAction" },
+              { "type": "null" }
             ]
         },
         "keys": {
-          "description": "Defines the key combinations used to call the command.",
+          "description": "Defines the key combinations used to call the command. It must be composed of...\n -any number of modifiers (ctrl/alt/shift)\n -a non-modifier key",
           "oneOf": [
             {
               "$ref": "#/definitions/KeyChordSegment"
@@ -274,7 +276,7 @@
       "properties": {
         "alwaysShowTabs": {
           "default": true,
-          "description": "When set to true, tabs are always displayed. When set to false and showTabsInTitlebar is set to false, tabs only appear after opening a new tab.",
+          "description": "When set to true, tabs are always displayed. When set to false and \"showTabsInTitlebar\" is set to false, tabs only appear after opening a new tab.",
           "type": "boolean"
         },
         "copyOnSelect": {
@@ -282,9 +284,29 @@
           "description": "When set to true, a selection is immediately copied to your clipboard upon creation. When set to false, the selection persists and awaits further action.",
           "type": "boolean"
         },
+        "copyFormatting": {
+          "default": true,
+          "description": "When set to `true`, the color and font formatting of selected text is also copied to your clipboard. When set to `false`, only plain text is copied to your clipboard.",
+          "type": "boolean"
+        },
         "defaultProfile": {
           "$ref": "#/definitions/ProfileGuid",
-          "description": "Sets the default profile. Opens by clicking the '+' icon or typing the key binding assigned to 'newTab'. The guid of the desired default profile is used as the value."
+          "description": "Sets the default profile. Opens by clicking the \"+\" icon or typing the key binding assigned to \"newTab\". The \"guid\" of the desired default profile is used as the value."
+        },
+        "disabledProfileSources": {
+          "description": "Disables all the dynamic profile generators in this list, preventing them from adding their profiles to the list of profiles on startup.",
+          "items": {
+            "$ref": "#/definitions/DynamicProfileSource"
+          },
+          "type": "array"
+        },
+        "experimental.rendering.forceFullRepaint": {
+          "description": "When set to true, we will redraw the entire screen each frame. When set to false, we will render only the updates to the screen between frames.",
+          "type": "boolean"
+        },
+        "experimental.rendering.software": {
+          "description": "When set to true, we will use the software renderer (a.k.a. WARP) instead of the hardware one.",
+          "type": "boolean"
         },
         "initialCols": {
           "default": 120,
@@ -295,7 +317,7 @@
         },
         "initialPosition": {
           "$ref": "#/definitions/Coordinates",
-          "description": "The position of the top left corner of the window upon first load. On a system with multiple displays, these coordinates are relative to the top left of the primary display. If launchMode is set to maximized, the window will be maximized on the monitor specified by those coordinates."
+          "description": "The position of the top left corner of the window upon first load. On a system with multiple displays, these coordinates are relative to the top left of the primary display. If \"launchMode\" is set to maximized, the window will be maximized on the monitor specified by those coordinates."
         },
         "initialRows": {
           "default": 30,
@@ -315,10 +337,10 @@
         },
         "rowsToScroll": {
           "default": "system",
-          "description": "The number of rows to scroll at a time with the mouse wheel. This will override the system setting if the value is not zero or 'system'.",
+          "description": "The number of rows to scroll at a time with the mouse wheel. This will override the system setting if the value is not zero or \"system\".",
           "maximum": 999,
           "minimum": 0,
-          "type": ["integer", "string"]
+          "type": [ "integer", "string" ]
         },
         "keybindings": {
           "description": "Properties are specific to each custom key binding.",
@@ -327,9 +349,9 @@
           },
           "type": "array"
         },
-        "requestedTheme": {
+        "theme": {
           "default": "system",
-          "description": "Sets the theme of the application.",
+          "description": "Sets the theme of the application. The special value \"system\" refers to the active Windows system theme.",
           "enum": [
             "light",
             "dark",
@@ -344,17 +366,17 @@
         },
         "showTerminalTitleInTitlebar": {
           "default": true,
-          "description": "When set to true, titlebar displays the title of the selected tab. When set to false, titlebar displays 'Windows Terminal'.",
+          "description": "When set to true, titlebar displays the title of the selected tab. When set to false, titlebar displays \"Windows Terminal\".",
           "type": "boolean"
         },
         "snapToGridOnResize": {
           "default": false,
-          "description": "When set to true, the window will snap to the nearest character boundary on resize. When false, the window will resize 'smoothly'",
+          "description": "When set to true, the window will snap to the nearest character boundary on resize. When false, the window will resize smoothly",
           "type": "boolean"
         },
         "tabWidthMode": {
           "default": "equal",
-          "description": "Sets the width of the tabs.",
+          "description": "Sets the width of the tabs. Possible values include:\n -\"equal\" sizes each tab to the same width\n -\"titleLength\" sizes each tab to the length of its title",
           "enum": [
             "equal",
             "titleLength"
@@ -368,8 +390,8 @@
         },
         "confirmCloseAllTabs": {
           "default": true,
-          "description": " When set to `true` closing a window with multiple tabs open WILL require confirmation.  When set to `false` closing a window with multiple tabs open WILL NOT require confirmation.",
-          "type":"boolean"
+          "description": "When set to \"true\" closing a window with multiple tabs open will require confirmation.  When set to \"false\", the confirmation dialog will not appear.",
+          "type": "boolean"
         }
       },
       "required": [
@@ -401,12 +423,12 @@
         "background": {
           "$ref": "#/definitions/Color",
           "default": "#0c0c0c",
-          "description": "Sets the background color of the profile. Overrides background set in color scheme if colorscheme is set. Uses hex color format: \"#rrggbb\".",
+          "description": "Sets the background color of the text. Overrides \"background\" from the color scheme. Uses hex color format: \"#rrggbb\".",
           "type": ["string", "null"]
         },
         "backgroundImage": {
-          "description": "Sets the file location of the Image to draw over the window background.",
-          "type": "string"
+          "description": "Sets the file location of the image to draw over the window background.",
+          "type": ["string", "null"]
         },
         "backgroundImageAlignment": {
           "default": "center",
@@ -421,12 +443,14 @@
             "topLeft",
             "topRight"
           ],
+          "description": "Sets how the background image aligns to the boundaries of the window. Possible values: \"center\", \"left\", \"top\", \"right\", \"bottom\", \"topLeft\", \"topRight\", \"bottomLeft\", \"bottomRight\"",
           "type": "string"
         },
         "backgroundImageOpacity": {
-          "description": "(Not in SettingsSchema.md)",
-          "maximum": 1,
-          "minimum": 0,
+          "default": 1.0,
+          "description": "Sets the transparency of the background image. Accepts floating point values from 0-1.",
+          "maximum": 1.0,
+          "minimum": 0.0,
           "type": "number"
         },
         "backgroundImageStretchMode": {
@@ -442,7 +466,7 @@
         },
         "closeOnExit": {
           "default": "graceful",
-          "description": "Sets how the profile reacts to termination or failure to launch. Possible values: \"graceful\" (close when exit is typed or the process exits normally), \"always\" (always close) and \"never\" (never close). true and false are accepted as synonyms for \"graceful\" and \"never\" respectively.",
+          "description": "Sets how the profile reacts to termination or failure to launch. Possible values:\n -\"graceful\" (close when exit is typed or the process exits normally)\n -\"always\" (always close)\n -\"never\" (never close).\ntrue and false are accepted as synonyms for \"graceful\" and \"never\" respectively.",
           "oneOf": [
             {
               "enum": [
@@ -462,110 +486,27 @@
           "description": "Name of the terminal color scheme to use. Color schemes are defined under \"schemes\".",
           "type": "string"
         },
-        "colorTable": {
-          "description": "Array of colors used in the profile if colorscheme is not set. Colors use hex color format: \"#rrggbb\". Ordering is as follows: [black, red, green, yellow, blue, magenta, cyan, white, bright black, bright red, bright green, bright yellow, bright blue, bright magenta, bright cyan, bright white]",
-          "items": {
-            "additionalProperties": false,
-            "properties": {
-              "background": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the background color of the color table."
-              },
-              "black": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI black."
-              },
-              "blue": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI blue."
-              },
-              "brightBlack": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright black."
-              },
-              "brightBlue": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright blue."
-              },
-              "brightCyan": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright cyan."
-              },
-              "brightGreen": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright green."
-              },
-              "brightPurple": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright purple."
-              },
-              "brightRed": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright red."
-              },
-              "brightWhite": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright white."
-              },
-              "brightYellow": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI bright yellow."
-              },
-              "cyan": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI cyan."
-              },
-              "foreground": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the foreground color of the color table."
-              },
-              "green": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI green."
-              },
-              "purple": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI purple."
-              },
-              "red": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI red."
-              },
-              "white": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI white."
-              },
-              "yellow": {
-                "$ref": "#/definitions/Color",
-                "description": "Sets the color used as ANSI yellow."
-              }
-            },
-            "type": "object"
-          },
-          "type": "array"
-        },
         "commandline": {
           "description": "Executable used in the profile.",
           "type": "string"
         },
-        "connectionType": {
-          "$ref": "#/definitions/ProfileGuid",
-          "description": "A GUID reference to a connection type. Currently undocumented as of 0.3, this is used for Azure Cloud Shell"
-        },
         "cursorColor": {
-          "$ref": "#/definitions/Color",
-          "default": "#FFFFFF",
-          "description": "Sets the cursor color for the profile. Uses hex color format: \"#rrggbb\"."
+          "oneOf": [
+            { "$ref": "#/definitions/Color" },
+            {"type": "null"}
+          ],
+          "description": "Sets the color of the cursor. Overrides the cursor color from the color scheme. Uses hex color format: \"#rrggbb\"."
         },
         "cursorHeight": {
           "description": "Sets the percentage height of the cursor starting from the bottom. Only works when cursorShape is set to \"vintage\". Accepts values from 25-100.",
           "maximum": 100,
           "minimum": 25,
-          "type": "integer"
+          "type": ["integer","null"],
+          "default": 25
         },
         "cursorShape": {
           "default": "bar",
-          "description": "Sets the cursor shape for the profile. Possible values: \"vintage\" ( ▃ ), \"bar\" ( ┃, default ), \"underscore\" ( ▁ ), \"filledBox\" ( █ ), \"emptyBox\" ( ▯ )",
+          "description": "Sets the shape of the cursor. Possible values:\n -\"bar\" ( ┃, default )\n -\"emptyBox\" ( ▯ )\n -\"filledBox\" ( █ )\n -\"underscore\" ( ▁ )\n -\"vintage\" ( ▃ )",
           "enum": [
             "bar",
             "emptyBox",
@@ -580,20 +521,20 @@
           "type": "boolean"
         },
         "fontFace": {
-          "default": "Consolas",
+          "default": "Cascadia Mono",
           "description": "Name of the font face used in the profile.",
           "type": "string"
         },
         "fontSize": {
           "default": 12,
-          "description": "Sets the font size.",
+          "description": "Size of the font in points.",
           "minimum": 1,
           "type": "integer"
         },
         "foreground": {
           "$ref": "#/definitions/Color",
           "default": "#cccccc",
-          "description": "Sets the foreground color of the profile. Overrides foreground set in color scheme if colorscheme is set. Uses hex color format: \"#rrggbb\".",
+          "description": "Sets the text color. Overrides \"foreground\" from the color scheme. Uses hex color format: \"#rrggbb\".",
           "type": ["string", "null"]
         },
         "guid": {
@@ -613,7 +554,7 @@
         },
         "icon": {
           "description": "Image file location of the icon used in the profile. Displays within the tab and the dropdown menu.",
-          "type": "string"
+          "type": ["string", "null"]
         },
         "name": {
           "description": "Name of the profile. Displays in the dropdown menu.",
@@ -622,7 +563,7 @@
         },
         "padding": {
           "default": "8, 8, 8, 8",
-          "description": "Sets the padding around the text within the window. Can have three different formats: \"#\" sets the same padding for all sides, \"#, #\" sets the same padding for left-right and top-bottom, and \"#, #, #, #\" sets the padding individually for left, top, right, and bottom.",
+          "description": "Sets the padding around the text within the window. Can have three different formats:\n -\"#\" sets the same padding for all sides \n -\"#, #\" sets the same padding for left-right and top-bottom\n -\"#, #, #, #\" sets the padding individually for left, top, right, and bottom.",
           "pattern": "^-?[0-9]+(\\.[0-9]+)?( *, *-?[0-9]+(\\.[0-9]+)?|( *, *-?[0-9]+(\\.[0-9]+)?){3})?$",
           "type": "string"
         },
@@ -636,8 +577,11 @@
           "type": "string"
         },
         "selectionBackground": {
-          "$ref": "#/definitions/Color",
-          "description": "Sets the selection background color of the profile. Overrides selection background set in color scheme if colorscheme is set. Uses hex color format: \"#rrggbb\"."
+          "oneOf": [
+            {"$ref": "#/definitions/Color"},
+            { "type": "null" }
+          ],
+          "description": "Sets the background color of selected text. Overrides selectionBackground set in the color scheme. Uses hex color format: \"#rrggbb\"."
         },
         "snapOnInput": {
           "default": true,
@@ -646,7 +590,7 @@
         },
         "source": {
           "description": "Stores the name of the profile generator that originated this profile.",
-          "type": "string"
+          "type": ["string", "null"]
         },
         "startingDirectory": {
           "description": "The directory the shell starts in when it is loaded.",
@@ -654,11 +598,12 @@
         },
         "suppressApplicationTitle": {
           "description": "When set to true, tabTitle overrides the default title of the tab and any title change messages from the application will be suppressed. When set to false, tabTitle behaves as normal.",
-          "type": "boolean"
+          "type": "boolean",
+          "default": false
         },
         "tabTitle": {
           "description": "If set, will replace the name as the title to pass to the shell on startup. Some shells (like bash) may choose to ignore this initial value, while others (cmd, powershell) may use this value over the lifetime of the application.",
-          "type": "string"
+          "type": ["string", "null"]
         },
         "useAcrylic": {
           "default": false,
@@ -746,6 +691,11 @@
             "$ref": "#/definitions/Color",
             "description": "Sets the color used as ANSI bright yellow."
           },
+          "cursorColor": {
+            "$ref": "#/definitions/Color",
+            "default": "#FFFFFF",
+            "description": "Sets the cursor color of the color scheme."
+          },
           "cyan": {
             "$ref": "#/definitions/Color",
             "description": "Sets the color used as ANSI cyan."
@@ -784,37 +734,15 @@
       "type": "array"
     }
   },
-  "oneOf": [
+  "allOf": [
+    { "$ref": "#/definitions/Globals" },
     {
-      "allOf": [
-        { "$ref": "#/definitions/Globals" },
-        {
-          "additionalItems": true,
-          "properties": {
-            "profiles": {
-              "oneOf": [
-              { "$ref": "#/definitions/ProfileList" },
-              { "$ref": "#/definitions/ProfilesObject" }
-              ]
-            },
-            "schemes": { "$ref": "#/definitions/SchemeList" }
-          },
-          "required": [
-            "profiles",
-            "schemes",
-            "defaultProfile"
-          ]
-        }
-      ]
-    },
-    {
-      "additionalItems": false,
+      "additionalItems": true,
       "properties": {
-        "globals": { "$ref": "#/definitions/Globals" },
         "profiles": {
           "oneOf": [
-          { "$ref": "#/definitions/ProfileList" },
-          { "$ref": "#/definitions/ProfilesObject" }
+            { "$ref": "#/definitions/ProfileList" },
+            { "$ref": "#/definitions/ProfilesObject" }
           ]
         },
         "schemes": { "$ref": "#/definitions/SchemeList" }
@@ -822,7 +750,7 @@
       "required": [
         "profiles",
         "schemes",
-        "globals"
+        "defaultProfile"
       ]
     }
   ]

doc/specs/#4191 - Formatted Copy/spec.md

@@ -0,0 +1,88 @@
+---
+author: Kayla Cinnamon @cinnamon-msft
+created on: 2020-04-01
+last updated: 2020-04-07
+issue id: #4191
+---
+
+# Formatted Copy
+
+## Abstract
+
+When copying text, the Terminal should provide the option of including formatting. Not all apps that receive text allow for picking which format you want when pasting. The default should be to only copy plain text, based on the response from this poll on Twitter.
+
+![Twitter poll](twitter-poll.png)
+
+## Solution Proposals
+
+A proposal for the right click behavior as well as two user settings proposals are described below. The conclusion the team arrived at is at the bottom under the [Conclusions section](#conclusions).
+
+1. [Settings option 1 - global setting](#settings-option-1---global-setting)
+2. [Settings option 2 - key binding argument](#settings-option-2---key-binding-argument)
+3. [Right click behavior](#right-click-behavior)
+
+### Settings option 1 - global setting
+
+We could have a global setting that when enabled, would copy formatting to the clipboard on all copy operations.
+
+### Settings option 2 - key binding argument
+
+We could add an argument to the `copy` key binding argument to allow for formatted copying when the user chooses to do so.
+
+### Right click behavior
+
+By default, right clicking to copy would only copy the plain text.
+
+## UI/UX Design
+
+### Settings option 1 - global setting
+
+a. The user could list which kinds of formats they want included when they copy. When right clicking, they would copy with these formats.
+
+`"copyFormats": ["html","rtf","plain"]`
+
+b. We could also just combine html and rtf into a single boolean. Users would either get plain text only (`false`) or all formatting (`true`) onto their clipboard. If this is set to `true`, the default right click behavior is reversed: right clicking copies the formatting.
+
+`"copyFormatting": true`
+
+### Settings option 2 - key binding argument
+
+a. Just like the `trimWhitespace` argument you can add to the `copy` key binding, we could add one for text formatting. This would not change the right click behavior.
+
+`{"command": {"action": "copy", "keepFormatting": true}, "keys": "ctrl+a"}`
+
+b. We could also split out the html and rtf formats. The right click behavior would still stay as default.
+
+`{"command": {"action": "copy", "formats": ["html","rtf","plain"]}, "keys": "ctrl+a"}`
+
+## Capabilities
+
+### Accessibility
+
+This shouldn't affect accessibility.
+
+### Security
+
+This does not affect security.
+
+### Reliability
+
+This does not affect reliability.
+
+### Compatibility
+
+This breaks the existing behavior of always copying the formatting. The justification for breaking this default behavior is in response to the community saying the default should be plain text only.
+
+### Performance, Power, and Efficiency
+
+## Potential Issues
+
+One possible issue is that discovering how to copy the formatting might be difficult to find. We could mitigate this by adding it into the settings.json file and commenting it out.
+
+## Conclusions
+
+The team has decided to have plain text as the default copy behavior and to enable formatted copying with a global setting that accepts a boolean value (settings option 1 - global setting, option b). In the future, we can modify this setting to also accept an array, so the user can specify which formats they would like to copy. Additionally, a key binding can be added to allow for greater flexibility.
+
+## Future considerations
+
+We could always add an additional option if people want more flexibility. For example, if we ship a global setting now, we could ship a key binding later that lets you choose how you want to copy, and vice versa. Additionally, we can add functionality to the global setting that allows for specific formats or styles to be copied.

doc/specs/#605 - Search/spec.md

@@ -30,7 +30,7 @@ Conhost already has a module for search. It implements case sensitive or insensi
 
 We will create a `SearchBoxControl` Xaml `UserControl` element. When a search process begins, a `SearchBoxControl` object will be created and attached to `TermControl` root grid. In other words, one SearchBox is added for each `TermControl`. The reasons for this design is:
 
-1. Each `TermControl` object is a Terminal Window and has a individual text buffer. In phase 1 we are going to search witin the current terminal text buffer. 
+1. Each `TermControl` object is a Terminal Window and has a individual text buffer. In phase 1 we are going to search within the current terminal text buffer. 
 2. If we put the search box under TerminalApp, then the search can only happen on the current focused Terminal. 
 3. If the community does not like the current design, we can lift SearchBox to a higher level. 
 

doc/specs/#607 - Commandline Arguments for the Windows Terminal.md

@@ -92,7 +92,7 @@ would quickly become hard to parse and understand for the user.
 
 ### Proposal 2 - Commands and Parameters
 
-Instead, we'll try to seperate these arguments by their responsibilities. Some
+Instead, we'll try to separate these arguments by their responsibilities. Some
 of these arguments cause something to happen, like `help`, `version`, or
 `open-settings`. Other arguments act more like modifiers, like for example
 `--profile` or `--startingDirectory`, which provide additional information to
@@ -275,7 +275,7 @@ terminal window.
 `list-profiles [--all,-A] [--showGuids,-g]`
 
 Displays a list of each of the available profiles. Each profile displays it's
-name, seperated by newlines.
+name, separated by newlines.
 
 **Parameters**:
 * `--all,-A`: Show all profiles, including profiles marked `"hidden": true`.
@@ -323,7 +323,7 @@ vertically or horizontally.
 **Parameters**:
 * `--target,-t target-pane`: Creates a new split in the given `target-pane`.
   Each pane has a unique index (per-tab) which can be used to identify them.
-  These indicies are assigned in the order the panes were created. If omitted,
+  These indices are assigned in the order the panes were created. If omitted,
   defaults to the index of the currently focused pane.
 * `-H`, `-V`: Used to indicate which direction to split the pane. `-V` is
   "vertically" (think `[|]`), and `-H` is "horizontally" (think `[-]`). If
@@ -355,7 +355,7 @@ Moves focus within the currently focused tab to a given pane.
 
 * `--target,-t target-pane`: moves focus to the given `target-pane`. Each pane
   has a unique index (per-tab) which can be used to identify them. These
-  indicies are assigned in the order the panes were created. If omitted,
+  indices are assigned in the order the panes were created. If omitted,
   defaults to the index of the currently focused pane (which is effectively a
   no-op).
 
@@ -410,7 +410,7 @@ like `guid` and `name`, as well as high priority properties to add as arguments.
 Following an investigation performed the week of Nov 18th, 2019, I've determined
 that we should be able to use the [CLI11] open-source library to parse
 our arguments. We'll need to add some additional logic on top of CLI11 in order
-to properly seperate commands with `;`, but that's not impossible to achieve.
+to properly separate commands with `;`, but that's not impossible to achieve.
 
 CLI11 will allow us to parse commandlines as a series of options, with a
 possible sub-command that takes its own set of parameters. This functionality
@@ -507,7 +507,7 @@ runtimeclass TerminalParameters {
 * [ ] Add a `ShortcutAction` for `FocusPane`, which accepts a single parameter
   `index`.
   - We'll need to track each `Pane`'s ID as `Pane`s are created, so that we can
-    quickly switch to the i'th `Pane`.
+    quickly switch to the nth `Pane`.
   - This is in order to support the `-t,--target` parameter of `split-pane`.
 
 ## Capabilities

doc/specs/drafts/#2046 - Command Palette.md

@@ -0,0 +1,427 @@
+---
+author: Mike Griese @zadjii-msft
+created on: 2019-08-01
+last updated: 2020-04-13
+issue id: 2046
+---
+
+_This is a draft spec. It should be considered a work-in-progress._
+
+# Command Palette
+
+## Abstract
+
+This spec covers the addition of a "command palette" to the Windows Terminal.
+The Command Palette is a GUI that the user can activate to search for and
+execute commands. Beneficially, the command palette allows the user to execute
+commands _even if they aren't bound to a keybinding_.
+
+## Inspiration
+
+This feature is largely inspired by the "Command Palette" in text editors like
+VsCode, Sublime Text and others.
+
+This spec was initially drafted in [a
+comment](https://github.com/microsoft/terminal/issues/2046#issuecomment-514219791)
+in [#2046]. That was authored during the annual Microsoft Hackathon, where I
+proceeded to prototype the solution. This spec is influenced by things I learned
+prototyping.
+
+## Solution Design
+
+First off, for the sake of clarity, we'll rename the `command` of a keybinding
+to `action`. This will help keep the mental model between commands and actions
+clearer. When deserializing keybindings, we'll include a check for the old
+`command` key to migrate it.
+
+We'll introduce a new top-level array to the user settings, under the key
+`commands`. `commands` will contain an array of commands, each with the
+following schema:
+
+```js
+{
+    "name": string,
+    "action": string,
+    "icon": string
+    "args": object?,
+}
+```
+
+Command names should be human-friendly names of actions, though they don't need
+to necessarily be related to the action that it fires. For example, a command
+with `newTab` as the action could have `"Open New Tab"` as the name.
+
+The command will be parsed into a new class, `Command`:
+
+```c++
+class Command
+{
+    winrt::hstring Name();
+    winrt::TerminalApp::ActionAndArgs ActionAndArgs();
+    winrt::hstring IconSource();
+}
+```
+
+We'll add another structure in GlobalAppSettings to hold all these actions. It
+will just be a `std::vector<Command>` in `GlobalAppSettings`.
+
+We'll need app to be able to turn this vector into a `ListView`, or similar, so
+that we can display this list of actions. Each element in the view will be
+intrinsically associated with the `Command` object it's associated with. In
+order to support this, we'll make `Command` a winrt type that implements
+`Windows.UI.Xaml.Data.INotifyPropertyChanged`. This will let us bind the XAML
+element to the winrt type.
+
+When an element is clicked on in the list of commands, we'll raise the event
+corresponding to that `ShortcutAction`. `AppKeyBindings` already does a great
+job of dispatching `ShortcutActions` (and their associated arguments), so we'll
+re-use that. We'll pull the basic parts of dispatching `ActionAndArgs`
+callbacks into another class, `ShortcutActionDispatch`, with a single
+`PerformAction(ActionAndArgs)` method (and events for each action).
+`AppKeyBindings` will be initialized with a reference to the
+`ShortcutActionDispatch` object, so that it can call `PerformAction` on it.
+Additionally, by having a singular `ShortcutActionDispatch` instance, we won't
+need to re-hook up the ShortcutAction keybindings each time we re-load the
+settings.
+
+In `App`, when someone clicks on an item in the list, we'll get the
+`ActionAndArgs` associated with that list element, and call PerformAction on
+the app's `ShortcutActionDispatch`. This will trigger the event handler just the
+same as pressing the keybinding.
+
+### Commands for each profile?
+
+[#3879] Is a request for being able to launch a profile directly, via the
+command palette. Essentially, the user will type the name of a profile, and hit
+enter to launch that profile. I quite like this idea, but with the current spec,
+this won't work great. We'd need to manually have one entry in the command
+palette for each profile, and every time the user adds a profile, they'd need to
+update the list of commands to add a new entry for that profile as well.
+
+This is a fairly complicated addition to this feature, so I'd hold it for
+"Command Palette v2", though I believe it's solution deserves special
+consideration from the outset.
+
+I suggest that we need a mechanism by which the user can specify a single
+command that would be expanded to one command for every profile in the list of
+profiles. Consider the following sample:
+
+```json
+    "commands": [
+        {
+            "expandOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": "New Tab with ${profile.name}",
+            "command": { "action": "newTab", "profile": "${profile.name}" }
+        },
+        {
+            "expandOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": "New Vertical Split with ${profile.name}",
+            "command": { "action": "splitPane", "split":"vertical", "profile": "${profile.name}" }
+        }
+    ],
+```
+
+In this example:
+* The `"expandOn": "profiles"` property indicates that each command should be
+  repeated for each individual profile.
+* The `${profile.name}` value is treated as "when expanded, use the given
+  profile's name". This allows each command to use the `name` and `icon`
+  properties of a `Profile` to customize the text of the command.
+
+To ensure that this works correctly, we'll need to make sure to expand these
+commands after all the other settings have been parsed, presumably in the
+`Validate` phase. If we do it earlier, it's possible that not all the profiles
+from various sources will have been added yet, which would lead to an incomplete
+command list.
+
+We'll need to have a placeholder property to indicate that a command should be
+expanded for each `Profile`. When the command is first parsed, we'll leave the
+format strings `${...}` unexpanded at this time. Then, in the validate phase,
+when we encounter a `"expandOn": "profiles"` command, we'll remove it from the
+list, and use it as a prototype to generate commands for every `Profile` in our
+profiles list. We'll do a string find-and-replace on the format strings to
+replace them with the values from the profile, before adding the completed
+command to the list of commands.
+
+Of course, how does this work with localization? Considering the [section
+below](#localization), we'd update the built-in commands to the following:
+
+```json
+    "commands": [
+        {
+            "iterateOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": { "key": "NewTabWithProfileCommandName" },
+            "command": { "action": "newTab", "profile": "${profile.name}" }
+        },
+        {
+            "iterateOn": "profiles",
+            "icon": "${profile.icon}",
+            "name": { "key": "NewVerticalSplitWithProfileCommandName" },
+            "command": { "action": "splitPane", "split":"vertical", "profile": "${profile.name}" }
+        }
+    ],
+```
+
+In this example, we'll look up the `NewTabWithProfileCommandName` resource when
+we're first parsing the command, to find a string similar to `"New Tab with
+${profile.name}"`. When we then later expand the command, we'll see the
+`${profile.name}` bit from the resource, and expand that like we normally would.
+
+Trickily, we'll need to make sure to have a helper for replacing strings like
+this that can be used for general purpose arg parsing. As you can see, the
+`profile` property of the `newTab` command also needs the name of the profile.
+Either the command validation will need to go through and update these strings
+manually, or we'll need another of enabling these `IActionArgs` classes to fill
+those parameters in based on the profile being used. Perhaps the command
+pre-expansion could just stash the json for the action, then expand it later?
+This implementation detail is why this particular feature is not slated for
+inclusion in an initial Command Palette implementation.
+
+## UI/UX Design
+
+We'll add another action that can be used to toggle the visibility of the
+command palette. Pressing that keybinding will bring up the command palette.
+
+When the command palette appears, we'll want it to appear as a single overlay
+over all of the panes of the Terminal. The drop-down will be centered
+horizontally, dropping down from the top (from the tab row). When commands are
+entered, it will be implied that they are delivered to the focused terminal
+pane. This will help avoid two problematic scenarios that could arise from
+having the command palette attache to a single pane:
+  * When attached to a single pane, it might be very easy for the UI to quickly
+    become cluttered, especially at smaller pane sizes.
+  * This avoids the "find the overlay problem" which is common in editors like
+    VS where the dialog appears attached to the active editor pane.
+
+The palette will consist of two main UI elements: a text box for searching for
+commands, and a list of commands.
+
+The list of commands will be populated with all the commands by default. Each
+command will appear like a `MenuFlyoutItem`, with an icon at the left (if it has
+one) and the name visible. When opened, the palette will automatically highlight
+the first entry in the list.
+
+The user can navigate the list of entries with the arrow keys. Hitting enter
+will close the palette and execute the action that's highlighted. Hitting escape
+will dismiss the palette, returning control to the terminal. When the palette is
+closed for any reason (executing a command, dismissing with either escape or the
+`toggleCommandPalette` keybinding), we'll clear out any search text from the
+palette, so the user can start fresh again.
+
+We'll also want to enable the command palette to be filterable, so that the user
+can type the name of a command, and the command palette will automatically
+filter the list of commands. This should be more powerful then just a simple
+string compare - the user should be able to type a search string, and get all
+the commands that match a "fuzzy search" for that string. This will allow users
+to find the command they're looking for without needing to type the entire
+command.
+
+For example, consider the following list of commands:
+
+```json
+    "commands": [
+        { "icon": null, "name": "New Tab", "action": "newTab" },
+        { "icon": null, "name": "Close Tab", "action": "closeTab" },
+        { "icon": null, "name": "Close Pane", "action": "closePane" },
+        { "icon": null, "name": "[-] Split Horizontal", "action": "splitHorizontal" },
+        { "icon": null, "name": "[ | ] Split Vertical", "action": "splitVertical" },
+        { "icon": null, "name": "Next Tab", "action": "nextTab" },
+        { "icon": null, "name": "Prev Tab", "action": "prevTab" },
+        { "icon": null, "name": "Open Settings", "action": "openSettings" },
+        { "icon": null, "name": "Open Media Controls", "action": "openTestPane" }
+    ],
+```
+
+* "open" should return both "**Open** Settings" and "**Open** Media Controls".
+* "Tab" would return "New **Tab**", "Close **Tab**", "Next **Tab**" and "Prev
+  **Tab**".
+* "P" would return "Close **P**ane", "[-] S**p**lit Horizontal", "[ | ]
+  S**p**lit Vertical", "**P**rev Tab", "O**p**en Settings" and "O**p**en Media
+  Controls".
+* Even more powerfully, "sv" would return "[ | ] Split Vertical" (by matching
+  the **S** in "Split", then the **V** in "Vertical"). This is a great example
+  of how a user could execute a command with very few keystrokes.
+
+As the user types, we should **bold** each matching character in the command
+name, to show how their input correlates to the results on screen.
+
+## Capabilities
+
+### Accessibility
+
+As the entire command palette will be a native XAML element, it'll automatically
+be hooked up to the UIA tree, allowing for screen readers to naturally find it.
+ * When the palette is opened, it will automatically receive focus.
+ * The terminal panes will not be able to be interacted with while the palette
+   is open, which will help keep the UIA tree simple while the palette is open.
+
+### Security
+
+This should not introduce any _new_ security concerns. We're relying on the
+security of jsoncpp for parsing json. Adding new keys to the settings file
+will rely on jsoncpp's ability to securely parse those json values.
+
+### Reliability
+
+We'll need to make sure that invalid commands are ignored. A command could be
+invalid because:
+* it has a null `name`, or a name with the empty string for a value.
+* it has a null `action`, or an action specified that's not an actual
+  `ShortcutAction`.
+
+We'll ignore invalid commands from the user's settings, instead of hard
+crashing. I don't believe this is a scenario that warrants an error dialog to
+indicate to the user that there's a problem with the json.
+
+### Compatibility
+
+We will need to define default _commands_ for all the existing keybinding
+commands. With #754, we could add all the actions (that make sense) as commands
+to the commands list, so that everyone wouldn't need to define them manually.
+
+### Performance, Power, and Efficiency
+
+We'll be adding a few extra XAML elements to our tree which will certainly
+increase our runtime memory footprint while the palette is open.
+
+We'll additionally be introducing a few extra json values to parse, so that could
+increase our load times (though this will likely be negligible).
+
+## Potential Issues
+
+This will first require the work in [#1205] to work properly. Right now we
+heavily lean on the "focused" element to determine which terminal is "active".
+However, when the command palette is opened, focus will move out of the terminal
+control into the command palette, which leads to some hard to debug crashes.
+
+Additionally, we'll need to ensure that the "fuzzy search" algorithm proposed
+above will work for non-english languages, where a single character might be
+multiple `char`s long. As we'll be using a standard XAML text box for input, we
+won't need to worry about handling the input ourselves.
+
+### Localization
+
+Because we'll be shipping a set of default commands with the terminal, we should
+make sure that list of commands can be localizable. Each of the names we'll give
+to the commands should be locale-specific.
+
+To facilitate this, we'll use a special type of object in JSON that will let us
+specify a resource name in JSON. We'll use a syntax like the following to
+suggest that we should load a string from our resources, as opposed to using the
+value from the file:
+
+```json
+    "commands": [
+        { "icon": null, "name": { "key": "NewTabCommandName" }, "action": "newTab" },
+        { "icon": null, "name": { "key": "CloseTabCommandKey" }, "action": "closeTab" },
+        { "icon": null, "name": { "key": "ClosePaneCommandKey" }, "action": "closePane" },
+        { "icon": null, "name": { "key": "SplitHorizontalCommandKey" }, "action": "splitHorizontal" },
+        { "icon": null, "name": { "key": "SplitVerticalCommandKey" }, "action": "splitVertical" },
+        { "icon": null, "name": { "key": "NextTabCommandKey" }, "action": "nextTab" },
+        { "icon": null, "name": { "key": "PrevTabCommandKey" }, "action": "prevTab" },
+        { "icon": null, "name": { "key": "OpenSettingsCommandKey" }, "action": "openSettings" },
+    ],
+```
+
+We'll check at parse time if the `name` property is a string or an object. If
+it's a string, we'll treat that string as the literal text. Otherwise, if it's
+an object, we'll attempt to use the `key` property of that object to look up a
+string from our `ResourceDictionary`. This way, we'll be able to ship localized
+strings for all the built-in commands, while also allowing the user to easily
+add their own commands.
+
+During the spec review process, we considered other options for localization as
+well. The original proposal included options such as having one `defaults.json`
+file per-locale, and building the Terminal independently for each locale. Those
+were not really feasible options, so we instead settled on this solution, as it
+allowed us to leverage the existing localization support provided to us by the
+platform.
+
+The `{ "key": "resourceName" }` solution proposed here was also touched on in
+[#5280].
+
+
+## Future considerations
+
+* Commands will provide an easy point for allowing an extension to add its
+  actions to the UI, without forcing the user to bind the extension's actions to
+  a keybinding
+* Also discussed in [#2046] was the potential for adding a command that inputs a
+  certain commandline to be run by the shell. I felt that was out of scope for
+  this spec, so I'm not including it in detail. I believe that would be
+  accomplished by adding a `inputCommand` action, with two args: `commandline`,
+  a string, and `suppressNewline`, an optional bool, defaulted to false. The
+  `inputCommand` action would deliver the given `commandline` as input to the
+  connection, followed by a newline (as to execute the command).
+  `suppressNewline` would prevent the newline from being added. This would work
+  relatively well, so long as you're sitting at a shell prompt. If you were in
+  an application like `vim`, this might be handy for executing a sequence of
+  vim-specific keybindings. Otherwise, you're just going to end up writing a
+  commandline to the buffer of vim. It would be weird, but not unexpected.
+* Additionally mentioned in [#2046] was the potential for profile-scoped
+  commands. While that's a great idea, I believe it's out of scope for this
+  spec.
+* Once [#754] lands, we'll need to make sure to include commands for each action
+  manually in the default settings. This will add some overhead that the
+  developer will need to do whenever they add an action. That's unfortunate, but
+  will be largely beneficial to the end user.
+* We could theoretically also display the keybinding for a certain command in
+  the `ListViewItem` for the command. We'd need some way to correlate a
+  command's action to a keybinding's action. This could be done in a follow-up
+  task.
+* We might want to alter the fuzzy-search algorithm, to give higher precedence
+  in the results list to commands with more consecutive matching characters.
+  Alternatively we could give more weight to commands where the search matched
+  the initial character of words in the command.
+  - For example: `ot` would give more weight to "**O**pen **T**ab" than
+    "**O**pen Se**t**tings").
+* Another idea for a future spec is the concept of "nested commands", where a
+  single command has many sub-commands. This would hide the children commands
+  from the entire list of commands, allowing for much more succinct top-level
+  list of commands, and allowing related commands to be grouped together.
+  - For example, I have a text editor plugin that enables rendering markdown to
+    a number of different styles. To use that command in my text editor, first I
+    hit enter on the "Render Markdown..." command, then I select which style I
+    want to render to, in another list of options. This way, I don't need to
+    have three options for "Render Markdown to github", "Render Markdown to
+    gitlab", all in the top-level list.
+  - We probably also want to allow a nested command set to be evaluated at
+    runtime somehow. Like if we had a "Open New Tab..." command that then had a
+    nested menu with the list of profiles.
+* We may want to add a button to the New Tab Button's dropdown to "Show Command
+  Palette". I'm hesitant to keep adding new buttons to that UI, but the command
+  palette is otherwise not highly discoverable.
+  - We could add another button to the UI to toggle the visibility of the
+    command palette. This was the idea initially proposed in [#2046].
+  - For both these options, we may want a global setting to hide that button, to
+    keep the UI as minimal as possible.
+* [#1571] is a request for customizing the "new tab dropdown" menu. When we get
+  to discussing that design, we should consider also enabling users to add
+  commands from their list of commands to that menu as well.
+
+## Resources
+Initial post that inspired this spec: #[2046](https://github.com/microsoft/terminal/issues/2046)
+
+Keybindings args: #[1349](https://github.com/microsoft/terminal/pull/1349)
+
+Cascading User & Default Settings: #[754](https://github.com/microsoft/terminal/issues/754)
+
+Untie "active control" from "currently XAML-focused control" #[1205](https://github.com/microsoft/terminal/issues/1205)
+
+Allow dropdown menu customization in profiles.json [#1571](https://github.com/microsoft/terminal/issues/1571)
+
+Search or run a command in Dropdown menu [#3879]
+
+Spec: Introduce a mini-specification for localized resource use from JSON [#5280]
+
+<!-- Footnotes -->
+[#754]: https://github.com/microsoft/terminal/issues/754
+[#1205]: https://github.com/microsoft/terminal/issues/1205
+[#1142]: https://github.com/microsoft/terminal/pull/1349
+[#2046]: https://github.com/microsoft/terminal/issues/2046
+[#1571]: https://github.com/microsoft/terminal/issues/1571
+[#3879]: https://github.com/microsoft/terminal/issues/3879
+[#5280]: https://github.com/microsoft/terminal/pull/5280

doc/specs/drafts/576-ProfilesJumplistSpec.md

@@ -0,0 +1,127 @@
+---
+author: Brandon Chong @dsafa
+created on: 2019-06-20
+last updated: 2019-06-20
+issue id: 576
+---
+
+# Add Profiles To Jumplist
+
+## Abstract
+
+This spec outlines adding support for launching a profile from the jumplist. The main two points that will be detailed are:
+1. Adding jumplist support
+2. Adding the ability to open a profile from the jumplist
+
+The profiles available in the jumplist will match the profiles available in the application from the + dropdown. The scope of the jumplist feature is limited to desktop devices.
+
+## Inspiration
+The inspiration is to be able to quickly open the terminal with one of the configured profiles.
+
+## Terminology
+- Jumplist: This is the menu that appears when the application is right-clicked on the taskbar or the start menu.
+
+## Solution Design
+
+### Overview
+The jumplist has to be created/modified during the life-cycle of the application. The following is an outline of the steps to be performed (more details below)
+1. Load settings / profiles
+2. Create the jumplist with the initial profiles
+3. Maintain sync between the jumplist and profiles throughout the life of the application
+
+### Jumplist integration
+UWP provides an API to access to the jumplist through the [Windows.UI.StartScreen.JumpList class](https://docs.microsoft.com/en-us/uwp/api/windows.ui.startscreen.jumplist), however from previous attempts [1], the api does not work for the project architecture.
+Instead, we'll use the COM interface [ICustomDestinationList](https://docs.microsoft.com/en-us/windows/desktop/api/shobjidl_core/nn-shobjidl_core-icustomdestinationlist) [2] directly to create the jumplist. Since we are using Win32 apis, the work should be done in the `WindowsTerminal` project.
+
+Using `ICustomDestinationList` is straightforward with a few additions discussed in this section [below](#Implementation-notes). Resources for using the jumplist can be found [here](https://msdn.microsoft.com/en-us/library/windows/desktop/gg281362.aspx) and [here](https://www.codeproject.com/Articles/36561/Windows-7-Goodies-in-C-Jump-Lists).
+
+The basic overview:
+1. Get an instance of the `ICustomDestinationList` COM object
+2. Call `ICustomDestinationList.BeginList`
+3. Create an `IObjectCollection` COM object
+4. Create `IShellLink` COM objects for each profile and add them to the `IObjectCollection`
+5. Add the `IObjectCollection` to the `ICustomDestinationList`
+6. Call `ICustomDestination.CommitList`
+
+Note that the jumplist is replaced each time, instead of being updated.
+
+#### Approach
+One approach is to wrap the COM interfaces in a jumplist class and use that to add and remove items.
+
+#### What if there are multiple instances of the terminal application?
+There maybe multiple instances trying to update the jumplist at the same time.
+
+### Adding profiles to the jumplist
+To add the profiles to the jumplist there are some prerequisites that are needed
+- Be able to access settings / profiles from the `WindowsTerminal` project.
+- Detect when profiles are modified
+  - Created: Add a new profile to the jumplist when a new profile is created by the user
+  - Deleted: Remove the profile from the jumplist when the profile is removed by the user
+  - Modified: We'll have to sync profile name changes / icon changes with the jump list
+
+There are also different "categories" that we could add the profiles to. A jumplist can have items in a system category such as `Recent` or `Frequent` or a custom category. Jumplist items can also be a task. The difference between adding an item to a category or the task list is that items in a category can be `pinned` and `removed` from the jumplist by the user. Here is a summary of the two from the documentation [2]:
+- `Destinations can be files, folders, websites, or other content-based items, but are not necessarily file-backed. Destinations can be thought of as things or nouns`
+- `Tasks are common actions performed in an application that apply to all users of that application regardless of an individual's usage patterns. Tasks can be thought of as actions or verbs`
+
+Following this, it would be more appropriate to add the profiles to the `Tasks` list as we are launching a profile. Essentially each item in the jumplist will be a shortcut that opens the terminal and provides command line arguments.
+
+#### Implementation notes
+When specifying the icon to use in the `IShellLink` object, it does not appear to be able to read `ms-appx://` URIs such as ones for the default profile icons and also only able to read `.ico` files. The way that the UWP api is able to do it is by adding additional `PropertyKey`s to the `IShellLink` object [3]. Using these tools [JumpList](https://github.com/EricZimmerman/JumpList) and [Lnk Explorer](https://github.com/EricZimmerman/LECmd), we can examine what is different with UWP jumplists. When we examine the `.lnk` items that the jumplist uses, we can see that additional properties are added to the property store.
+
+| Property Key (Format ID\Property ID)     | Description                                  | Example Value                                                      |
+| ---------------------------------------- | -------------------------------------------- | ------------------------------------------------------------------ |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\28  | App User Model DestList Provided Description |                                                                    |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\27  | App User Model DestList Provided Title       | Windows PowerShell                                                 |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\30  | App User Model DestList Provided Group Name  | Profiles                                                           |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\29  | App User Model DestList Logo Uri             | ms-appx:///ProfileIcons/{61c54bbd-c2c6-5271-96e7-009a87ff44bf}.png |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\5   | App User Model ID                            | WindowsTerminalDev_8wekyb3d8bbwe!App                               |
+| {9F4C2855-9F79-4B39-A8D0-E1D42DE1D5F3}\20  | App User Model Activation Context            | {61c54bbd-c2c6-5271-96e7-009a87ff44bf}                             |
+| {436F2667-14E2-4FEB-B30A-146C53B5B674}\100 | Link Arguments                               | {61c54bbd-c2c6-5271-96e7-009a87ff44bf}                             |
+| {F29F85E0-4FF9-1068-AB91-08002B27B3D9}\2   | (Description not available)                  | Windows PowerShell                                                 |
+
+If we look at the property key `9f4c2855-9f79-4b39-a8d0-e1d42de1d5f3\29`, it specifies the uri for the icon and supports the `ms-appx://` scheme. So for icon support we can add that property key when creating the `IShellLink`. Also note that with this approach, it needs the `file://` uri scheme in the path for custom icons.
+
+### Launching the terminal from the jumplist
+The jumplist will launch the terminal by calling the executable alias `wt.exe` with arguments to indicate the profile. The command line arguments to use are tracked in issue [#607](https://github.com/microsoft/terminal/issues/607)
+
+## UI/UX Design
+No UI changes are needed. The jumplist is provided by Windows.
+
+### Localization
+Depending on how the jump list items will be worded.
+
+### Profile order
+The order of the profiles in the jumplist should match the order within the application.
+
+## Capabilities
+
+### Accessibility
+Will be provided by what Windows supports for jump lists
+
+### Security
+Should not introduce any new security issues
+
+### Reliability
+Should not introduce any new reliability issues
+
+### Compatibility
+Will have to add the ability to get notified of changes to the profile settings.
+
+### Performance, Power, and Efficiency
+The jumplist will have to be saved each time a profile change occurs but the frequency would be expected to be low.
+
+## Potential Issues
+
+#### Should it open a new instance of the terminal or open in a new tab?
+
+#### What should happen if a non existant profile is launched
+The jumplist is only updated when the application is running so the profiles could be modified or deleted outside and the jumplist will not be updated. Handling will be done by whatever handles the command line parsing.
+
+## Future considerations
+Other things could potentially be added to the jumplist other than profiles.
+
+## Resources
+
+- [1] [Original feature request: issue #576](https://github.com/microsoft/terminal/issues/576)
+- [2] [ICustomDestinationList](https://docs.microsoft.com/en-us/windows/desktop/api/shobjidl_core/nn-shobjidl_core-icustomdestinationlist)
+- [3] [Windows property system](https://docs.microsoft.com/en-us/windows/desktop/properties/property-system-overview)

doc/user-docs/ThirdPartyToolProfiles.md

@@ -2,7 +2,7 @@
 
 This doc will hopefully provide a useful guide for adding profiles for common
 third-party tools to your
-[profiles.json](https://github.com/microsoft/terminal/blob/master/doc/user-docs/UsingJsonSettings.md)
+[settings.json](https://github.com/microsoft/terminal/blob/master/doc/user-docs/UsingJsonSettings.md)
 file.
 
 All of these profiles are provided _without_ their `guid` set. If you'd like to
@@ -30,6 +30,7 @@ Assuming that you've installed cmder into `%CMDER_ROOT%`:
 {
     "commandline" : "cmd.exe /k \"%CMDER_ROOT%\\vendor\\init.bat\"",
     "name" : "cmder",
+    "icon" : "%CMDER_ROOT%/icons/cmder.ico",
     "startingDirectory" : "%USERPROFILE%"
 }
 ```
@@ -71,10 +72,48 @@ Assuming that you've installed Git Bash into `C:/Program Files/Git`:
 ```json
 {
     "name" : "Git Bash",
-    "commandline" : "C:/Program Files/Git/bin/bash.exe",
+    "commandline" : "C:/Program Files/Git/bin/bash.exe -li",
     "icon" : "C:/Program Files/Git/mingw64/share/git/git-for-windows.ico",
     "startingDirectory" : "%USERPROFILE%"
 }
 ````
 
+## Git Bash (WOW64)
+
+Assuming that you've installed Git Bash into `C:/Program Files (x86)/Git`:
+
+```json
+{
+    "name" : "Git Bash",
+    "commandline" : "%ProgramFiles(x86)%/Git/bin/bash.exe -li",
+    "icon" : "%ProgramFiles(x86)%/Git/mingw32/share/git/git-for-windows.ico",
+    "startingDirectory" : "%USERPROFILE%"
+}
+```
+
+## MSYS2
+
+Assuming that you've installed MSYS2 into `C:/msys64`:
+
+```json
+{
+    "name" : "MSYS2",
+    "commandline" : "C:/msys64/msys2_shell.cmd -defterm -no-start -mingw64",
+    "icon": "C:/msys64/msys2.ico",
+    "startingDirectory" : "C:/msys64/home/user"
+}
+````
+
+## Developer Command Prompt for Visual Studio
+
+Assuming that you've installed VS 2019 Professional:
+
+```json
+{
+    "name" : "Developer Command Prompt for VS 2019",
+    "commandline" : "cmd.exe /k \"C:/Program Files (x86)/Microsoft Visual Studio/2019/Professional/Common7/Tools/VsDevCmd.bat\"",
+    "startingDirectory" : "%USERPROFILE%"
+}
+```
+
 <!-- Adding a tool here? Make sure to add it in alphabetical order! -->

doc/user-docs/UsingCommandlineArguments.md

@@ -33,7 +33,7 @@ Display the help message.
 
 Opens a new tab with the given customizations. On its _first_ invocation, also
 opens a new window. Subsequent `new-tab` commands will all open new tabs in the
-same window.
+same window. <sup>[[1](#footnote-1)]</sup>
 
 **Parameters**:
 
@@ -41,17 +41,18 @@ same window.
 
 #### `split-pane`
 
-`split-pane [-H]|[-V] [terminal_parameters]`
+`split-pane [-H,--horizontal|-V,--vertical] [terminal_parameters]`
 
 Creates a new pane in the currently focused tab by splitting the given pane
-vertically or horizontally.
+vertically or horizontally. <sup>[[1](#footnote-1)]</sup>
 
 **Parameters**:
 
-* `-H`, `-V`: Used to indicate which direction to split the pane. `-V` is
-  "vertically" (think `[|]`), and `-H` is "horizontally" (think `[-]`). If
-  omitted, defaults to "auto", which splits the current pane in whatever the
-  larger dimension is. If both `-H` and `-V` are provided, defaults to vertical.
+* `-H,--horizontal`, `-V,--vertical`: Used to indicate which direction to split
+  the pane. `-V` is "vertically" (think `[|]`), and `-H` is "horizontally"
+  (think `[-]`). If omitted, defaults to "auto", which splits the current pane
+  in whatever the larger dimension is. If both `-H` and `-V` are provided,
+  defaults to vertical.
 * `[terminal_parameters]`: See [[terminal_parameters]](#terminal_parameters).
 
 #### `focus-tab`
@@ -89,6 +90,10 @@ following:
   selected profile. If the user wants to use a `;` in this commandline, it
   should be escaped as `\;`.
 
+### Notes
+
+* <span id="footnote-1"></span> [1]: If you try to run a `wt` commandline while running in a Windows Terminal window, the commandline will _always_ create a new window by default. Being able to run `wt` commandlines in the _current_ window is planned in the future - for more information, refer to [#4472].
+
 ## Examples
 
 ### Open Windows Terminal in the current directory
@@ -120,9 +125,77 @@ This creates a new Windows Terminal window with one tab, and 3 panes:
 * `split-pane -p "Windows PowerShell"`: This will create a new pane, split from
   the parent with the default profile. This pane will open with the "Windows
   PowerShell" profile
-* `split-pane -H wsl.exe`: This will create a third pane, slit _horizontally_
+* `split-pane -H wsl.exe`: This will create a third pane, split _horizontally_
   from the "Windows PowerShell" pane. It will be running the default profile,
   and will use `wsl.exe` as the commandline (instead of the default profile's
   `commandline`).
 
+
+### Using multiple commands from PowerShell
+
+The Windows Terminal uses the semicolon character `;` as a delimiter for
+separating subcommands in the `wt` commandline. Unfortunately, `powershell` also
+uses `;` as a command separator. To work around this you can use the following
+tricks to help run multiple wt sub commands from powershell. In all the
+following examples, we'll be creating a new Terminal window with three panes -
+one running `cmd`, one with `powershell`, and a last one running `wsl`.
+
+In each of the following examples, we're using the `Start-Process` command to
+run `wt`. For more information on why we're using `Start-Process`, see ["Using
+`start`"](#using-start) below.
+
+#### Single quoted parameters (if you aren't calculating anything):
+
+In this example, we'll wrap all the parameters to `wt` in single quotes (`'`)
+
+```PowerShell
+start wt 'new-tab "cmd"; split-pane -p "Windows PowerShell" ; split-pane -H wsl.exe'
+```
+
+#### Escaped quotes (if you need variables):
+
+If you'd like to pass a value contained in a variable to the `wt` commandline,
+instead use the following syntax:
+
+```PowerShell
+$ThirdPane = "wsl.exe"
+start wt "new-tab cmd; split-pane -p `"Windows PowerShell`" ; split-pane -H $ThirdPane"
+```
+
+Note the usage of  `` ` `` to escape the double-quotes (`"`) around "Windows
+Powershell" in the `-p` parameter to the `split-pane` sub-command.
+
+#### Using `start`
+
+All the above examples explicitly used `start` to launch the Terminal.
+
+In the following examples, we're going to not use `start` to run the
+commandline. Instead, we'll try two other methods of escaping the commandline:
+* Only escaping the semicolons so that `powershell` will ignore them and pass
+  them straight to `wt`.
+* Using `--%`, so powershell will treat the rest of the commandline as arguments
+  to the application.
+
+```PowerShell
+wt new-tab "cmd" `; split-pane -p "Windows PowerShell" `; split-pane -H wsl.exe
+```
+
+```Powershell
+wt --% new-tab cmd ; split-pane -p "Windows PowerShell" ; split-pane -H wsl.exe
+```
+
+In both these examples, the newly created Windows Terminal window will create
+the window by correctly parsing all the provided commandline arguments.
+
+However, these methods are _not_ recommended currently, as Powershell will wait
+for the newly-created Terminal window to be closed before returning control to
+Powershell. By default, Powershell will always wait for Windows Store
+applications (like the Windows Terminal) to close before returning to the
+prompt. Note that this is different than the behavior of `cmd`, which will return
+to the prompt immediately. See
+[Powershell/PowerShell#9970](https://github.com/PowerShell/PowerShell/issues/9970)
+for more details on this bug.
+
+
 [#4023]: https://github.com/microsoft/terminal/pull/4023
+[#4472]: https://github.com/microsoft/terminal/issues/4472

doc/user-docs/UsingJsonSettings.md

@@ -1,15 +1,15 @@
 # Editing Windows Terminal JSON Settings
 
 One way (currently the only way) to configure Windows Terminal is by editing the
-`profiles.json` settings file. At the time of writing you can open the settings
+`settings.json` settings file. At the time of writing you can open the settings
 file in your default editor by selecting `Settings` from the WT pull down menu.
 
-The settings are stored in the file `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe\LocalState\profiles.json`.
+The settings are stored in the file `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe\LocalState\settings.json`.
 
 As of [#2515](https://github.com/microsoft/terminal/pull/2515), the settings are
-split into _two_ files: a hardcoded `defaults.json`, and `profiles.json`, which
+split into _two_ files: a hardcoded `defaults.json`, and `settings.json`, which
 contains the user settings. Users should only be concerned with the contents of
-the `profiles.json`, which contains their customizations. The `defaults.json`
+the `settings.json`, which contains their customizations. The `defaults.json`
 file is only provided as a reference of what the default settings are. For more
 details on how these two files work, see [Settings
 Layering](#settings-layering). To view the default settings file, click on the
@@ -38,16 +38,17 @@ not affect a particular terminal instance.
 Example settings include
 
 ```json
+{
     "defaultProfile" : "{58ad8b0c-3ef8-5f4d-bc6f-13e4c00f2530}",
     "initialCols" : 120,
     "initialRows" : 50,
-    "requestedTheme" : "system",
+    "theme" : "system",
     "keybindings" : []
     ...
+}
 ```
 
-These global properties can exist either in the root json object, or in an
-object under a root property `"globals"`.
+These global properties should exist in the root json object.
 
 ## Key Bindings
 
@@ -87,7 +88,7 @@ This will allow you to simplify the above snippet as follows:
 }
 ```
 
-
+A list of default key bindings is available [here](https://github.com/microsoft/terminal/blob/master/src/cascadia/TerminalApp/defaults.json#L204).
 
 ### Unbinding keys
 
@@ -107,6 +108,22 @@ add the following to your keybindings:
 This will _unbind_ <kbd>Ctrl+Shift+6</kbd>, allowing vim to use the keystroke
 instead of the terminal.
 
+### Binding multiple keys
+
+You can have multiple key chords bound to the same action. To do this, simply
+add multiple bindings for the same action. For example:
+
+```json
+    "keybindings" :
+    [
+        { "command": "copy", "keys": "ctrl+shift+c" },
+        { "command": "copy", "keys": "ctrl+c" },
+        { "command": "copy", "keys": "enter" }
+    ]
+```
+
+In this snippet, all three of <kbd>ctrl+shift+c</kbd>, <kbd>ctrl+c</kbd> and <kbd>enter</kbd> are bound to `copy`.
+
 ## Profiles
 
 A profile contains the settings applied when a new WT tab is opened. Each
@@ -143,12 +160,12 @@ Example settings include
 
 The profile GUID is used to reference the default profile in the global settings.
 
-The values for background image stretch mode are documented [here](https://docs.microsoft.com/en-us/uwp/api/windows.ui.xaml.media.stretch)
+The values for background image stretch mode are documented [here](https://docs.microsoft.com/en-us/uwp/api/windows.ui.xaml.media.stretch).
 
 ### Hiding a profile
 
 If you want to remove a profile from the list of profiles in the new tab
-dropdown, but keep the profile around in your `profiles.json` file, you can add
+dropdown, but keep the profile around in your `settings.json` file, you can add
 the property `"hidden": true` to the profile's json. This can also be used to
 remove the default `cmd` and PowerShell profiles, if the user does not wish to
 see them.
@@ -182,10 +199,10 @@ The runtime settings are actually constructed from _three_ sources:
   profiles for both Windows PowerShell and Command Prompt (`cmd.exe`).
 * Dynamic Profiles, which are generated at runtime. These include Powershell
   Core, the Azure Cloud Shell connector, and profiles for and WSL distros.
-* The user settings from `profiles.json`.
+* The user settings from `settings.json`.
 
 Settings from each of these sources are "layered" upon the settings from
-previous sources. In this manner, the user settings in `profiles.json` can
+previous sources. In this manner, the user settings in `settings.json` can
 contain _only the changes from the default settings_. For example, if a user
 would like to only change the color scheme of the default `cmd` profile to
 "Solarized Dark", you could change your cmd profile to the following:
@@ -204,19 +221,19 @@ with that GUID will all be treated as the same object. Any changes in that
 profile will overwrite those from the defaults.
 
 Similarly, you can overwrite settings from a color scheme by defining a color
-scheme in `profiles.json` with the same name as a default color scheme.
+scheme in `settings.json` with the same name as a default color scheme.
 
 If you'd like to unbind a keystroke that's bound to an action in the default
 keybindings, you can set the `"command"` to `"unbound"` or `null`. This will
-allow the keystroke to fallthough to the commandline application instead of
+allow the keystroke to fallthrough to the commandline application instead of
 performing the default action.
 
 ### Dynamic Profiles
 
 When dynamic profiles are created at runtime, they'll be added to the
-`profiles.json` file. You can identify these profiles by the presence of a
+`settings.json` file. You can identify these profiles by the presence of a
 `"source"` property. These profiles are tied to their source - if you uninstall
-a linux distro, then the profile will remain in your `profiles.json` file, but
+a linux distro, then the profile will remain in your `settings.json` file, but
 the profile will be hidden.
 
 The Windows Terminal uses the `guid` property of these dynamically-generated
@@ -230,11 +247,17 @@ like to hide all the WSL profiles, you could add the following setting:
 
 ```json
 
-    "disabledProfileSources": ["Microsoft.Terminal.WSL"],
+    "disabledProfileSources": ["Windows.Terminal.WSL"],
     ...
 
 ```
 
+> 👉 **NOTE**: On launch, if a dynamic profile generator is enabled, it will
+> always add new profiles it detects to your list of profiles. If you delete a
+> dynamically generated profile from your list of profiles, it will just get
+> re-added the next time the Terminal is launched! To remove a dynamic profile
+> from your list of profiles, make sure to set `"hidden": true` in the profile.
+
 ### Default settings
 
 In [#2325](https://github.com/microsoft/terminal/issues/2325), we introduced the
@@ -355,7 +378,7 @@ In the above settings, the `"fontFace"` in the `cmd.exe` profile overrides the
 1. Download the [Debian JPG logo](https://www.debian.org/logos/openlogo-100.jpg)
 2. Put the image in the
  `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_<randomString>\LocalState\`
- directory (same directory as your `profiles.json` file).
+ directory (same directory as your `settings.json` file).
 
     __NOTE__:  You can put the image anywhere you like, the above suggestion happens to be convenient.
 3. Open your WT json properties file.
@@ -376,7 +399,7 @@ Notes:
 
 1. You will need to experiment with different color settings
 and schemes to make your terminal text visible on top of your image
-2. If you store the image in the UWP directory (the same directory as your profiles.json file),
+2. If you store the image in the UWP directory (the same directory as your settings.json file),
 then you should use the URI style path name given in the above example.
 More information about UWP URI schemes [here](https://docs.microsoft.com/en-us/windows/uwp/app-resources/uri-schemes).
 3. Instead of using a UWP URI you can use a:
@@ -398,7 +421,7 @@ following objects into your `globals.keybindings` array:
 { "command": "paste", "keys": ["ctrl+shift+v"] }
 ```
 
-> 👉 **Note**: you can also add a keybinding for the `copyTextWithoutNewlines` command. This removes newlines as the text is copied to your clipboard.
+> 👉 **Note**: you can also add a keybinding for the `copy` command with the argument `"trimWhitespace": true`. This removes newlines as the text is copied to your clipboard.
 
 This will add copy and paste on <kbd>ctrl+shift+c</kbd>
 and <kbd>ctrl+shift+v</kbd> respectively.

doc/user-docs/index.md

@@ -25,7 +25,7 @@ NOTE: The default shell is PowerShell; you can change this using the _Running a
 
 ### Command line options
 
-None at this time. See issue [#607](https://github.com/microsoft/terminal/issues/607)
+Windows Terminal has implemented a rich set of command-line options in part as response to issue [#607](https://github.com/microsoft/terminal/issues/607).  See [UsingCommandlineArguments.md](https://github.com/microsoft/terminal/blob/master/doc/user-docs/UsingCommandlineArguments.md) for details.
 
 ## Multiple Tabs
 
@@ -45,7 +45,7 @@ To customize the shell list, see the _Configuring Windows Terminal_ section belo
 
 ## Starting a new PowerShell tab with admin privilege
 
-There is no current plan to support this feature for security reasons. See issue [#623](https://github.com/microsoft/terminal/issues/632)
+There is no current plan to support this feature for security reasons. See issue [#632](https://github.com/microsoft/terminal/issues/632)
 
 ## Selecting and Copying Text in Windows Terminal
 
@@ -61,11 +61,11 @@ Copy and paste operations can also be keybound. For more information on how to b
 
 ## Add a "Open Windows Terminal Here" to File Explorer
 
-Not currently supported "out of the box". See issue [#1060](https://github.com/microsoft/terminal/issues/1060)
+Not currently supported "out of the box" (See issue [#1060](https://github.com/microsoft/terminal/issues/1060)). However, you can open Windows Terminal in current directory by typing `wt -d .` in the Explorer address bar.
 
 ## Configuring Windows Terminal
 
-All Windows Terminal settings are currently managed using the `profiles.json` file, located within `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe/LocalState`.
+All Windows Terminal settings are currently managed using the `settings.json` file, located within `$env:LocalAppData\Packages\Microsoft.WindowsTerminal_8wekyb3d8bbwe/LocalState`.
 
 To open the settings file from Windows Terminal:
 
@@ -73,7 +73,7 @@ To open the settings file from Windows Terminal:
 2. From the dropdown list, click `Settings`. You can also use a shortcut: <kbd>Ctrl</kbd>+<kbd>,</kbd>.
 3. Your default `json` editor will open the settings file.
 
-For an introduction to the various settings, see [Using Json Settings](UsingJsonSettings.md). The list of valid settings can be found in the [profiles.json documentation](../cascadia/SettingsSchema.md) section.
+For an introduction to the various settings, see [Using Json Settings](UsingJsonSettings.md). The list of valid settings can be found in the [settings.json documentation](../cascadia/SettingsSchema.md) section.
 
 ## Tips and Tricks
 
@@ -87,4 +87,5 @@ For an introduction to the various settings, see [Using Json Settings](UsingJson
 2. Terminal zoom can be changed by holding <kbd>Ctrl</kbd> and scrolling with mouse.
 3. Background opacity can be changed by holding <kbd>Ctrl</kbd>+<kbd>Shift</kbd> and scrolling with mouse. Note that acrylic transparency is limited by the OS only to focused windows.
 4. Open Windows Terminal in current directory by typing `wt -d .` in the address bar.
-5. Please add more Tips and Tricks.
+5. Pin the Windows Terminal to the taskbar. Now it can be launched using the Windows shortcut <kbd>Win</kbd>+<kbd>Number</kbd> (e.g. <kbd>Win</kbd>+<kbd>1</kbd> or any other number based on the position in the taskbar!). Press <kbd>Win</kbd>+<kbd>Shift</kbd>+<kbd>Number</kbd> to always launch a new window.
+6. Please add more Tips and Tricks.

oss/README.md

@@ -0,0 +1,8 @@
+### Component-Governance-tracked OSS dependencies
+
+This directory contains mirrored open-source projects that are used by the
+console host and Windows Terminal. Code in this directory will be replicated
+into the Windows OS repository.
+
+All projects in this directory **must** bear Component Governance Manifests
+(`cgmanifest.json` files) indicating their provenance.

oss/dynamic_bitset/LICENSE

@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2019 Maxime Pinard
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

oss/dynamic_bitset/MAINTAINER_README.md

@@ -0,0 +1,17 @@
+### Notes for Future Maintainers
+
+This was originally imported by @miniksa in March 2020.
+
+The provenance information (where it came from and which commit) is stored in the file `cgmanifest.json` in the same directory as this readme.
+Please update the provenance information in that file when ingesting an updated version of the dependent library.
+That provenance file is automatically read and inventoried by Microsoft systems to ensure compliance with appropiate governance standards.
+
+## What should be done to update this in the future?
+
+1. Go to pinam45/dynamic_bitset repository on GitHub.
+2. Take the entire contents of the include directory wholesale and drop it in the root directory here.
+3. Don't change anything about it.
+4. Validate that the license in the root of the repository didn't change and update it if so. It is sitting in the same directory as this readme. 
+   If it changed dramatically, ensure that it is still compatible with our license scheme. Also update the NOTICE file in the root of our repository to declare the third-party usage.
+5. Submit the pull.
+

oss/dynamic_bitset/cgmanifest.json

@@ -0,0 +1,13 @@
+{"Registrations":[ 
+    {
+      "component": { 
+       "type": "git", 
+       "git": { 
+         "repositoryUrl": "https://github.com/pinam45/dynamic_bitset", 
+         "commitHash": "00f2d066ce9deebf28b006636150e5a882beb83f" 
+         }
+       }
+    }
+ ],
+ "Version": 1
+}

oss/fmt/LICENSE.rst

@@ -0,0 +1,27 @@
+Copyright (c) 2012 - present, Victor Zverovich
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+--- Optional exception to the license ---
+
+As an exception, if, as a result of your compiling your source code, portions
+of this Software are embedded into a machine-executable object form of such
+source code, you may redistribute such embedded portions in such object form
+without including the above copyright and permission notices.

oss/fmt/MAINTAINER_README.md

@@ -0,0 +1,17 @@
+### Notes for Future Maintainers
+
+This was originally imported by @DHowett-MSFT in April 2020.
+
+The provenance information (where it came from and which commit) is stored in the file `cgmanifest.json` in the same directory as this readme.
+Please update the provenance information in that file when ingesting an updated version of the dependent library.
+That provenance file is automatically read and inventoried by Microsoft systems to ensure compliance with appropiate governance standards.
+
+## What should be done to update this in the future?
+
+1. Go to fmtlib/fmt repository on GitHub.
+2. Take the entire contents of the include/ and src/ directories and drop them in this directory.
+3. Don't change anything about it.
+4. Validate that the license in the root of the repository didn't change and update it if so. It is sitting in the same directory as this readme. 
+   If it changed dramatically, ensure that it is still compatible with our license scheme. Also update the NOTICE file in the root of our repository to declare the third-party usage.
+5. Submit the pull.
+

oss/fmt/cgmanifest.json

@@ -0,0 +1,13 @@
+{"Registrations":[ 
+    {
+      "component": { 
+       "type": "git", 
+       "git": { 
+         "repositoryUrl": "https://github.com/fmtlib/fmt", 
+         "commitHash": "9bdd1596cef1b57b9556f8bef32dc4a32322ef3e" 
+         }
+       }
+    }
+ ],
+ "Version": 1
+}

oss/fmt/include/fmt/color.h

@@ -0,0 +1,568 @@
+// Formatting library for C++ - color support
+//
+// Copyright (c) 2018 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COLOR_H_
+#define FMT_COLOR_H_
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+enum class color : uint32_t {
+  alice_blue = 0xF0F8FF,               // rgb(240,248,255)
+  antique_white = 0xFAEBD7,            // rgb(250,235,215)
+  aqua = 0x00FFFF,                     // rgb(0,255,255)
+  aquamarine = 0x7FFFD4,               // rgb(127,255,212)
+  azure = 0xF0FFFF,                    // rgb(240,255,255)
+  beige = 0xF5F5DC,                    // rgb(245,245,220)
+  bisque = 0xFFE4C4,                   // rgb(255,228,196)
+  black = 0x000000,                    // rgb(0,0,0)
+  blanched_almond = 0xFFEBCD,          // rgb(255,235,205)
+  blue = 0x0000FF,                     // rgb(0,0,255)
+  blue_violet = 0x8A2BE2,              // rgb(138,43,226)
+  brown = 0xA52A2A,                    // rgb(165,42,42)
+  burly_wood = 0xDEB887,               // rgb(222,184,135)
+  cadet_blue = 0x5F9EA0,               // rgb(95,158,160)
+  chartreuse = 0x7FFF00,               // rgb(127,255,0)
+  chocolate = 0xD2691E,                // rgb(210,105,30)
+  coral = 0xFF7F50,                    // rgb(255,127,80)
+  cornflower_blue = 0x6495ED,          // rgb(100,149,237)
+  cornsilk = 0xFFF8DC,                 // rgb(255,248,220)
+  crimson = 0xDC143C,                  // rgb(220,20,60)
+  cyan = 0x00FFFF,                     // rgb(0,255,255)
+  dark_blue = 0x00008B,                // rgb(0,0,139)
+  dark_cyan = 0x008B8B,                // rgb(0,139,139)
+  dark_golden_rod = 0xB8860B,          // rgb(184,134,11)
+  dark_gray = 0xA9A9A9,                // rgb(169,169,169)
+  dark_green = 0x006400,               // rgb(0,100,0)
+  dark_khaki = 0xBDB76B,               // rgb(189,183,107)
+  dark_magenta = 0x8B008B,             // rgb(139,0,139)
+  dark_olive_green = 0x556B2F,         // rgb(85,107,47)
+  dark_orange = 0xFF8C00,              // rgb(255,140,0)
+  dark_orchid = 0x9932CC,              // rgb(153,50,204)
+  dark_red = 0x8B0000,                 // rgb(139,0,0)
+  dark_salmon = 0xE9967A,              // rgb(233,150,122)
+  dark_sea_green = 0x8FBC8F,           // rgb(143,188,143)
+  dark_slate_blue = 0x483D8B,          // rgb(72,61,139)
+  dark_slate_gray = 0x2F4F4F,          // rgb(47,79,79)
+  dark_turquoise = 0x00CED1,           // rgb(0,206,209)
+  dark_violet = 0x9400D3,              // rgb(148,0,211)
+  deep_pink = 0xFF1493,                // rgb(255,20,147)
+  deep_sky_blue = 0x00BFFF,            // rgb(0,191,255)
+  dim_gray = 0x696969,                 // rgb(105,105,105)
+  dodger_blue = 0x1E90FF,              // rgb(30,144,255)
+  fire_brick = 0xB22222,               // rgb(178,34,34)
+  floral_white = 0xFFFAF0,             // rgb(255,250,240)
+  forest_green = 0x228B22,             // rgb(34,139,34)
+  fuchsia = 0xFF00FF,                  // rgb(255,0,255)
+  gainsboro = 0xDCDCDC,                // rgb(220,220,220)
+  ghost_white = 0xF8F8FF,              // rgb(248,248,255)
+  gold = 0xFFD700,                     // rgb(255,215,0)
+  golden_rod = 0xDAA520,               // rgb(218,165,32)
+  gray = 0x808080,                     // rgb(128,128,128)
+  green = 0x008000,                    // rgb(0,128,0)
+  green_yellow = 0xADFF2F,             // rgb(173,255,47)
+  honey_dew = 0xF0FFF0,                // rgb(240,255,240)
+  hot_pink = 0xFF69B4,                 // rgb(255,105,180)
+  indian_red = 0xCD5C5C,               // rgb(205,92,92)
+  indigo = 0x4B0082,                   // rgb(75,0,130)
+  ivory = 0xFFFFF0,                    // rgb(255,255,240)
+  khaki = 0xF0E68C,                    // rgb(240,230,140)
+  lavender = 0xE6E6FA,                 // rgb(230,230,250)
+  lavender_blush = 0xFFF0F5,           // rgb(255,240,245)
+  lawn_green = 0x7CFC00,               // rgb(124,252,0)
+  lemon_chiffon = 0xFFFACD,            // rgb(255,250,205)
+  light_blue = 0xADD8E6,               // rgb(173,216,230)
+  light_coral = 0xF08080,              // rgb(240,128,128)
+  light_cyan = 0xE0FFFF,               // rgb(224,255,255)
+  light_golden_rod_yellow = 0xFAFAD2,  // rgb(250,250,210)
+  light_gray = 0xD3D3D3,               // rgb(211,211,211)
+  light_green = 0x90EE90,              // rgb(144,238,144)
+  light_pink = 0xFFB6C1,               // rgb(255,182,193)
+  light_salmon = 0xFFA07A,             // rgb(255,160,122)
+  light_sea_green = 0x20B2AA,          // rgb(32,178,170)
+  light_sky_blue = 0x87CEFA,           // rgb(135,206,250)
+  light_slate_gray = 0x778899,         // rgb(119,136,153)
+  light_steel_blue = 0xB0C4DE,         // rgb(176,196,222)
+  light_yellow = 0xFFFFE0,             // rgb(255,255,224)
+  lime = 0x00FF00,                     // rgb(0,255,0)
+  lime_green = 0x32CD32,               // rgb(50,205,50)
+  linen = 0xFAF0E6,                    // rgb(250,240,230)
+  magenta = 0xFF00FF,                  // rgb(255,0,255)
+  maroon = 0x800000,                   // rgb(128,0,0)
+  medium_aquamarine = 0x66CDAA,        // rgb(102,205,170)
+  medium_blue = 0x0000CD,              // rgb(0,0,205)
+  medium_orchid = 0xBA55D3,            // rgb(186,85,211)
+  medium_purple = 0x9370DB,            // rgb(147,112,219)
+  medium_sea_green = 0x3CB371,         // rgb(60,179,113)
+  medium_slate_blue = 0x7B68EE,        // rgb(123,104,238)
+  medium_spring_green = 0x00FA9A,      // rgb(0,250,154)
+  medium_turquoise = 0x48D1CC,         // rgb(72,209,204)
+  medium_violet_red = 0xC71585,        // rgb(199,21,133)
+  midnight_blue = 0x191970,            // rgb(25,25,112)
+  mint_cream = 0xF5FFFA,               // rgb(245,255,250)
+  misty_rose = 0xFFE4E1,               // rgb(255,228,225)
+  moccasin = 0xFFE4B5,                 // rgb(255,228,181)
+  navajo_white = 0xFFDEAD,             // rgb(255,222,173)
+  navy = 0x000080,                     // rgb(0,0,128)
+  old_lace = 0xFDF5E6,                 // rgb(253,245,230)
+  olive = 0x808000,                    // rgb(128,128,0)
+  olive_drab = 0x6B8E23,               // rgb(107,142,35)
+  orange = 0xFFA500,                   // rgb(255,165,0)
+  orange_red = 0xFF4500,               // rgb(255,69,0)
+  orchid = 0xDA70D6,                   // rgb(218,112,214)
+  pale_golden_rod = 0xEEE8AA,          // rgb(238,232,170)
+  pale_green = 0x98FB98,               // rgb(152,251,152)
+  pale_turquoise = 0xAFEEEE,           // rgb(175,238,238)
+  pale_violet_red = 0xDB7093,          // rgb(219,112,147)
+  papaya_whip = 0xFFEFD5,              // rgb(255,239,213)
+  peach_puff = 0xFFDAB9,               // rgb(255,218,185)
+  peru = 0xCD853F,                     // rgb(205,133,63)
+  pink = 0xFFC0CB,                     // rgb(255,192,203)
+  plum = 0xDDA0DD,                     // rgb(221,160,221)
+  powder_blue = 0xB0E0E6,              // rgb(176,224,230)
+  purple = 0x800080,                   // rgb(128,0,128)
+  rebecca_purple = 0x663399,           // rgb(102,51,153)
+  red = 0xFF0000,                      // rgb(255,0,0)
+  rosy_brown = 0xBC8F8F,               // rgb(188,143,143)
+  royal_blue = 0x4169E1,               // rgb(65,105,225)
+  saddle_brown = 0x8B4513,             // rgb(139,69,19)
+  salmon = 0xFA8072,                   // rgb(250,128,114)
+  sandy_brown = 0xF4A460,              // rgb(244,164,96)
+  sea_green = 0x2E8B57,                // rgb(46,139,87)
+  sea_shell = 0xFFF5EE,                // rgb(255,245,238)
+  sienna = 0xA0522D,                   // rgb(160,82,45)
+  silver = 0xC0C0C0,                   // rgb(192,192,192)
+  sky_blue = 0x87CEEB,                 // rgb(135,206,235)
+  slate_blue = 0x6A5ACD,               // rgb(106,90,205)
+  slate_gray = 0x708090,               // rgb(112,128,144)
+  snow = 0xFFFAFA,                     // rgb(255,250,250)
+  spring_green = 0x00FF7F,             // rgb(0,255,127)
+  steel_blue = 0x4682B4,               // rgb(70,130,180)
+  tan = 0xD2B48C,                      // rgb(210,180,140)
+  teal = 0x008080,                     // rgb(0,128,128)
+  thistle = 0xD8BFD8,                  // rgb(216,191,216)
+  tomato = 0xFF6347,                   // rgb(255,99,71)
+  turquoise = 0x40E0D0,                // rgb(64,224,208)
+  violet = 0xEE82EE,                   // rgb(238,130,238)
+  wheat = 0xF5DEB3,                    // rgb(245,222,179)
+  white = 0xFFFFFF,                    // rgb(255,255,255)
+  white_smoke = 0xF5F5F5,              // rgb(245,245,245)
+  yellow = 0xFFFF00,                   // rgb(255,255,0)
+  yellow_green = 0x9ACD32              // rgb(154,205,50)
+};                                     // enum class color
+
+enum class terminal_color : uint8_t {
+  black = 30,
+  red,
+  green,
+  yellow,
+  blue,
+  magenta,
+  cyan,
+  white,
+  bright_black = 90,
+  bright_red,
+  bright_green,
+  bright_yellow,
+  bright_blue,
+  bright_magenta,
+  bright_cyan,
+  bright_white
+};
+
+enum class emphasis : uint8_t {
+  bold = 1,
+  italic = 1 << 1,
+  underline = 1 << 2,
+  strikethrough = 1 << 3
+};
+
+// rgb is a struct for red, green and blue colors.
+// Using the name "rgb" makes some editors show the color in a tooltip.
+struct rgb {
+  FMT_CONSTEXPR rgb() : r(0), g(0), b(0) {}
+  FMT_CONSTEXPR rgb(uint8_t r_, uint8_t g_, uint8_t b_) : r(r_), g(g_), b(b_) {}
+  FMT_CONSTEXPR rgb(uint32_t hex)
+      : r((hex >> 16) & 0xFF), g((hex >> 8) & 0xFF), b(hex & 0xFF) {}
+  FMT_CONSTEXPR rgb(color hex)
+      : r((uint32_t(hex) >> 16) & 0xFF),
+        g((uint32_t(hex) >> 8) & 0xFF),
+        b(uint32_t(hex) & 0xFF) {}
+  uint8_t r;
+  uint8_t g;
+  uint8_t b;
+};
+
+namespace internal {
+
+// color is a struct of either a rgb color or a terminal color.
+struct color_type {
+  FMT_CONSTEXPR color_type() FMT_NOEXCEPT : is_rgb(), value{} {}
+  FMT_CONSTEXPR color_type(color rgb_color) FMT_NOEXCEPT : is_rgb(true),
+                                                           value{} {
+    value.rgb_color = static_cast<uint32_t>(rgb_color);
+  }
+  FMT_CONSTEXPR color_type(rgb rgb_color) FMT_NOEXCEPT : is_rgb(true), value{} {
+    value.rgb_color = (static_cast<uint32_t>(rgb_color.r) << 16) |
+                      (static_cast<uint32_t>(rgb_color.g) << 8) | rgb_color.b;
+  }
+  FMT_CONSTEXPR color_type(terminal_color term_color) FMT_NOEXCEPT : is_rgb(),
+                                                                     value{} {
+    value.term_color = static_cast<uint8_t>(term_color);
+  }
+  bool is_rgb;
+  union color_union {
+    uint8_t term_color;
+    uint32_t rgb_color;
+  } value;
+};
+}  // namespace internal
+
+// Experimental text formatting support.
+class text_style {
+ public:
+  FMT_CONSTEXPR text_style(emphasis em = emphasis()) FMT_NOEXCEPT
+      : set_foreground_color(),
+        set_background_color(),
+        ems(em) {}
+
+  FMT_CONSTEXPR text_style& operator|=(const text_style& rhs) {
+    if (!set_foreground_color) {
+      set_foreground_color = rhs.set_foreground_color;
+      foreground_color = rhs.foreground_color;
+    } else if (rhs.set_foreground_color) {
+      if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
+        FMT_THROW(format_error("can't OR a terminal color"));
+      foreground_color.value.rgb_color |= rhs.foreground_color.value.rgb_color;
+    }
+
+    if (!set_background_color) {
+      set_background_color = rhs.set_background_color;
+      background_color = rhs.background_color;
+    } else if (rhs.set_background_color) {
+      if (!background_color.is_rgb || !rhs.background_color.is_rgb)
+        FMT_THROW(format_error("can't OR a terminal color"));
+      background_color.value.rgb_color |= rhs.background_color.value.rgb_color;
+    }
+
+    ems = static_cast<emphasis>(static_cast<uint8_t>(ems) |
+                                static_cast<uint8_t>(rhs.ems));
+    return *this;
+  }
+
+  friend FMT_CONSTEXPR text_style operator|(text_style lhs,
+                                            const text_style& rhs) {
+    return lhs |= rhs;
+  }
+
+  FMT_CONSTEXPR text_style& operator&=(const text_style& rhs) {
+    if (!set_foreground_color) {
+      set_foreground_color = rhs.set_foreground_color;
+      foreground_color = rhs.foreground_color;
+    } else if (rhs.set_foreground_color) {
+      if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
+        FMT_THROW(format_error("can't AND a terminal color"));
+      foreground_color.value.rgb_color &= rhs.foreground_color.value.rgb_color;
+    }
+
+    if (!set_background_color) {
+      set_background_color = rhs.set_background_color;
+      background_color = rhs.background_color;
+    } else if (rhs.set_background_color) {
+      if (!background_color.is_rgb || !rhs.background_color.is_rgb)
+        FMT_THROW(format_error("can't AND a terminal color"));
+      background_color.value.rgb_color &= rhs.background_color.value.rgb_color;
+    }
+
+    ems = static_cast<emphasis>(static_cast<uint8_t>(ems) &
+                                static_cast<uint8_t>(rhs.ems));
+    return *this;
+  }
+
+  friend FMT_CONSTEXPR text_style operator&(text_style lhs,
+                                            const text_style& rhs) {
+    return lhs &= rhs;
+  }
+
+  FMT_CONSTEXPR bool has_foreground() const FMT_NOEXCEPT {
+    return set_foreground_color;
+  }
+  FMT_CONSTEXPR bool has_background() const FMT_NOEXCEPT {
+    return set_background_color;
+  }
+  FMT_CONSTEXPR bool has_emphasis() const FMT_NOEXCEPT {
+    return static_cast<uint8_t>(ems) != 0;
+  }
+  FMT_CONSTEXPR internal::color_type get_foreground() const FMT_NOEXCEPT {
+    FMT_ASSERT(has_foreground(), "no foreground specified for this style");
+    return foreground_color;
+  }
+  FMT_CONSTEXPR internal::color_type get_background() const FMT_NOEXCEPT {
+    FMT_ASSERT(has_background(), "no background specified for this style");
+    return background_color;
+  }
+  FMT_CONSTEXPR emphasis get_emphasis() const FMT_NOEXCEPT {
+    FMT_ASSERT(has_emphasis(), "no emphasis specified for this style");
+    return ems;
+  }
+
+ private:
+  FMT_CONSTEXPR text_style(bool is_foreground,
+                           internal::color_type text_color) FMT_NOEXCEPT
+      : set_foreground_color(),
+        set_background_color(),
+        ems() {
+    if (is_foreground) {
+      foreground_color = text_color;
+      set_foreground_color = true;
+    } else {
+      background_color = text_color;
+      set_background_color = true;
+    }
+  }
+
+  friend FMT_CONSTEXPR_DECL text_style fg(internal::color_type foreground)
+      FMT_NOEXCEPT;
+  friend FMT_CONSTEXPR_DECL text_style bg(internal::color_type background)
+      FMT_NOEXCEPT;
+
+  internal::color_type foreground_color;
+  internal::color_type background_color;
+  bool set_foreground_color;
+  bool set_background_color;
+  emphasis ems;
+};
+
+FMT_CONSTEXPR text_style fg(internal::color_type foreground) FMT_NOEXCEPT {
+  return text_style(/*is_foreground=*/true, foreground);
+}
+
+FMT_CONSTEXPR text_style bg(internal::color_type background) FMT_NOEXCEPT {
+  return text_style(/*is_foreground=*/false, background);
+}
+
+FMT_CONSTEXPR text_style operator|(emphasis lhs, emphasis rhs) FMT_NOEXCEPT {
+  return text_style(lhs) | rhs;
+}
+
+namespace internal {
+
+template <typename Char> struct ansi_color_escape {
+  FMT_CONSTEXPR ansi_color_escape(internal::color_type text_color,
+                                  const char* esc) FMT_NOEXCEPT {
+    // If we have a terminal color, we need to output another escape code
+    // sequence.
+    if (!text_color.is_rgb) {
+      bool is_background = esc == internal::data::background_color;
+      uint32_t value = text_color.value.term_color;
+      // Background ASCII codes are the same as the foreground ones but with
+      // 10 more.
+      if (is_background) value += 10u;
+
+      std::size_t index = 0;
+      buffer[index++] = static_cast<Char>('\x1b');
+      buffer[index++] = static_cast<Char>('[');
+
+      if (value >= 100u) {
+        buffer[index++] = static_cast<Char>('1');
+        value %= 100u;
+      }
+      buffer[index++] = static_cast<Char>('0' + value / 10u);
+      buffer[index++] = static_cast<Char>('0' + value % 10u);
+
+      buffer[index++] = static_cast<Char>('m');
+      buffer[index++] = static_cast<Char>('\0');
+      return;
+    }
+
+    for (int i = 0; i < 7; i++) {
+      buffer[i] = static_cast<Char>(esc[i]);
+    }
+    rgb color(text_color.value.rgb_color);
+    to_esc(color.r, buffer + 7, ';');
+    to_esc(color.g, buffer + 11, ';');
+    to_esc(color.b, buffer + 15, 'm');
+    buffer[19] = static_cast<Char>(0);
+  }
+  FMT_CONSTEXPR ansi_color_escape(emphasis em) FMT_NOEXCEPT {
+    uint8_t em_codes[4] = {};
+    uint8_t em_bits = static_cast<uint8_t>(em);
+    if (em_bits & static_cast<uint8_t>(emphasis::bold)) em_codes[0] = 1;
+    if (em_bits & static_cast<uint8_t>(emphasis::italic)) em_codes[1] = 3;
+    if (em_bits & static_cast<uint8_t>(emphasis::underline)) em_codes[2] = 4;
+    if (em_bits & static_cast<uint8_t>(emphasis::strikethrough))
+      em_codes[3] = 9;
+
+    std::size_t index = 0;
+    for (int i = 0; i < 4; ++i) {
+      if (!em_codes[i]) continue;
+      buffer[index++] = static_cast<Char>('\x1b');
+      buffer[index++] = static_cast<Char>('[');
+      buffer[index++] = static_cast<Char>('0' + em_codes[i]);
+      buffer[index++] = static_cast<Char>('m');
+    }
+    buffer[index++] = static_cast<Char>(0);
+  }
+  FMT_CONSTEXPR operator const Char*() const FMT_NOEXCEPT { return buffer; }
+
+  FMT_CONSTEXPR const Char* begin() const FMT_NOEXCEPT { return buffer; }
+  FMT_CONSTEXPR const Char* end() const FMT_NOEXCEPT {
+    return buffer + std::char_traits<Char>::length(buffer);
+  }
+
+ private:
+  Char buffer[7u + 3u * 4u + 1u];
+
+  static FMT_CONSTEXPR void to_esc(uint8_t c, Char* out,
+                                   char delimiter) FMT_NOEXCEPT {
+    out[0] = static_cast<Char>('0' + c / 100);
+    out[1] = static_cast<Char>('0' + c / 10 % 10);
+    out[2] = static_cast<Char>('0' + c % 10);
+    out[3] = static_cast<Char>(delimiter);
+  }
+};
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_foreground_color(
+    internal::color_type foreground) FMT_NOEXCEPT {
+  return ansi_color_escape<Char>(foreground, internal::data::foreground_color);
+}
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_background_color(
+    internal::color_type background) FMT_NOEXCEPT {
+  return ansi_color_escape<Char>(background, internal::data::background_color);
+}
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_emphasis(emphasis em) FMT_NOEXCEPT {
+  return ansi_color_escape<Char>(em);
+}
+
+template <typename Char>
+inline void fputs(const Char* chars, FILE* stream) FMT_NOEXCEPT {
+  std::fputs(chars, stream);
+}
+
+template <>
+inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) FMT_NOEXCEPT {
+  std::fputws(chars, stream);
+}
+
+template <typename Char> inline void reset_color(FILE* stream) FMT_NOEXCEPT {
+  fputs(internal::data::reset_color, stream);
+}
+
+template <> inline void reset_color<wchar_t>(FILE* stream) FMT_NOEXCEPT {
+  fputs(internal::data::wreset_color, stream);
+}
+
+template <typename Char>
+inline void reset_color(basic_memory_buffer<Char>& buffer) FMT_NOEXCEPT {
+  const char* begin = data::reset_color;
+  const char* end = begin + sizeof(data::reset_color) - 1;
+  buffer.append(begin, end);
+}
+
+template <typename Char>
+void vformat_to(basic_memory_buffer<Char>& buf, const text_style& ts,
+                basic_string_view<Char> format_str,
+                basic_format_args<buffer_context<Char>> args) {
+  bool has_style = false;
+  if (ts.has_emphasis()) {
+    has_style = true;
+    auto emphasis = internal::make_emphasis<Char>(ts.get_emphasis());
+    buf.append(emphasis.begin(), emphasis.end());
+  }
+  if (ts.has_foreground()) {
+    has_style = true;
+    auto foreground =
+        internal::make_foreground_color<Char>(ts.get_foreground());
+    buf.append(foreground.begin(), foreground.end());
+  }
+  if (ts.has_background()) {
+    has_style = true;
+    auto background =
+        internal::make_background_color<Char>(ts.get_background());
+    buf.append(background.begin(), background.end());
+  }
+  internal::vformat_to(buf, format_str, args);
+  if (has_style) internal::reset_color<Char>(buf);
+}
+}  // namespace internal
+
+template <typename S, typename Char = char_t<S>>
+void vprint(std::FILE* f, const text_style& ts, const S& format,
+            basic_format_args<buffer_context<Char>> args) {
+  basic_memory_buffer<Char> buf;
+  internal::vformat_to(buf, ts, to_string_view(format), args);
+  buf.push_back(Char(0));
+  internal::fputs(buf.data(), f);
+}
+
+/**
+  Formats a string and prints it to the specified file stream using ANSI
+  escape sequences to specify text formatting.
+  Example:
+    fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+               "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_string<S>::value)>
+void print(std::FILE* f, const text_style& ts, const S& format_str,
+           const Args&... args) {
+  internal::check_format_string<Args...>(format_str);
+  using context = buffer_context<char_t<S>>;
+  format_arg_store<context, Args...> as{args...};
+  vprint(f, ts, format_str, basic_format_args<context>(as));
+}
+
+/**
+  Formats a string and prints it to stdout using ANSI escape sequences to
+  specify text formatting.
+  Example:
+    fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+               "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_string<S>::value)>
+void print(const text_style& ts, const S& format_str, const Args&... args) {
+  return print(stdout, ts, format_str, args...);
+}
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vformat(
+    const text_style& ts, const S& format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buf;
+  internal::vformat_to(buf, ts, to_string_view(format_str), args);
+  return fmt::to_string(buf);
+}
+
+/**
+  \rst
+  Formats arguments and returns the result as a string using ANSI
+  escape sequences to specify text formatting.
+
+  **Example**::
+
+    #include <fmt/color.h>
+    std::string message = fmt::format(fmt::emphasis::bold | fg(fmt::color::red),
+                                      "The answer is {}", 42);
+  \endrst
+*/
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline std::basic_string<Char> format(const text_style& ts, const S& format_str,
+                                      const Args&... args) {
+  return vformat(ts, to_string_view(format_str),
+                 internal::make_args_checked<Args...>(format_str, args...));
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_COLOR_H_

oss/fmt/include/fmt/compile.h

@@ -0,0 +1,595 @@
+// Formatting library for C++ - experimental format string compilation
+//
+// Copyright (c) 2012 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COMPILE_H_
+#define FMT_COMPILE_H_
+
+#include <vector>
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+// Part of a compiled format string. It can be either literal text or a
+// replacement field.
+template <typename Char> struct format_part {
+  enum class kind { arg_index, arg_name, text, replacement };
+
+  struct replacement {
+    arg_ref<Char> arg_id;
+    dynamic_format_specs<Char> specs;
+  };
+
+  kind part_kind;
+  union value {
+    int arg_index;
+    basic_string_view<Char> str;
+    replacement repl;
+
+    FMT_CONSTEXPR value(int index = 0) : arg_index(index) {}
+    FMT_CONSTEXPR value(basic_string_view<Char> s) : str(s) {}
+    FMT_CONSTEXPR value(replacement r) : repl(r) {}
+  } val;
+  // Position past the end of the argument id.
+  const Char* arg_id_end = nullptr;
+
+  FMT_CONSTEXPR format_part(kind k = kind::arg_index, value v = {})
+      : part_kind(k), val(v) {}
+
+  static FMT_CONSTEXPR format_part make_arg_index(int index) {
+    return format_part(kind::arg_index, index);
+  }
+  static FMT_CONSTEXPR format_part make_arg_name(basic_string_view<Char> name) {
+    return format_part(kind::arg_name, name);
+  }
+  static FMT_CONSTEXPR format_part make_text(basic_string_view<Char> text) {
+    return format_part(kind::text, text);
+  }
+  static FMT_CONSTEXPR format_part make_replacement(replacement repl) {
+    return format_part(kind::replacement, repl);
+  }
+};
+
+template <typename Char> struct part_counter {
+  unsigned num_parts = 0;
+
+  FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
+    if (begin != end) ++num_parts;
+  }
+
+  FMT_CONSTEXPR void on_arg_id() { ++num_parts; }
+  FMT_CONSTEXPR void on_arg_id(int) { ++num_parts; }
+  FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) { ++num_parts; }
+
+  FMT_CONSTEXPR void on_replacement_field(const Char*) {}
+
+  FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
+                                            const Char* end) {
+    // Find the matching brace.
+    unsigned brace_counter = 0;
+    for (; begin != end; ++begin) {
+      if (*begin == '{') {
+        ++brace_counter;
+      } else if (*begin == '}') {
+        if (brace_counter == 0u) break;
+        --brace_counter;
+      }
+    }
+    return begin;
+  }
+
+  FMT_CONSTEXPR void on_error(const char*) {}
+};
+
+// Counts the number of parts in a format string.
+template <typename Char>
+FMT_CONSTEXPR unsigned count_parts(basic_string_view<Char> format_str) {
+  part_counter<Char> counter;
+  parse_format_string<true>(format_str, counter);
+  return counter.num_parts;
+}
+
+template <typename Char, typename PartHandler>
+class format_string_compiler : public error_handler {
+ private:
+  using part = format_part<Char>;
+
+  PartHandler handler_;
+  part part_;
+  basic_string_view<Char> format_str_;
+  basic_format_parse_context<Char> parse_context_;
+
+ public:
+  FMT_CONSTEXPR format_string_compiler(basic_string_view<Char> format_str,
+                                       PartHandler handler)
+      : handler_(handler),
+        format_str_(format_str),
+        parse_context_(format_str) {}
+
+  FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
+    if (begin != end)
+      handler_(part::make_text({begin, to_unsigned(end - begin)}));
+  }
+
+  FMT_CONSTEXPR void on_arg_id() {
+    part_ = part::make_arg_index(parse_context_.next_arg_id());
+  }
+
+  FMT_CONSTEXPR void on_arg_id(int id) {
+    parse_context_.check_arg_id(id);
+    part_ = part::make_arg_index(id);
+  }
+
+  FMT_CONSTEXPR void on_arg_id(basic_string_view<Char> id) {
+    part_ = part::make_arg_name(id);
+  }
+
+  FMT_CONSTEXPR void on_replacement_field(const Char* ptr) {
+    part_.arg_id_end = ptr;
+    handler_(part_);
+  }
+
+  FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
+                                            const Char* end) {
+    auto repl = typename part::replacement();
+    dynamic_specs_handler<basic_format_parse_context<Char>> handler(
+        repl.specs, parse_context_);
+    auto it = parse_format_specs(begin, end, handler);
+    if (*it != '}') on_error("missing '}' in format string");
+    repl.arg_id = part_.part_kind == part::kind::arg_index
+                      ? arg_ref<Char>(part_.val.arg_index)
+                      : arg_ref<Char>(part_.val.str);
+    auto part = part::make_replacement(repl);
+    part.arg_id_end = begin;
+    handler_(part);
+    return it;
+  }
+};
+
+// Compiles a format string and invokes handler(part) for each parsed part.
+template <bool IS_CONSTEXPR, typename Char, typename PartHandler>
+FMT_CONSTEXPR void compile_format_string(basic_string_view<Char> format_str,
+                                         PartHandler handler) {
+  parse_format_string<IS_CONSTEXPR>(
+      format_str,
+      format_string_compiler<Char, PartHandler>(format_str, handler));
+}
+
+template <typename Range, typename Context, typename Id>
+void format_arg(
+    basic_format_parse_context<typename Range::value_type>& parse_ctx,
+    Context& ctx, Id arg_id) {
+  ctx.advance_to(
+      visit_format_arg(arg_formatter<Range>(ctx, &parse_ctx), ctx.arg(arg_id)));
+}
+
+// vformat_to is defined in a subnamespace to prevent ADL.
+namespace cf {
+template <typename Context, typename Range, typename CompiledFormat>
+auto vformat_to(Range out, CompiledFormat& cf, basic_format_args<Context> args)
+    -> typename Context::iterator {
+  using char_type = typename Context::char_type;
+  basic_format_parse_context<char_type> parse_ctx(
+      to_string_view(cf.format_str_));
+  Context ctx(out.begin(), args);
+
+  const auto& parts = cf.parts();
+  for (auto part_it = std::begin(parts); part_it != std::end(parts);
+       ++part_it) {
+    const auto& part = *part_it;
+    const auto& value = part.val;
+
+    using format_part_t = format_part<char_type>;
+    switch (part.part_kind) {
+    case format_part_t::kind::text: {
+      const auto text = value.str;
+      auto output = ctx.out();
+      auto&& it = reserve(output, text.size());
+      it = std::copy_n(text.begin(), text.size(), it);
+      ctx.advance_to(output);
+      break;
+    }
+
+    case format_part_t::kind::arg_index:
+      advance_to(parse_ctx, part.arg_id_end);
+      internal::format_arg<Range>(parse_ctx, ctx, value.arg_index);
+      break;
+
+    case format_part_t::kind::arg_name:
+      advance_to(parse_ctx, part.arg_id_end);
+      internal::format_arg<Range>(parse_ctx, ctx, value.str);
+      break;
+
+    case format_part_t::kind::replacement: {
+      const auto& arg_id_value = value.repl.arg_id.val;
+      const auto arg = value.repl.arg_id.kind == arg_id_kind::index
+                           ? ctx.arg(arg_id_value.index)
+                           : ctx.arg(arg_id_value.name);
+
+      auto specs = value.repl.specs;
+
+      handle_dynamic_spec<width_checker>(specs.width, specs.width_ref, ctx);
+      handle_dynamic_spec<precision_checker>(specs.precision,
+                                             specs.precision_ref, ctx);
+
+      error_handler h;
+      numeric_specs_checker<error_handler> checker(h, arg.type());
+      if (specs.align == align::numeric) checker.require_numeric_argument();
+      if (specs.sign != sign::none) checker.check_sign();
+      if (specs.alt) checker.require_numeric_argument();
+      if (specs.precision >= 0) checker.check_precision();
+
+      advance_to(parse_ctx, part.arg_id_end);
+      ctx.advance_to(
+          visit_format_arg(arg_formatter<Range>(ctx, nullptr, &specs), arg));
+      break;
+    }
+    }
+  }
+  return ctx.out();
+}
+}  // namespace cf
+
+struct basic_compiled_format {};
+
+template <typename S, typename = void>
+struct compiled_format_base : basic_compiled_format {
+  using char_type = char_t<S>;
+  using parts_container = std::vector<internal::format_part<char_type>>;
+
+  parts_container compiled_parts;
+
+  explicit compiled_format_base(basic_string_view<char_type> format_str) {
+    compile_format_string<false>(format_str,
+                                 [this](const format_part<char_type>& part) {
+                                   compiled_parts.push_back(part);
+                                 });
+  }
+
+  const parts_container& parts() const { return compiled_parts; }
+};
+
+template <typename Char, unsigned N> struct format_part_array {
+  format_part<Char> data[N] = {};
+  FMT_CONSTEXPR format_part_array() = default;
+};
+
+template <typename Char, unsigned N>
+FMT_CONSTEXPR format_part_array<Char, N> compile_to_parts(
+    basic_string_view<Char> format_str) {
+  format_part_array<Char, N> parts;
+  unsigned counter = 0;
+  // This is not a lambda for compatibility with older compilers.
+  struct {
+    format_part<Char>* parts;
+    unsigned* counter;
+    FMT_CONSTEXPR void operator()(const format_part<Char>& part) {
+      parts[(*counter)++] = part;
+    }
+  } collector{parts.data, &counter};
+  compile_format_string<true>(format_str, collector);
+  if (counter < N) {
+    parts.data[counter] =
+        format_part<Char>::make_text(basic_string_view<Char>());
+  }
+  return parts;
+}
+
+template <typename T> constexpr const T& constexpr_max(const T& a, const T& b) {
+  return (a < b) ? b : a;
+}
+
+template <typename S>
+struct compiled_format_base<S, enable_if_t<is_compile_string<S>::value>>
+    : basic_compiled_format {
+  using char_type = char_t<S>;
+
+  FMT_CONSTEXPR explicit compiled_format_base(basic_string_view<char_type>) {}
+
+// Workaround for old compilers. Format string compilation will not be
+// performed there anyway.
+#if FMT_USE_CONSTEXPR
+  static FMT_CONSTEXPR_DECL const unsigned num_format_parts =
+      constexpr_max(count_parts(to_string_view(S())), 1u);
+#else
+  static const unsigned num_format_parts = 1;
+#endif
+
+  using parts_container = format_part<char_type>[num_format_parts];
+
+  const parts_container& parts() const {
+    static FMT_CONSTEXPR_DECL const auto compiled_parts =
+        compile_to_parts<char_type, num_format_parts>(
+            internal::to_string_view(S()));
+    return compiled_parts.data;
+  }
+};
+
+template <typename S, typename... Args>
+class compiled_format : private compiled_format_base<S> {
+ public:
+  using typename compiled_format_base<S>::char_type;
+
+ private:
+  basic_string_view<char_type> format_str_;
+
+  template <typename Context, typename Range, typename CompiledFormat>
+  friend auto cf::vformat_to(Range out, CompiledFormat& cf,
+                             basic_format_args<Context> args) ->
+      typename Context::iterator;
+
+ public:
+  compiled_format() = delete;
+  explicit constexpr compiled_format(basic_string_view<char_type> format_str)
+      : compiled_format_base<S>(format_str), format_str_(format_str) {}
+};
+
+#ifdef __cpp_if_constexpr
+template <typename... Args> struct type_list {};
+
+// Returns a reference to the argument at index N from [first, rest...].
+template <int N, typename T, typename... Args>
+constexpr const auto& get(const T& first, const Args&... rest) {
+  static_assert(N < 1 + sizeof...(Args), "index is out of bounds");
+  if constexpr (N == 0)
+    return first;
+  else
+    return get<N - 1>(rest...);
+}
+
+template <int N, typename> struct get_type_impl;
+
+template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> {
+  using type = remove_cvref_t<decltype(get<N>(std::declval<Args>()...))>;
+};
+
+template <int N, typename T>
+using get_type = typename get_type_impl<N, T>::type;
+
+template <typename T> struct is_compiled_format : std::false_type {};
+
+template <typename Char> struct text {
+  basic_string_view<Char> data;
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  OutputIt format(OutputIt out, const Args&...) const {
+    // TODO: reserve
+    return copy_str<Char>(data.begin(), data.end(), out);
+  }
+};
+
+template <typename Char>
+struct is_compiled_format<text<Char>> : std::true_type {};
+
+template <typename Char>
+constexpr text<Char> make_text(basic_string_view<Char> s, size_t pos,
+                               size_t size) {
+  return {{&s[pos], size}};
+}
+
+template <typename Char, typename OutputIt, typename T,
+          std::enable_if_t<std::is_integral_v<T>, int> = 0>
+OutputIt format_default(OutputIt out, T value) {
+  // TODO: reserve
+  format_int fi(value);
+  return std::copy(fi.data(), fi.data() + fi.size(), out);
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, double value) {
+  writer w(out);
+  w.write(value);
+  return w.out();
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, Char value) {
+  *out++ = value;
+  return out;
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, const Char* value) {
+  auto length = std::char_traits<Char>::length(value);
+  return copy_str<Char>(value, value + length, out);
+}
+
+// A replacement field that refers to argument N.
+template <typename Char, typename T, int N> struct field {
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  OutputIt format(OutputIt out, const Args&... args) const {
+    // This ensures that the argument type is convertile to `const T&`.
+    const T& arg = get<N>(args...);
+    return format_default<Char>(out, arg);
+  }
+};
+
+template <typename Char, typename T, int N>
+struct is_compiled_format<field<Char, T, N>> : std::true_type {};
+
+template <typename L, typename R> struct concat {
+  L lhs;
+  R rhs;
+  using char_type = typename L::char_type;
+
+  template <typename OutputIt, typename... Args>
+  OutputIt format(OutputIt out, const Args&... args) const {
+    out = lhs.format(out, args...);
+    return rhs.format(out, args...);
+  }
+};
+
+template <typename L, typename R>
+struct is_compiled_format<concat<L, R>> : std::true_type {};
+
+template <typename L, typename R>
+constexpr concat<L, R> make_concat(L lhs, R rhs) {
+  return {lhs, rhs};
+}
+
+struct unknown_format {};
+
+template <typename Char>
+constexpr size_t parse_text(basic_string_view<Char> str, size_t pos) {
+  for (size_t size = str.size(); pos != size; ++pos) {
+    if (str[pos] == '{' || str[pos] == '}') break;
+  }
+  return pos;
+}
+
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S format_str);
+
+template <typename Args, size_t POS, int ID, typename T, typename S>
+constexpr auto parse_tail(T head, S format_str) {
+  if constexpr (POS != to_string_view(format_str).size()) {
+    constexpr auto tail = compile_format_string<Args, POS, ID>(format_str);
+    if constexpr (std::is_same<remove_cvref_t<decltype(tail)>,
+                               unknown_format>())
+      return tail;
+    else
+      return make_concat(head, tail);
+  } else {
+    return head;
+  }
+}
+
+// Compiles a non-empty format string and returns the compiled representation
+// or unknown_format() on unrecognized input.
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S format_str) {
+  using char_type = typename S::char_type;
+  constexpr basic_string_view<char_type> str = format_str;
+  if constexpr (str[POS] == '{') {
+    if (POS + 1 == str.size())
+      throw format_error("unmatched '{' in format string");
+    if constexpr (str[POS + 1] == '{') {
+      return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
+    } else if constexpr (str[POS + 1] == '}') {
+      using type = get_type<ID, Args>;
+      if constexpr (std::is_same<type, int>::value) {
+        return parse_tail<Args, POS + 2, ID + 1>(field<char_type, type, ID>(),
+                                                 format_str);
+      } else {
+        return unknown_format();
+      }
+    } else {
+      return unknown_format();
+    }
+  } else if constexpr (str[POS] == '}') {
+    if (POS + 1 == str.size())
+      throw format_error("unmatched '}' in format string");
+    return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
+  } else {
+    constexpr auto end = parse_text(str, POS + 1);
+    return parse_tail<Args, end, ID>(make_text(str, POS, end - POS),
+                                     format_str);
+  }
+}
+#endif  // __cpp_if_constexpr
+}  // namespace internal
+
+#if FMT_USE_CONSTEXPR
+#  ifdef __cpp_if_constexpr
+template <typename... Args, typename S,
+          FMT_ENABLE_IF(is_compile_string<S>::value)>
+constexpr auto compile(S format_str) {
+  constexpr basic_string_view<typename S::char_type> str = format_str;
+  if constexpr (str.size() == 0) {
+    return internal::make_text(str, 0, 0);
+  } else {
+    constexpr auto result =
+        internal::compile_format_string<internal::type_list<Args...>, 0, 0>(
+            format_str);
+    if constexpr (std::is_same<remove_cvref_t<decltype(result)>,
+                               internal::unknown_format>()) {
+      return internal::compiled_format<S, Args...>(to_string_view(format_str));
+    } else {
+      return result;
+    }
+  }
+}
+
+template <typename CompiledFormat, typename... Args,
+          typename Char = typename CompiledFormat::char_type,
+          FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
+std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
+  basic_memory_buffer<Char> buffer;
+  cf.format(std::back_inserter(buffer), args...);
+  return to_string(buffer);
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+          FMT_ENABLE_IF(internal::is_compiled_format<CompiledFormat>::value)>
+OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+                   const Args&... args) {
+  return cf.format(out, args...);
+}
+#  else
+template <typename... Args, typename S,
+          FMT_ENABLE_IF(is_compile_string<S>::value)>
+constexpr auto compile(S format_str) -> internal::compiled_format<S, Args...> {
+  return internal::compiled_format<S, Args...>(to_string_view(format_str));
+}
+#  endif  // __cpp_if_constexpr
+#endif    // FMT_USE_CONSTEXPR
+
+// Compiles the format string which must be a string literal.
+template <typename... Args, typename Char, size_t N>
+auto compile(const Char (&format_str)[N])
+    -> internal::compiled_format<const Char*, Args...> {
+  return internal::compiled_format<const Char*, Args...>(
+      basic_string_view<Char>(format_str, N - 1));
+}
+
+template <typename CompiledFormat, typename... Args,
+          typename Char = typename CompiledFormat::char_type,
+          FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
+                                        CompiledFormat>::value)>
+std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
+  basic_memory_buffer<Char> buffer;
+  using range = buffer_range<Char>;
+  using context = buffer_context<Char>;
+  internal::cf::vformat_to<context>(range(buffer), cf,
+                                    make_format_args<context>(args...));
+  return to_string(buffer);
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+          FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
+                                        CompiledFormat>::value)>
+OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+                   const Args&... args) {
+  using char_type = typename CompiledFormat::char_type;
+  using range = internal::output_range<OutputIt, char_type>;
+  using context = format_context_t<OutputIt, char_type>;
+  return internal::cf::vformat_to<context>(range(out), cf,
+                                           make_format_args<context>(args...));
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)>
+format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n,
+                                         const CompiledFormat& cf,
+                                         const Args&... args) {
+  auto it =
+      format_to(internal::truncating_iterator<OutputIt>(out, n), cf, args...);
+  return {it.base(), it.count()};
+}
+
+template <typename CompiledFormat, typename... Args>
+std::size_t formatted_size(const CompiledFormat& cf, const Args&... args) {
+  return format_to(internal::counting_iterator(), cf, args...).count();
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_COMPILE_H_

oss/fmt/include/fmt/locale.h

@@ -0,0 +1,78 @@
+// Formatting library for C++ - std::locale support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_LOCALE_H_
+#define FMT_LOCALE_H_
+
+#include <locale>
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+namespace internal {
+template <typename Char>
+typename buffer_context<Char>::iterator vformat_to(
+    const std::locale& loc, buffer<Char>& buf,
+    basic_string_view<Char> format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  using range = buffer_range<Char>;
+  return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), args,
+                                          internal::locale_ref(loc));
+}
+
+template <typename Char>
+std::basic_string<Char> vformat(
+    const std::locale& loc, basic_string_view<Char> format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  internal::vformat_to(loc, buffer, format_str, args);
+  return fmt::to_string(buffer);
+}
+}  // namespace internal
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vformat(
+    const std::locale& loc, const S& format_str,
+    basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  return internal::vformat(loc, to_string_view(format_str), args);
+}
+
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline std::basic_string<Char> format(const std::locale& loc,
+                                      const S& format_str, Args&&... args) {
+  return internal::vformat(
+      loc, to_string_view(format_str),
+      internal::make_args_checked<Args...>(format_str, args...));
+}
+
+template <typename S, typename OutputIt, typename... Args,
+          typename Char = enable_if_t<
+              internal::is_output_iterator<OutputIt>::value, char_t<S>>>
+inline OutputIt vformat_to(
+    OutputIt out, const std::locale& loc, const S& format_str,
+    format_args_t<type_identity_t<OutputIt>, Char> args) {
+  using range = internal::output_range<OutputIt, Char>;
+  return vformat_to<arg_formatter<range>>(
+      range(out), to_string_view(format_str), args, internal::locale_ref(loc));
+}
+
+template <typename OutputIt, typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value&&
+                            internal::is_string<S>::value)>
+inline OutputIt format_to(OutputIt out, const std::locale& loc,
+                          const S& format_str, Args&&... args) {
+  internal::check_format_string<Args...>(format_str);
+  using context = format_context_t<OutputIt, char_t<S>>;
+  format_arg_store<context, Args...> as{args...};
+  return vformat_to(out, loc, to_string_view(format_str),
+                    basic_format_args<context>(as));
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_LOCALE_H_

oss/fmt/include/fmt/os.h

@@ -0,0 +1,392 @@
+// Formatting library for C++ - optional OS-specific functionality
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_OS_H_
+#define FMT_OS_H_
+
+#if defined(__MINGW32__) || defined(__CYGWIN__)
+// Workaround MinGW bug https://sourceforge.net/p/mingw/bugs/2024/.
+#  undef __STRICT_ANSI__
+#endif
+
+#include <cerrno>
+#include <clocale>  // for locale_t
+#include <cstddef>
+#include <cstdio>
+#include <cstdlib>  // for strtod_l
+
+#if defined __APPLE__ || defined(__FreeBSD__)
+#  include <xlocale.h>  // for LC_NUMERIC_MASK on OS X
+#endif
+
+#include "format.h"
+
+// UWP doesn't provide _pipe.
+#if FMT_HAS_INCLUDE("winapifamily.h")
+#  include <winapifamily.h>
+#endif
+#if FMT_HAS_INCLUDE("fcntl.h") && \
+    (!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+#  include <fcntl.h>  // for O_RDONLY
+#  define FMT_USE_FCNTL 1
+#else
+#  define FMT_USE_FCNTL 0
+#endif
+
+#ifndef FMT_POSIX
+#  if defined(_WIN32) && !defined(__MINGW32__)
+// Fix warnings about deprecated symbols.
+#    define FMT_POSIX(call) _##call
+#  else
+#    define FMT_POSIX(call) call
+#  endif
+#endif
+
+// Calls to system functions are wrapped in FMT_SYSTEM for testability.
+#ifdef FMT_SYSTEM
+#  define FMT_POSIX_CALL(call) FMT_SYSTEM(call)
+#else
+#  define FMT_SYSTEM(call) call
+#  ifdef _WIN32
+// Fix warnings about deprecated symbols.
+#    define FMT_POSIX_CALL(call) ::_##call
+#  else
+#    define FMT_POSIX_CALL(call) ::call
+#  endif
+#endif
+
+// Retries the expression while it evaluates to error_result and errno
+// equals to EINTR.
+#ifndef _WIN32
+#  define FMT_RETRY_VAL(result, expression, error_result) \
+    do {                                                  \
+      (result) = (expression);                            \
+    } while ((result) == (error_result) && errno == EINTR)
+#else
+#  define FMT_RETRY_VAL(result, expression, error_result) result = (expression)
+#endif
+
+#define FMT_RETRY(result, expression) FMT_RETRY_VAL(result, expression, -1)
+
+FMT_BEGIN_NAMESPACE
+
+/**
+  \rst
+  A reference to a null-terminated string. It can be constructed from a C
+  string or ``std::string``.
+
+  You can use one of the following type aliases for common character types:
+
+  +---------------+-----------------------------+
+  | Type          | Definition                  |
+  +===============+=============================+
+  | cstring_view  | basic_cstring_view<char>    |
+  +---------------+-----------------------------+
+  | wcstring_view | basic_cstring_view<wchar_t> |
+  +---------------+-----------------------------+
+
+  This class is most useful as a parameter type to allow passing
+  different types of strings to a function, for example::
+
+    template <typename... Args>
+    std::string format(cstring_view format_str, const Args & ... args);
+
+    format("{}", 42);
+    format(std::string("{}"), 42);
+  \endrst
+ */
+template <typename Char> class basic_cstring_view {
+ private:
+  const Char* data_;
+
+ public:
+  /** Constructs a string reference object from a C string. */
+  basic_cstring_view(const Char* s) : data_(s) {}
+
+  /**
+    \rst
+    Constructs a string reference from an ``std::string`` object.
+    \endrst
+   */
+  basic_cstring_view(const std::basic_string<Char>& s) : data_(s.c_str()) {}
+
+  /** Returns the pointer to a C string. */
+  const Char* c_str() const { return data_; }
+};
+
+using cstring_view = basic_cstring_view<char>;
+using wcstring_view = basic_cstring_view<wchar_t>;
+
+// An error code.
+class error_code {
+ private:
+  int value_;
+
+ public:
+  explicit error_code(int value = 0) FMT_NOEXCEPT : value_(value) {}
+
+  int get() const FMT_NOEXCEPT { return value_; }
+};
+
+#ifdef _WIN32
+namespace internal {
+// A converter from UTF-16 to UTF-8.
+// It is only provided for Windows since other systems support UTF-8 natively.
+class utf16_to_utf8 {
+ private:
+  memory_buffer buffer_;
+
+ public:
+  utf16_to_utf8() {}
+  FMT_API explicit utf16_to_utf8(wstring_view s);
+  operator string_view() const { return string_view(&buffer_[0], size()); }
+  size_t size() const { return buffer_.size() - 1; }
+  const char* c_str() const { return &buffer_[0]; }
+  std::string str() const { return std::string(&buffer_[0], size()); }
+
+  // Performs conversion returning a system error code instead of
+  // throwing exception on conversion error. This method may still throw
+  // in case of memory allocation error.
+  FMT_API int convert(wstring_view s);
+};
+
+FMT_API void format_windows_error(buffer<char>& out, int error_code,
+                                  string_view message) FMT_NOEXCEPT;
+}  // namespace internal
+
+/** A Windows error. */
+class windows_error : public system_error {
+ private:
+  FMT_API void init(int error_code, string_view format_str, format_args args);
+
+ public:
+  /**
+   \rst
+   Constructs a :class:`fmt::windows_error` object with the description
+   of the form
+
+   .. parsed-literal::
+     *<message>*: *<system-message>*
+
+   where *<message>* is the formatted message and *<system-message>* is the
+   system message corresponding to the error code.
+   *error_code* is a Windows error code as given by ``GetLastError``.
+   If *error_code* is not a valid error code such as -1, the system message
+   will look like "error -1".
+
+   **Example**::
+
+     // This throws a windows_error with the description
+     //   cannot open file 'madeup': The system cannot find the file specified.
+     // or similar (system message may vary).
+     const char *filename = "madeup";
+     LPOFSTRUCT of = LPOFSTRUCT();
+     HFILE file = OpenFile(filename, &of, OF_READ);
+     if (file == HFILE_ERROR) {
+       throw fmt::windows_error(GetLastError(),
+                                "cannot open file '{}'", filename);
+     }
+   \endrst
+  */
+  template <typename... Args>
+  windows_error(int error_code, string_view message, const Args&... args) {
+    init(error_code, message, make_format_args(args...));
+  }
+};
+
+// Reports a Windows error without throwing an exception.
+// Can be used to report errors from destructors.
+FMT_API void report_windows_error(int error_code,
+                                  string_view message) FMT_NOEXCEPT;
+#endif  // _WIN32
+
+// A buffered file.
+class buffered_file {
+ private:
+  FILE* file_;
+
+  friend class file;
+
+  explicit buffered_file(FILE* f) : file_(f) {}
+
+ public:
+  buffered_file(const buffered_file&) = delete;
+  void operator=(const buffered_file&) = delete;
+
+  // Constructs a buffered_file object which doesn't represent any file.
+  buffered_file() FMT_NOEXCEPT : file_(nullptr) {}
+
+  // Destroys the object closing the file it represents if any.
+  FMT_API ~buffered_file() FMT_NOEXCEPT;
+
+ public:
+  buffered_file(buffered_file&& other) FMT_NOEXCEPT : file_(other.file_) {
+    other.file_ = nullptr;
+  }
+
+  buffered_file& operator=(buffered_file&& other) {
+    close();
+    file_ = other.file_;
+    other.file_ = nullptr;
+    return *this;
+  }
+
+  // Opens a file.
+  FMT_API buffered_file(cstring_view filename, cstring_view mode);
+
+  // Closes the file.
+  FMT_API void close();
+
+  // Returns the pointer to a FILE object representing this file.
+  FILE* get() const FMT_NOEXCEPT { return file_; }
+
+  // We place parentheses around fileno to workaround a bug in some versions
+  // of MinGW that define fileno as a macro.
+  FMT_API int(fileno)() const;
+
+  void vprint(string_view format_str, format_args args) {
+    fmt::vprint(file_, format_str, args);
+  }
+
+  template <typename... Args>
+  inline void print(string_view format_str, const Args&... args) {
+    vprint(format_str, make_format_args(args...));
+  }
+};
+
+#if FMT_USE_FCNTL
+// A file. Closed file is represented by a file object with descriptor -1.
+// Methods that are not declared with FMT_NOEXCEPT may throw
+// fmt::system_error in case of failure. Note that some errors such as
+// closing the file multiple times will cause a crash on Windows rather
+// than an exception. You can get standard behavior by overriding the
+// invalid parameter handler with _set_invalid_parameter_handler.
+class file {
+ private:
+  int fd_;  // File descriptor.
+
+  // Constructs a file object with a given descriptor.
+  explicit file(int fd) : fd_(fd) {}
+
+ public:
+  // Possible values for the oflag argument to the constructor.
+  enum {
+    RDONLY = FMT_POSIX(O_RDONLY),  // Open for reading only.
+    WRONLY = FMT_POSIX(O_WRONLY),  // Open for writing only.
+    RDWR = FMT_POSIX(O_RDWR)       // Open for reading and writing.
+  };
+
+  // Constructs a file object which doesn't represent any file.
+  file() FMT_NOEXCEPT : fd_(-1) {}
+
+  // Opens a file and constructs a file object representing this file.
+  FMT_API file(cstring_view path, int oflag);
+
+ public:
+  file(const file&) = delete;
+  void operator=(const file&) = delete;
+
+  file(file&& other) FMT_NOEXCEPT : fd_(other.fd_) { other.fd_ = -1; }
+
+  file& operator=(file&& other) FMT_NOEXCEPT {
+    close();
+    fd_ = other.fd_;
+    other.fd_ = -1;
+    return *this;
+  }
+
+  // Destroys the object closing the file it represents if any.
+  FMT_API ~file() FMT_NOEXCEPT;
+
+  // Returns the file descriptor.
+  int descriptor() const FMT_NOEXCEPT { return fd_; }
+
+  // Closes the file.
+  FMT_API void close();
+
+  // Returns the file size. The size has signed type for consistency with
+  // stat::st_size.
+  FMT_API long long size() const;
+
+  // Attempts to read count bytes from the file into the specified buffer.
+  FMT_API std::size_t read(void* buffer, std::size_t count);
+
+  // Attempts to write count bytes from the specified buffer to the file.
+  FMT_API std::size_t write(const void* buffer, std::size_t count);
+
+  // Duplicates a file descriptor with the dup function and returns
+  // the duplicate as a file object.
+  FMT_API static file dup(int fd);
+
+  // Makes fd be the copy of this file descriptor, closing fd first if
+  // necessary.
+  FMT_API void dup2(int fd);
+
+  // Makes fd be the copy of this file descriptor, closing fd first if
+  // necessary.
+  FMT_API void dup2(int fd, error_code& ec) FMT_NOEXCEPT;
+
+  // Creates a pipe setting up read_end and write_end file objects for reading
+  // and writing respectively.
+  FMT_API static void pipe(file& read_end, file& write_end);
+
+  // Creates a buffered_file object associated with this file and detaches
+  // this file object from the file.
+  FMT_API buffered_file fdopen(const char* mode);
+};
+
+// Returns the memory page size.
+long getpagesize();
+#endif  // FMT_USE_FCNTL
+
+#ifdef FMT_LOCALE
+// A "C" numeric locale.
+class locale {
+ private:
+#  ifdef _WIN32
+  using locale_t = _locale_t;
+
+  static void freelocale(locale_t loc) { _free_locale(loc); }
+
+  static double strtod_l(const char* nptr, char** endptr, _locale_t loc) {
+    return _strtod_l(nptr, endptr, loc);
+  }
+#  endif
+
+  locale_t locale_;
+
+ public:
+  using type = locale_t;
+  locale(const locale&) = delete;
+  void operator=(const locale&) = delete;
+
+  locale() {
+#  ifndef _WIN32
+    locale_ = FMT_SYSTEM(newlocale(LC_NUMERIC_MASK, "C", nullptr));
+#  else
+    locale_ = _create_locale(LC_NUMERIC, "C");
+#  endif
+    if (!locale_) FMT_THROW(system_error(errno, "cannot create locale"));
+  }
+  ~locale() { freelocale(locale_); }
+
+  type get() const { return locale_; }
+
+  // Converts string to floating-point number and advances str past the end
+  // of the parsed input.
+  double strtod(const char*& str) const {
+    char* end = nullptr;
+    double result = strtod_l(str, &end, locale_);
+    str = end;
+    return result;
+  }
+};
+using Locale FMT_DEPRECATED_ALIAS = locale;
+#endif  // FMT_LOCALE
+FMT_END_NAMESPACE
+
+#endif  // FMT_OS_H_

oss/fmt/include/fmt/ostream.h

@@ -0,0 +1,143 @@
+// Formatting library for C++ - std::ostream support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_OSTREAM_H_
+#define FMT_OSTREAM_H_
+
+#include <ostream>
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+template <class Char> class formatbuf : public std::basic_streambuf<Char> {
+ private:
+  using int_type = typename std::basic_streambuf<Char>::int_type;
+  using traits_type = typename std::basic_streambuf<Char>::traits_type;
+
+  buffer<Char>& buffer_;
+
+ public:
+  formatbuf(buffer<Char>& buf) : buffer_(buf) {}
+
+ protected:
+  // The put-area is actually always empty. This makes the implementation
+  // simpler and has the advantage that the streambuf and the buffer are always
+  // in sync and sputc never writes into uninitialized memory. The obvious
+  // disadvantage is that each call to sputc always results in a (virtual) call
+  // to overflow. There is no disadvantage here for sputn since this always
+  // results in a call to xsputn.
+
+  int_type overflow(int_type ch = traits_type::eof()) FMT_OVERRIDE {
+    if (!traits_type::eq_int_type(ch, traits_type::eof()))
+      buffer_.push_back(static_cast<Char>(ch));
+    return ch;
+  }
+
+  std::streamsize xsputn(const Char* s, std::streamsize count) FMT_OVERRIDE {
+    buffer_.append(s, s + count);
+    return count;
+  }
+};
+
+template <typename Char> struct test_stream : std::basic_ostream<Char> {
+ private:
+  // Hide all operator<< from std::basic_ostream<Char>.
+  void_t<> operator<<(null<>);
+  void_t<> operator<<(const Char*);
+
+  template <typename T, FMT_ENABLE_IF(std::is_convertible<T, int>::value &&
+                                      !std::is_enum<T>::value)>
+  void_t<> operator<<(T);
+};
+
+// Checks if T has a user-defined operator<< (e.g. not a member of
+// std::ostream).
+template <typename T, typename Char> class is_streamable {
+ private:
+  template <typename U>
+  static bool_constant<!std::is_same<decltype(std::declval<test_stream<Char>&>()
+                                              << std::declval<U>()),
+                                     void_t<>>::value>
+  test(int);
+
+  template <typename> static std::false_type test(...);
+
+  using result = decltype(test<T>(0));
+
+ public:
+  static const bool value = result::value;
+};
+
+// Write the content of buf to os.
+template <typename Char>
+void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
+  const Char* buf_data = buf.data();
+  using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
+  unsigned_streamsize size = buf.size();
+  unsigned_streamsize max_size = to_unsigned(max_value<std::streamsize>());
+  do {
+    unsigned_streamsize n = size <= max_size ? size : max_size;
+    os.write(buf_data, static_cast<std::streamsize>(n));
+    buf_data += n;
+    size -= n;
+  } while (size != 0);
+}
+
+template <typename Char, typename T>
+void format_value(buffer<Char>& buf, const T& value,
+                  locale_ref loc = locale_ref()) {
+  formatbuf<Char> format_buf(buf);
+  std::basic_ostream<Char> output(&format_buf);
+  #if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+  if (loc) output.imbue(loc.get<std::locale>());
+  #endif
+  output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
+  output << value;
+  buf.resize(buf.size());
+}
+
+// Formats an object of type T that has an overloaded ostream operator<<.
+template <typename T, typename Char>
+struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>>
+    : formatter<basic_string_view<Char>, Char> {
+  template <typename Context>
+  auto format(const T& value, Context& ctx) -> decltype(ctx.out()) {
+    basic_memory_buffer<Char> buffer;
+    format_value(buffer, value, ctx.locale());
+    basic_string_view<Char> str(buffer.data(), buffer.size());
+    return formatter<basic_string_view<Char>, Char>::format(str, ctx);
+  }
+};
+}  // namespace internal
+
+template <typename Char>
+void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
+            basic_format_args<buffer_context<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  internal::vformat_to(buffer, format_str, args);
+  internal::write(os, buffer);
+}
+
+/**
+  \rst
+  Prints formatted data to the stream *os*.
+
+  **Example**::
+
+    fmt::print(cerr, "Don't {}!", "panic");
+  \endrst
+ */
+template <typename S, typename... Args,
+          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+void print(std::basic_ostream<Char>& os, const S& format_str, Args&&... args) {
+  vprint(os, to_string_view(format_str),
+         internal::make_args_checked<Args...>(format_str, args...));
+}
+FMT_END_NAMESPACE
+
+#endif  // FMT_OSTREAM_H_

oss/fmt/include/fmt/posix.h

@@ -0,0 +1,2 @@
+#include "os.h"
+#warning "fmt/posix.h is deprecated; use fmt/os.h instead"

oss/fmt/include/fmt/printf.h

@@ -0,0 +1,721 @@
+// Formatting library for C++ - legacy printf implementation
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_PRINTF_H_
+#define FMT_PRINTF_H_
+
+#include <algorithm>  // std::max
+#include <limits>     // std::numeric_limits
+
+#include "ostream.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+// Checks if a value fits in int - used to avoid warnings about comparing
+// signed and unsigned integers.
+template <bool IsSigned> struct int_checker {
+  template <typename T> static bool fits_in_int(T value) {
+    unsigned max = max_value<int>();
+    return value <= max;
+  }
+  static bool fits_in_int(bool) { return true; }
+};
+
+template <> struct int_checker<true> {
+  template <typename T> static bool fits_in_int(T value) {
+    return value >= (std::numeric_limits<int>::min)() &&
+           value <= max_value<int>();
+  }
+  static bool fits_in_int(int) { return true; }
+};
+
+class printf_precision_handler {
+ public:
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  int operator()(T value) {
+    if (!int_checker<std::numeric_limits<T>::is_signed>::fits_in_int(value))
+      FMT_THROW(format_error("number is too big"));
+    return (std::max)(static_cast<int>(value), 0);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  int operator()(T) {
+    FMT_THROW(format_error("precision is not integer"));
+    return 0;
+  }
+};
+
+// An argument visitor that returns true iff arg is a zero integer.
+class is_zero_int {
+ public:
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  bool operator()(T value) {
+    return value == 0;
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  bool operator()(T) {
+    return false;
+  }
+};
+
+template <typename T> struct make_unsigned_or_bool : std::make_unsigned<T> {};
+
+template <> struct make_unsigned_or_bool<bool> { using type = bool; };
+
+template <typename T, typename Context> class arg_converter {
+ private:
+  using char_type = typename Context::char_type;
+
+  basic_format_arg<Context>& arg_;
+  char_type type_;
+
+ public:
+  arg_converter(basic_format_arg<Context>& arg, char_type type)
+      : arg_(arg), type_(type) {}
+
+  void operator()(bool value) {
+    if (type_ != 's') operator()<bool>(value);
+  }
+
+  template <typename U, FMT_ENABLE_IF(std::is_integral<U>::value)>
+  void operator()(U value) {
+    bool is_signed = type_ == 'd' || type_ == 'i';
+    using target_type = conditional_t<std::is_same<T, void>::value, U, T>;
+    if (const_check(sizeof(target_type) <= sizeof(int))) {
+      // Extra casts are used to silence warnings.
+      if (is_signed) {
+        arg_ = internal::make_arg<Context>(
+            static_cast<int>(static_cast<target_type>(value)));
+      } else {
+        using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
+        arg_ = internal::make_arg<Context>(
+            static_cast<unsigned>(static_cast<unsigned_type>(value)));
+      }
+    } else {
+      if (is_signed) {
+        // glibc's printf doesn't sign extend arguments of smaller types:
+        //   std::printf("%lld", -42);  // prints "4294967254"
+        // but we don't have to do the same because it's a UB.
+        arg_ = internal::make_arg<Context>(static_cast<long long>(value));
+      } else {
+        arg_ = internal::make_arg<Context>(
+            static_cast<typename make_unsigned_or_bool<U>::type>(value));
+      }
+    }
+  }
+
+  template <typename U, FMT_ENABLE_IF(!std::is_integral<U>::value)>
+  void operator()(U) {}  // No conversion needed for non-integral types.
+};
+
+// Converts an integer argument to T for printf, if T is an integral type.
+// If T is void, the argument is converted to corresponding signed or unsigned
+// type depending on the type specifier: 'd' and 'i' - signed, other -
+// unsigned).
+template <typename T, typename Context, typename Char>
+void convert_arg(basic_format_arg<Context>& arg, Char type) {
+  visit_format_arg(arg_converter<T, Context>(arg, type), arg);
+}
+
+// Converts an integer argument to char for printf.
+template <typename Context> class char_converter {
+ private:
+  basic_format_arg<Context>& arg_;
+
+ public:
+  explicit char_converter(basic_format_arg<Context>& arg) : arg_(arg) {}
+
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  void operator()(T value) {
+    arg_ = internal::make_arg<Context>(
+        static_cast<typename Context::char_type>(value));
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  void operator()(T) {}  // No conversion needed for non-integral types.
+};
+
+// Checks if an argument is a valid printf width specifier and sets
+// left alignment if it is negative.
+template <typename Char> class printf_width_handler {
+ private:
+  using format_specs = basic_format_specs<Char>;
+
+  format_specs& specs_;
+
+ public:
+  explicit printf_width_handler(format_specs& specs) : specs_(specs) {}
+
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  unsigned operator()(T value) {
+    auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
+    if (internal::is_negative(value)) {
+      specs_.align = align::left;
+      width = 0 - width;
+    }
+    unsigned int_max = max_value<int>();
+    if (width > int_max) FMT_THROW(format_error("number is too big"));
+    return static_cast<unsigned>(width);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  unsigned operator()(T) {
+    FMT_THROW(format_error("width is not integer"));
+    return 0;
+  }
+};
+
+template <typename Char, typename Context>
+void printf(buffer<Char>& buf, basic_string_view<Char> format,
+            basic_format_args<Context> args) {
+  Context(std::back_inserter(buf), format, args).format();
+}
+
+template <typename OutputIt, typename Char, typename Context>
+internal::truncating_iterator<OutputIt> printf(
+    internal::truncating_iterator<OutputIt> it, basic_string_view<Char> format,
+    basic_format_args<Context> args) {
+  return Context(it, format, args).format();
+}
+}  // namespace internal
+
+using internal::printf;  // For printing into memory_buffer.
+
+template <typename Range> class printf_arg_formatter;
+
+template <typename OutputIt, typename Char> class basic_printf_context;
+
+/**
+  \rst
+  The ``printf`` argument formatter.
+  \endrst
+ */
+template <typename Range>
+class printf_arg_formatter : public internal::arg_formatter_base<Range> {
+ public:
+  using iterator = typename Range::iterator;
+
+ private:
+  using char_type = typename Range::value_type;
+  using base = internal::arg_formatter_base<Range>;
+  using context_type = basic_printf_context<iterator, char_type>;
+
+  context_type& context_;
+
+  void write_null_pointer(char) {
+    this->specs()->type = 0;
+    this->write("(nil)");
+  }
+
+  void write_null_pointer(wchar_t) {
+    this->specs()->type = 0;
+    this->write(L"(nil)");
+  }
+
+ public:
+  using format_specs = typename base::format_specs;
+
+  /**
+    \rst
+    Constructs an argument formatter object.
+    *buffer* is a reference to the output buffer and *specs* contains format
+    specifier information for standard argument types.
+    \endrst
+   */
+  printf_arg_formatter(iterator iter, format_specs& specs, context_type& ctx)
+      : base(Range(iter), &specs, internal::locale_ref()), context_(ctx) {}
+
+  template <typename T, FMT_ENABLE_IF(fmt::internal::is_integral<T>::value)>
+  iterator operator()(T value) {
+    // MSVC2013 fails to compile separate overloads for bool and char_type so
+    // use std::is_same instead.
+    if (std::is_same<T, bool>::value) {
+      format_specs& fmt_specs = *this->specs();
+      if (fmt_specs.type != 's') return base::operator()(value ? 1 : 0);
+      fmt_specs.type = 0;
+      this->write(value != 0);
+    } else if (std::is_same<T, char_type>::value) {
+      format_specs& fmt_specs = *this->specs();
+      if (fmt_specs.type && fmt_specs.type != 'c')
+        return (*this)(static_cast<int>(value));
+      fmt_specs.sign = sign::none;
+      fmt_specs.alt = false;
+      fmt_specs.align = align::right;
+      return base::operator()(value);
+    } else {
+      return base::operator()(value);
+    }
+    return this->out();
+  }
+
+  template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+  iterator operator()(T value) {
+    return base::operator()(value);
+  }
+
+  /** Formats a null-terminated C string. */
+  iterator operator()(const char* value) {
+    if (value)
+      base::operator()(value);
+    else if (this->specs()->type == 'p')
+      write_null_pointer(char_type());
+    else
+      this->write("(null)");
+    return this->out();
+  }
+
+  /** Formats a null-terminated wide C string. */
+  iterator operator()(const wchar_t* value) {
+    if (value)
+      base::operator()(value);
+    else if (this->specs()->type == 'p')
+      write_null_pointer(char_type());
+    else
+      this->write(L"(null)");
+    return this->out();
+  }
+
+  iterator operator()(basic_string_view<char_type> value) {
+    return base::operator()(value);
+  }
+
+  iterator operator()(monostate value) { return base::operator()(value); }
+
+  /** Formats a pointer. */
+  iterator operator()(const void* value) {
+    if (value) return base::operator()(value);
+    this->specs()->type = 0;
+    write_null_pointer(char_type());
+    return this->out();
+  }
+
+  /** Formats an argument of a custom (user-defined) type. */
+  iterator operator()(typename basic_format_arg<context_type>::handle handle) {
+    handle.format(context_.parse_context(), context_);
+    return this->out();
+  }
+};
+
+template <typename T> struct printf_formatter {
+  printf_formatter() = delete;
+
+  template <typename ParseContext>
+  auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const T& value, FormatContext& ctx) -> decltype(ctx.out()) {
+    internal::format_value(internal::get_container(ctx.out()), value);
+    return ctx.out();
+  }
+};
+
+/** This template formats data and writes the output to a writer. */
+template <typename OutputIt, typename Char> class basic_printf_context {
+ public:
+  /** The character type for the output. */
+  using char_type = Char;
+  using iterator = OutputIt;
+  using format_arg = basic_format_arg<basic_printf_context>;
+  template <typename T> using formatter_type = printf_formatter<T>;
+
+ private:
+  using format_specs = basic_format_specs<char_type>;
+
+  OutputIt out_;
+  basic_format_args<basic_printf_context> args_;
+  basic_format_parse_context<Char> parse_ctx_;
+
+  static void parse_flags(format_specs& specs, const Char*& it,
+                          const Char* end);
+
+  // Returns the argument with specified index or, if arg_index is -1, the next
+  // argument.
+  format_arg get_arg(int arg_index = -1);
+
+  // Parses argument index, flags and width and returns the argument index.
+  int parse_header(const Char*& it, const Char* end, format_specs& specs);
+
+ public:
+  /**
+   \rst
+   Constructs a ``printf_context`` object. References to the arguments and
+   the writer are stored in the context object so make sure they have
+   appropriate lifetimes.
+   \endrst
+   */
+  basic_printf_context(OutputIt out, basic_string_view<char_type> format_str,
+                       basic_format_args<basic_printf_context> args)
+      : out_(out), args_(args), parse_ctx_(format_str) {}
+
+  OutputIt out() { return out_; }
+  void advance_to(OutputIt it) { out_ = it; }
+
+  internal::locale_ref locale() { return {}; }
+
+  format_arg arg(int id) const { return args_.get(id); }
+
+  basic_format_parse_context<Char>& parse_context() { return parse_ctx_; }
+
+  FMT_CONSTEXPR void on_error(const char* message) {
+    parse_ctx_.on_error(message);
+  }
+
+  /** Formats stored arguments and writes the output to the range. */
+  template <typename ArgFormatter = printf_arg_formatter<buffer_range<Char>>>
+  OutputIt format();
+};
+
+template <typename OutputIt, typename Char>
+void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
+                                                       const Char*& it,
+                                                       const Char* end) {
+  for (; it != end; ++it) {
+    switch (*it) {
+    case '-':
+      specs.align = align::left;
+      break;
+    case '+':
+      specs.sign = sign::plus;
+      break;
+    case '0':
+      specs.fill[0] = '0';
+      break;
+    case ' ':
+      specs.sign = sign::space;
+      break;
+    case '#':
+      specs.alt = true;
+      break;
+    default:
+      return;
+    }
+  }
+}
+
+template <typename OutputIt, typename Char>
+typename basic_printf_context<OutputIt, Char>::format_arg
+basic_printf_context<OutputIt, Char>::get_arg(int arg_index) {
+  if (arg_index < 0)
+    arg_index = parse_ctx_.next_arg_id();
+  else
+    parse_ctx_.check_arg_id(--arg_index);
+  return internal::get_arg(*this, arg_index);
+}
+
+template <typename OutputIt, typename Char>
+int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it,
+                                                       const Char* end,
+                                                       format_specs& specs) {
+  int arg_index = -1;
+  char_type c = *it;
+  if (c >= '0' && c <= '9') {
+    // Parse an argument index (if followed by '$') or a width possibly
+    // preceded with '0' flag(s).
+    internal::error_handler eh;
+    int value = parse_nonnegative_int(it, end, eh);
+    if (it != end && *it == '$') {  // value is an argument index
+      ++it;
+      arg_index = value;
+    } else {
+      if (c == '0') specs.fill[0] = '0';
+      if (value != 0) {
+        // Nonzero value means that we parsed width and don't need to
+        // parse it or flags again, so return now.
+        specs.width = value;
+        return arg_index;
+      }
+    }
+  }
+  parse_flags(specs, it, end);
+  // Parse width.
+  if (it != end) {
+    if (*it >= '0' && *it <= '9') {
+      internal::error_handler eh;
+      specs.width = parse_nonnegative_int(it, end, eh);
+    } else if (*it == '*') {
+      ++it;
+      specs.width = static_cast<int>(visit_format_arg(
+          internal::printf_width_handler<char_type>(specs), get_arg()));
+    }
+  }
+  return arg_index;
+}
+
+template <typename OutputIt, typename Char>
+template <typename ArgFormatter>
+OutputIt basic_printf_context<OutputIt, Char>::format() {
+  auto out = this->out();
+  const Char* start = parse_ctx_.begin();
+  const Char* end = parse_ctx_.end();
+  auto it = start;
+  while (it != end) {
+    char_type c = *it++;
+    if (c != '%') continue;
+    if (it != end && *it == c) {
+      out = std::copy(start, it, out);
+      start = ++it;
+      continue;
+    }
+    out = std::copy(start, it - 1, out);
+
+    format_specs specs;
+    specs.align = align::right;
+
+    // Parse argument index, flags and width.
+    int arg_index = parse_header(it, end, specs);
+    if (arg_index == 0) on_error("argument index out of range");
+
+    // Parse precision.
+    if (it != end && *it == '.') {
+      ++it;
+      c = it != end ? *it : 0;
+      if ('0' <= c && c <= '9') {
+        internal::error_handler eh;
+        specs.precision = parse_nonnegative_int(it, end, eh);
+      } else if (c == '*') {
+        ++it;
+        specs.precision = static_cast<int>(
+            visit_format_arg(internal::printf_precision_handler(), get_arg()));
+      } else {
+        specs.precision = 0;
+      }
+    }
+
+    format_arg arg = get_arg(arg_index);
+    if (specs.alt && visit_format_arg(internal::is_zero_int(), arg))
+      specs.alt = false;
+    if (specs.fill[0] == '0') {
+      if (arg.is_arithmetic())
+        specs.align = align::numeric;
+      else
+        specs.fill[0] = ' ';  // Ignore '0' flag for non-numeric types.
+    }
+
+    // Parse length and convert the argument to the required type.
+    c = it != end ? *it++ : 0;
+    char_type t = it != end ? *it : 0;
+    using internal::convert_arg;
+    switch (c) {
+    case 'h':
+      if (t == 'h') {
+        ++it;
+        t = it != end ? *it : 0;
+        convert_arg<signed char>(arg, t);
+      } else {
+        convert_arg<short>(arg, t);
+      }
+      break;
+    case 'l':
+      if (t == 'l') {
+        ++it;
+        t = it != end ? *it : 0;
+        convert_arg<long long>(arg, t);
+      } else {
+        convert_arg<long>(arg, t);
+      }
+      break;
+    case 'j':
+      convert_arg<intmax_t>(arg, t);
+      break;
+    case 'z':
+      convert_arg<std::size_t>(arg, t);
+      break;
+    case 't':
+      convert_arg<std::ptrdiff_t>(arg, t);
+      break;
+    case 'L':
+      // printf produces garbage when 'L' is omitted for long double, no
+      // need to do the same.
+      break;
+    default:
+      --it;
+      convert_arg<void>(arg, c);
+    }
+
+    // Parse type.
+    if (it == end) FMT_THROW(format_error("invalid format string"));
+    specs.type = static_cast<char>(*it++);
+    if (arg.is_integral()) {
+      // Normalize type.
+      switch (specs.type) {
+      case 'i':
+      case 'u':
+        specs.type = 'd';
+        break;
+      case 'c':
+        visit_format_arg(internal::char_converter<basic_printf_context>(arg),
+                         arg);
+        break;
+      }
+    }
+
+    start = it;
+
+    // Format argument.
+    visit_format_arg(ArgFormatter(out, specs, *this), arg);
+  }
+  return std::copy(start, it, out);
+}
+
+template <typename Char>
+using basic_printf_context_t =
+    basic_printf_context<std::back_insert_iterator<internal::buffer<Char>>,
+                         Char>;
+
+using printf_context = basic_printf_context_t<char>;
+using wprintf_context = basic_printf_context_t<wchar_t>;
+
+using printf_args = basic_format_args<printf_context>;
+using wprintf_args = basic_format_args<wprintf_context>;
+
+/**
+  \rst
+  Constructs an `~fmt::format_arg_store` object that contains references to
+  arguments and can be implicitly converted to `~fmt::printf_args`.
+  \endrst
+ */
+template <typename... Args>
+inline format_arg_store<printf_context, Args...> make_printf_args(
+    const Args&... args) {
+  return {args...};
+}
+
+/**
+  \rst
+  Constructs an `~fmt::format_arg_store` object that contains references to
+  arguments and can be implicitly converted to `~fmt::wprintf_args`.
+  \endrst
+ */
+template <typename... Args>
+inline format_arg_store<wprintf_context, Args...> make_wprintf_args(
+    const Args&... args) {
+  return {args...};
+}
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vsprintf(
+    const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  printf(buffer, to_string_view(format), args);
+  return to_string(buffer);
+}
+
+/**
+  \rst
+  Formats arguments and returns the result as a string.
+
+  **Example**::
+
+    std::string message = fmt::sprintf("The answer is %d", 42);
+  \endrst
+*/
+template <typename S, typename... Args,
+          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+inline std::basic_string<Char> sprintf(const S& format, const Args&... args) {
+  using context = basic_printf_context_t<Char>;
+  return vsprintf(to_string_view(format), make_format_args<context>(args...));
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vfprintf(
+    std::FILE* f, const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  printf(buffer, to_string_view(format), args);
+  std::size_t size = buffer.size();
+  return std::fwrite(buffer.data(), sizeof(Char), size, f) < size
+             ? -1
+             : static_cast<int>(size);
+}
+
+/**
+  \rst
+  Prints formatted data to the file *f*.
+
+  **Example**::
+
+    fmt::fprintf(stderr, "Don't %s!", "panic");
+  \endrst
+ */
+template <typename S, typename... Args,
+          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+inline int fprintf(std::FILE* f, const S& format, const Args&... args) {
+  using context = basic_printf_context_t<Char>;
+  return vfprintf(f, to_string_view(format),
+                  make_format_args<context>(args...));
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vprintf(
+    const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  return vfprintf(stdout, to_string_view(format), args);
+}
+
+/**
+  \rst
+  Prints formatted data to ``stdout``.
+
+  **Example**::
+
+    fmt::printf("Elapsed time: %.2f seconds", 1.23);
+  \endrst
+ */
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(internal::is_string<S>::value)>
+inline int printf(const S& format_str, const Args&... args) {
+  using context = basic_printf_context_t<char_t<S>>;
+  return vprintf(to_string_view(format_str),
+                 make_format_args<context>(args...));
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vfprintf(
+    std::basic_ostream<Char>& os, const S& format,
+    basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) {
+  basic_memory_buffer<Char> buffer;
+  printf(buffer, to_string_view(format), args);
+  internal::write(os, buffer);
+  return static_cast<int>(buffer.size());
+}
+
+/** Formats arguments and writes the output to the range. */
+template <typename ArgFormatter, typename Char,
+          typename Context =
+              basic_printf_context<typename ArgFormatter::iterator, Char>>
+typename ArgFormatter::iterator vprintf(
+    internal::buffer<Char>& out, basic_string_view<Char> format_str,
+    basic_format_args<type_identity_t<Context>> args) {
+  typename ArgFormatter::iterator iter(out);
+  Context(iter, format_str, args).template format<ArgFormatter>();
+  return iter;
+}
+
+/**
+  \rst
+  Prints formatted data to the stream *os*.
+
+  **Example**::
+
+    fmt::fprintf(cerr, "Don't %s!", "panic");
+  \endrst
+ */
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline int fprintf(std::basic_ostream<Char>& os, const S& format_str,
+                   const Args&... args) {
+  using context = basic_printf_context_t<Char>;
+  return vfprintf(os, to_string_view(format_str),
+                  make_format_args<context>(args...));
+}
+FMT_END_NAMESPACE
+
+#endif  // FMT_PRINTF_H_

oss/fmt/include/fmt/ranges.h

@@ -0,0 +1,387 @@
+// Formatting library for C++ - experimental range support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+//
+// Copyright (c) 2018 - present, Remotion (Igor Schulz)
+// All Rights Reserved
+// {fmt} support for ranges, containers and types tuple interface.
+
+#ifndef FMT_RANGES_H_
+#define FMT_RANGES_H_
+
+#include <initializer_list>
+#include <type_traits>
+
+#include "format.h"
+
+// output only up to N items from the range.
+#ifndef FMT_RANGE_OUTPUT_LENGTH_LIMIT
+#  define FMT_RANGE_OUTPUT_LENGTH_LIMIT 256
+#endif
+
+FMT_BEGIN_NAMESPACE
+
+template <typename Char> struct formatting_base {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+};
+
+template <typename Char, typename Enable = void>
+struct formatting_range : formatting_base<Char> {
+  static FMT_CONSTEXPR_DECL const std::size_t range_length_limit =
+      FMT_RANGE_OUTPUT_LENGTH_LIMIT;  // output only up to N items from the
+                                      // range.
+  Char prefix;
+  Char delimiter;
+  Char postfix;
+  formatting_range() : prefix('{'), delimiter(','), postfix('}') {}
+  static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
+  static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
+};
+
+template <typename Char, typename Enable = void>
+struct formatting_tuple : formatting_base<Char> {
+  Char prefix;
+  Char delimiter;
+  Char postfix;
+  formatting_tuple() : prefix('('), delimiter(','), postfix(')') {}
+  static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
+  static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
+};
+
+namespace internal {
+
+template <typename RangeT, typename OutputIterator>
+OutputIterator copy(const RangeT& range, OutputIterator out) {
+  for (auto it = range.begin(), end = range.end(); it != end; ++it)
+    *out++ = *it;
+  return out;
+}
+
+template <typename OutputIterator>
+OutputIterator copy(const char* str, OutputIterator out) {
+  while (*str) *out++ = *str++;
+  return out;
+}
+
+template <typename OutputIterator>
+OutputIterator copy(char ch, OutputIterator out) {
+  *out++ = ch;
+  return out;
+}
+
+/// Return true value if T has std::string interface, like std::string_view.
+template <typename T> class is_like_std_string {
+  template <typename U>
+  static auto check(U* p)
+      -> decltype((void)p->find('a'), p->length(), (void)p->data(), int());
+  template <typename> static void check(...);
+
+ public:
+  static FMT_CONSTEXPR_DECL const bool value =
+      is_string<T>::value || !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+template <typename Char>
+struct is_like_std_string<fmt::basic_string_view<Char>> : std::true_type {};
+
+template <typename... Ts> struct conditional_helper {};
+
+template <typename T, typename _ = void> struct is_range_ : std::false_type {};
+
+#if !FMT_MSC_VER || FMT_MSC_VER > 1800
+template <typename T>
+struct is_range_<
+    T, conditional_t<false,
+                     conditional_helper<decltype(std::declval<T>().begin()),
+                                        decltype(std::declval<T>().end())>,
+                     void>> : std::true_type {};
+#endif
+
+/// tuple_size and tuple_element check.
+template <typename T> class is_tuple_like_ {
+  template <typename U>
+  static auto check(U* p) -> decltype(std::tuple_size<U>::value, int());
+  template <typename> static void check(...);
+
+ public:
+  static FMT_CONSTEXPR_DECL const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+// Check for integer_sequence
+#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VER >= 1900
+template <typename T, T... N>
+using integer_sequence = std::integer_sequence<T, N...>;
+template <std::size_t... N> using index_sequence = std::index_sequence<N...>;
+template <std::size_t N>
+using make_index_sequence = std::make_index_sequence<N>;
+#else
+template <typename T, T... N> struct integer_sequence {
+  using value_type = T;
+
+  static FMT_CONSTEXPR std::size_t size() { return sizeof...(N); }
+};
+
+template <std::size_t... N>
+using index_sequence = integer_sequence<std::size_t, N...>;
+
+template <typename T, std::size_t N, T... Ns>
+struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {};
+template <typename T, T... Ns>
+struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {};
+
+template <std::size_t N>
+using make_index_sequence = make_integer_sequence<std::size_t, N>;
+#endif
+
+template <class Tuple, class F, size_t... Is>
+void for_each(index_sequence<Is...>, Tuple&& tup, F&& f) FMT_NOEXCEPT {
+  using std::get;
+  // using free function get<I>(T) now.
+  const int _[] = {0, ((void)f(get<Is>(tup)), 0)...};
+  (void)_;  // blocks warnings
+}
+
+template <class T>
+FMT_CONSTEXPR make_index_sequence<std::tuple_size<T>::value> get_indexes(
+    T const&) {
+  return {};
+}
+
+template <class Tuple, class F> void for_each(Tuple&& tup, F&& f) {
+  const auto indexes = get_indexes(tup);
+  for_each(indexes, std::forward<Tuple>(tup), std::forward<F>(f));
+}
+
+template <typename Arg, FMT_ENABLE_IF(!is_like_std_string<
+                                      typename std::decay<Arg>::type>::value)>
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
+  return add_space ? " {}" : "{}";
+}
+
+template <typename Arg, FMT_ENABLE_IF(is_like_std_string<
+                                      typename std::decay<Arg>::type>::value)>
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
+  return add_space ? " \"{}\"" : "\"{}\"";
+}
+
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char*) {
+  return add_space ? " \"{}\"" : "\"{}\"";
+}
+FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t*) {
+  return add_space ? L" \"{}\"" : L"\"{}\"";
+}
+
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char) {
+  return add_space ? " '{}'" : "'{}'";
+}
+FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t) {
+  return add_space ? L" '{}'" : L"'{}'";
+}
+
+}  // namespace internal
+
+template <typename T> struct is_tuple_like {
+  static FMT_CONSTEXPR_DECL const bool value =
+      internal::is_tuple_like_<T>::value && !internal::is_range_<T>::value;
+};
+
+template <typename TupleT, typename Char>
+struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> {
+ private:
+  // C++11 generic lambda for format()
+  template <typename FormatContext> struct format_each {
+    template <typename T> void operator()(const T& v) {
+      if (i > 0) {
+        if (formatting.add_prepostfix_space) {
+          *out++ = ' ';
+        }
+        out = internal::copy(formatting.delimiter, out);
+      }
+      out = format_to(out,
+                      internal::format_str_quoted(
+                          (formatting.add_delimiter_spaces && i > 0), v),
+                      v);
+      ++i;
+    }
+
+    formatting_tuple<Char>& formatting;
+    std::size_t& i;
+    typename std::add_lvalue_reference<decltype(
+        std::declval<FormatContext>().out())>::type out;
+  };
+
+ public:
+  formatting_tuple<Char> formatting;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return formatting.parse(ctx);
+  }
+
+  template <typename FormatContext = format_context>
+  auto format(const TupleT& values, FormatContext& ctx) -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    std::size_t i = 0;
+    internal::copy(formatting.prefix, out);
+
+    internal::for_each(values, format_each<FormatContext>{formatting, i, out});
+    if (formatting.add_prepostfix_space) {
+      *out++ = ' ';
+    }
+    internal::copy(formatting.postfix, out);
+
+    return ctx.out();
+  }
+};
+
+template <typename T, typename Char> struct is_range {
+  static FMT_CONSTEXPR_DECL const bool value =
+      internal::is_range_<T>::value &&
+      !internal::is_like_std_string<T>::value &&
+      !std::is_convertible<T, std::basic_string<Char>>::value &&
+      !std::is_constructible<internal::std_string_view<Char>, T>::value;
+};
+
+template <typename RangeT, typename Char>
+struct formatter<RangeT, Char,
+                 enable_if_t<fmt::is_range<RangeT, Char>::value>> {
+  formatting_range<Char> formatting;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return formatting.parse(ctx);
+  }
+
+  template <typename FormatContext>
+  typename FormatContext::iterator format(const RangeT& values,
+                                          FormatContext& ctx) {
+    auto out = internal::copy(formatting.prefix, ctx.out());
+    std::size_t i = 0;
+    for (auto it = values.begin(), end = values.end(); it != end; ++it) {
+      if (i > 0) {
+        if (formatting.add_prepostfix_space) *out++ = ' ';
+        out = internal::copy(formatting.delimiter, out);
+      }
+      out = format_to(out,
+                      internal::format_str_quoted(
+                          (formatting.add_delimiter_spaces && i > 0), *it),
+                      *it);
+      if (++i > formatting.range_length_limit) {
+        out = format_to(out, " ... <other elements>");
+        break;
+      }
+    }
+    if (formatting.add_prepostfix_space) *out++ = ' ';
+    return internal::copy(formatting.postfix, out);
+  }
+};
+
+template <typename Char, typename... T> struct tuple_arg_join : internal::view {
+  const std::tuple<T...>& tuple;
+  basic_string_view<Char> sep;
+
+  tuple_arg_join(const std::tuple<T...>& t, basic_string_view<Char> s)
+      : tuple{t}, sep{s} {}
+};
+
+template <typename Char, typename... T>
+struct formatter<tuple_arg_join<Char, T...>, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  typename FormatContext::iterator format(
+      const tuple_arg_join<Char, T...>& value, FormatContext& ctx) {
+    return format(value, ctx, internal::make_index_sequence<sizeof...(T)>{});
+  }
+
+ private:
+  template <typename FormatContext, size_t... N>
+  typename FormatContext::iterator format(
+      const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
+      internal::index_sequence<N...>) {
+    return format_args(value, ctx, std::get<N>(value.tuple)...);
+  }
+
+  template <typename FormatContext>
+  typename FormatContext::iterator format_args(
+      const tuple_arg_join<Char, T...>&, FormatContext& ctx) {
+    // NOTE: for compilers that support C++17, this empty function instantiation
+    // can be replaced with a constexpr branch in the variadic overload.
+    return ctx.out();
+  }
+
+  template <typename FormatContext, typename Arg, typename... Args>
+  typename FormatContext::iterator format_args(
+      const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
+      const Arg& arg, const Args&... args) {
+    using base = formatter<typename std::decay<Arg>::type, Char>;
+    auto out = ctx.out();
+    out = base{}.format(arg, ctx);
+    if (sizeof...(Args) > 0) {
+      out = std::copy(value.sep.begin(), value.sep.end(), out);
+      ctx.advance_to(out);
+      return format_args(value, ctx, args...);
+    }
+    return out;
+  }
+};
+
+/**
+  \rst
+  Returns an object that formats `tuple` with elements separated by `sep`.
+
+  **Example**::
+
+    std::tuple<int, char> t = {1, 'a'};
+    fmt::print("{}", fmt::join(t, ", "));
+    // Output: "1, a"
+  \endrst
+ */
+template <typename... T>
+FMT_CONSTEXPR tuple_arg_join<char, T...> join(const std::tuple<T...>& tuple,
+                                              string_view sep) {
+  return {tuple, sep};
+}
+
+template <typename... T>
+FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple,
+                                                 wstring_view sep) {
+  return {tuple, sep};
+}
+
+/**
+  \rst
+  Returns an object that formats `initializer_list` with elements separated by
+  `sep`.
+
+  **Example**::
+
+    fmt::print("{}", fmt::join({1, 2, 3}, ", "));
+    // Output: "1, 2, 3"
+  \endrst
+ */
+template <typename T>
+arg_join<internal::iterator_t<const std::initializer_list<T>>, char> join(
+    std::initializer_list<T> list, string_view sep) {
+  return join(std::begin(list), std::end(list), sep);
+}
+
+template <typename T>
+arg_join<internal::iterator_t<const std::initializer_list<T>>, wchar_t> join(
+    std::initializer_list<T> list, wstring_view sep) {
+  return join(std::begin(list), std::end(list), sep);
+}
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_RANGES_H_

oss/fmt/src/format.cc

@@ -0,0 +1,176 @@
+// Formatting library for C++
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#include "fmt/format-inl.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+template <typename T>
+int format_float(char* buf, std::size_t size, const char* format, int precision,
+                 T value) {
+#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
+  if (precision > 100000)
+    throw std::runtime_error(
+        "fuzz mode - avoid large allocation inside snprintf");
+#endif
+  // Suppress the warning about nonliteral format string.
+  int (*snprintf_ptr)(char*, size_t, const char*, ...) = FMT_SNPRINTF;
+  return precision < 0 ? snprintf_ptr(buf, size, format, value)
+                       : snprintf_ptr(buf, size, format, precision, value);
+}
+struct sprintf_specs {
+  int precision;
+  char type;
+  bool alt : 1;
+
+  template <typename Char>
+  constexpr sprintf_specs(basic_format_specs<Char> specs)
+      : precision(specs.precision), type(specs.type), alt(specs.alt) {}
+
+  constexpr bool has_precision() const { return precision >= 0; }
+};
+
+// This is deprecated and is kept only to preserve ABI compatibility.
+template <typename Double>
+char* sprintf_format(Double value, internal::buffer<char>& buf,
+                     sprintf_specs specs) {
+  // Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
+  FMT_ASSERT(buf.capacity() != 0, "empty buffer");
+
+  // Build format string.
+  enum { max_format_size = 10 };  // longest format: %#-*.*Lg
+  char format[max_format_size];
+  char* format_ptr = format;
+  *format_ptr++ = '%';
+  if (specs.alt || !specs.type) *format_ptr++ = '#';
+  if (specs.precision >= 0) {
+    *format_ptr++ = '.';
+    *format_ptr++ = '*';
+  }
+  if (std::is_same<Double, long double>::value) *format_ptr++ = 'L';
+
+  char type = specs.type;
+
+  if (type == '%')
+    type = 'f';
+  else if (type == 0 || type == 'n')
+    type = 'g';
+#if FMT_MSC_VER
+  if (type == 'F') {
+    // MSVC's printf doesn't support 'F'.
+    type = 'f';
+  }
+#endif
+  *format_ptr++ = type;
+  *format_ptr = '\0';
+
+  // Format using snprintf.
+  char* start = nullptr;
+  char* decimal_point_pos = nullptr;
+  for (;;) {
+    std::size_t buffer_size = buf.capacity();
+    start = &buf[0];
+    int result =
+        format_float(start, buffer_size, format, specs.precision, value);
+    if (result >= 0) {
+      unsigned n = internal::to_unsigned(result);
+      if (n < buf.capacity()) {
+        // Find the decimal point.
+        auto p = buf.data(), end = p + n;
+        if (*p == '+' || *p == '-') ++p;
+        if (specs.type != 'a' && specs.type != 'A') {
+          while (p < end && *p >= '0' && *p <= '9') ++p;
+          if (p < end && *p != 'e' && *p != 'E') {
+            decimal_point_pos = p;
+            if (!specs.type) {
+              // Keep only one trailing zero after the decimal point.
+              ++p;
+              if (*p == '0') ++p;
+              while (p != end && *p >= '1' && *p <= '9') ++p;
+              char* where = p;
+              while (p != end && *p == '0') ++p;
+              if (p == end || *p < '0' || *p > '9') {
+                if (p != end) std::memmove(where, p, to_unsigned(end - p));
+                n -= static_cast<unsigned>(p - where);
+              }
+            }
+          }
+        }
+        buf.resize(n);
+        break;  // The buffer is large enough - continue with formatting.
+      }
+      buf.reserve(n + 1);
+    } else {
+      // If result is negative we ask to increase the capacity by at least 1,
+      // but as std::vector, the buffer grows exponentially.
+      buf.reserve(buf.capacity() + 1);
+    }
+  }
+  return decimal_point_pos;
+}
+}  // namespace internal
+
+template FMT_API char* internal::sprintf_format(double, internal::buffer<char>&,
+                                                sprintf_specs);
+template FMT_API char* internal::sprintf_format(long double,
+                                                internal::buffer<char>&,
+                                                sprintf_specs);
+
+template struct FMT_INSTANTIATION_DEF_API internal::basic_data<void>;
+
+// Workaround a bug in MSVC2013 that prevents instantiation of format_float.
+int (*instantiate_format_float)(double, int, internal::float_specs,
+                                internal::buffer<char>&) =
+    internal::format_float;
+
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+template FMT_API internal::locale_ref::locale_ref(const std::locale& loc);
+template FMT_API std::locale internal::locale_ref::get<std::locale>() const;
+#endif
+
+// Explicit instantiations for char.
+
+template FMT_API std::string internal::grouping_impl<char>(locale_ref);
+template FMT_API char internal::thousands_sep_impl(locale_ref);
+template FMT_API char internal::decimal_point_impl(locale_ref);
+
+template FMT_API void internal::buffer<char>::append(const char*, const char*);
+
+template FMT_API void internal::arg_map<format_context>::init(
+    const basic_format_args<format_context>& args);
+
+template FMT_API std::string internal::vformat<char>(
+    string_view, basic_format_args<format_context>);
+
+template FMT_API format_context::iterator internal::vformat_to(
+    internal::buffer<char>&, string_view, basic_format_args<format_context>);
+
+template FMT_API int internal::snprintf_float(double, int,
+                                              internal::float_specs,
+                                              internal::buffer<char>&);
+template FMT_API int internal::snprintf_float(long double, int,
+                                              internal::float_specs,
+                                              internal::buffer<char>&);
+template FMT_API int internal::format_float(double, int, internal::float_specs,
+                                            internal::buffer<char>&);
+template FMT_API int internal::format_float(long double, int,
+                                            internal::float_specs,
+                                            internal::buffer<char>&);
+
+// Explicit instantiations for wchar_t.
+
+template FMT_API std::string internal::grouping_impl<wchar_t>(locale_ref);
+template FMT_API wchar_t internal::thousands_sep_impl(locale_ref);
+template FMT_API wchar_t internal::decimal_point_impl(locale_ref);
+
+template FMT_API void internal::buffer<wchar_t>::append(const wchar_t*,
+                                                        const wchar_t*);
+
+template FMT_API std::wstring internal::vformat<wchar_t>(
+    wstring_view, basic_format_args<wformat_context>);
+FMT_END_NAMESPACE

oss/fmt/src/os.cc

@@ -0,0 +1,316 @@
+// Formatting library for C++ - optional OS-specific functionality
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+// Disable bogus MSVC warnings.
+#if !defined(_CRT_SECURE_NO_WARNINGS) && defined(_MSC_VER)
+#  define _CRT_SECURE_NO_WARNINGS
+#endif
+
+#include "fmt/os.h"
+
+#include <climits>
+
+#if FMT_USE_FCNTL
+#  include <sys/stat.h>
+#  include <sys/types.h>
+
+#  ifndef _WIN32
+#    include <unistd.h>
+#  else
+#    ifndef WIN32_LEAN_AND_MEAN
+#      define WIN32_LEAN_AND_MEAN
+#    endif
+#    include <io.h>
+#    include <windows.h>
+
+#    define O_CREAT _O_CREAT
+#    define O_TRUNC _O_TRUNC
+
+#    ifndef S_IRUSR
+#      define S_IRUSR _S_IREAD
+#    endif
+
+#    ifndef S_IWUSR
+#      define S_IWUSR _S_IWRITE
+#    endif
+
+#    ifdef __MINGW32__
+#      define _SH_DENYNO 0x40
+#    endif
+#  endif  // _WIN32
+#endif    // FMT_USE_FCNTL
+
+#ifdef _WIN32
+#  include <windows.h>
+#endif
+
+#ifdef fileno
+#  undef fileno
+#endif
+
+namespace {
+#ifdef _WIN32
+// Return type of read and write functions.
+using RWResult = int;
+
+// On Windows the count argument to read and write is unsigned, so convert
+// it from size_t preventing integer overflow.
+inline unsigned convert_rwcount(std::size_t count) {
+  return count <= UINT_MAX ? static_cast<unsigned>(count) : UINT_MAX;
+}
+#else
+// Return type of read and write functions.
+using RWResult = ssize_t;
+
+inline std::size_t convert_rwcount(std::size_t count) { return count; }
+#endif
+}  // namespace
+
+FMT_BEGIN_NAMESPACE
+
+#ifdef _WIN32
+internal::utf16_to_utf8::utf16_to_utf8(wstring_view s) {
+  if (int error_code = convert(s)) {
+    FMT_THROW(windows_error(error_code,
+                            "cannot convert string from UTF-16 to UTF-8"));
+  }
+}
+
+int internal::utf16_to_utf8::convert(wstring_view s) {
+  if (s.size() > INT_MAX) return ERROR_INVALID_PARAMETER;
+  int s_size = static_cast<int>(s.size());
+  if (s_size == 0) {
+    // WideCharToMultiByte does not support zero length, handle separately.
+    buffer_.resize(1);
+    buffer_[0] = 0;
+    return 0;
+  }
+
+  int length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, nullptr, 0,
+                                   nullptr, nullptr);
+  if (length == 0) return GetLastError();
+  buffer_.resize(length + 1);
+  length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, &buffer_[0],
+                               length, nullptr, nullptr);
+  if (length == 0) return GetLastError();
+  buffer_[length] = 0;
+  return 0;
+}
+
+void windows_error::init(int err_code, string_view format_str,
+                         format_args args) {
+  error_code_ = err_code;
+  memory_buffer buffer;
+  internal::format_windows_error(buffer, err_code, vformat(format_str, args));
+  std::runtime_error& base = *this;
+  base = std::runtime_error(to_string(buffer));
+}
+
+void internal::format_windows_error(internal::buffer<char>& out, int error_code,
+                                    string_view message) FMT_NOEXCEPT {
+  FMT_TRY {
+    wmemory_buffer buf;
+    buf.resize(inline_buffer_size);
+    for (;;) {
+      wchar_t* system_message = &buf[0];
+      int result = FormatMessageW(
+          FORMAT_MESSAGE_FROM_SYSTEM | FORMAT_MESSAGE_IGNORE_INSERTS, nullptr,
+          error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT), system_message,
+          static_cast<uint32_t>(buf.size()), nullptr);
+      if (result != 0) {
+        utf16_to_utf8 utf8_message;
+        if (utf8_message.convert(system_message) == ERROR_SUCCESS) {
+          internal::writer w(out);
+          w.write(message);
+          w.write(": ");
+          w.write(utf8_message);
+          return;
+        }
+        break;
+      }
+      if (GetLastError() != ERROR_INSUFFICIENT_BUFFER)
+        break;  // Can't get error message, report error code instead.
+      buf.resize(buf.size() * 2);
+    }
+  }
+  FMT_CATCH(...) {}
+  format_error_code(out, error_code, message);
+}
+
+void report_windows_error(int error_code,
+                          fmt::string_view message) FMT_NOEXCEPT {
+  report_error(internal::format_windows_error, error_code, message);
+}
+#endif  // _WIN32
+
+buffered_file::~buffered_file() FMT_NOEXCEPT {
+  if (file_ && FMT_SYSTEM(fclose(file_)) != 0)
+    report_system_error(errno, "cannot close file");
+}
+
+buffered_file::buffered_file(cstring_view filename, cstring_view mode) {
+  FMT_RETRY_VAL(file_, FMT_SYSTEM(fopen(filename.c_str(), mode.c_str())),
+                nullptr);
+  if (!file_)
+    FMT_THROW(system_error(errno, "cannot open file {}", filename.c_str()));
+}
+
+void buffered_file::close() {
+  if (!file_) return;
+  int result = FMT_SYSTEM(fclose(file_));
+  file_ = nullptr;
+  if (result != 0) FMT_THROW(system_error(errno, "cannot close file"));
+}
+
+// A macro used to prevent expansion of fileno on broken versions of MinGW.
+#define FMT_ARGS
+
+int buffered_file::fileno() const {
+  int fd = FMT_POSIX_CALL(fileno FMT_ARGS(file_));
+  if (fd == -1) FMT_THROW(system_error(errno, "cannot get file descriptor"));
+  return fd;
+}
+
+#if FMT_USE_FCNTL
+file::file(cstring_view path, int oflag) {
+  int mode = S_IRUSR | S_IWUSR;
+#  if defined(_WIN32) && !defined(__MINGW32__)
+  fd_ = -1;
+  FMT_POSIX_CALL(sopen_s(&fd_, path.c_str(), oflag, _SH_DENYNO, mode));
+#  else
+  FMT_RETRY(fd_, FMT_POSIX_CALL(open(path.c_str(), oflag, mode)));
+#  endif
+  if (fd_ == -1)
+    FMT_THROW(system_error(errno, "cannot open file {}", path.c_str()));
+}
+
+file::~file() FMT_NOEXCEPT {
+  // Don't retry close in case of EINTR!
+  // See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
+  if (fd_ != -1 && FMT_POSIX_CALL(close(fd_)) != 0)
+    report_system_error(errno, "cannot close file");
+}
+
+void file::close() {
+  if (fd_ == -1) return;
+  // Don't retry close in case of EINTR!
+  // See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
+  int result = FMT_POSIX_CALL(close(fd_));
+  fd_ = -1;
+  if (result != 0) FMT_THROW(system_error(errno, "cannot close file"));
+}
+
+long long file::size() const {
+#  ifdef _WIN32
+  // Use GetFileSize instead of GetFileSizeEx for the case when _WIN32_WINNT
+  // is less than 0x0500 as is the case with some default MinGW builds.
+  // Both functions support large file sizes.
+  DWORD size_upper = 0;
+  HANDLE handle = reinterpret_cast<HANDLE>(_get_osfhandle(fd_));
+  DWORD size_lower = FMT_SYSTEM(GetFileSize(handle, &size_upper));
+  if (size_lower == INVALID_FILE_SIZE) {
+    DWORD error = GetLastError();
+    if (error != NO_ERROR)
+      FMT_THROW(windows_error(GetLastError(), "cannot get file size"));
+  }
+  unsigned long long long_size = size_upper;
+  return (long_size << sizeof(DWORD) * CHAR_BIT) | size_lower;
+#  else
+  using Stat = struct stat;
+  Stat file_stat = Stat();
+  if (FMT_POSIX_CALL(fstat(fd_, &file_stat)) == -1)
+    FMT_THROW(system_error(errno, "cannot get file attributes"));
+  static_assert(sizeof(long long) >= sizeof(file_stat.st_size),
+                "return type of file::size is not large enough");
+  return file_stat.st_size;
+#  endif
+}
+
+std::size_t file::read(void* buffer, std::size_t count) {
+  RWResult result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(read(fd_, buffer, convert_rwcount(count))));
+  if (result < 0) FMT_THROW(system_error(errno, "cannot read from file"));
+  return internal::to_unsigned(result);
+}
+
+std::size_t file::write(const void* buffer, std::size_t count) {
+  RWResult result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(write(fd_, buffer, convert_rwcount(count))));
+  if (result < 0) FMT_THROW(system_error(errno, "cannot write to file"));
+  return internal::to_unsigned(result);
+}
+
+file file::dup(int fd) {
+  // Don't retry as dup doesn't return EINTR.
+  // http://pubs.opengroup.org/onlinepubs/009695399/functions/dup.html
+  int new_fd = FMT_POSIX_CALL(dup(fd));
+  if (new_fd == -1)
+    FMT_THROW(system_error(errno, "cannot duplicate file descriptor {}", fd));
+  return file(new_fd);
+}
+
+void file::dup2(int fd) {
+  int result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
+  if (result == -1) {
+    FMT_THROW(system_error(errno, "cannot duplicate file descriptor {} to {}",
+                           fd_, fd));
+  }
+}
+
+void file::dup2(int fd, error_code& ec) FMT_NOEXCEPT {
+  int result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
+  if (result == -1) ec = error_code(errno);
+}
+
+void file::pipe(file& read_end, file& write_end) {
+  // Close the descriptors first to make sure that assignments don't throw
+  // and there are no leaks.
+  read_end.close();
+  write_end.close();
+  int fds[2] = {};
+#  ifdef _WIN32
+  // Make the default pipe capacity same as on Linux 2.6.11+.
+  enum { DEFAULT_CAPACITY = 65536 };
+  int result = FMT_POSIX_CALL(pipe(fds, DEFAULT_CAPACITY, _O_BINARY));
+#  else
+  // Don't retry as the pipe function doesn't return EINTR.
+  // http://pubs.opengroup.org/onlinepubs/009696799/functions/pipe.html
+  int result = FMT_POSIX_CALL(pipe(fds));
+#  endif
+  if (result != 0) FMT_THROW(system_error(errno, "cannot create pipe"));
+  // The following assignments don't throw because read_fd and write_fd
+  // are closed.
+  read_end = file(fds[0]);
+  write_end = file(fds[1]);
+}
+
+buffered_file file::fdopen(const char* mode) {
+  // Don't retry as fdopen doesn't return EINTR.
+  FILE* f = FMT_POSIX_CALL(fdopen(fd_, mode));
+  if (!f)
+    FMT_THROW(
+        system_error(errno, "cannot associate stream with file descriptor"));
+  buffered_file bf(f);
+  fd_ = -1;
+  return bf;
+}
+
+long getpagesize() {
+#  ifdef _WIN32
+  SYSTEM_INFO si;
+  GetSystemInfo(&si);
+  return si.dwPageSize;
+#  else
+  long size = FMT_POSIX_CALL(sysconf(_SC_PAGESIZE));
+  if (size < 0) FMT_THROW(system_error(errno, "cannot get memory page size"));
+  return size;
+#  endif
+}
+#endif  // FMT_USE_FCNTL
+FMT_END_NAMESPACE

oss/libpopcnt/LICENSE

@@ -0,0 +1,26 @@
+BSD 2-Clause License
+
+Copyright (c) 2016 - 2019, Kim Walisch
+Copyright (c) 2016 - 2019, Wojciech Muła
+
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+1. Redistributions of source code must retain the above copyright notice, this
+   list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright notice,
+   this list of conditions and the following disclaimer in the documentation
+   and/or other materials provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR
+ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

oss/libpopcnt/MAINTAINER_README.md

@@ -0,0 +1,17 @@
+### Notes for Future Maintainers
+
+This was originally imported by @miniksa in March 2020.
+
+The provenance information (where it came from and which commit) is stored in the file `cgmanifest.json` in the same directory as this readme.
+Please update the provenance information in that file when ingesting an updated version of the dependent library.
+That provenance file is automatically read and inventoried by Microsoft systems to ensure compliance with appropiate governance standards.
+
+## What should be done to update this in the future?
+
+1. Go to kimwalisch/libpopcnt repository on GitHub.
+2. Take the `libpopcnt.h` file.
+3. Don't change anything about it.
+4. Validate that the `LICENSE` in the root of the repository didn't change and update it if so. It is sitting in the same directory as this readme. 
+   If it changed dramatically, ensure that it is still compatible with our license scheme. Also update the NOTICE file in the root of our repository to declare the third-party usage.
+5. Submit the pull.
+

oss/libpopcnt/cgmanifest.json

@@ -0,0 +1,13 @@
+{"Registrations":[ 
+    {
+      "component": { 
+       "type": "git", 
+       "git": { 
+         "repositoryUrl": "https://github.com/kimwalisch/libpopcnt", 
+         "commitHash": "043a99fba31121a70bcb2f589faa17f534ae6085" 
+         }
+       }
+    }
+ ],
+ "Version": 1
+}